aboutsummaryrefslogtreecommitdiff
path: root/.venv/lib/python3.12/site-packages/anthropic
diff options
context:
space:
mode:
Diffstat (limited to '.venv/lib/python3.12/site-packages/anthropic')
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/__init__.py106
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_base_client.py2153
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_client.py531
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_compat.py219
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_constants.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_decoders/jsonl.py123
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_exceptions.py126
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_files.py123
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_legacy_response.py511
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_models.py832
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_qs.py150
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_resource.py41
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_response.py872
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_streaming.py443
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_types.py219
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/__init__.py57
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/_logs.py25
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/_proxy.py62
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/_reflection.py42
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/_streams.py12
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/_sync.py86
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/_transform.py402
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/_typing.py149
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_utils/_utils.py414
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/_version.py4
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/.keep4
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/__init__.py0
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/_extras/__init__.py1
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/_extras/_common.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/_extras/_google_auth.py29
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/__init__.py1
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_auth.py72
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_beta.py102
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_beta_messages.py93
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_client.py390
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_stream.py37
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_stream_decoder.py64
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/streaming/__init__.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_beta_messages.py462
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_beta_types.py100
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_messages.py462
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_types.py100
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/vertex/__init__.py1
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_auth.py42
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_beta.py102
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_beta_messages.py93
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_client.py406
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/pagination.py84
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/py.typed0
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/__init__.py61
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/beta/__init__.py47
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/beta/beta.py134
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/__init__.py33
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/batches.py889
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/messages.py2587
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/beta/models.py300
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/completions.py823
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/messages/__init__.py35
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/messages/batches.py717
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/messages/messages.py2551
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/resources/models.py300
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/__init__.py107
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/anthropic_beta_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/base64_image_source_param.py23
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/base64_pdf_source_param.py23
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/__init__.py76
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_image_source_param.py23
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_pdf_block_param.py33
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_pdf_source_param.py23
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_cache_control_ephemeral_param.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_char_location.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_char_location_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_content_block_location.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_content_block_location_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_page_location.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_page_location_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citations_config_param.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citations_delta.py23
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block.py17
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_param.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_source_content_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_source_param.py16
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_image_block_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_input_json_delta.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message.py112
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_delta_usage.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_param.py16
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_tokens_count.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_metadata_param.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_model_info.py28
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_plain_text_source_param.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_delta_event.py27
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_start_event.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_stop_event.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_delta_event.py39
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_start_event.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_stop_event.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_stream_event.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_redacted_thinking_block.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_redacted_thinking_block_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_signature_delta.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_block.py23
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_block_param.py21
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_citation.py16
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_citation_param.py16
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_delta.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_block.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_block_param.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_disabled_param.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_enabled_param.py24
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_delta.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_bash_20241022_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_bash_20250124_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_any_param.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_auto_param.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_none_param.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_param.py17
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_tool_param.py21
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_computer_use_20241022_param.py31
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_computer_use_20250124_param.py31
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_param.py47
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_result_block_param.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_text_editor_20241022_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_text_editor_20250124_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_union_param.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_use_block.py17
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_use_block_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_url_image_source_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_url_pdf_source_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_usage.py21
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/message_count_tokens_params.py234
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/message_create_params.py297
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/__init__.py17
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/batch_create_params.py41
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/batch_list_params.py34
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_deleted_message_batch.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch.py77
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_canceled_result.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_errored_result.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_expired_result.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_individual_response.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_request_counts.py35
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_result.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_succeeded_result.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta/model_list_params.py27
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_api_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_authentication_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_billing_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_error.py32
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_error_response.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_gateway_timeout_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_invalid_request_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_not_found_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_overloaded_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_permission_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/beta_rate_limit_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/cache_control_ephemeral_param.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/citation_char_location.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/citation_char_location_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/citation_content_block_location.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/citation_content_block_location_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/citation_page_location.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/citation_page_location_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/citations_config_param.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/citations_delta.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/completion.py43
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/completion_create_params.py131
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/content_block.py16
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/content_block_delta_event.py9
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/content_block_param.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/content_block_source_content_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/content_block_source_param.py16
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/content_block_start_event.py9
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/content_block_stop_event.py9
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/document_block_param.py31
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/image_block_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/input_json_delta.py16
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message.py112
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_count_tokens_params.py212
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_count_tokens_tool_param.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_create_params.py320
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_delta_event.py9
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_delta_usage.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_param.py39
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_start_event.py9
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_stop_event.py9
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_stream_event.py9
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/message_tokens_count.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/__init__.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/batch_create_params.py36
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/batch_list_params.py27
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/deleted_message_batch.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch.py77
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_canceled_result.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_errored_result.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_expired_result.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_individual_response.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_request_counts.py35
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_result.py19
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_succeeded_result.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/metadata_param.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/model.py25
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/model_info.py28
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/model_list_params.py27
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/model_param.py27
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/plain_text_source_param.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_delta_event.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_start_event.py25
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_stop_event.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/raw_message_delta_event.py39
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/raw_message_start_event.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/raw_message_stop_event.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/raw_message_stream_event.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/redacted_thinking_block.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/redacted_thinking_block_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/__init__.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/api_error_object.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/authentication_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/billing_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/error_object.py32
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/error_response.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/gateway_timeout_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/invalid_request_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/not_found_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/overloaded_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/permission_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/shared/rate_limit_error.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/signature_delta.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/text_block.py23
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/text_block_param.py21
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/text_citation.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/text_citation_param.py16
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/text_delta.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/thinking_block.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/thinking_block_param.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_disabled_param.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_enabled_param.py24
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/thinking_delta.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_bash_20250124_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_any_param.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_auto_param.py18
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_none_param.py11
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_param.py15
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_tool_param.py21
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_param.py48
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_result_block_param.py26
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_text_editor_20250124_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_union_param.py14
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_use_block.py17
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/tool_use_block_param.py22
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/url_image_source_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/url_pdf_source_param.py13
-rw-r--r--.venv/lib/python3.12/site-packages/anthropic/types/usage.py21
255 files changed, 24112 insertions, 0 deletions
diff --git a/.venv/lib/python3.12/site-packages/anthropic/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/__init__.py
new file mode 100644
index 00000000..8cba2f09
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/__init__.py
@@ -0,0 +1,106 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from . import types
+from ._types import NOT_GIVEN, Omit, NoneType, NotGiven, Transport, ProxiesTypes
+from ._utils import file_from_path
+from ._client import (
+ Client,
+ Stream,
+ Timeout,
+ Anthropic,
+ Transport,
+ AsyncClient,
+ AsyncStream,
+ AsyncAnthropic,
+ RequestOptions,
+)
+from ._models import BaseModel
+from ._version import __title__, __version__
+from ._response import APIResponse as APIResponse, AsyncAPIResponse as AsyncAPIResponse
+from ._constants import (
+ AI_PROMPT as AI_PROMPT,
+ HUMAN_PROMPT as HUMAN_PROMPT,
+ DEFAULT_TIMEOUT,
+ DEFAULT_MAX_RETRIES,
+ DEFAULT_CONNECTION_LIMITS,
+)
+from ._exceptions import (
+ APIError,
+ ConflictError,
+ NotFoundError,
+ AnthropicError,
+ APIStatusError,
+ RateLimitError,
+ APITimeoutError,
+ BadRequestError,
+ APIConnectionError,
+ AuthenticationError,
+ InternalServerError,
+ PermissionDeniedError,
+ UnprocessableEntityError,
+ APIResponseValidationError,
+)
+from ._base_client import DefaultHttpxClient, DefaultAsyncHttpxClient
+from ._utils._logs import setup_logging as _setup_logging
+
+__all__ = [
+ "types",
+ "__version__",
+ "__title__",
+ "NoneType",
+ "Transport",
+ "ProxiesTypes",
+ "NotGiven",
+ "NOT_GIVEN",
+ "Omit",
+ "AnthropicError",
+ "APIError",
+ "APIStatusError",
+ "APITimeoutError",
+ "APIConnectionError",
+ "APIResponseValidationError",
+ "BadRequestError",
+ "AuthenticationError",
+ "PermissionDeniedError",
+ "NotFoundError",
+ "ConflictError",
+ "UnprocessableEntityError",
+ "RateLimitError",
+ "InternalServerError",
+ "Timeout",
+ "RequestOptions",
+ "Client",
+ "AsyncClient",
+ "Stream",
+ "AsyncStream",
+ "Anthropic",
+ "AsyncAnthropic",
+ "file_from_path",
+ "BaseModel",
+ "DEFAULT_TIMEOUT",
+ "DEFAULT_MAX_RETRIES",
+ "DEFAULT_CONNECTION_LIMITS",
+ "DefaultHttpxClient",
+ "DefaultAsyncHttpxClient",
+ "HUMAN_PROMPT",
+ "AI_PROMPT",
+]
+
+from .lib.vertex import *
+from .lib.bedrock import *
+from .lib.streaming import *
+
+_setup_logging()
+
+# Update the __module__ attribute for exported symbols so that
+# error messages point to this module instead of the module
+# it was originally defined in, e.g.
+# anthropic._exceptions.NotFoundError -> anthropic.NotFoundError
+__locals = locals()
+for __name in __all__:
+ if not __name.startswith("__"):
+ try:
+ __locals[__name].__module__ = "anthropic"
+ except (TypeError, AttributeError):
+ # Some of our exported symbols are builtins which we can't set attributes for.
+ pass
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_base_client.py b/.venv/lib/python3.12/site-packages/anthropic/_base_client.py
new file mode 100644
index 00000000..41b57e18
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_base_client.py
@@ -0,0 +1,2153 @@
+from __future__ import annotations
+
+import sys
+import json
+import time
+import uuid
+import email
+import socket
+import asyncio
+import inspect
+import logging
+import platform
+import warnings
+import email.utils
+from types import TracebackType
+from random import random
+from typing import (
+ TYPE_CHECKING,
+ Any,
+ Dict,
+ Type,
+ Union,
+ Generic,
+ Mapping,
+ TypeVar,
+ Iterable,
+ Iterator,
+ Optional,
+ Generator,
+ AsyncIterator,
+ cast,
+ overload,
+)
+from typing_extensions import Literal, override, get_origin
+
+import anyio
+import httpx
+import distro
+import pydantic
+from httpx import URL, Limits
+from pydantic import PrivateAttr
+
+from . import _exceptions
+from ._qs import Querystring
+from ._files import to_httpx_files, async_to_httpx_files
+from ._types import (
+ NOT_GIVEN,
+ Body,
+ Omit,
+ Query,
+ Headers,
+ Timeout,
+ NotGiven,
+ ResponseT,
+ Transport,
+ AnyMapping,
+ PostParser,
+ ProxiesTypes,
+ RequestFiles,
+ HttpxSendArgs,
+ AsyncTransport,
+ RequestOptions,
+ HttpxRequestFiles,
+ ModelBuilderProtocol,
+)
+from ._utils import is_dict, is_list, asyncify, is_given, lru_cache, is_mapping
+from ._compat import PYDANTIC_V2, model_copy, model_dump
+from ._models import GenericModel, FinalRequestOptions, validate_type, construct_type
+from ._response import (
+ APIResponse,
+ BaseAPIResponse,
+ AsyncAPIResponse,
+ extract_response_type,
+)
+from ._constants import (
+ DEFAULT_TIMEOUT,
+ MAX_RETRY_DELAY,
+ DEFAULT_MAX_RETRIES,
+ INITIAL_RETRY_DELAY,
+ RAW_RESPONSE_HEADER,
+ OVERRIDE_CAST_TO_HEADER,
+ DEFAULT_CONNECTION_LIMITS,
+)
+from ._streaming import Stream, SSEDecoder, AsyncStream, SSEBytesDecoder
+from ._exceptions import (
+ APIStatusError,
+ APITimeoutError,
+ APIConnectionError,
+ APIResponseValidationError,
+)
+from ._legacy_response import LegacyAPIResponse
+
+log: logging.Logger = logging.getLogger(__name__)
+
+# TODO: make base page type vars covariant
+SyncPageT = TypeVar("SyncPageT", bound="BaseSyncPage[Any]")
+AsyncPageT = TypeVar("AsyncPageT", bound="BaseAsyncPage[Any]")
+
+
+_T = TypeVar("_T")
+_T_co = TypeVar("_T_co", covariant=True)
+
+_StreamT = TypeVar("_StreamT", bound=Stream[Any])
+_AsyncStreamT = TypeVar("_AsyncStreamT", bound=AsyncStream[Any])
+
+if TYPE_CHECKING:
+ from httpx._config import DEFAULT_TIMEOUT_CONFIG as HTTPX_DEFAULT_TIMEOUT
+else:
+ try:
+ from httpx._config import DEFAULT_TIMEOUT_CONFIG as HTTPX_DEFAULT_TIMEOUT
+ except ImportError:
+ # taken from https://github.com/encode/httpx/blob/3ba5fe0d7ac70222590e759c31442b1cab263791/httpx/_config.py#L366
+ HTTPX_DEFAULT_TIMEOUT = Timeout(5.0)
+
+
+class PageInfo:
+ """Stores the necessary information to build the request to retrieve the next page.
+
+ Either `url` or `params` must be set.
+ """
+
+ url: URL | NotGiven
+ params: Query | NotGiven
+
+ @overload
+ def __init__(
+ self,
+ *,
+ url: URL,
+ ) -> None: ...
+
+ @overload
+ def __init__(
+ self,
+ *,
+ params: Query,
+ ) -> None: ...
+
+ def __init__(
+ self,
+ *,
+ url: URL | NotGiven = NOT_GIVEN,
+ params: Query | NotGiven = NOT_GIVEN,
+ ) -> None:
+ self.url = url
+ self.params = params
+
+ @override
+ def __repr__(self) -> str:
+ if self.url:
+ return f"{self.__class__.__name__}(url={self.url})"
+ return f"{self.__class__.__name__}(params={self.params})"
+
+
+class BasePage(GenericModel, Generic[_T]):
+ """
+ Defines the core interface for pagination.
+
+ Type Args:
+ ModelT: The pydantic model that represents an item in the response.
+
+ Methods:
+ has_next_page(): Check if there is another page available
+ next_page_info(): Get the necessary information to make a request for the next page
+ """
+
+ _options: FinalRequestOptions = PrivateAttr()
+ _model: Type[_T] = PrivateAttr()
+
+ def has_next_page(self) -> bool:
+ items = self._get_page_items()
+ if not items:
+ return False
+ return self.next_page_info() is not None
+
+ def next_page_info(self) -> Optional[PageInfo]: ...
+
+ def _get_page_items(self) -> Iterable[_T]: # type: ignore[empty-body]
+ ...
+
+ def _params_from_url(self, url: URL) -> httpx.QueryParams:
+ # TODO: do we have to preprocess params here?
+ return httpx.QueryParams(cast(Any, self._options.params)).merge(url.params)
+
+ def _info_to_options(self, info: PageInfo) -> FinalRequestOptions:
+ options = model_copy(self._options)
+ options._strip_raw_response_header()
+
+ if not isinstance(info.params, NotGiven):
+ options.params = {**options.params, **info.params}
+ return options
+
+ if not isinstance(info.url, NotGiven):
+ params = self._params_from_url(info.url)
+ url = info.url.copy_with(params=params)
+ options.params = dict(url.params)
+ options.url = str(url)
+ return options
+
+ raise ValueError("Unexpected PageInfo state")
+
+
+class BaseSyncPage(BasePage[_T], Generic[_T]):
+ _client: SyncAPIClient = pydantic.PrivateAttr()
+
+ def _set_private_attributes(
+ self,
+ client: SyncAPIClient,
+ model: Type[_T],
+ options: FinalRequestOptions,
+ ) -> None:
+ if PYDANTIC_V2 and getattr(self, "__pydantic_private__", None) is None:
+ self.__pydantic_private__ = {}
+
+ self._model = model
+ self._client = client
+ self._options = options
+
+ # Pydantic uses a custom `__iter__` method to support casting BaseModels
+ # to dictionaries. e.g. dict(model).
+ # As we want to support `for item in page`, this is inherently incompatible
+ # with the default pydantic behaviour. It is not possible to support both
+ # use cases at once. Fortunately, this is not a big deal as all other pydantic
+ # methods should continue to work as expected as there is an alternative method
+ # to cast a model to a dictionary, model.dict(), which is used internally
+ # by pydantic.
+ def __iter__(self) -> Iterator[_T]: # type: ignore
+ for page in self.iter_pages():
+ for item in page._get_page_items():
+ yield item
+
+ def iter_pages(self: SyncPageT) -> Iterator[SyncPageT]:
+ page = self
+ while True:
+ yield page
+ if page.has_next_page():
+ page = page.get_next_page()
+ else:
+ return
+
+ def get_next_page(self: SyncPageT) -> SyncPageT:
+ info = self.next_page_info()
+ if not info:
+ raise RuntimeError(
+ "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`."
+ )
+
+ options = self._info_to_options(info)
+ return self._client._request_api_list(self._model, page=self.__class__, options=options)
+
+
+class AsyncPaginator(Generic[_T, AsyncPageT]):
+ def __init__(
+ self,
+ client: AsyncAPIClient,
+ options: FinalRequestOptions,
+ page_cls: Type[AsyncPageT],
+ model: Type[_T],
+ ) -> None:
+ self._model = model
+ self._client = client
+ self._options = options
+ self._page_cls = page_cls
+
+ def __await__(self) -> Generator[Any, None, AsyncPageT]:
+ return self._get_page().__await__()
+
+ async def _get_page(self) -> AsyncPageT:
+ def _parser(resp: AsyncPageT) -> AsyncPageT:
+ resp._set_private_attributes(
+ model=self._model,
+ options=self._options,
+ client=self._client,
+ )
+ return resp
+
+ self._options.post_parser = _parser
+
+ return await self._client.request(self._page_cls, self._options)
+
+ async def __aiter__(self) -> AsyncIterator[_T]:
+ # https://github.com/microsoft/pyright/issues/3464
+ page = cast(
+ AsyncPageT,
+ await self, # type: ignore
+ )
+ async for item in page:
+ yield item
+
+
+class BaseAsyncPage(BasePage[_T], Generic[_T]):
+ _client: AsyncAPIClient = pydantic.PrivateAttr()
+
+ def _set_private_attributes(
+ self,
+ model: Type[_T],
+ client: AsyncAPIClient,
+ options: FinalRequestOptions,
+ ) -> None:
+ if PYDANTIC_V2 and getattr(self, "__pydantic_private__", None) is None:
+ self.__pydantic_private__ = {}
+
+ self._model = model
+ self._client = client
+ self._options = options
+
+ async def __aiter__(self) -> AsyncIterator[_T]:
+ async for page in self.iter_pages():
+ for item in page._get_page_items():
+ yield item
+
+ async def iter_pages(self: AsyncPageT) -> AsyncIterator[AsyncPageT]:
+ page = self
+ while True:
+ yield page
+ if page.has_next_page():
+ page = await page.get_next_page()
+ else:
+ return
+
+ async def get_next_page(self: AsyncPageT) -> AsyncPageT:
+ info = self.next_page_info()
+ if not info:
+ raise RuntimeError(
+ "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`."
+ )
+
+ options = self._info_to_options(info)
+ return await self._client._request_api_list(self._model, page=self.__class__, options=options)
+
+
+_HttpxClientT = TypeVar("_HttpxClientT", bound=Union[httpx.Client, httpx.AsyncClient])
+_DefaultStreamT = TypeVar("_DefaultStreamT", bound=Union[Stream[Any], AsyncStream[Any]])
+
+
+class BaseClient(Generic[_HttpxClientT, _DefaultStreamT]):
+ _client: _HttpxClientT
+ _version: str
+ _base_url: URL
+ max_retries: int
+ timeout: Union[float, Timeout, None]
+ _limits: httpx.Limits
+ _proxies: ProxiesTypes | None
+ _transport: Transport | AsyncTransport | None
+ _strict_response_validation: bool
+ _idempotency_header: str | None
+ _default_stream_cls: type[_DefaultStreamT] | None = None
+
+ def __init__(
+ self,
+ *,
+ version: str,
+ base_url: str | URL,
+ _strict_response_validation: bool,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ timeout: float | Timeout | None = DEFAULT_TIMEOUT,
+ limits: httpx.Limits,
+ transport: Transport | AsyncTransport | None,
+ proxies: ProxiesTypes | None,
+ custom_headers: Mapping[str, str] | None = None,
+ custom_query: Mapping[str, object] | None = None,
+ ) -> None:
+ self._version = version
+ self._base_url = self._enforce_trailing_slash(URL(base_url))
+ self.max_retries = max_retries
+ self.timeout = timeout
+ self._limits = limits
+ self._proxies = proxies
+ self._transport = transport
+ self._custom_headers = custom_headers or {}
+ self._custom_query = custom_query or {}
+ self._strict_response_validation = _strict_response_validation
+ self._idempotency_header = None
+ self._platform: Platform | None = None
+
+ if max_retries is None: # pyright: ignore[reportUnnecessaryComparison]
+ raise TypeError(
+ "max_retries cannot be None. If you want to disable retries, pass `0`; if you want unlimited retries, pass `math.inf` or a very high number; if you want the default behavior, pass `anthropic.DEFAULT_MAX_RETRIES`"
+ )
+
+ def _enforce_trailing_slash(self, url: URL) -> URL:
+ if url.raw_path.endswith(b"/"):
+ return url
+ return url.copy_with(raw_path=url.raw_path + b"/")
+
+ def _make_status_error_from_response(
+ self,
+ response: httpx.Response,
+ ) -> APIStatusError:
+ if response.is_closed and not response.is_stream_consumed:
+ # We can't read the response body as it has been closed
+ # before it was read. This can happen if an event hook
+ # raises a status error.
+ body = None
+ err_msg = f"Error code: {response.status_code}"
+ else:
+ err_text = response.text.strip()
+ body = err_text
+
+ try:
+ body = json.loads(err_text)
+ err_msg = f"Error code: {response.status_code} - {body}"
+ except Exception:
+ err_msg = err_text or f"Error code: {response.status_code}"
+
+ return self._make_status_error(err_msg, body=body, response=response)
+
+ def _make_status_error(
+ self,
+ err_msg: str,
+ *,
+ body: object,
+ response: httpx.Response,
+ ) -> _exceptions.APIStatusError:
+ raise NotImplementedError()
+
+ def _build_headers(self, options: FinalRequestOptions, *, retries_taken: int = 0) -> httpx.Headers:
+ custom_headers = options.headers or {}
+ headers_dict = _merge_mappings(
+ {
+ "x-stainless-timeout": str(options.timeout.read)
+ if isinstance(options.timeout, Timeout)
+ else str(options.timeout),
+ **self.default_headers,
+ },
+ custom_headers,
+ )
+ self._validate_headers(headers_dict, custom_headers)
+
+ # headers are case-insensitive while dictionaries are not.
+ headers = httpx.Headers(headers_dict)
+
+ idempotency_header = self._idempotency_header
+ if idempotency_header and options.method.lower() != "get" and idempotency_header not in headers:
+ headers[idempotency_header] = options.idempotency_key or self._idempotency_key()
+
+ # Don't set these headers if they were already set or removed by the caller. We check
+ # `custom_headers`, which can contain `Omit()`, instead of `headers` to account for the removal case.
+ lower_custom_headers = [header.lower() for header in custom_headers]
+ if "x-stainless-retry-count" not in lower_custom_headers:
+ headers["x-stainless-retry-count"] = str(retries_taken)
+ if "x-stainless-read-timeout" not in lower_custom_headers:
+ timeout = self.timeout if isinstance(options.timeout, NotGiven) else options.timeout
+ if isinstance(timeout, Timeout):
+ timeout = timeout.read
+ if timeout is not None:
+ headers["x-stainless-read-timeout"] = str(timeout)
+
+ return headers
+
+ def _prepare_url(self, url: str) -> URL:
+ """
+ Merge a URL argument together with any 'base_url' on the client,
+ to create the URL used for the outgoing request.
+ """
+ # Copied from httpx's `_merge_url` method.
+ merge_url = URL(url)
+ if merge_url.is_relative_url:
+ merge_raw_path = self.base_url.raw_path + merge_url.raw_path.lstrip(b"/")
+ return self.base_url.copy_with(raw_path=merge_raw_path)
+
+ return merge_url
+
+ def _make_sse_decoder(self) -> SSEDecoder | SSEBytesDecoder:
+ return SSEDecoder()
+
+ def _build_request(
+ self,
+ options: FinalRequestOptions,
+ *,
+ retries_taken: int = 0,
+ ) -> httpx.Request:
+ if log.isEnabledFor(logging.DEBUG):
+ log.debug("Request options: %s", model_dump(options, exclude_unset=True))
+
+ kwargs: dict[str, Any] = {}
+
+ json_data = options.json_data
+ if options.extra_json is not None:
+ if json_data is None:
+ json_data = cast(Body, options.extra_json)
+ elif is_mapping(json_data):
+ json_data = _merge_mappings(json_data, options.extra_json)
+ else:
+ raise RuntimeError(f"Unexpected JSON data type, {type(json_data)}, cannot merge with `extra_body`")
+
+ headers = self._build_headers(options, retries_taken=retries_taken)
+ params = _merge_mappings(self.default_query, options.params)
+ content_type = headers.get("Content-Type")
+ files = options.files
+
+ # If the given Content-Type header is multipart/form-data then it
+ # has to be removed so that httpx can generate the header with
+ # additional information for us as it has to be in this form
+ # for the server to be able to correctly parse the request:
+ # multipart/form-data; boundary=---abc--
+ if content_type is not None and content_type.startswith("multipart/form-data"):
+ if "boundary" not in content_type:
+ # only remove the header if the boundary hasn't been explicitly set
+ # as the caller doesn't want httpx to come up with their own boundary
+ headers.pop("Content-Type")
+
+ # As we are now sending multipart/form-data instead of application/json
+ # we need to tell httpx to use it, https://www.python-httpx.org/advanced/clients/#multipart-file-encoding
+ if json_data:
+ if not is_dict(json_data):
+ raise TypeError(
+ f"Expected query input to be a dictionary for multipart requests but got {type(json_data)} instead."
+ )
+ kwargs["data"] = self._serialize_multipartform(json_data)
+
+ # httpx determines whether or not to send a "multipart/form-data"
+ # request based on the truthiness of the "files" argument.
+ # This gets around that issue by generating a dict value that
+ # evaluates to true.
+ #
+ # https://github.com/encode/httpx/discussions/2399#discussioncomment-3814186
+ if not files:
+ files = cast(HttpxRequestFiles, ForceMultipartDict())
+
+ prepared_url = self._prepare_url(options.url)
+ if "_" in prepared_url.host:
+ # work around https://github.com/encode/httpx/discussions/2880
+ kwargs["extensions"] = {"sni_hostname": prepared_url.host.replace("_", "-")}
+
+ # TODO: report this error to httpx
+ return self._client.build_request( # pyright: ignore[reportUnknownMemberType]
+ headers=headers,
+ timeout=self.timeout if isinstance(options.timeout, NotGiven) else options.timeout,
+ method=options.method,
+ url=prepared_url,
+ # the `Query` type that we use is incompatible with qs'
+ # `Params` type as it needs to be typed as `Mapping[str, object]`
+ # so that passing a `TypedDict` doesn't cause an error.
+ # https://github.com/microsoft/pyright/issues/3526#event-6715453066
+ params=self.qs.stringify(cast(Mapping[str, Any], params)) if params else None,
+ json=json_data if is_given(json_data) else None,
+ files=files,
+ **kwargs,
+ )
+
+ def _serialize_multipartform(self, data: Mapping[object, object]) -> dict[str, object]:
+ items = self.qs.stringify_items(
+ # TODO: type ignore is required as stringify_items is well typed but we can't be
+ # well typed without heavy validation.
+ data, # type: ignore
+ array_format="brackets",
+ )
+ serialized: dict[str, object] = {}
+ for key, value in items:
+ existing = serialized.get(key)
+
+ if not existing:
+ serialized[key] = value
+ continue
+
+ # If a value has already been set for this key then that
+ # means we're sending data like `array[]=[1, 2, 3]` and we
+ # need to tell httpx that we want to send multiple values with
+ # the same key which is done by using a list or a tuple.
+ #
+ # Note: 2d arrays should never result in the same key at both
+ # levels so it's safe to assume that if the value is a list,
+ # it was because we changed it to be a list.
+ if is_list(existing):
+ existing.append(value)
+ else:
+ serialized[key] = [existing, value]
+
+ return serialized
+
+ def _maybe_override_cast_to(self, cast_to: type[ResponseT], options: FinalRequestOptions) -> type[ResponseT]:
+ if not is_given(options.headers):
+ return cast_to
+
+ # make a copy of the headers so we don't mutate user-input
+ headers = dict(options.headers)
+
+ # we internally support defining a temporary header to override the
+ # default `cast_to` type for use with `.with_raw_response` and `.with_streaming_response`
+ # see _response.py for implementation details
+ override_cast_to = headers.pop(OVERRIDE_CAST_TO_HEADER, NOT_GIVEN)
+ if is_given(override_cast_to):
+ options.headers = headers
+ return cast(Type[ResponseT], override_cast_to)
+
+ return cast_to
+
+ def _should_stream_response_body(self, request: httpx.Request) -> bool:
+ return request.headers.get(RAW_RESPONSE_HEADER) == "stream" # type: ignore[no-any-return]
+
+ def _process_response_data(
+ self,
+ *,
+ data: object,
+ cast_to: type[ResponseT],
+ response: httpx.Response,
+ ) -> ResponseT:
+ if data is None:
+ return cast(ResponseT, None)
+
+ if cast_to is object:
+ return cast(ResponseT, data)
+
+ try:
+ if inspect.isclass(cast_to) and issubclass(cast_to, ModelBuilderProtocol):
+ return cast(ResponseT, cast_to.build(response=response, data=data))
+
+ if self._strict_response_validation:
+ return cast(ResponseT, validate_type(type_=cast_to, value=data))
+
+ return cast(ResponseT, construct_type(type_=cast_to, value=data))
+ except pydantic.ValidationError as err:
+ raise APIResponseValidationError(response=response, body=data) from err
+
+ @property
+ def qs(self) -> Querystring:
+ return Querystring()
+
+ @property
+ def custom_auth(self) -> httpx.Auth | None:
+ return None
+
+ @property
+ def auth_headers(self) -> dict[str, str]:
+ return {}
+
+ @property
+ def default_headers(self) -> dict[str, str | Omit]:
+ return {
+ "Accept": "application/json",
+ "Content-Type": "application/json",
+ "User-Agent": self.user_agent,
+ **self.platform_headers(),
+ **self.auth_headers,
+ **self._custom_headers,
+ }
+
+ @property
+ def default_query(self) -> dict[str, object]:
+ return {
+ **self._custom_query,
+ }
+
+ def _validate_headers(
+ self,
+ headers: Headers, # noqa: ARG002
+ custom_headers: Headers, # noqa: ARG002
+ ) -> None:
+ """Validate the given default headers and custom headers.
+
+ Does nothing by default.
+ """
+ return
+
+ @property
+ def user_agent(self) -> str:
+ return f"{self.__class__.__name__}/Python {self._version}"
+
+ @property
+ def base_url(self) -> URL:
+ return self._base_url
+
+ @base_url.setter
+ def base_url(self, url: URL | str) -> None:
+ self._base_url = self._enforce_trailing_slash(url if isinstance(url, URL) else URL(url))
+
+ def platform_headers(self) -> Dict[str, str]:
+ # the actual implementation is in a separate `lru_cache` decorated
+ # function because adding `lru_cache` to methods will leak memory
+ # https://github.com/python/cpython/issues/88476
+ return platform_headers(self._version, platform=self._platform)
+
+ def _calculate_nonstreaming_timeout(self, max_tokens: int) -> Timeout:
+ maximum_time = 60 * 60
+ default_time = 60 * 10
+
+ expected_time = maximum_time * max_tokens / 128_000
+ if expected_time > default_time:
+ raise ValueError(
+ "Streaming is strongly recommended for operations that may take longer than 10 minutes. "
+ + "See https://github.com/anthropics/anthropic-sdk-python#long-requests for more details",
+ )
+ return Timeout(
+ default_time,
+ connect=5.0,
+ )
+
+ def _parse_retry_after_header(self, response_headers: Optional[httpx.Headers] = None) -> float | None:
+ """Returns a float of the number of seconds (not milliseconds) to wait after retrying, or None if unspecified.
+
+ About the Retry-After header: https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After
+ See also https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After#syntax
+ """
+ if response_headers is None:
+ return None
+
+ # First, try the non-standard `retry-after-ms` header for milliseconds,
+ # which is more precise than integer-seconds `retry-after`
+ try:
+ retry_ms_header = response_headers.get("retry-after-ms", None)
+ return float(retry_ms_header) / 1000
+ except (TypeError, ValueError):
+ pass
+
+ # Next, try parsing `retry-after` header as seconds (allowing nonstandard floats).
+ retry_header = response_headers.get("retry-after")
+ try:
+ # note: the spec indicates that this should only ever be an integer
+ # but if someone sends a float there's no reason for us to not respect it
+ return float(retry_header)
+ except (TypeError, ValueError):
+ pass
+
+ # Last, try parsing `retry-after` as a date.
+ retry_date_tuple = email.utils.parsedate_tz(retry_header)
+ if retry_date_tuple is None:
+ return None
+
+ retry_date = email.utils.mktime_tz(retry_date_tuple)
+ return float(retry_date - time.time())
+
+ def _calculate_retry_timeout(
+ self,
+ remaining_retries: int,
+ options: FinalRequestOptions,
+ response_headers: Optional[httpx.Headers] = None,
+ ) -> float:
+ max_retries = options.get_max_retries(self.max_retries)
+
+ # If the API asks us to wait a certain amount of time (and it's a reasonable amount), just do what it says.
+ retry_after = self._parse_retry_after_header(response_headers)
+ if retry_after is not None and 0 < retry_after <= 60:
+ return retry_after
+
+ # Also cap retry count to 1000 to avoid any potential overflows with `pow`
+ nb_retries = min(max_retries - remaining_retries, 1000)
+
+ # Apply exponential backoff, but not more than the max.
+ sleep_seconds = min(INITIAL_RETRY_DELAY * pow(2.0, nb_retries), MAX_RETRY_DELAY)
+
+ # Apply some jitter, plus-or-minus half a second.
+ jitter = 1 - 0.25 * random()
+ timeout = sleep_seconds * jitter
+ return timeout if timeout >= 0 else 0
+
+ def _should_retry(self, response: httpx.Response) -> bool:
+ # Note: this is not a standard header
+ should_retry_header = response.headers.get("x-should-retry")
+
+ # If the server explicitly says whether or not to retry, obey.
+ if should_retry_header == "true":
+ log.debug("Retrying as header `x-should-retry` is set to `true`")
+ return True
+ if should_retry_header == "false":
+ log.debug("Not retrying as header `x-should-retry` is set to `false`")
+ return False
+
+ # Retry on request timeouts.
+ if response.status_code == 408:
+ log.debug("Retrying due to status code %i", response.status_code)
+ return True
+
+ # Retry on lock timeouts.
+ if response.status_code == 409:
+ log.debug("Retrying due to status code %i", response.status_code)
+ return True
+
+ # Retry on rate limits.
+ if response.status_code == 429:
+ log.debug("Retrying due to status code %i", response.status_code)
+ return True
+
+ # Retry internal errors.
+ if response.status_code >= 500:
+ log.debug("Retrying due to status code %i", response.status_code)
+ return True
+
+ log.debug("Not retrying")
+ return False
+
+ def _idempotency_key(self) -> str:
+ return f"stainless-python-retry-{uuid.uuid4()}"
+
+
+class _DefaultHttpxClient(httpx.Client):
+ def __init__(self, **kwargs: Any) -> None:
+ kwargs.setdefault("timeout", DEFAULT_TIMEOUT)
+ kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS)
+ kwargs.setdefault("follow_redirects", True)
+
+ if "transport" not in kwargs:
+ socket_options = [
+ (socket.SOL_SOCKET, socket.SO_KEEPALIVE, True),
+ (socket.IPPROTO_TCP, socket.TCP_KEEPINTVL, 60),
+ (socket.IPPROTO_TCP, socket.TCP_KEEPCNT, 5),
+ ]
+ TCP_KEEPIDLE = getattr(socket, "TCP_KEEPIDLE", None)
+ if TCP_KEEPIDLE is not None:
+ socket_options.append((socket.IPPROTO_TCP, TCP_KEEPIDLE, 60))
+
+ kwargs["transport"] = httpx.HTTPTransport(
+ # note: limits is always set above
+ limits=kwargs["limits"],
+ socket_options=socket_options,
+ )
+
+ super().__init__(**kwargs)
+
+
+if TYPE_CHECKING:
+ DefaultHttpxClient = httpx.Client
+ """An alias to `httpx.Client` that provides the same defaults that this SDK
+ uses internally.
+
+ This is useful because overriding the `http_client` with your own instance of
+ `httpx.Client` will result in httpx's defaults being used, not ours.
+ """
+else:
+ DefaultHttpxClient = _DefaultHttpxClient
+
+
+class SyncHttpxClientWrapper(DefaultHttpxClient):
+ def __del__(self) -> None:
+ if self.is_closed:
+ return
+
+ try:
+ self.close()
+ except Exception:
+ pass
+
+
+class SyncAPIClient(BaseClient[httpx.Client, Stream[Any]]):
+ _client: httpx.Client
+ _default_stream_cls: type[Stream[Any]] | None = None
+
+ def __init__(
+ self,
+ *,
+ version: str,
+ base_url: str | URL,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ timeout: float | Timeout | None | NotGiven = NOT_GIVEN,
+ transport: Transport | None = None,
+ proxies: ProxiesTypes | None = None,
+ limits: Limits | None = None,
+ http_client: httpx.Client | None = None,
+ custom_headers: Mapping[str, str] | None = None,
+ custom_query: Mapping[str, object] | None = None,
+ _strict_response_validation: bool,
+ ) -> None:
+ kwargs: dict[str, Any] = {}
+ if limits is not None:
+ warnings.warn(
+ "The `connection_pool_limits` argument is deprecated. The `http_client` argument should be passed instead",
+ category=DeprecationWarning,
+ stacklevel=3,
+ )
+ if http_client is not None:
+ raise ValueError("The `http_client` argument is mutually exclusive with `connection_pool_limits`")
+ else:
+ limits = DEFAULT_CONNECTION_LIMITS
+
+ if transport is not None:
+ kwargs["transport"] = transport
+ warnings.warn(
+ "The `transport` argument is deprecated. The `http_client` argument should be passed instead",
+ category=DeprecationWarning,
+ stacklevel=3,
+ )
+ if http_client is not None:
+ raise ValueError("The `http_client` argument is mutually exclusive with `transport`")
+
+ if proxies is not None:
+ kwargs["proxies"] = proxies
+ warnings.warn(
+ "The `proxies` argument is deprecated. The `http_client` argument should be passed instead",
+ category=DeprecationWarning,
+ stacklevel=3,
+ )
+ if http_client is not None:
+ raise ValueError("The `http_client` argument is mutually exclusive with `proxies`")
+
+ if not is_given(timeout):
+ # if the user passed in a custom http client with a non-default
+ # timeout set then we use that timeout.
+ #
+ # note: there is an edge case here where the user passes in a client
+ # where they've explicitly set the timeout to match the default timeout
+ # as this check is structural, meaning that we'll think they didn't
+ # pass in a timeout and will ignore it
+ if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT:
+ timeout = http_client.timeout
+ else:
+ timeout = DEFAULT_TIMEOUT
+
+ if http_client is not None and not isinstance(http_client, httpx.Client): # pyright: ignore[reportUnnecessaryIsInstance]
+ raise TypeError(
+ f"Invalid `http_client` argument; Expected an instance of `httpx.Client` but got {type(http_client)}"
+ )
+
+ super().__init__(
+ version=version,
+ limits=limits,
+ # cast to a valid type because mypy doesn't understand our type narrowing
+ timeout=cast(Timeout, timeout),
+ proxies=proxies,
+ base_url=base_url,
+ transport=transport,
+ max_retries=max_retries,
+ custom_query=custom_query,
+ custom_headers=custom_headers,
+ _strict_response_validation=_strict_response_validation,
+ )
+ self._client = http_client or SyncHttpxClientWrapper(
+ base_url=base_url,
+ # cast to a valid type because mypy doesn't understand our type narrowing
+ timeout=cast(Timeout, timeout),
+ limits=limits,
+ follow_redirects=True,
+ **kwargs, # type: ignore
+ )
+
+ def is_closed(self) -> bool:
+ return self._client.is_closed
+
+ def close(self) -> None:
+ """Close the underlying HTTPX client.
+
+ The client will *not* be usable after this.
+ """
+ # If an error is thrown while constructing a client, self._client
+ # may not be present
+ if hasattr(self, "_client"):
+ self._client.close()
+
+ def __enter__(self: _T) -> _T:
+ return self
+
+ def __exit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ self.close()
+
+ def _prepare_options(
+ self,
+ options: FinalRequestOptions, # noqa: ARG002
+ ) -> FinalRequestOptions:
+ """Hook for mutating the given options"""
+ return options
+
+ def _prepare_request(
+ self,
+ request: httpx.Request, # noqa: ARG002
+ ) -> None:
+ """This method is used as a callback for mutating the `Request` object
+ after it has been constructed.
+ This is useful for cases where you want to add certain headers based off of
+ the request properties, e.g. `url`, `method` etc.
+ """
+ return None
+
+ @overload
+ def request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ remaining_retries: Optional[int] = None,
+ *,
+ stream: Literal[True],
+ stream_cls: Type[_StreamT],
+ ) -> _StreamT: ...
+
+ @overload
+ def request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ remaining_retries: Optional[int] = None,
+ *,
+ stream: Literal[False] = False,
+ ) -> ResponseT: ...
+
+ @overload
+ def request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ remaining_retries: Optional[int] = None,
+ *,
+ stream: bool = False,
+ stream_cls: Type[_StreamT] | None = None,
+ ) -> ResponseT | _StreamT: ...
+
+ def request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ remaining_retries: Optional[int] = None,
+ *,
+ stream: bool = False,
+ stream_cls: type[_StreamT] | None = None,
+ ) -> ResponseT | _StreamT:
+ if remaining_retries is not None:
+ retries_taken = options.get_max_retries(self.max_retries) - remaining_retries
+ else:
+ retries_taken = 0
+
+ return self._request(
+ cast_to=cast_to,
+ options=options,
+ stream=stream,
+ stream_cls=stream_cls,
+ retries_taken=retries_taken,
+ )
+
+ def _request(
+ self,
+ *,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ retries_taken: int,
+ stream: bool,
+ stream_cls: type[_StreamT] | None,
+ ) -> ResponseT | _StreamT:
+ # create a copy of the options we were given so that if the
+ # options are mutated later & we then retry, the retries are
+ # given the original options
+ input_options = model_copy(options)
+
+ cast_to = self._maybe_override_cast_to(cast_to, options)
+ options = self._prepare_options(options)
+
+ remaining_retries = options.get_max_retries(self.max_retries) - retries_taken
+ request = self._build_request(options, retries_taken=retries_taken)
+ self._prepare_request(request)
+
+ kwargs: HttpxSendArgs = {}
+ if self.custom_auth is not None:
+ kwargs["auth"] = self.custom_auth
+
+ log.debug("Sending HTTP Request: %s %s", request.method, request.url)
+
+ try:
+ response = self._client.send(
+ request,
+ stream=stream or self._should_stream_response_body(request=request),
+ **kwargs,
+ )
+ except httpx.TimeoutException as err:
+ log.debug("Encountered httpx.TimeoutException", exc_info=True)
+
+ if remaining_retries > 0:
+ return self._retry_request(
+ input_options,
+ cast_to,
+ retries_taken=retries_taken,
+ stream=stream,
+ stream_cls=stream_cls,
+ response_headers=None,
+ )
+
+ log.debug("Raising timeout error")
+ raise APITimeoutError(request=request) from err
+ except Exception as err:
+ log.debug("Encountered Exception", exc_info=True)
+
+ if remaining_retries > 0:
+ return self._retry_request(
+ input_options,
+ cast_to,
+ retries_taken=retries_taken,
+ stream=stream,
+ stream_cls=stream_cls,
+ response_headers=None,
+ )
+
+ log.debug("Raising connection error")
+ raise APIConnectionError(request=request) from err
+
+ log.debug(
+ 'HTTP Response: %s %s "%i %s" %s',
+ request.method,
+ request.url,
+ response.status_code,
+ response.reason_phrase,
+ response.headers,
+ )
+ log.debug("request_id: %s", response.headers.get("request-id"))
+
+ try:
+ response.raise_for_status()
+ except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code
+ log.debug("Encountered httpx.HTTPStatusError", exc_info=True)
+
+ if remaining_retries > 0 and self._should_retry(err.response):
+ err.response.close()
+ return self._retry_request(
+ input_options,
+ cast_to,
+ retries_taken=retries_taken,
+ response_headers=err.response.headers,
+ stream=stream,
+ stream_cls=stream_cls,
+ )
+
+ # If the response is streamed then we need to explicitly read the response
+ # to completion before attempting to access the response text.
+ if not err.response.is_closed:
+ err.response.read()
+
+ log.debug("Re-raising status error")
+ raise self._make_status_error_from_response(err.response) from None
+
+ return self._process_response(
+ cast_to=cast_to,
+ options=options,
+ response=response,
+ stream=stream,
+ stream_cls=stream_cls,
+ retries_taken=retries_taken,
+ )
+
+ def _retry_request(
+ self,
+ options: FinalRequestOptions,
+ cast_to: Type[ResponseT],
+ *,
+ retries_taken: int,
+ response_headers: httpx.Headers | None,
+ stream: bool,
+ stream_cls: type[_StreamT] | None,
+ ) -> ResponseT | _StreamT:
+ remaining_retries = options.get_max_retries(self.max_retries) - retries_taken
+ if remaining_retries == 1:
+ log.debug("1 retry left")
+ else:
+ log.debug("%i retries left", remaining_retries)
+
+ timeout = self._calculate_retry_timeout(remaining_retries, options, response_headers)
+ log.info("Retrying request to %s in %f seconds", options.url, timeout)
+
+ # In a synchronous context we are blocking the entire thread. Up to the library user to run the client in a
+ # different thread if necessary.
+ time.sleep(timeout)
+
+ return self._request(
+ options=options,
+ cast_to=cast_to,
+ retries_taken=retries_taken + 1,
+ stream=stream,
+ stream_cls=stream_cls,
+ )
+
+ def _process_response(
+ self,
+ *,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ response: httpx.Response,
+ stream: bool,
+ stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None,
+ retries_taken: int = 0,
+ ) -> ResponseT:
+ if response.request.headers.get(RAW_RESPONSE_HEADER) == "true":
+ return cast(
+ ResponseT,
+ LegacyAPIResponse(
+ raw=response,
+ client=self,
+ cast_to=cast_to,
+ stream=stream,
+ stream_cls=stream_cls,
+ options=options,
+ retries_taken=retries_taken,
+ ),
+ )
+
+ origin = get_origin(cast_to) or cast_to
+
+ if inspect.isclass(origin) and issubclass(origin, BaseAPIResponse):
+ if not issubclass(origin, APIResponse):
+ raise TypeError(f"API Response types must subclass {APIResponse}; Received {origin}")
+
+ response_cls = cast("type[BaseAPIResponse[Any]]", cast_to)
+ return cast(
+ ResponseT,
+ response_cls(
+ raw=response,
+ client=self,
+ cast_to=extract_response_type(response_cls),
+ stream=stream,
+ stream_cls=stream_cls,
+ options=options,
+ retries_taken=retries_taken,
+ ),
+ )
+
+ if cast_to == httpx.Response:
+ return cast(ResponseT, response)
+
+ api_response = APIResponse(
+ raw=response,
+ client=self,
+ cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast]
+ stream=stream,
+ stream_cls=stream_cls,
+ options=options,
+ retries_taken=retries_taken,
+ )
+ if bool(response.request.headers.get(RAW_RESPONSE_HEADER)):
+ return cast(ResponseT, api_response)
+
+ return api_response.parse()
+
+ def _request_api_list(
+ self,
+ model: Type[object],
+ page: Type[SyncPageT],
+ options: FinalRequestOptions,
+ ) -> SyncPageT:
+ def _parser(resp: SyncPageT) -> SyncPageT:
+ resp._set_private_attributes(
+ client=self,
+ model=model,
+ options=options,
+ )
+ return resp
+
+ options.post_parser = _parser
+
+ return self.request(page, options, stream=False)
+
+ @overload
+ def get(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ options: RequestOptions = {},
+ stream: Literal[False] = False,
+ ) -> ResponseT: ...
+
+ @overload
+ def get(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ options: RequestOptions = {},
+ stream: Literal[True],
+ stream_cls: type[_StreamT],
+ ) -> _StreamT: ...
+
+ @overload
+ def get(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ options: RequestOptions = {},
+ stream: bool,
+ stream_cls: type[_StreamT] | None = None,
+ ) -> ResponseT | _StreamT: ...
+
+ def get(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ options: RequestOptions = {},
+ stream: bool = False,
+ stream_cls: type[_StreamT] | None = None,
+ ) -> ResponseT | _StreamT:
+ opts = FinalRequestOptions.construct(method="get", url=path, **options)
+ # cast is required because mypy complains about returning Any even though
+ # it understands the type variables
+ return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls))
+
+ @overload
+ def post(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ files: RequestFiles | None = None,
+ stream: Literal[False] = False,
+ ) -> ResponseT: ...
+
+ @overload
+ def post(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ files: RequestFiles | None = None,
+ stream: Literal[True],
+ stream_cls: type[_StreamT],
+ ) -> _StreamT: ...
+
+ @overload
+ def post(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ files: RequestFiles | None = None,
+ stream: bool,
+ stream_cls: type[_StreamT] | None = None,
+ ) -> ResponseT | _StreamT: ...
+
+ def post(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ files: RequestFiles | None = None,
+ stream: bool = False,
+ stream_cls: type[_StreamT] | None = None,
+ ) -> ResponseT | _StreamT:
+ opts = FinalRequestOptions.construct(
+ method="post", url=path, json_data=body, files=to_httpx_files(files), **options
+ )
+ return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls))
+
+ def patch(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ ) -> ResponseT:
+ opts = FinalRequestOptions.construct(method="patch", url=path, json_data=body, **options)
+ return self.request(cast_to, opts)
+
+ def put(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ files: RequestFiles | None = None,
+ options: RequestOptions = {},
+ ) -> ResponseT:
+ opts = FinalRequestOptions.construct(
+ method="put", url=path, json_data=body, files=to_httpx_files(files), **options
+ )
+ return self.request(cast_to, opts)
+
+ def delete(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ ) -> ResponseT:
+ opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, **options)
+ return self.request(cast_to, opts)
+
+ def get_api_list(
+ self,
+ path: str,
+ *,
+ model: Type[object],
+ page: Type[SyncPageT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ method: str = "get",
+ ) -> SyncPageT:
+ opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options)
+ return self._request_api_list(model, page, opts)
+
+
+class _DefaultAsyncHttpxClient(httpx.AsyncClient):
+ def __init__(self, **kwargs: Any) -> None:
+ kwargs.setdefault("timeout", DEFAULT_TIMEOUT)
+ kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS)
+ kwargs.setdefault("follow_redirects", True)
+
+ if "transport" not in kwargs:
+ socket_options = [
+ (socket.SOL_SOCKET, socket.SO_KEEPALIVE, True),
+ (socket.IPPROTO_TCP, socket.TCP_KEEPINTVL, 60),
+ (socket.IPPROTO_TCP, socket.TCP_KEEPCNT, 5),
+ ]
+ TCP_KEEPIDLE = getattr(socket, "TCP_KEEPIDLE", None)
+ if TCP_KEEPIDLE is not None:
+ socket_options.append((socket.IPPROTO_TCP, TCP_KEEPIDLE, 60))
+
+ kwargs["transport"] = httpx.AsyncHTTPTransport(
+ # note: limits is always set above
+ limits=kwargs["limits"],
+ socket_options=socket_options,
+ )
+
+ super().__init__(**kwargs)
+
+
+if TYPE_CHECKING:
+ DefaultAsyncHttpxClient = httpx.AsyncClient
+ """An alias to `httpx.AsyncClient` that provides the same defaults that this SDK
+ uses internally.
+
+ This is useful because overriding the `http_client` with your own instance of
+ `httpx.AsyncClient` will result in httpx's defaults being used, not ours.
+ """
+else:
+ DefaultAsyncHttpxClient = _DefaultAsyncHttpxClient
+
+
+class AsyncHttpxClientWrapper(DefaultAsyncHttpxClient):
+ def __del__(self) -> None:
+ if self.is_closed:
+ return
+
+ try:
+ # TODO(someday): support non asyncio runtimes here
+ asyncio.get_running_loop().create_task(self.aclose())
+ except Exception:
+ pass
+
+
+class AsyncAPIClient(BaseClient[httpx.AsyncClient, AsyncStream[Any]]):
+ _client: httpx.AsyncClient
+ _default_stream_cls: type[AsyncStream[Any]] | None = None
+
+ def __init__(
+ self,
+ *,
+ version: str,
+ base_url: str | URL,
+ _strict_response_validation: bool,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ timeout: float | Timeout | None | NotGiven = NOT_GIVEN,
+ transport: AsyncTransport | None = None,
+ proxies: ProxiesTypes | None = None,
+ limits: Limits | None = None,
+ http_client: httpx.AsyncClient | None = None,
+ custom_headers: Mapping[str, str] | None = None,
+ custom_query: Mapping[str, object] | None = None,
+ ) -> None:
+ kwargs: dict[str, Any] = {}
+ if limits is not None:
+ warnings.warn(
+ "The `connection_pool_limits` argument is deprecated. The `http_client` argument should be passed instead",
+ category=DeprecationWarning,
+ stacklevel=3,
+ )
+ if http_client is not None:
+ raise ValueError("The `http_client` argument is mutually exclusive with `connection_pool_limits`")
+ else:
+ limits = DEFAULT_CONNECTION_LIMITS
+
+ if transport is not None:
+ kwargs["transport"] = transport
+
+ warnings.warn(
+ "The `transport` argument is deprecated. The `http_client` argument should be passed instead",
+ category=DeprecationWarning,
+ stacklevel=3,
+ )
+ if http_client is not None:
+ raise ValueError("The `http_client` argument is mutually exclusive with `transport`")
+
+ if proxies is not None:
+ kwargs["proxies"] = proxies
+ warnings.warn(
+ "The `proxies` argument is deprecated. The `http_client` argument should be passed instead",
+ category=DeprecationWarning,
+ stacklevel=3,
+ )
+ if http_client is not None:
+ raise ValueError("The `http_client` argument is mutually exclusive with `proxies`")
+
+ if not is_given(timeout):
+ # if the user passed in a custom http client with a non-default
+ # timeout set then we use that timeout.
+ #
+ # note: there is an edge case here where the user passes in a client
+ # where they've explicitly set the timeout to match the default timeout
+ # as this check is structural, meaning that we'll think they didn't
+ # pass in a timeout and will ignore it
+ if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT:
+ timeout = http_client.timeout
+ else:
+ timeout = DEFAULT_TIMEOUT
+
+ if http_client is not None and not isinstance(http_client, httpx.AsyncClient): # pyright: ignore[reportUnnecessaryIsInstance]
+ raise TypeError(
+ f"Invalid `http_client` argument; Expected an instance of `httpx.AsyncClient` but got {type(http_client)}"
+ )
+
+ super().__init__(
+ version=version,
+ base_url=base_url,
+ limits=limits,
+ # cast to a valid type because mypy doesn't understand our type narrowing
+ timeout=cast(Timeout, timeout),
+ proxies=proxies,
+ transport=transport,
+ max_retries=max_retries,
+ custom_query=custom_query,
+ custom_headers=custom_headers,
+ _strict_response_validation=_strict_response_validation,
+ )
+ self._client = http_client or AsyncHttpxClientWrapper(
+ base_url=base_url,
+ # cast to a valid type because mypy doesn't understand our type narrowing
+ timeout=cast(Timeout, timeout),
+ limits=limits,
+ follow_redirects=True,
+ **kwargs, # type: ignore
+ )
+
+ def is_closed(self) -> bool:
+ return self._client.is_closed
+
+ async def close(self) -> None:
+ """Close the underlying HTTPX client.
+
+ The client will *not* be usable after this.
+ """
+ await self._client.aclose()
+
+ async def __aenter__(self: _T) -> _T:
+ return self
+
+ async def __aexit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ await self.close()
+
+ async def _prepare_options(
+ self,
+ options: FinalRequestOptions, # noqa: ARG002
+ ) -> FinalRequestOptions:
+ """Hook for mutating the given options"""
+ return options
+
+ async def _prepare_request(
+ self,
+ request: httpx.Request, # noqa: ARG002
+ ) -> None:
+ """This method is used as a callback for mutating the `Request` object
+ after it has been constructed.
+ This is useful for cases where you want to add certain headers based off of
+ the request properties, e.g. `url`, `method` etc.
+ """
+ return None
+
+ @overload
+ async def request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ *,
+ stream: Literal[False] = False,
+ remaining_retries: Optional[int] = None,
+ ) -> ResponseT: ...
+
+ @overload
+ async def request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ *,
+ stream: Literal[True],
+ stream_cls: type[_AsyncStreamT],
+ remaining_retries: Optional[int] = None,
+ ) -> _AsyncStreamT: ...
+
+ @overload
+ async def request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ *,
+ stream: bool,
+ stream_cls: type[_AsyncStreamT] | None = None,
+ remaining_retries: Optional[int] = None,
+ ) -> ResponseT | _AsyncStreamT: ...
+
+ async def request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ *,
+ stream: bool = False,
+ stream_cls: type[_AsyncStreamT] | None = None,
+ remaining_retries: Optional[int] = None,
+ ) -> ResponseT | _AsyncStreamT:
+ if remaining_retries is not None:
+ retries_taken = options.get_max_retries(self.max_retries) - remaining_retries
+ else:
+ retries_taken = 0
+
+ return await self._request(
+ cast_to=cast_to,
+ options=options,
+ stream=stream,
+ stream_cls=stream_cls,
+ retries_taken=retries_taken,
+ )
+
+ async def _request(
+ self,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ *,
+ stream: bool,
+ stream_cls: type[_AsyncStreamT] | None,
+ retries_taken: int,
+ ) -> ResponseT | _AsyncStreamT:
+ if self._platform is None:
+ # `get_platform` can make blocking IO calls so we
+ # execute it earlier while we are in an async context
+ self._platform = await asyncify(get_platform)()
+
+ # create a copy of the options we were given so that if the
+ # options are mutated later & we then retry, the retries are
+ # given the original options
+ input_options = model_copy(options)
+
+ cast_to = self._maybe_override_cast_to(cast_to, options)
+ options = await self._prepare_options(options)
+
+ remaining_retries = options.get_max_retries(self.max_retries) - retries_taken
+ request = self._build_request(options, retries_taken=retries_taken)
+ await self._prepare_request(request)
+
+ kwargs: HttpxSendArgs = {}
+ if self.custom_auth is not None:
+ kwargs["auth"] = self.custom_auth
+
+ try:
+ response = await self._client.send(
+ request,
+ stream=stream or self._should_stream_response_body(request=request),
+ **kwargs,
+ )
+ except httpx.TimeoutException as err:
+ log.debug("Encountered httpx.TimeoutException", exc_info=True)
+
+ if remaining_retries > 0:
+ return await self._retry_request(
+ input_options,
+ cast_to,
+ retries_taken=retries_taken,
+ stream=stream,
+ stream_cls=stream_cls,
+ response_headers=None,
+ )
+
+ log.debug("Raising timeout error")
+ raise APITimeoutError(request=request) from err
+ except Exception as err:
+ log.debug("Encountered Exception", exc_info=True)
+
+ if remaining_retries > 0:
+ return await self._retry_request(
+ input_options,
+ cast_to,
+ retries_taken=retries_taken,
+ stream=stream,
+ stream_cls=stream_cls,
+ response_headers=None,
+ )
+
+ log.debug("Raising connection error")
+ raise APIConnectionError(request=request) from err
+
+ log.debug(
+ 'HTTP Request: %s %s "%i %s"', request.method, request.url, response.status_code, response.reason_phrase
+ )
+
+ try:
+ response.raise_for_status()
+ except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code
+ log.debug("Encountered httpx.HTTPStatusError", exc_info=True)
+
+ if remaining_retries > 0 and self._should_retry(err.response):
+ await err.response.aclose()
+ return await self._retry_request(
+ input_options,
+ cast_to,
+ retries_taken=retries_taken,
+ response_headers=err.response.headers,
+ stream=stream,
+ stream_cls=stream_cls,
+ )
+
+ # If the response is streamed then we need to explicitly read the response
+ # to completion before attempting to access the response text.
+ if not err.response.is_closed:
+ await err.response.aread()
+
+ log.debug("Re-raising status error")
+ raise self._make_status_error_from_response(err.response) from None
+
+ return await self._process_response(
+ cast_to=cast_to,
+ options=options,
+ response=response,
+ stream=stream,
+ stream_cls=stream_cls,
+ retries_taken=retries_taken,
+ )
+
+ async def _retry_request(
+ self,
+ options: FinalRequestOptions,
+ cast_to: Type[ResponseT],
+ *,
+ retries_taken: int,
+ response_headers: httpx.Headers | None,
+ stream: bool,
+ stream_cls: type[_AsyncStreamT] | None,
+ ) -> ResponseT | _AsyncStreamT:
+ remaining_retries = options.get_max_retries(self.max_retries) - retries_taken
+ if remaining_retries == 1:
+ log.debug("1 retry left")
+ else:
+ log.debug("%i retries left", remaining_retries)
+
+ timeout = self._calculate_retry_timeout(remaining_retries, options, response_headers)
+ log.info("Retrying request to %s in %f seconds", options.url, timeout)
+
+ await anyio.sleep(timeout)
+
+ return await self._request(
+ options=options,
+ cast_to=cast_to,
+ retries_taken=retries_taken + 1,
+ stream=stream,
+ stream_cls=stream_cls,
+ )
+
+ async def _process_response(
+ self,
+ *,
+ cast_to: Type[ResponseT],
+ options: FinalRequestOptions,
+ response: httpx.Response,
+ stream: bool,
+ stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None,
+ retries_taken: int = 0,
+ ) -> ResponseT:
+ if response.request.headers.get(RAW_RESPONSE_HEADER) == "true":
+ return cast(
+ ResponseT,
+ LegacyAPIResponse(
+ raw=response,
+ client=self,
+ cast_to=cast_to,
+ stream=stream,
+ stream_cls=stream_cls,
+ options=options,
+ retries_taken=retries_taken,
+ ),
+ )
+
+ origin = get_origin(cast_to) or cast_to
+
+ if inspect.isclass(origin) and issubclass(origin, BaseAPIResponse):
+ if not issubclass(origin, AsyncAPIResponse):
+ raise TypeError(f"API Response types must subclass {AsyncAPIResponse}; Received {origin}")
+
+ response_cls = cast("type[BaseAPIResponse[Any]]", cast_to)
+ return cast(
+ "ResponseT",
+ response_cls(
+ raw=response,
+ client=self,
+ cast_to=extract_response_type(response_cls),
+ stream=stream,
+ stream_cls=stream_cls,
+ options=options,
+ retries_taken=retries_taken,
+ ),
+ )
+
+ if cast_to == httpx.Response:
+ return cast(ResponseT, response)
+
+ api_response = AsyncAPIResponse(
+ raw=response,
+ client=self,
+ cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast]
+ stream=stream,
+ stream_cls=stream_cls,
+ options=options,
+ retries_taken=retries_taken,
+ )
+ if bool(response.request.headers.get(RAW_RESPONSE_HEADER)):
+ return cast(ResponseT, api_response)
+
+ return await api_response.parse()
+
+ def _request_api_list(
+ self,
+ model: Type[_T],
+ page: Type[AsyncPageT],
+ options: FinalRequestOptions,
+ ) -> AsyncPaginator[_T, AsyncPageT]:
+ return AsyncPaginator(client=self, options=options, page_cls=page, model=model)
+
+ @overload
+ async def get(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ options: RequestOptions = {},
+ stream: Literal[False] = False,
+ ) -> ResponseT: ...
+
+ @overload
+ async def get(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ options: RequestOptions = {},
+ stream: Literal[True],
+ stream_cls: type[_AsyncStreamT],
+ ) -> _AsyncStreamT: ...
+
+ @overload
+ async def get(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ options: RequestOptions = {},
+ stream: bool,
+ stream_cls: type[_AsyncStreamT] | None = None,
+ ) -> ResponseT | _AsyncStreamT: ...
+
+ async def get(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ options: RequestOptions = {},
+ stream: bool = False,
+ stream_cls: type[_AsyncStreamT] | None = None,
+ ) -> ResponseT | _AsyncStreamT:
+ opts = FinalRequestOptions.construct(method="get", url=path, **options)
+ return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)
+
+ @overload
+ async def post(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ files: RequestFiles | None = None,
+ options: RequestOptions = {},
+ stream: Literal[False] = False,
+ ) -> ResponseT: ...
+
+ @overload
+ async def post(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ files: RequestFiles | None = None,
+ options: RequestOptions = {},
+ stream: Literal[True],
+ stream_cls: type[_AsyncStreamT],
+ ) -> _AsyncStreamT: ...
+
+ @overload
+ async def post(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ files: RequestFiles | None = None,
+ options: RequestOptions = {},
+ stream: bool,
+ stream_cls: type[_AsyncStreamT] | None = None,
+ ) -> ResponseT | _AsyncStreamT: ...
+
+ async def post(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ files: RequestFiles | None = None,
+ options: RequestOptions = {},
+ stream: bool = False,
+ stream_cls: type[_AsyncStreamT] | None = None,
+ ) -> ResponseT | _AsyncStreamT:
+ opts = FinalRequestOptions.construct(
+ method="post", url=path, json_data=body, files=await async_to_httpx_files(files), **options
+ )
+ return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)
+
+ async def patch(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ ) -> ResponseT:
+ opts = FinalRequestOptions.construct(method="patch", url=path, json_data=body, **options)
+ return await self.request(cast_to, opts)
+
+ async def put(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ files: RequestFiles | None = None,
+ options: RequestOptions = {},
+ ) -> ResponseT:
+ opts = FinalRequestOptions.construct(
+ method="put", url=path, json_data=body, files=await async_to_httpx_files(files), **options
+ )
+ return await self.request(cast_to, opts)
+
+ async def delete(
+ self,
+ path: str,
+ *,
+ cast_to: Type[ResponseT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ ) -> ResponseT:
+ opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, **options)
+ return await self.request(cast_to, opts)
+
+ def get_api_list(
+ self,
+ path: str,
+ *,
+ model: Type[_T],
+ page: Type[AsyncPageT],
+ body: Body | None = None,
+ options: RequestOptions = {},
+ method: str = "get",
+ ) -> AsyncPaginator[_T, AsyncPageT]:
+ opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options)
+ return self._request_api_list(model, page, opts)
+
+
+def make_request_options(
+ *,
+ query: Query | None = None,
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ idempotency_key: str | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ post_parser: PostParser | NotGiven = NOT_GIVEN,
+) -> RequestOptions:
+ """Create a dict of type RequestOptions without keys of NotGiven values."""
+ options: RequestOptions = {}
+ if extra_headers is not None:
+ options["headers"] = extra_headers
+
+ if extra_body is not None:
+ options["extra_json"] = cast(AnyMapping, extra_body)
+
+ if query is not None:
+ options["params"] = query
+
+ if extra_query is not None:
+ options["params"] = {**options.get("params", {}), **extra_query}
+
+ if not isinstance(timeout, NotGiven):
+ options["timeout"] = timeout
+
+ if idempotency_key is not None:
+ options["idempotency_key"] = idempotency_key
+
+ if is_given(post_parser):
+ # internal
+ options["post_parser"] = post_parser # type: ignore
+
+ return options
+
+
+class ForceMultipartDict(Dict[str, None]):
+ def __bool__(self) -> bool:
+ return True
+
+
+class OtherPlatform:
+ def __init__(self, name: str) -> None:
+ self.name = name
+
+ @override
+ def __str__(self) -> str:
+ return f"Other:{self.name}"
+
+
+Platform = Union[
+ OtherPlatform,
+ Literal[
+ "MacOS",
+ "Linux",
+ "Windows",
+ "FreeBSD",
+ "OpenBSD",
+ "iOS",
+ "Android",
+ "Unknown",
+ ],
+]
+
+
+def get_platform() -> Platform:
+ try:
+ system = platform.system().lower()
+ platform_name = platform.platform().lower()
+ except Exception:
+ return "Unknown"
+
+ if "iphone" in platform_name or "ipad" in platform_name:
+ # Tested using Python3IDE on an iPhone 11 and Pythonista on an iPad 7
+ # system is Darwin and platform_name is a string like:
+ # - Darwin-21.6.0-iPhone12,1-64bit
+ # - Darwin-21.6.0-iPad7,11-64bit
+ return "iOS"
+
+ if system == "darwin":
+ return "MacOS"
+
+ if system == "windows":
+ return "Windows"
+
+ if "android" in platform_name:
+ # Tested using Pydroid 3
+ # system is Linux and platform_name is a string like 'Linux-5.10.81-android12-9-00001-geba40aecb3b7-ab8534902-aarch64-with-libc'
+ return "Android"
+
+ if system == "linux":
+ # https://distro.readthedocs.io/en/latest/#distro.id
+ distro_id = distro.id()
+ if distro_id == "freebsd":
+ return "FreeBSD"
+
+ if distro_id == "openbsd":
+ return "OpenBSD"
+
+ return "Linux"
+
+ if platform_name:
+ return OtherPlatform(platform_name)
+
+ return "Unknown"
+
+
+@lru_cache(maxsize=None)
+def platform_headers(version: str, *, platform: Platform | None) -> Dict[str, str]:
+ return {
+ "X-Stainless-Lang": "python",
+ "X-Stainless-Package-Version": version,
+ "X-Stainless-OS": str(platform or get_platform()),
+ "X-Stainless-Arch": str(get_architecture()),
+ "X-Stainless-Runtime": get_python_runtime(),
+ "X-Stainless-Runtime-Version": get_python_version(),
+ }
+
+
+class OtherArch:
+ def __init__(self, name: str) -> None:
+ self.name = name
+
+ @override
+ def __str__(self) -> str:
+ return f"other:{self.name}"
+
+
+Arch = Union[OtherArch, Literal["x32", "x64", "arm", "arm64", "unknown"]]
+
+
+def get_python_runtime() -> str:
+ try:
+ return platform.python_implementation()
+ except Exception:
+ return "unknown"
+
+
+def get_python_version() -> str:
+ try:
+ return platform.python_version()
+ except Exception:
+ return "unknown"
+
+
+def get_architecture() -> Arch:
+ try:
+ machine = platform.machine().lower()
+ except Exception:
+ return "unknown"
+
+ if machine in ("arm64", "aarch64"):
+ return "arm64"
+
+ # TODO: untested
+ if machine == "arm":
+ return "arm"
+
+ if machine == "x86_64":
+ return "x64"
+
+ # TODO: untested
+ if sys.maxsize <= 2**32:
+ return "x32"
+
+ if machine:
+ return OtherArch(machine)
+
+ return "unknown"
+
+
+def _merge_mappings(
+ obj1: Mapping[_T_co, Union[_T, Omit]],
+ obj2: Mapping[_T_co, Union[_T, Omit]],
+) -> Dict[_T_co, _T]:
+ """Merge two mappings of the same type, removing any values that are instances of `Omit`.
+
+ In cases with duplicate keys the second mapping takes precedence.
+ """
+ merged = {**obj1, **obj2}
+ return {key: value for key, value in merged.items() if not isinstance(value, Omit)}
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_client.py b/.venv/lib/python3.12/site-packages/anthropic/_client.py
new file mode 100644
index 00000000..842e26b5
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_client.py
@@ -0,0 +1,531 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+import os
+from typing import Any, Union, Mapping
+from typing_extensions import Self, override
+
+import httpx
+
+from . import _constants, _exceptions
+from ._qs import Querystring
+from ._types import (
+ NOT_GIVEN,
+ Omit,
+ Headers,
+ Timeout,
+ NotGiven,
+ Transport,
+ ProxiesTypes,
+ RequestOptions,
+)
+from ._utils import (
+ is_given,
+ get_async_library,
+)
+from ._version import __version__
+from .resources import models, completions
+from ._streaming import Stream as Stream, AsyncStream as AsyncStream
+from ._exceptions import APIStatusError
+from ._base_client import (
+ DEFAULT_MAX_RETRIES,
+ SyncAPIClient,
+ AsyncAPIClient,
+)
+from .resources.beta import beta
+from .resources.messages import messages
+
+__all__ = [
+ "Timeout",
+ "Transport",
+ "ProxiesTypes",
+ "RequestOptions",
+ "Anthropic",
+ "AsyncAnthropic",
+ "Client",
+ "AsyncClient",
+]
+
+
+class Anthropic(SyncAPIClient):
+ completions: completions.Completions
+ messages: messages.Messages
+ models: models.Models
+ beta: beta.Beta
+ with_raw_response: AnthropicWithRawResponse
+ with_streaming_response: AnthropicWithStreamedResponse
+
+ # client options
+ api_key: str | None
+ auth_token: str | None
+
+ # constants
+ HUMAN_PROMPT = _constants.HUMAN_PROMPT
+ AI_PROMPT = _constants.AI_PROMPT
+
+ def __init__(
+ self,
+ *,
+ api_key: str | None = None,
+ auth_token: str | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: Union[float, Timeout, None, NotGiven] = NOT_GIVEN,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ # Configure a custom httpx client.
+ # We provide a `DefaultHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`.
+ # See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details.
+ http_client: httpx.Client | None = None,
+ # Enable or disable schema validation for data returned by the API.
+ # When enabled an error APIResponseValidationError is raised
+ # if the API responds with invalid data for the expected schema.
+ #
+ # This parameter may be removed or changed in the future.
+ # If you rely on this feature, please open a GitHub issue
+ # outlining your use-case to help us decide if it should be
+ # part of our public interface in the future.
+ _strict_response_validation: bool = False,
+ ) -> None:
+ """Construct a new synchronous Anthropic client instance.
+
+ This automatically infers the following arguments from their corresponding environment variables if they are not provided:
+ - `api_key` from `ANTHROPIC_API_KEY`
+ - `auth_token` from `ANTHROPIC_AUTH_TOKEN`
+ """
+ if api_key is None:
+ api_key = os.environ.get("ANTHROPIC_API_KEY")
+ self.api_key = api_key
+
+ if auth_token is None:
+ auth_token = os.environ.get("ANTHROPIC_AUTH_TOKEN")
+ self.auth_token = auth_token
+
+ if base_url is None:
+ base_url = os.environ.get("ANTHROPIC_BASE_URL")
+ if base_url is None:
+ base_url = f"https://api.anthropic.com"
+
+ super().__init__(
+ version=__version__,
+ base_url=base_url,
+ max_retries=max_retries,
+ timeout=timeout,
+ http_client=http_client,
+ custom_headers=default_headers,
+ custom_query=default_query,
+ _strict_response_validation=_strict_response_validation,
+ )
+
+ self._default_stream_cls = Stream
+
+ self.completions = completions.Completions(self)
+ self.messages = messages.Messages(self)
+ self.models = models.Models(self)
+ self.beta = beta.Beta(self)
+ self.with_raw_response = AnthropicWithRawResponse(self)
+ self.with_streaming_response = AnthropicWithStreamedResponse(self)
+
+ @property
+ @override
+ def qs(self) -> Querystring:
+ return Querystring(array_format="comma")
+
+ @property
+ @override
+ def auth_headers(self) -> dict[str, str]:
+ if self._api_key_auth:
+ return self._api_key_auth
+ if self._bearer_auth:
+ return self._bearer_auth
+ return {}
+
+ @property
+ def _api_key_auth(self) -> dict[str, str]:
+ api_key = self.api_key
+ if api_key is None:
+ return {}
+ return {"X-Api-Key": api_key}
+
+ @property
+ def _bearer_auth(self) -> dict[str, str]:
+ auth_token = self.auth_token
+ if auth_token is None:
+ return {}
+ return {"Authorization": f"Bearer {auth_token}"}
+
+ @property
+ @override
+ def default_headers(self) -> dict[str, str | Omit]:
+ return {
+ **super().default_headers,
+ "X-Stainless-Async": "false",
+ "anthropic-version": "2023-06-01",
+ **self._custom_headers,
+ }
+
+ @override
+ def _validate_headers(self, headers: Headers, custom_headers: Headers) -> None:
+ if self.api_key and headers.get("X-Api-Key"):
+ return
+ if isinstance(custom_headers.get("X-Api-Key"), Omit):
+ return
+
+ if self.auth_token and headers.get("Authorization"):
+ return
+ if isinstance(custom_headers.get("Authorization"), Omit):
+ return
+
+ raise TypeError(
+ '"Could not resolve authentication method. Expected either api_key or auth_token to be set. Or for one of the `X-Api-Key` or `Authorization` headers to be explicitly omitted"'
+ )
+
+ def copy(
+ self,
+ *,
+ api_key: str | None = None,
+ auth_token: str | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | Timeout | None | NotGiven = NOT_GIVEN,
+ http_client: httpx.Client | None = None,
+ max_retries: int | NotGiven = NOT_GIVEN,
+ default_headers: Mapping[str, str] | None = None,
+ set_default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ set_default_query: Mapping[str, object] | None = None,
+ _extra_kwargs: Mapping[str, Any] = {},
+ ) -> Self:
+ """
+ Create a new client instance re-using the same options given to the current client with optional overriding.
+ """
+ if default_headers is not None and set_default_headers is not None:
+ raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive")
+
+ if default_query is not None and set_default_query is not None:
+ raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive")
+
+ headers = self._custom_headers
+ if default_headers is not None:
+ headers = {**headers, **default_headers}
+ elif set_default_headers is not None:
+ headers = set_default_headers
+
+ params = self._custom_query
+ if default_query is not None:
+ params = {**params, **default_query}
+ elif set_default_query is not None:
+ params = set_default_query
+
+ http_client = http_client or self._client
+ return self.__class__(
+ api_key=api_key or self.api_key,
+ auth_token=auth_token or self.auth_token,
+ base_url=base_url or self.base_url,
+ timeout=self.timeout if isinstance(timeout, NotGiven) else timeout,
+ http_client=http_client,
+ max_retries=max_retries if is_given(max_retries) else self.max_retries,
+ default_headers=headers,
+ default_query=params,
+ **_extra_kwargs,
+ )
+
+ # Alias for `copy` for nicer inline usage, e.g.
+ # client.with_options(timeout=10).foo.create(...)
+ with_options = copy
+
+ @override
+ def _make_status_error(
+ self,
+ err_msg: str,
+ *,
+ body: object,
+ response: httpx.Response,
+ ) -> APIStatusError:
+ if response.status_code == 400:
+ return _exceptions.BadRequestError(err_msg, response=response, body=body)
+
+ if response.status_code == 401:
+ return _exceptions.AuthenticationError(err_msg, response=response, body=body)
+
+ if response.status_code == 403:
+ return _exceptions.PermissionDeniedError(err_msg, response=response, body=body)
+
+ if response.status_code == 404:
+ return _exceptions.NotFoundError(err_msg, response=response, body=body)
+
+ if response.status_code == 409:
+ return _exceptions.ConflictError(err_msg, response=response, body=body)
+
+ if response.status_code == 413:
+ return _exceptions.RequestTooLargeError(err_msg, response=response, body=body)
+
+ if response.status_code == 422:
+ return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body)
+
+ if response.status_code == 429:
+ return _exceptions.RateLimitError(err_msg, response=response, body=body)
+
+ if response.status_code == 529:
+ return _exceptions.OverloadedError(err_msg, response=response, body=body)
+
+ if response.status_code >= 500:
+ return _exceptions.InternalServerError(err_msg, response=response, body=body)
+ return APIStatusError(err_msg, response=response, body=body)
+
+
+class AsyncAnthropic(AsyncAPIClient):
+ completions: completions.AsyncCompletions
+ messages: messages.AsyncMessages
+ models: models.AsyncModels
+ beta: beta.AsyncBeta
+ with_raw_response: AsyncAnthropicWithRawResponse
+ with_streaming_response: AsyncAnthropicWithStreamedResponse
+
+ # client options
+ api_key: str | None
+ auth_token: str | None
+
+ # constants
+ HUMAN_PROMPT = _constants.HUMAN_PROMPT
+ AI_PROMPT = _constants.AI_PROMPT
+
+ def __init__(
+ self,
+ *,
+ api_key: str | None = None,
+ auth_token: str | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: Union[float, Timeout, None, NotGiven] = NOT_GIVEN,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ # Configure a custom httpx client.
+ # We provide a `DefaultAsyncHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`.
+ # See the [httpx documentation](https://www.python-httpx.org/api/#asyncclient) for more details.
+ http_client: httpx.AsyncClient | None = None,
+ # Enable or disable schema validation for data returned by the API.
+ # When enabled an error APIResponseValidationError is raised
+ # if the API responds with invalid data for the expected schema.
+ #
+ # This parameter may be removed or changed in the future.
+ # If you rely on this feature, please open a GitHub issue
+ # outlining your use-case to help us decide if it should be
+ # part of our public interface in the future.
+ _strict_response_validation: bool = False,
+ ) -> None:
+ """Construct a new async AsyncAnthropic client instance.
+
+ This automatically infers the following arguments from their corresponding environment variables if they are not provided:
+ - `api_key` from `ANTHROPIC_API_KEY`
+ - `auth_token` from `ANTHROPIC_AUTH_TOKEN`
+ """
+ if api_key is None:
+ api_key = os.environ.get("ANTHROPIC_API_KEY")
+ self.api_key = api_key
+
+ if auth_token is None:
+ auth_token = os.environ.get("ANTHROPIC_AUTH_TOKEN")
+ self.auth_token = auth_token
+
+ if base_url is None:
+ base_url = os.environ.get("ANTHROPIC_BASE_URL")
+ if base_url is None:
+ base_url = f"https://api.anthropic.com"
+
+ super().__init__(
+ version=__version__,
+ base_url=base_url,
+ max_retries=max_retries,
+ timeout=timeout,
+ http_client=http_client,
+ custom_headers=default_headers,
+ custom_query=default_query,
+ _strict_response_validation=_strict_response_validation,
+ )
+
+ self._default_stream_cls = AsyncStream
+
+ self.completions = completions.AsyncCompletions(self)
+ self.messages = messages.AsyncMessages(self)
+ self.models = models.AsyncModels(self)
+ self.beta = beta.AsyncBeta(self)
+ self.with_raw_response = AsyncAnthropicWithRawResponse(self)
+ self.with_streaming_response = AsyncAnthropicWithStreamedResponse(self)
+
+ @property
+ @override
+ def qs(self) -> Querystring:
+ return Querystring(array_format="comma")
+
+ @property
+ @override
+ def auth_headers(self) -> dict[str, str]:
+ if self._api_key_auth:
+ return self._api_key_auth
+ if self._bearer_auth:
+ return self._bearer_auth
+ return {}
+
+ @property
+ def _api_key_auth(self) -> dict[str, str]:
+ api_key = self.api_key
+ if api_key is None:
+ return {}
+ return {"X-Api-Key": api_key}
+
+ @property
+ def _bearer_auth(self) -> dict[str, str]:
+ auth_token = self.auth_token
+ if auth_token is None:
+ return {}
+ return {"Authorization": f"Bearer {auth_token}"}
+
+ @property
+ @override
+ def default_headers(self) -> dict[str, str | Omit]:
+ return {
+ **super().default_headers,
+ "X-Stainless-Async": f"async:{get_async_library()}",
+ "anthropic-version": "2023-06-01",
+ **self._custom_headers,
+ }
+
+ @override
+ def _validate_headers(self, headers: Headers, custom_headers: Headers) -> None:
+ if self.api_key and headers.get("X-Api-Key"):
+ return
+ if isinstance(custom_headers.get("X-Api-Key"), Omit):
+ return
+
+ if self.auth_token and headers.get("Authorization"):
+ return
+ if isinstance(custom_headers.get("Authorization"), Omit):
+ return
+
+ raise TypeError(
+ '"Could not resolve authentication method. Expected either api_key or auth_token to be set. Or for one of the `X-Api-Key` or `Authorization` headers to be explicitly omitted"'
+ )
+
+ def copy(
+ self,
+ *,
+ api_key: str | None = None,
+ auth_token: str | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | Timeout | None | NotGiven = NOT_GIVEN,
+ http_client: httpx.AsyncClient | None = None,
+ max_retries: int | NotGiven = NOT_GIVEN,
+ default_headers: Mapping[str, str] | None = None,
+ set_default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ set_default_query: Mapping[str, object] | None = None,
+ _extra_kwargs: Mapping[str, Any] = {},
+ ) -> Self:
+ """
+ Create a new client instance re-using the same options given to the current client with optional overriding.
+ """
+ if default_headers is not None and set_default_headers is not None:
+ raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive")
+
+ if default_query is not None and set_default_query is not None:
+ raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive")
+
+ headers = self._custom_headers
+ if default_headers is not None:
+ headers = {**headers, **default_headers}
+ elif set_default_headers is not None:
+ headers = set_default_headers
+
+ params = self._custom_query
+ if default_query is not None:
+ params = {**params, **default_query}
+ elif set_default_query is not None:
+ params = set_default_query
+
+ http_client = http_client or self._client
+ return self.__class__(
+ api_key=api_key or self.api_key,
+ auth_token=auth_token or self.auth_token,
+ base_url=base_url or self.base_url,
+ timeout=self.timeout if isinstance(timeout, NotGiven) else timeout,
+ http_client=http_client,
+ max_retries=max_retries if is_given(max_retries) else self.max_retries,
+ default_headers=headers,
+ default_query=params,
+ **_extra_kwargs,
+ )
+
+ # Alias for `copy` for nicer inline usage, e.g.
+ # client.with_options(timeout=10).foo.create(...)
+ with_options = copy
+
+ @override
+ def _make_status_error(
+ self,
+ err_msg: str,
+ *,
+ body: object,
+ response: httpx.Response,
+ ) -> APIStatusError:
+ if response.status_code == 400:
+ return _exceptions.BadRequestError(err_msg, response=response, body=body)
+
+ if response.status_code == 401:
+ return _exceptions.AuthenticationError(err_msg, response=response, body=body)
+
+ if response.status_code == 403:
+ return _exceptions.PermissionDeniedError(err_msg, response=response, body=body)
+
+ if response.status_code == 404:
+ return _exceptions.NotFoundError(err_msg, response=response, body=body)
+
+ if response.status_code == 409:
+ return _exceptions.ConflictError(err_msg, response=response, body=body)
+
+ if response.status_code == 422:
+ return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body)
+
+ if response.status_code == 429:
+ return _exceptions.RateLimitError(err_msg, response=response, body=body)
+
+ if response.status_code >= 500:
+ return _exceptions.InternalServerError(err_msg, response=response, body=body)
+ return APIStatusError(err_msg, response=response, body=body)
+
+
+class AnthropicWithRawResponse:
+ def __init__(self, client: Anthropic) -> None:
+ self.completions = completions.CompletionsWithRawResponse(client.completions)
+ self.messages = messages.MessagesWithRawResponse(client.messages)
+ self.models = models.ModelsWithRawResponse(client.models)
+ self.beta = beta.BetaWithRawResponse(client.beta)
+
+
+class AsyncAnthropicWithRawResponse:
+ def __init__(self, client: AsyncAnthropic) -> None:
+ self.completions = completions.AsyncCompletionsWithRawResponse(client.completions)
+ self.messages = messages.AsyncMessagesWithRawResponse(client.messages)
+ self.models = models.AsyncModelsWithRawResponse(client.models)
+ self.beta = beta.AsyncBetaWithRawResponse(client.beta)
+
+
+class AnthropicWithStreamedResponse:
+ def __init__(self, client: Anthropic) -> None:
+ self.completions = completions.CompletionsWithStreamingResponse(client.completions)
+ self.messages = messages.MessagesWithStreamingResponse(client.messages)
+ self.models = models.ModelsWithStreamingResponse(client.models)
+ self.beta = beta.BetaWithStreamingResponse(client.beta)
+
+
+class AsyncAnthropicWithStreamedResponse:
+ def __init__(self, client: AsyncAnthropic) -> None:
+ self.completions = completions.AsyncCompletionsWithStreamingResponse(client.completions)
+ self.messages = messages.AsyncMessagesWithStreamingResponse(client.messages)
+ self.models = models.AsyncModelsWithStreamingResponse(client.models)
+ self.beta = beta.AsyncBetaWithStreamingResponse(client.beta)
+
+
+Client = Anthropic
+
+AsyncClient = AsyncAnthropic
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_compat.py b/.venv/lib/python3.12/site-packages/anthropic/_compat.py
new file mode 100644
index 00000000..92d9ee61
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_compat.py
@@ -0,0 +1,219 @@
+from __future__ import annotations
+
+from typing import TYPE_CHECKING, Any, Union, Generic, TypeVar, Callable, cast, overload
+from datetime import date, datetime
+from typing_extensions import Self, Literal
+
+import pydantic
+from pydantic.fields import FieldInfo
+
+from ._types import IncEx, StrBytesIntFloat
+
+_T = TypeVar("_T")
+_ModelT = TypeVar("_ModelT", bound=pydantic.BaseModel)
+
+# --------------- Pydantic v2 compatibility ---------------
+
+# Pyright incorrectly reports some of our functions as overriding a method when they don't
+# pyright: reportIncompatibleMethodOverride=false
+
+PYDANTIC_V2 = pydantic.VERSION.startswith("2.")
+
+# v1 re-exports
+if TYPE_CHECKING:
+
+ def parse_date(value: date | StrBytesIntFloat) -> date: # noqa: ARG001
+ ...
+
+ def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: # noqa: ARG001
+ ...
+
+ def get_args(t: type[Any]) -> tuple[Any, ...]: # noqa: ARG001
+ ...
+
+ def is_union(tp: type[Any] | None) -> bool: # noqa: ARG001
+ ...
+
+ def get_origin(t: type[Any]) -> type[Any] | None: # noqa: ARG001
+ ...
+
+ def is_literal_type(type_: type[Any]) -> bool: # noqa: ARG001
+ ...
+
+ def is_typeddict(type_: type[Any]) -> bool: # noqa: ARG001
+ ...
+
+else:
+ if PYDANTIC_V2:
+ from pydantic.v1.typing import (
+ get_args as get_args,
+ is_union as is_union,
+ get_origin as get_origin,
+ is_typeddict as is_typeddict,
+ is_literal_type as is_literal_type,
+ )
+ from pydantic.v1.datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime
+ else:
+ from pydantic.typing import (
+ get_args as get_args,
+ is_union as is_union,
+ get_origin as get_origin,
+ is_typeddict as is_typeddict,
+ is_literal_type as is_literal_type,
+ )
+ from pydantic.datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime
+
+
+# refactored config
+if TYPE_CHECKING:
+ from pydantic import ConfigDict as ConfigDict
+else:
+ if PYDANTIC_V2:
+ from pydantic import ConfigDict
+ else:
+ # TODO: provide an error message here?
+ ConfigDict = None
+
+
+# renamed methods / properties
+def parse_obj(model: type[_ModelT], value: object) -> _ModelT:
+ if PYDANTIC_V2:
+ return model.model_validate(value)
+ else:
+ return cast(_ModelT, model.parse_obj(value)) # pyright: ignore[reportDeprecated, reportUnnecessaryCast]
+
+
+def field_is_required(field: FieldInfo) -> bool:
+ if PYDANTIC_V2:
+ return field.is_required()
+ return field.required # type: ignore
+
+
+def field_get_default(field: FieldInfo) -> Any:
+ value = field.get_default()
+ if PYDANTIC_V2:
+ from pydantic_core import PydanticUndefined
+
+ if value == PydanticUndefined:
+ return None
+ return value
+ return value
+
+
+def field_outer_type(field: FieldInfo) -> Any:
+ if PYDANTIC_V2:
+ return field.annotation
+ return field.outer_type_ # type: ignore
+
+
+def get_model_config(model: type[pydantic.BaseModel]) -> Any:
+ if PYDANTIC_V2:
+ return model.model_config
+ return model.__config__ # type: ignore
+
+
+def get_model_fields(model: type[pydantic.BaseModel]) -> dict[str, FieldInfo]:
+ if PYDANTIC_V2:
+ return model.model_fields
+ return model.__fields__ # type: ignore
+
+
+def model_copy(model: _ModelT, *, deep: bool = False) -> _ModelT:
+ if PYDANTIC_V2:
+ return model.model_copy(deep=deep)
+ return model.copy(deep=deep) # type: ignore
+
+
+def model_json(model: pydantic.BaseModel, *, indent: int | None = None) -> str:
+ if PYDANTIC_V2:
+ return model.model_dump_json(indent=indent)
+ return model.json(indent=indent) # type: ignore
+
+
+def model_dump(
+ model: pydantic.BaseModel,
+ *,
+ exclude: IncEx | None = None,
+ exclude_unset: bool = False,
+ exclude_defaults: bool = False,
+ warnings: bool = True,
+ mode: Literal["json", "python"] = "python",
+) -> dict[str, Any]:
+ if PYDANTIC_V2 or hasattr(model, "model_dump"):
+ return model.model_dump(
+ mode=mode,
+ exclude=exclude,
+ exclude_unset=exclude_unset,
+ exclude_defaults=exclude_defaults,
+ # warnings are not supported in Pydantic v1
+ warnings=warnings if PYDANTIC_V2 else True,
+ )
+ return cast(
+ "dict[str, Any]",
+ model.dict( # pyright: ignore[reportDeprecated, reportUnnecessaryCast]
+ exclude=exclude,
+ exclude_unset=exclude_unset,
+ exclude_defaults=exclude_defaults,
+ ),
+ )
+
+
+def model_parse(model: type[_ModelT], data: Any) -> _ModelT:
+ if PYDANTIC_V2:
+ return model.model_validate(data)
+ return model.parse_obj(data) # pyright: ignore[reportDeprecated]
+
+
+# generic models
+if TYPE_CHECKING:
+
+ class GenericModel(pydantic.BaseModel): ...
+
+else:
+ if PYDANTIC_V2:
+ # there no longer needs to be a distinction in v2 but
+ # we still have to create our own subclass to avoid
+ # inconsistent MRO ordering errors
+ class GenericModel(pydantic.BaseModel): ...
+
+ else:
+ import pydantic.generics
+
+ class GenericModel(pydantic.generics.GenericModel, pydantic.BaseModel): ...
+
+
+# cached properties
+if TYPE_CHECKING:
+ cached_property = property
+
+ # we define a separate type (copied from typeshed)
+ # that represents that `cached_property` is `set`able
+ # at runtime, which differs from `@property`.
+ #
+ # this is a separate type as editors likely special case
+ # `@property` and we don't want to cause issues just to have
+ # more helpful internal types.
+
+ class typed_cached_property(Generic[_T]):
+ func: Callable[[Any], _T]
+ attrname: str | None
+
+ def __init__(self, func: Callable[[Any], _T]) -> None: ...
+
+ @overload
+ def __get__(self, instance: None, owner: type[Any] | None = None) -> Self: ...
+
+ @overload
+ def __get__(self, instance: object, owner: type[Any] | None = None) -> _T: ...
+
+ def __get__(self, instance: object, owner: type[Any] | None = None) -> _T | Self:
+ raise NotImplementedError()
+
+ def __set_name__(self, owner: type[Any], name: str) -> None: ...
+
+ # __set__ is not defined at runtime, but @cached_property is designed to be settable
+ def __set__(self, instance: object, value: _T) -> None: ...
+else:
+ from functools import cached_property as cached_property
+
+ typed_cached_property = cached_property
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_constants.py b/.venv/lib/python3.12/site-packages/anthropic/_constants.py
new file mode 100644
index 00000000..617c4b47
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_constants.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+import httpx
+
+RAW_RESPONSE_HEADER = "X-Stainless-Raw-Response"
+OVERRIDE_CAST_TO_HEADER = "____stainless_override_cast_to"
+
+# default timeout is 10 minutes
+DEFAULT_TIMEOUT = httpx.Timeout(timeout=10 * 60, connect=5.0)
+DEFAULT_MAX_RETRIES = 2
+DEFAULT_CONNECTION_LIMITS = httpx.Limits(max_connections=1000, max_keepalive_connections=100)
+
+INITIAL_RETRY_DELAY = 0.5
+MAX_RETRY_DELAY = 8.0
+
+HUMAN_PROMPT = "\n\nHuman:"
+
+AI_PROMPT = "\n\nAssistant:"
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_decoders/jsonl.py b/.venv/lib/python3.12/site-packages/anthropic/_decoders/jsonl.py
new file mode 100644
index 00000000..ac5ac74f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_decoders/jsonl.py
@@ -0,0 +1,123 @@
+from __future__ import annotations
+
+import json
+from typing_extensions import Generic, TypeVar, Iterator, AsyncIterator
+
+import httpx
+
+from .._models import construct_type_unchecked
+
+_T = TypeVar("_T")
+
+
+class JSONLDecoder(Generic[_T]):
+ """A decoder for [JSON Lines](https://jsonlines.org) format.
+
+ This class provides an iterator over a byte-iterator that parses each JSON Line
+ into a given type.
+ """
+
+ http_response: httpx.Response
+ """The HTTP response this decoder was constructed from"""
+
+ def __init__(
+ self,
+ *,
+ raw_iterator: Iterator[bytes],
+ line_type: type[_T],
+ http_response: httpx.Response,
+ ) -> None:
+ super().__init__()
+ self.http_response = http_response
+ self._raw_iterator = raw_iterator
+ self._line_type = line_type
+ self._iterator = self.__decode__()
+
+ def close(self) -> None:
+ """Close the response body stream.
+
+ This is called automatically if you consume the entire stream.
+ """
+ self.http_response.close()
+
+ def __decode__(self) -> Iterator[_T]:
+ buf = b""
+ for chunk in self._raw_iterator:
+ for line in chunk.splitlines(keepends=True):
+ buf += line
+ if buf.endswith((b"\r", b"\n", b"\r\n")):
+ yield construct_type_unchecked(
+ value=json.loads(buf),
+ type_=self._line_type,
+ )
+ buf = b""
+
+ # flush
+ if buf:
+ yield construct_type_unchecked(
+ value=json.loads(buf),
+ type_=self._line_type,
+ )
+
+ def __next__(self) -> _T:
+ return self._iterator.__next__()
+
+ def __iter__(self) -> Iterator[_T]:
+ for item in self._iterator:
+ yield item
+
+
+class AsyncJSONLDecoder(Generic[_T]):
+ """A decoder for [JSON Lines](https://jsonlines.org) format.
+
+ This class provides an async iterator over a byte-iterator that parses each JSON Line
+ into a given type.
+ """
+
+ http_response: httpx.Response
+
+ def __init__(
+ self,
+ *,
+ raw_iterator: AsyncIterator[bytes],
+ line_type: type[_T],
+ http_response: httpx.Response,
+ ) -> None:
+ super().__init__()
+ self.http_response = http_response
+ self._raw_iterator = raw_iterator
+ self._line_type = line_type
+ self._iterator = self.__decode__()
+
+ async def close(self) -> None:
+ """Close the response body stream.
+
+ This is called automatically if you consume the entire stream.
+ """
+ await self.http_response.aclose()
+
+ async def __decode__(self) -> AsyncIterator[_T]:
+ buf = b""
+ async for chunk in self._raw_iterator:
+ for line in chunk.splitlines(keepends=True):
+ buf += line
+ if buf.endswith((b"\r", b"\n", b"\r\n")):
+ yield construct_type_unchecked(
+ value=json.loads(buf),
+ type_=self._line_type,
+ )
+ buf = b""
+
+ # flush
+ if buf:
+ yield construct_type_unchecked(
+ value=json.loads(buf),
+ type_=self._line_type,
+ )
+
+ async def __anext__(self) -> _T:
+ return await self._iterator.__anext__()
+
+ async def __aiter__(self) -> AsyncIterator[_T]:
+ async for item in self._iterator:
+ yield item
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_exceptions.py b/.venv/lib/python3.12/site-packages/anthropic/_exceptions.py
new file mode 100644
index 00000000..2bf3e81a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_exceptions.py
@@ -0,0 +1,126 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal
+
+import httpx
+
+__all__ = [
+ "BadRequestError",
+ "AuthenticationError",
+ "PermissionDeniedError",
+ "NotFoundError",
+ "ConflictError",
+ "UnprocessableEntityError",
+ "RateLimitError",
+ "InternalServerError",
+]
+
+
+class AnthropicError(Exception):
+ pass
+
+
+class APIError(AnthropicError):
+ message: str
+ request: httpx.Request
+
+ body: object | None
+ """The API response body.
+
+ If the API responded with a valid JSON structure then this property will be the
+ decoded result.
+
+ If it isn't a valid JSON structure then this will be the raw response.
+
+ If there was no response associated with this error then it will be `None`.
+ """
+
+ def __init__(self, message: str, request: httpx.Request, *, body: object | None) -> None: # noqa: ARG002
+ super().__init__(message)
+ self.request = request
+ self.message = message
+ self.body = body
+
+
+class APIResponseValidationError(APIError):
+ response: httpx.Response
+ status_code: int
+
+ def __init__(self, response: httpx.Response, body: object | None, *, message: str | None = None) -> None:
+ super().__init__(message or "Data returned by API invalid for expected schema.", response.request, body=body)
+ self.response = response
+ self.status_code = response.status_code
+
+
+class APIStatusError(APIError):
+ """Raised when an API response has a status code of 4xx or 5xx."""
+
+ response: httpx.Response
+ status_code: int
+ request_id: str | None
+
+ def __init__(self, message: str, *, response: httpx.Response, body: object | None) -> None:
+ super().__init__(message, response.request, body=body)
+ self.response = response
+ self.status_code = response.status_code
+ self.request_id = response.headers.get("request-id")
+
+
+class APIConnectionError(APIError):
+ def __init__(self, *, message: str = "Connection error.", request: httpx.Request) -> None:
+ super().__init__(message, request, body=None)
+
+
+class APITimeoutError(APIConnectionError):
+ def __init__(self, request: httpx.Request) -> None:
+ super().__init__(message="Request timed out.", request=request)
+
+
+class BadRequestError(APIStatusError):
+ status_code: Literal[400] = 400 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class AuthenticationError(APIStatusError):
+ status_code: Literal[401] = 401 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class PermissionDeniedError(APIStatusError):
+ status_code: Literal[403] = 403 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class NotFoundError(APIStatusError):
+ status_code: Literal[404] = 404 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class ConflictError(APIStatusError):
+ status_code: Literal[409] = 409 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class RequestTooLargeError(APIStatusError):
+ status_code: Literal[413] = 413 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class UnprocessableEntityError(APIStatusError):
+ status_code: Literal[422] = 422 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class RateLimitError(APIStatusError):
+ status_code: Literal[429] = 429 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class ServiceUnavailableError(APIStatusError):
+ status_code: Literal[503] = 503 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class OverloadedError(APIStatusError):
+ status_code: Literal[529] = 529 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class DeadlineExceededError(APIStatusError):
+ status_code: Literal[504] = 504 # pyright: ignore[reportIncompatibleVariableOverride]
+
+
+class InternalServerError(APIStatusError):
+ pass
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_files.py b/.venv/lib/python3.12/site-packages/anthropic/_files.py
new file mode 100644
index 00000000..715cc207
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_files.py
@@ -0,0 +1,123 @@
+from __future__ import annotations
+
+import io
+import os
+import pathlib
+from typing import overload
+from typing_extensions import TypeGuard
+
+import anyio
+
+from ._types import (
+ FileTypes,
+ FileContent,
+ RequestFiles,
+ HttpxFileTypes,
+ Base64FileInput,
+ HttpxFileContent,
+ HttpxRequestFiles,
+)
+from ._utils import is_tuple_t, is_mapping_t, is_sequence_t
+
+
+def is_base64_file_input(obj: object) -> TypeGuard[Base64FileInput]:
+ return isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike)
+
+
+def is_file_content(obj: object) -> TypeGuard[FileContent]:
+ return (
+ isinstance(obj, bytes) or isinstance(obj, tuple) or isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike)
+ )
+
+
+def assert_is_file_content(obj: object, *, key: str | None = None) -> None:
+ if not is_file_content(obj):
+ prefix = f"Expected entry at `{key}`" if key is not None else f"Expected file input `{obj!r}`"
+ raise RuntimeError(
+ f"{prefix} to be bytes, an io.IOBase instance, PathLike or a tuple but received {type(obj)} instead."
+ ) from None
+
+
+@overload
+def to_httpx_files(files: None) -> None: ...
+
+
+@overload
+def to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ...
+
+
+def to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None:
+ if files is None:
+ return None
+
+ if is_mapping_t(files):
+ files = {key: _transform_file(file) for key, file in files.items()}
+ elif is_sequence_t(files):
+ files = [(key, _transform_file(file)) for key, file in files]
+ else:
+ raise TypeError(f"Unexpected file type input {type(files)}, expected mapping or sequence")
+
+ return files
+
+
+def _transform_file(file: FileTypes) -> HttpxFileTypes:
+ if is_file_content(file):
+ if isinstance(file, os.PathLike):
+ path = pathlib.Path(file)
+ return (path.name, path.read_bytes())
+
+ return file
+
+ if is_tuple_t(file):
+ return (file[0], _read_file_content(file[1]), *file[2:])
+
+ raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple")
+
+
+def _read_file_content(file: FileContent) -> HttpxFileContent:
+ if isinstance(file, os.PathLike):
+ return pathlib.Path(file).read_bytes()
+ return file
+
+
+@overload
+async def async_to_httpx_files(files: None) -> None: ...
+
+
+@overload
+async def async_to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ...
+
+
+async def async_to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None:
+ if files is None:
+ return None
+
+ if is_mapping_t(files):
+ files = {key: await _async_transform_file(file) for key, file in files.items()}
+ elif is_sequence_t(files):
+ files = [(key, await _async_transform_file(file)) for key, file in files]
+ else:
+ raise TypeError("Unexpected file type input {type(files)}, expected mapping or sequence")
+
+ return files
+
+
+async def _async_transform_file(file: FileTypes) -> HttpxFileTypes:
+ if is_file_content(file):
+ if isinstance(file, os.PathLike):
+ path = anyio.Path(file)
+ return (path.name, await path.read_bytes())
+
+ return file
+
+ if is_tuple_t(file):
+ return (file[0], await _async_read_file_content(file[1]), *file[2:])
+
+ raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple")
+
+
+async def _async_read_file_content(file: FileContent) -> HttpxFileContent:
+ if isinstance(file, os.PathLike):
+ return await anyio.Path(file).read_bytes()
+
+ return file
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_legacy_response.py b/.venv/lib/python3.12/site-packages/anthropic/_legacy_response.py
new file mode 100644
index 00000000..5703932e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_legacy_response.py
@@ -0,0 +1,511 @@
+from __future__ import annotations
+
+import os
+import inspect
+import logging
+import datetime
+import functools
+from typing import (
+ TYPE_CHECKING,
+ Any,
+ Union,
+ Generic,
+ TypeVar,
+ Callable,
+ Iterator,
+ AsyncIterator,
+ cast,
+ overload,
+)
+from typing_extensions import Awaitable, ParamSpec, override, deprecated, get_origin
+
+import anyio
+import httpx
+import pydantic
+
+from ._types import NoneType
+from ._utils import is_given, extract_type_arg, is_annotated_type, is_type_alias_type
+from ._models import BaseModel, is_basemodel, add_request_id
+from ._constants import RAW_RESPONSE_HEADER
+from ._streaming import Stream, AsyncStream, is_stream_class_type, extract_stream_chunk_type
+from ._exceptions import APIResponseValidationError
+from ._decoders.jsonl import JSONLDecoder, AsyncJSONLDecoder
+
+if TYPE_CHECKING:
+ from ._models import FinalRequestOptions
+ from ._base_client import BaseClient
+
+
+P = ParamSpec("P")
+R = TypeVar("R")
+_T = TypeVar("_T")
+_T_co = TypeVar("_T_co", covariant=True)
+
+log: logging.Logger = logging.getLogger(__name__)
+
+
+class LegacyAPIResponse(Generic[R]):
+ """This is a legacy class as it will be replaced by `APIResponse`
+ and `AsyncAPIResponse` in the `_response.py` file in the next major
+ release.
+
+ For the sync client this will mostly be the same with the exception
+ of `content` & `text` will be methods instead of properties. In the
+ async client, all methods will be async.
+
+ A migration script will be provided & the migration in general should
+ be smooth.
+ """
+
+ _cast_to: type[R]
+ _client: BaseClient[Any, Any]
+ _parsed_by_type: dict[type[Any], Any]
+ _stream: bool
+ _stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None
+ _options: FinalRequestOptions
+
+ http_response: httpx.Response
+
+ retries_taken: int
+ """The number of retries made. If no retries happened this will be `0`"""
+
+ def __init__(
+ self,
+ *,
+ raw: httpx.Response,
+ cast_to: type[R],
+ client: BaseClient[Any, Any],
+ stream: bool,
+ stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None,
+ options: FinalRequestOptions,
+ retries_taken: int = 0,
+ ) -> None:
+ self._cast_to = cast_to
+ self._client = client
+ self._parsed_by_type = {}
+ self._stream = stream
+ self._stream_cls = stream_cls
+ self._options = options
+ self.http_response = raw
+ self.retries_taken = retries_taken
+
+ @property
+ def request_id(self) -> str | None:
+ return self.http_response.headers.get("request-id") # type: ignore[no-any-return]
+
+ @overload
+ def parse(self, *, to: type[_T]) -> _T: ...
+
+ @overload
+ def parse(self) -> R: ...
+
+ def parse(self, *, to: type[_T] | None = None) -> R | _T:
+ """Returns the rich python representation of this response's data.
+
+ NOTE: For the async client: this will become a coroutine in the next major version.
+
+ For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`.
+
+ You can customise the type that the response is parsed into through
+ the `to` argument, e.g.
+
+ ```py
+ from anthropic import BaseModel
+
+
+ class MyModel(BaseModel):
+ foo: str
+
+
+ obj = response.parse(to=MyModel)
+ print(obj.foo)
+ ```
+
+ We support parsing:
+ - `BaseModel`
+ - `dict`
+ - `list`
+ - `Union`
+ - `str`
+ - `int`
+ - `float`
+ - `httpx.Response`
+ """
+ cache_key = to if to is not None else self._cast_to
+ cached = self._parsed_by_type.get(cache_key)
+ if cached is not None:
+ return cached # type: ignore[no-any-return]
+
+ parsed = self._parse(to=to)
+ if is_given(self._options.post_parser):
+ parsed = self._options.post_parser(parsed)
+
+ if isinstance(parsed, BaseModel):
+ add_request_id(parsed, self.request_id)
+
+ self._parsed_by_type[cache_key] = parsed
+ return cast(R, parsed)
+
+ @property
+ def headers(self) -> httpx.Headers:
+ return self.http_response.headers
+
+ @property
+ def http_request(self) -> httpx.Request:
+ return self.http_response.request
+
+ @property
+ def status_code(self) -> int:
+ return self.http_response.status_code
+
+ @property
+ def url(self) -> httpx.URL:
+ return self.http_response.url
+
+ @property
+ def method(self) -> str:
+ return self.http_request.method
+
+ @property
+ def content(self) -> bytes:
+ """Return the binary response content.
+
+ NOTE: this will be removed in favour of `.read()` in the
+ next major version.
+ """
+ return self.http_response.content
+
+ @property
+ def text(self) -> str:
+ """Return the decoded response content.
+
+ NOTE: this will be turned into a method in the next major version.
+ """
+ return self.http_response.text
+
+ @property
+ def http_version(self) -> str:
+ return self.http_response.http_version
+
+ @property
+ def is_closed(self) -> bool:
+ return self.http_response.is_closed
+
+ @property
+ def elapsed(self) -> datetime.timedelta:
+ """The time taken for the complete request/response cycle to complete."""
+ return self.http_response.elapsed
+
+ def _parse(self, *, to: type[_T] | None = None) -> R | _T:
+ cast_to = to if to is not None else self._cast_to
+
+ # unwrap `TypeAlias('Name', T)` -> `T`
+ if is_type_alias_type(cast_to):
+ cast_to = cast_to.__value__ # type: ignore[unreachable]
+
+ # unwrap `Annotated[T, ...]` -> `T`
+ if cast_to and is_annotated_type(cast_to):
+ cast_to = extract_type_arg(cast_to, 0)
+
+ origin = get_origin(cast_to) or cast_to
+
+ if inspect.isclass(origin):
+ if issubclass(cast(Any, origin), JSONLDecoder):
+ return cast(
+ R,
+ cast("type[JSONLDecoder[Any]]", cast_to)(
+ raw_iterator=self.http_response.iter_bytes(chunk_size=64),
+ line_type=extract_type_arg(cast_to, 0),
+ http_response=self.http_response,
+ ),
+ )
+
+ if issubclass(cast(Any, origin), AsyncJSONLDecoder):
+ return cast(
+ R,
+ cast("type[AsyncJSONLDecoder[Any]]", cast_to)(
+ raw_iterator=self.http_response.aiter_bytes(chunk_size=64),
+ line_type=extract_type_arg(cast_to, 0),
+ http_response=self.http_response,
+ ),
+ )
+
+ if self._stream:
+ if to:
+ if not is_stream_class_type(to):
+ raise TypeError(f"Expected custom parse type to be a subclass of {Stream} or {AsyncStream}")
+
+ return cast(
+ _T,
+ to(
+ cast_to=extract_stream_chunk_type(
+ to,
+ failure_message="Expected custom stream type to be passed with a type argument, e.g. Stream[ChunkType]",
+ ),
+ response=self.http_response,
+ client=cast(Any, self._client),
+ ),
+ )
+
+ if self._stream_cls:
+ return cast(
+ R,
+ self._stream_cls(
+ cast_to=extract_stream_chunk_type(self._stream_cls),
+ response=self.http_response,
+ client=cast(Any, self._client),
+ ),
+ )
+
+ stream_cls = cast("type[Stream[Any]] | type[AsyncStream[Any]] | None", self._client._default_stream_cls)
+ if stream_cls is None:
+ raise MissingStreamClassError()
+
+ return cast(
+ R,
+ stream_cls(
+ cast_to=cast_to,
+ response=self.http_response,
+ client=cast(Any, self._client),
+ ),
+ )
+
+ if cast_to is NoneType:
+ return cast(R, None)
+
+ response = self.http_response
+ if cast_to == str:
+ return cast(R, response.text)
+
+ if cast_to == int:
+ return cast(R, int(response.text))
+
+ if cast_to == float:
+ return cast(R, float(response.text))
+
+ if cast_to == bool:
+ return cast(R, response.text.lower() == "true")
+
+ if inspect.isclass(origin) and issubclass(origin, HttpxBinaryResponseContent):
+ return cast(R, cast_to(response)) # type: ignore
+
+ if origin == LegacyAPIResponse:
+ raise RuntimeError("Unexpected state - cast_to is `APIResponse`")
+
+ if inspect.isclass(
+ origin # pyright: ignore[reportUnknownArgumentType]
+ ) and issubclass(origin, httpx.Response):
+ # Because of the invariance of our ResponseT TypeVar, users can subclass httpx.Response
+ # and pass that class to our request functions. We cannot change the variance to be either
+ # covariant or contravariant as that makes our usage of ResponseT illegal. We could construct
+ # the response class ourselves but that is something that should be supported directly in httpx
+ # as it would be easy to incorrectly construct the Response object due to the multitude of arguments.
+ if cast_to != httpx.Response:
+ raise ValueError(f"Subclasses of httpx.Response cannot be passed to `cast_to`")
+ return cast(R, response)
+
+ if (
+ inspect.isclass(
+ origin # pyright: ignore[reportUnknownArgumentType]
+ )
+ and not issubclass(origin, BaseModel)
+ and issubclass(origin, pydantic.BaseModel)
+ ):
+ raise TypeError("Pydantic models must subclass our base model type, e.g. `from anthropic import BaseModel`")
+
+ if (
+ cast_to is not object
+ and not origin is list
+ and not origin is dict
+ and not origin is Union
+ and not issubclass(origin, BaseModel)
+ ):
+ raise RuntimeError(
+ f"Unsupported type, expected {cast_to} to be a subclass of {BaseModel}, {dict}, {list}, {Union}, {NoneType}, {str} or {httpx.Response}."
+ )
+
+ # split is required to handle cases where additional information is included
+ # in the response, e.g. application/json; charset=utf-8
+ content_type, *_ = response.headers.get("content-type", "*").split(";")
+ if content_type != "application/json":
+ if is_basemodel(cast_to):
+ try:
+ data = response.json()
+ except Exception as exc:
+ log.debug("Could not read JSON from response data due to %s - %s", type(exc), exc)
+ else:
+ return self._client._process_response_data(
+ data=data,
+ cast_to=cast_to, # type: ignore
+ response=response,
+ )
+
+ if self._client._strict_response_validation:
+ raise APIResponseValidationError(
+ response=response,
+ message=f"Expected Content-Type response header to be `application/json` but received `{content_type}` instead.",
+ body=response.text,
+ )
+
+ # If the API responds with content that isn't JSON then we just return
+ # the (decoded) text without performing any parsing so that you can still
+ # handle the response however you need to.
+ return response.text # type: ignore
+
+ data = response.json()
+
+ return self._client._process_response_data(
+ data=data,
+ cast_to=cast_to, # type: ignore
+ response=response,
+ )
+
+ @override
+ def __repr__(self) -> str:
+ return f"<APIResponse [{self.status_code} {self.http_response.reason_phrase}] type={self._cast_to}>"
+
+
+class MissingStreamClassError(TypeError):
+ def __init__(self) -> None:
+ super().__init__(
+ "The `stream` argument was set to `True` but the `stream_cls` argument was not given. See `anthropic._streaming` for reference",
+ )
+
+
+def to_raw_response_wrapper(func: Callable[P, R]) -> Callable[P, LegacyAPIResponse[R]]:
+ """Higher order function that takes one of our bound API methods and wraps it
+ to support returning the raw `APIResponse` object directly.
+ """
+
+ @functools.wraps(func)
+ def wrapped(*args: P.args, **kwargs: P.kwargs) -> LegacyAPIResponse[R]:
+ extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "true"
+
+ kwargs["extra_headers"] = extra_headers
+
+ return cast(LegacyAPIResponse[R], func(*args, **kwargs))
+
+ return wrapped
+
+
+def async_to_raw_response_wrapper(func: Callable[P, Awaitable[R]]) -> Callable[P, Awaitable[LegacyAPIResponse[R]]]:
+ """Higher order function that takes one of our bound API methods and wraps it
+ to support returning the raw `APIResponse` object directly.
+ """
+
+ @functools.wraps(func)
+ async def wrapped(*args: P.args, **kwargs: P.kwargs) -> LegacyAPIResponse[R]:
+ extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "true"
+
+ kwargs["extra_headers"] = extra_headers
+
+ return cast(LegacyAPIResponse[R], await func(*args, **kwargs))
+
+ return wrapped
+
+
+class HttpxBinaryResponseContent:
+ response: httpx.Response
+
+ def __init__(self, response: httpx.Response) -> None:
+ self.response = response
+
+ @property
+ def content(self) -> bytes:
+ return self.response.content
+
+ @property
+ def text(self) -> str:
+ return self.response.text
+
+ @property
+ def encoding(self) -> str | None:
+ return self.response.encoding
+
+ @property
+ def charset_encoding(self) -> str | None:
+ return self.response.charset_encoding
+
+ def json(self, **kwargs: Any) -> Any:
+ return self.response.json(**kwargs)
+
+ def read(self) -> bytes:
+ return self.response.read()
+
+ def iter_bytes(self, chunk_size: int | None = None) -> Iterator[bytes]:
+ return self.response.iter_bytes(chunk_size)
+
+ def iter_text(self, chunk_size: int | None = None) -> Iterator[str]:
+ return self.response.iter_text(chunk_size)
+
+ def iter_lines(self) -> Iterator[str]:
+ return self.response.iter_lines()
+
+ def iter_raw(self, chunk_size: int | None = None) -> Iterator[bytes]:
+ return self.response.iter_raw(chunk_size)
+
+ def write_to_file(
+ self,
+ file: str | os.PathLike[str],
+ ) -> None:
+ """Write the output to the given file.
+
+ Accepts a filename or any path-like object, e.g. pathlib.Path
+
+ Note: if you want to stream the data to the file instead of writing
+ all at once then you should use `.with_streaming_response` when making
+ the API request, e.g. `client.with_streaming_response.foo().stream_to_file('my_filename.txt')`
+ """
+ with open(file, mode="wb") as f:
+ for data in self.response.iter_bytes():
+ f.write(data)
+
+ @deprecated(
+ "Due to a bug, this method doesn't actually stream the response content, `.with_streaming_response.method()` should be used instead"
+ )
+ def stream_to_file(
+ self,
+ file: str | os.PathLike[str],
+ *,
+ chunk_size: int | None = None,
+ ) -> None:
+ with open(file, mode="wb") as f:
+ for data in self.response.iter_bytes(chunk_size):
+ f.write(data)
+
+ def close(self) -> None:
+ return self.response.close()
+
+ async def aread(self) -> bytes:
+ return await self.response.aread()
+
+ async def aiter_bytes(self, chunk_size: int | None = None) -> AsyncIterator[bytes]:
+ return self.response.aiter_bytes(chunk_size)
+
+ async def aiter_text(self, chunk_size: int | None = None) -> AsyncIterator[str]:
+ return self.response.aiter_text(chunk_size)
+
+ async def aiter_lines(self) -> AsyncIterator[str]:
+ return self.response.aiter_lines()
+
+ async def aiter_raw(self, chunk_size: int | None = None) -> AsyncIterator[bytes]:
+ return self.response.aiter_raw(chunk_size)
+
+ @deprecated(
+ "Due to a bug, this method doesn't actually stream the response content, `.with_streaming_response.method()` should be used instead"
+ )
+ async def astream_to_file(
+ self,
+ file: str | os.PathLike[str],
+ *,
+ chunk_size: int | None = None,
+ ) -> None:
+ path = anyio.Path(file)
+ async with await path.open(mode="wb") as f:
+ async for data in self.response.aiter_bytes(chunk_size):
+ await f.write(data)
+
+ async def aclose(self) -> None:
+ return await self.response.aclose()
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_models.py b/.venv/lib/python3.12/site-packages/anthropic/_models.py
new file mode 100644
index 00000000..dad8df9e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_models.py
@@ -0,0 +1,832 @@
+from __future__ import annotations
+
+import os
+import inspect
+from typing import TYPE_CHECKING, Any, Type, Union, Generic, TypeVar, Callable, Optional, cast
+from datetime import date, datetime
+from typing_extensions import (
+ Unpack,
+ Literal,
+ ClassVar,
+ Protocol,
+ Required,
+ ParamSpec,
+ TypedDict,
+ TypeGuard,
+ final,
+ override,
+ runtime_checkable,
+)
+
+import pydantic
+import pydantic.generics
+from pydantic.fields import FieldInfo
+
+from ._types import (
+ Body,
+ IncEx,
+ Query,
+ ModelT,
+ Headers,
+ Timeout,
+ NotGiven,
+ AnyMapping,
+ HttpxRequestFiles,
+)
+from ._utils import (
+ PropertyInfo,
+ is_list,
+ is_given,
+ json_safe,
+ lru_cache,
+ is_mapping,
+ parse_date,
+ coerce_boolean,
+ parse_datetime,
+ strip_not_given,
+ extract_type_arg,
+ is_annotated_type,
+ is_type_alias_type,
+ strip_annotated_type,
+)
+from ._compat import (
+ PYDANTIC_V2,
+ ConfigDict,
+ GenericModel as BaseGenericModel,
+ get_args,
+ is_union,
+ parse_obj,
+ get_origin,
+ is_literal_type,
+ get_model_config,
+ get_model_fields,
+ field_get_default,
+)
+from ._constants import RAW_RESPONSE_HEADER
+
+if TYPE_CHECKING:
+ from pydantic_core.core_schema import ModelField, LiteralSchema, ModelFieldsSchema
+
+__all__ = ["BaseModel", "GenericModel"]
+
+_T = TypeVar("_T")
+_BaseModelT = TypeVar("_BaseModelT", bound="BaseModel")
+
+P = ParamSpec("P")
+
+
+@runtime_checkable
+class _ConfigProtocol(Protocol):
+ allow_population_by_field_name: bool
+
+
+class BaseModel(pydantic.BaseModel):
+ if PYDANTIC_V2:
+ model_config: ClassVar[ConfigDict] = ConfigDict(
+ extra="allow", defer_build=coerce_boolean(os.environ.get("DEFER_PYDANTIC_BUILD", "true"))
+ )
+ else:
+
+ @property
+ @override
+ def model_fields_set(self) -> set[str]:
+ # a forwards-compat shim for pydantic v2
+ return self.__fields_set__ # type: ignore
+
+ class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated]
+ extra: Any = pydantic.Extra.allow # type: ignore
+
+ if TYPE_CHECKING:
+ _request_id: Optional[str] = None
+ """The ID of the request, returned via the `request-id` header. Useful for debugging requests and reporting issues to Anthropic.
+ This will **only** be set for the top-level response object, it will not be defined for nested objects. For example:
+
+ ```py
+ message = await client.messages.create(...)
+ message._request_id # req_xxx
+ message.usage._request_id # raises `AttributeError`
+ ```
+
+ Note: unlike other properties that use an `_` prefix, this property
+ *is* public. Unless documented otherwise, all other `_` prefix properties,
+ methods and modules are *private*.
+ """
+
+ def to_dict(
+ self,
+ *,
+ mode: Literal["json", "python"] = "python",
+ use_api_names: bool = True,
+ exclude_unset: bool = True,
+ exclude_defaults: bool = False,
+ exclude_none: bool = False,
+ warnings: bool = True,
+ ) -> dict[str, object]:
+ """Recursively generate a dictionary representation of the model, optionally specifying which fields to include or exclude.
+
+ By default, fields that were not set by the API will not be included,
+ and keys will match the API response, *not* the property names from the model.
+
+ For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property,
+ the output will use the `"fooBar"` key (unless `use_api_names=False` is passed).
+
+ Args:
+ mode:
+ If mode is 'json', the dictionary will only contain JSON serializable types. e.g. `datetime` will be turned into a string, `"2024-3-22T18:11:19.117000Z"`.
+ If mode is 'python', the dictionary may contain any Python objects. e.g. `datetime(2024, 3, 22)`
+
+ use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`.
+ exclude_unset: Whether to exclude fields that have not been explicitly set.
+ exclude_defaults: Whether to exclude fields that are set to their default value from the output.
+ exclude_none: Whether to exclude fields that have a value of `None` from the output.
+ warnings: Whether to log warnings when invalid fields are encountered. This is only supported in Pydantic v2.
+ """
+ return self.model_dump(
+ mode=mode,
+ by_alias=use_api_names,
+ exclude_unset=exclude_unset,
+ exclude_defaults=exclude_defaults,
+ exclude_none=exclude_none,
+ warnings=warnings,
+ )
+
+ def to_json(
+ self,
+ *,
+ indent: int | None = 2,
+ use_api_names: bool = True,
+ exclude_unset: bool = True,
+ exclude_defaults: bool = False,
+ exclude_none: bool = False,
+ warnings: bool = True,
+ ) -> str:
+ """Generates a JSON string representing this model as it would be received from or sent to the API (but with indentation).
+
+ By default, fields that were not set by the API will not be included,
+ and keys will match the API response, *not* the property names from the model.
+
+ For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property,
+ the output will use the `"fooBar"` key (unless `use_api_names=False` is passed).
+
+ Args:
+ indent: Indentation to use in the JSON output. If `None` is passed, the output will be compact. Defaults to `2`
+ use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`.
+ exclude_unset: Whether to exclude fields that have not been explicitly set.
+ exclude_defaults: Whether to exclude fields that have the default value.
+ exclude_none: Whether to exclude fields that have a value of `None`.
+ warnings: Whether to show any warnings that occurred during serialization. This is only supported in Pydantic v2.
+ """
+ return self.model_dump_json(
+ indent=indent,
+ by_alias=use_api_names,
+ exclude_unset=exclude_unset,
+ exclude_defaults=exclude_defaults,
+ exclude_none=exclude_none,
+ warnings=warnings,
+ )
+
+ @override
+ def __str__(self) -> str:
+ # mypy complains about an invalid self arg
+ return f"{self.__repr_name__()}({self.__repr_str__(', ')})" # type: ignore[misc]
+
+ # Override the 'construct' method in a way that supports recursive parsing without validation.
+ # Based on https://github.com/samuelcolvin/pydantic/issues/1168#issuecomment-817742836.
+ @classmethod
+ @override
+ def construct( # pyright: ignore[reportIncompatibleMethodOverride]
+ __cls: Type[ModelT],
+ _fields_set: set[str] | None = None,
+ **values: object,
+ ) -> ModelT:
+ m = __cls.__new__(__cls)
+ fields_values: dict[str, object] = {}
+
+ config = get_model_config(__cls)
+ populate_by_name = (
+ config.allow_population_by_field_name
+ if isinstance(config, _ConfigProtocol)
+ else config.get("populate_by_name")
+ )
+
+ if _fields_set is None:
+ _fields_set = set()
+
+ model_fields = get_model_fields(__cls)
+ for name, field in model_fields.items():
+ key = field.alias
+ if key is None or (key not in values and populate_by_name):
+ key = name
+
+ if key in values:
+ fields_values[name] = _construct_field(value=values[key], field=field, key=key)
+ _fields_set.add(name)
+ else:
+ fields_values[name] = field_get_default(field)
+
+ _extra = {}
+ for key, value in values.items():
+ if key not in model_fields:
+ if PYDANTIC_V2:
+ _extra[key] = value
+ else:
+ _fields_set.add(key)
+ fields_values[key] = value
+
+ object.__setattr__(m, "__dict__", fields_values)
+
+ if PYDANTIC_V2:
+ # these properties are copied from Pydantic's `model_construct()` method
+ object.__setattr__(m, "__pydantic_private__", None)
+ object.__setattr__(m, "__pydantic_extra__", _extra)
+ object.__setattr__(m, "__pydantic_fields_set__", _fields_set)
+ else:
+ # init_private_attributes() does not exist in v2
+ m._init_private_attributes() # type: ignore
+
+ # copied from Pydantic v1's `construct()` method
+ object.__setattr__(m, "__fields_set__", _fields_set)
+
+ return m
+
+ if not TYPE_CHECKING:
+ # type checkers incorrectly complain about this assignment
+ # because the type signatures are technically different
+ # although not in practice
+ model_construct = construct
+
+ if not PYDANTIC_V2:
+ # we define aliases for some of the new pydantic v2 methods so
+ # that we can just document these methods without having to specify
+ # a specific pydantic version as some users may not know which
+ # pydantic version they are currently using
+
+ @override
+ def model_dump(
+ self,
+ *,
+ mode: Literal["json", "python"] | str = "python",
+ include: IncEx | None = None,
+ exclude: IncEx | None = None,
+ by_alias: bool = False,
+ exclude_unset: bool = False,
+ exclude_defaults: bool = False,
+ exclude_none: bool = False,
+ round_trip: bool = False,
+ warnings: bool | Literal["none", "warn", "error"] = True,
+ context: dict[str, Any] | None = None,
+ serialize_as_any: bool = False,
+ ) -> dict[str, Any]:
+ """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump
+
+ Generate a dictionary representation of the model, optionally specifying which fields to include or exclude.
+
+ Args:
+ mode: The mode in which `to_python` should run.
+ If mode is 'json', the dictionary will only contain JSON serializable types.
+ If mode is 'python', the dictionary may contain any Python objects.
+ include: A list of fields to include in the output.
+ exclude: A list of fields to exclude from the output.
+ by_alias: Whether to use the field's alias in the dictionary key if defined.
+ exclude_unset: Whether to exclude fields that are unset or None from the output.
+ exclude_defaults: Whether to exclude fields that are set to their default value from the output.
+ exclude_none: Whether to exclude fields that have a value of `None` from the output.
+ round_trip: Whether to enable serialization and deserialization round-trip support.
+ warnings: Whether to log warnings when invalid fields are encountered.
+
+ Returns:
+ A dictionary representation of the model.
+ """
+ if mode not in {"json", "python"}:
+ raise ValueError("mode must be either 'json' or 'python'")
+ if round_trip != False:
+ raise ValueError("round_trip is only supported in Pydantic v2")
+ if warnings != True:
+ raise ValueError("warnings is only supported in Pydantic v2")
+ if context is not None:
+ raise ValueError("context is only supported in Pydantic v2")
+ if serialize_as_any != False:
+ raise ValueError("serialize_as_any is only supported in Pydantic v2")
+ dumped = super().dict( # pyright: ignore[reportDeprecated]
+ include=include,
+ exclude=exclude,
+ by_alias=by_alias,
+ exclude_unset=exclude_unset,
+ exclude_defaults=exclude_defaults,
+ exclude_none=exclude_none,
+ )
+
+ return cast(dict[str, Any], json_safe(dumped)) if mode == "json" else dumped
+
+ @override
+ def model_dump_json(
+ self,
+ *,
+ indent: int | None = None,
+ include: IncEx | None = None,
+ exclude: IncEx | None = None,
+ by_alias: bool = False,
+ exclude_unset: bool = False,
+ exclude_defaults: bool = False,
+ exclude_none: bool = False,
+ round_trip: bool = False,
+ warnings: bool | Literal["none", "warn", "error"] = True,
+ context: dict[str, Any] | None = None,
+ serialize_as_any: bool = False,
+ ) -> str:
+ """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump_json
+
+ Generates a JSON representation of the model using Pydantic's `to_json` method.
+
+ Args:
+ indent: Indentation to use in the JSON output. If None is passed, the output will be compact.
+ include: Field(s) to include in the JSON output. Can take either a string or set of strings.
+ exclude: Field(s) to exclude from the JSON output. Can take either a string or set of strings.
+ by_alias: Whether to serialize using field aliases.
+ exclude_unset: Whether to exclude fields that have not been explicitly set.
+ exclude_defaults: Whether to exclude fields that have the default value.
+ exclude_none: Whether to exclude fields that have a value of `None`.
+ round_trip: Whether to use serialization/deserialization between JSON and class instance.
+ warnings: Whether to show any warnings that occurred during serialization.
+
+ Returns:
+ A JSON string representation of the model.
+ """
+ if round_trip != False:
+ raise ValueError("round_trip is only supported in Pydantic v2")
+ if warnings != True:
+ raise ValueError("warnings is only supported in Pydantic v2")
+ if context is not None:
+ raise ValueError("context is only supported in Pydantic v2")
+ if serialize_as_any != False:
+ raise ValueError("serialize_as_any is only supported in Pydantic v2")
+ return super().json( # type: ignore[reportDeprecated]
+ indent=indent,
+ include=include,
+ exclude=exclude,
+ by_alias=by_alias,
+ exclude_unset=exclude_unset,
+ exclude_defaults=exclude_defaults,
+ exclude_none=exclude_none,
+ )
+
+
+def _construct_field(value: object, field: FieldInfo, key: str) -> object:
+ if value is None:
+ return field_get_default(field)
+
+ if PYDANTIC_V2:
+ type_ = field.annotation
+ else:
+ type_ = cast(type, field.outer_type_) # type: ignore
+
+ if type_ is None:
+ raise RuntimeError(f"Unexpected field type is None for {key}")
+
+ return construct_type(value=value, type_=type_)
+
+
+def is_basemodel(type_: type) -> bool:
+ """Returns whether or not the given type is either a `BaseModel` or a union of `BaseModel`"""
+ if is_union(type_):
+ for variant in get_args(type_):
+ if is_basemodel(variant):
+ return True
+
+ return False
+
+ return is_basemodel_type(type_)
+
+
+def is_basemodel_type(type_: type) -> TypeGuard[type[BaseModel] | type[GenericModel]]:
+ origin = get_origin(type_) or type_
+ if not inspect.isclass(origin):
+ return False
+ return issubclass(origin, BaseModel) or issubclass(origin, GenericModel)
+
+
+def build(
+ base_model_cls: Callable[P, _BaseModelT],
+ *args: P.args,
+ **kwargs: P.kwargs,
+) -> _BaseModelT:
+ """Construct a BaseModel class without validation.
+
+ This is useful for cases where you need to instantiate a `BaseModel`
+ from an API response as this provides type-safe params which isn't supported
+ by helpers like `construct_type()`.
+
+ ```py
+ build(MyModel, my_field_a="foo", my_field_b=123)
+ ```
+ """
+ if args:
+ raise TypeError(
+ "Received positional arguments which are not supported; Keyword arguments must be used instead",
+ )
+
+ return cast(_BaseModelT, construct_type(type_=base_model_cls, value=kwargs))
+
+
+def construct_type_unchecked(*, value: object, type_: type[_T]) -> _T:
+ """Loose coercion to the expected type with construction of nested values.
+
+ Note: the returned value from this function is not guaranteed to match the
+ given type.
+ """
+ return cast(_T, construct_type(value=value, type_=type_))
+
+
+def construct_type(*, value: object, type_: object) -> object:
+ """Loose coercion to the expected type with construction of nested values.
+
+ If the given value does not match the expected type then it is returned as-is.
+ """
+
+ # store a reference to the original type we were given before we extract any inner
+ # types so that we can properly resolve forward references in `TypeAliasType` annotations
+ original_type = None
+
+ # we allow `object` as the input type because otherwise, passing things like
+ # `Literal['value']` will be reported as a type error by type checkers
+ type_ = cast("type[object]", type_)
+ if is_type_alias_type(type_):
+ original_type = type_ # type: ignore[unreachable]
+ type_ = type_.__value__ # type: ignore[unreachable]
+
+ # unwrap `Annotated[T, ...]` -> `T`
+ if is_annotated_type(type_):
+ meta: tuple[Any, ...] = get_args(type_)[1:]
+ type_ = extract_type_arg(type_, 0)
+ else:
+ meta = tuple()
+
+ # we need to use the origin class for any types that are subscripted generics
+ # e.g. Dict[str, object]
+ origin = get_origin(type_) or type_
+ args = get_args(type_)
+
+ if is_union(origin):
+ try:
+ return validate_type(type_=cast("type[object]", original_type or type_), value=value)
+ except Exception:
+ pass
+
+ # if the type is a discriminated union then we want to construct the right variant
+ # in the union, even if the data doesn't match exactly, otherwise we'd break code
+ # that relies on the constructed class types, e.g.
+ #
+ # class FooType:
+ # kind: Literal['foo']
+ # value: str
+ #
+ # class BarType:
+ # kind: Literal['bar']
+ # value: int
+ #
+ # without this block, if the data we get is something like `{'kind': 'bar', 'value': 'foo'}` then
+ # we'd end up constructing `FooType` when it should be `BarType`.
+ discriminator = _build_discriminated_union_meta(union=type_, meta_annotations=meta)
+ if discriminator and is_mapping(value):
+ variant_value = value.get(discriminator.field_alias_from or discriminator.field_name)
+ if variant_value and isinstance(variant_value, str):
+ variant_type = discriminator.mapping.get(variant_value)
+ if variant_type:
+ return construct_type(type_=variant_type, value=value)
+
+ # if the data is not valid, use the first variant that doesn't fail while deserializing
+ for variant in args:
+ try:
+ return construct_type(value=value, type_=variant)
+ except Exception:
+ continue
+
+ raise RuntimeError(f"Could not convert data into a valid instance of {type_}")
+
+ if origin == dict:
+ if not is_mapping(value):
+ return value
+
+ _, items_type = get_args(type_) # Dict[_, items_type]
+ return {key: construct_type(value=item, type_=items_type) for key, item in value.items()}
+
+ if (
+ not is_literal_type(type_)
+ and inspect.isclass(origin)
+ and (issubclass(origin, BaseModel) or issubclass(origin, GenericModel))
+ ):
+ if is_list(value):
+ return [cast(Any, type_).construct(**entry) if is_mapping(entry) else entry for entry in value]
+
+ if is_mapping(value):
+ if issubclass(type_, BaseModel):
+ return type_.construct(**value) # type: ignore[arg-type]
+
+ return cast(Any, type_).construct(**value)
+
+ if origin == list:
+ if not is_list(value):
+ return value
+
+ inner_type = args[0] # List[inner_type]
+ return [construct_type(value=entry, type_=inner_type) for entry in value]
+
+ if origin == float:
+ if isinstance(value, int):
+ coerced = float(value)
+ if coerced != value:
+ return value
+ return coerced
+
+ return value
+
+ if type_ == datetime:
+ try:
+ return parse_datetime(value) # type: ignore
+ except Exception:
+ return value
+
+ if type_ == date:
+ try:
+ return parse_date(value) # type: ignore
+ except Exception:
+ return value
+
+ return value
+
+
+@runtime_checkable
+class CachedDiscriminatorType(Protocol):
+ __discriminator__: DiscriminatorDetails
+
+
+class DiscriminatorDetails:
+ field_name: str
+ """The name of the discriminator field in the variant class, e.g.
+
+ ```py
+ class Foo(BaseModel):
+ type: Literal['foo']
+ ```
+
+ Will result in field_name='type'
+ """
+
+ field_alias_from: str | None
+ """The name of the discriminator field in the API response, e.g.
+
+ ```py
+ class Foo(BaseModel):
+ type: Literal['foo'] = Field(alias='type_from_api')
+ ```
+
+ Will result in field_alias_from='type_from_api'
+ """
+
+ mapping: dict[str, type]
+ """Mapping of discriminator value to variant type, e.g.
+
+ {'foo': FooVariant, 'bar': BarVariant}
+ """
+
+ def __init__(
+ self,
+ *,
+ mapping: dict[str, type],
+ discriminator_field: str,
+ discriminator_alias: str | None,
+ ) -> None:
+ self.mapping = mapping
+ self.field_name = discriminator_field
+ self.field_alias_from = discriminator_alias
+
+
+def _build_discriminated_union_meta(*, union: type, meta_annotations: tuple[Any, ...]) -> DiscriminatorDetails | None:
+ if isinstance(union, CachedDiscriminatorType):
+ return union.__discriminator__
+
+ discriminator_field_name: str | None = None
+
+ for annotation in meta_annotations:
+ if isinstance(annotation, PropertyInfo) and annotation.discriminator is not None:
+ discriminator_field_name = annotation.discriminator
+ break
+
+ if not discriminator_field_name:
+ return None
+
+ mapping: dict[str, type] = {}
+ discriminator_alias: str | None = None
+
+ for variant in get_args(union):
+ variant = strip_annotated_type(variant)
+ if is_basemodel_type(variant):
+ if PYDANTIC_V2:
+ field = _extract_field_schema_pv2(variant, discriminator_field_name)
+ if not field:
+ continue
+
+ # Note: if one variant defines an alias then they all should
+ discriminator_alias = field.get("serialization_alias")
+
+ field_schema = field["schema"]
+
+ if field_schema["type"] == "literal":
+ for entry in cast("LiteralSchema", field_schema)["expected"]:
+ if isinstance(entry, str):
+ mapping[entry] = variant
+ else:
+ field_info = cast("dict[str, FieldInfo]", variant.__fields__).get(discriminator_field_name) # pyright: ignore[reportDeprecated, reportUnnecessaryCast]
+ if not field_info:
+ continue
+
+ # Note: if one variant defines an alias then they all should
+ discriminator_alias = field_info.alias
+
+ if field_info.annotation and is_literal_type(field_info.annotation):
+ for entry in get_args(field_info.annotation):
+ if isinstance(entry, str):
+ mapping[entry] = variant
+
+ if not mapping:
+ return None
+
+ details = DiscriminatorDetails(
+ mapping=mapping,
+ discriminator_field=discriminator_field_name,
+ discriminator_alias=discriminator_alias,
+ )
+ cast(CachedDiscriminatorType, union).__discriminator__ = details
+ return details
+
+
+def _extract_field_schema_pv2(model: type[BaseModel], field_name: str) -> ModelField | None:
+ schema = model.__pydantic_core_schema__
+ if schema["type"] != "model":
+ return None
+
+ fields_schema = schema["schema"]
+ if fields_schema["type"] != "model-fields":
+ return None
+
+ fields_schema = cast("ModelFieldsSchema", fields_schema)
+
+ field = fields_schema["fields"].get(field_name)
+ if not field:
+ return None
+
+ return cast("ModelField", field) # pyright: ignore[reportUnnecessaryCast]
+
+
+def validate_type(*, type_: type[_T], value: object) -> _T:
+ """Strict validation that the given value matches the expected type"""
+ if inspect.isclass(type_) and issubclass(type_, pydantic.BaseModel):
+ return cast(_T, parse_obj(type_, value))
+
+ return cast(_T, _validate_non_model_type(type_=type_, value=value))
+
+
+def set_pydantic_config(typ: Any, config: pydantic.ConfigDict) -> None:
+ """Add a pydantic config for the given type.
+
+ Note: this is a no-op on Pydantic v1.
+ """
+ setattr(typ, "__pydantic_config__", config) # noqa: B010
+
+
+def add_request_id(obj: BaseModel, request_id: str | None) -> None:
+ obj._request_id = request_id
+
+ # in Pydantic v1, using setattr like we do above causes the attribute
+ # to be included when serializing the model which we don't want in this
+ # case so we need to explicitly exclude it
+ if not PYDANTIC_V2:
+ try:
+ exclude_fields = obj.__exclude_fields__ # type: ignore
+ except AttributeError:
+ cast(Any, obj).__exclude_fields__ = {"_request_id", "__exclude_fields__"}
+ else:
+ cast(Any, obj).__exclude_fields__ = {*(exclude_fields or {}), "_request_id", "__exclude_fields__"}
+
+
+# our use of subclasssing here causes weirdness for type checkers,
+# so we just pretend that we don't subclass
+if TYPE_CHECKING:
+ GenericModel = BaseModel
+else:
+
+ class GenericModel(BaseGenericModel, BaseModel):
+ pass
+
+
+if PYDANTIC_V2:
+ from pydantic import TypeAdapter as _TypeAdapter
+
+ _CachedTypeAdapter = cast("TypeAdapter[object]", lru_cache(maxsize=None)(_TypeAdapter))
+
+ if TYPE_CHECKING:
+ from pydantic import TypeAdapter
+ else:
+ TypeAdapter = _CachedTypeAdapter
+
+ def _validate_non_model_type(*, type_: type[_T], value: object) -> _T:
+ return TypeAdapter(type_).validate_python(value)
+
+elif not TYPE_CHECKING: # TODO: condition is weird
+
+ class RootModel(GenericModel, Generic[_T]):
+ """Used as a placeholder to easily convert runtime types to a Pydantic format
+ to provide validation.
+
+ For example:
+ ```py
+ validated = RootModel[int](__root__="5").__root__
+ # validated: 5
+ ```
+ """
+
+ __root__: _T
+
+ def _validate_non_model_type(*, type_: type[_T], value: object) -> _T:
+ model = _create_pydantic_model(type_).validate(value)
+ return cast(_T, model.__root__)
+
+ def _create_pydantic_model(type_: _T) -> Type[RootModel[_T]]:
+ return RootModel[type_] # type: ignore
+
+
+class FinalRequestOptionsInput(TypedDict, total=False):
+ method: Required[str]
+ url: Required[str]
+ params: Query
+ headers: Headers
+ max_retries: int
+ timeout: float | Timeout | None
+ files: HttpxRequestFiles | None
+ idempotency_key: str
+ json_data: Body
+ extra_json: AnyMapping
+
+
+@final
+class FinalRequestOptions(pydantic.BaseModel):
+ method: str
+ url: str
+ params: Query = {}
+ headers: Union[Headers, NotGiven] = NotGiven()
+ max_retries: Union[int, NotGiven] = NotGiven()
+ timeout: Union[float, Timeout, None, NotGiven] = NotGiven()
+ files: Union[HttpxRequestFiles, None] = None
+ idempotency_key: Union[str, None] = None
+ post_parser: Union[Callable[[Any], Any], NotGiven] = NotGiven()
+
+ # It should be noted that we cannot use `json` here as that would override
+ # a BaseModel method in an incompatible fashion.
+ json_data: Union[Body, None] = None
+ extra_json: Union[AnyMapping, None] = None
+
+ if PYDANTIC_V2:
+ model_config: ClassVar[ConfigDict] = ConfigDict(arbitrary_types_allowed=True)
+ else:
+
+ class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated]
+ arbitrary_types_allowed: bool = True
+
+ def get_max_retries(self, max_retries: int) -> int:
+ if isinstance(self.max_retries, NotGiven):
+ return max_retries
+ return self.max_retries
+
+ def _strip_raw_response_header(self) -> None:
+ if not is_given(self.headers):
+ return
+
+ if self.headers.get(RAW_RESPONSE_HEADER):
+ self.headers = {**self.headers}
+ self.headers.pop(RAW_RESPONSE_HEADER)
+
+ # override the `construct` method so that we can run custom transformations.
+ # this is necessary as we don't want to do any actual runtime type checking
+ # (which means we can't use validators) but we do want to ensure that `NotGiven`
+ # values are not present
+ #
+ # type ignore required because we're adding explicit types to `**values`
+ @classmethod
+ def construct( # type: ignore
+ cls,
+ _fields_set: set[str] | None = None,
+ **values: Unpack[FinalRequestOptionsInput],
+ ) -> FinalRequestOptions:
+ kwargs: dict[str, Any] = {
+ # we unconditionally call `strip_not_given` on any value
+ # as it will just ignore any non-mapping types
+ key: strip_not_given(value)
+ for key, value in values.items()
+ }
+ if PYDANTIC_V2:
+ return super().model_construct(_fields_set, **kwargs)
+ return cast(FinalRequestOptions, super().construct(_fields_set, **kwargs)) # pyright: ignore[reportDeprecated]
+
+ if not TYPE_CHECKING:
+ # type checkers incorrectly complain about this assignment
+ model_construct = construct
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_qs.py b/.venv/lib/python3.12/site-packages/anthropic/_qs.py
new file mode 100644
index 00000000..274320ca
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_qs.py
@@ -0,0 +1,150 @@
+from __future__ import annotations
+
+from typing import Any, List, Tuple, Union, Mapping, TypeVar
+from urllib.parse import parse_qs, urlencode
+from typing_extensions import Literal, get_args
+
+from ._types import NOT_GIVEN, NotGiven, NotGivenOr
+from ._utils import flatten
+
+_T = TypeVar("_T")
+
+
+ArrayFormat = Literal["comma", "repeat", "indices", "brackets"]
+NestedFormat = Literal["dots", "brackets"]
+
+PrimitiveData = Union[str, int, float, bool, None]
+# this should be Data = Union[PrimitiveData, "List[Data]", "Tuple[Data]", "Mapping[str, Data]"]
+# https://github.com/microsoft/pyright/issues/3555
+Data = Union[PrimitiveData, List[Any], Tuple[Any], "Mapping[str, Any]"]
+Params = Mapping[str, Data]
+
+
+class Querystring:
+ array_format: ArrayFormat
+ nested_format: NestedFormat
+
+ def __init__(
+ self,
+ *,
+ array_format: ArrayFormat = "repeat",
+ nested_format: NestedFormat = "brackets",
+ ) -> None:
+ self.array_format = array_format
+ self.nested_format = nested_format
+
+ def parse(self, query: str) -> Mapping[str, object]:
+ # Note: custom format syntax is not supported yet
+ return parse_qs(query)
+
+ def stringify(
+ self,
+ params: Params,
+ *,
+ array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN,
+ nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN,
+ ) -> str:
+ return urlencode(
+ self.stringify_items(
+ params,
+ array_format=array_format,
+ nested_format=nested_format,
+ )
+ )
+
+ def stringify_items(
+ self,
+ params: Params,
+ *,
+ array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN,
+ nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN,
+ ) -> list[tuple[str, str]]:
+ opts = Options(
+ qs=self,
+ array_format=array_format,
+ nested_format=nested_format,
+ )
+ return flatten([self._stringify_item(key, value, opts) for key, value in params.items()])
+
+ def _stringify_item(
+ self,
+ key: str,
+ value: Data,
+ opts: Options,
+ ) -> list[tuple[str, str]]:
+ if isinstance(value, Mapping):
+ items: list[tuple[str, str]] = []
+ nested_format = opts.nested_format
+ for subkey, subvalue in value.items():
+ items.extend(
+ self._stringify_item(
+ # TODO: error if unknown format
+ f"{key}.{subkey}" if nested_format == "dots" else f"{key}[{subkey}]",
+ subvalue,
+ opts,
+ )
+ )
+ return items
+
+ if isinstance(value, (list, tuple)):
+ array_format = opts.array_format
+ if array_format == "comma":
+ return [
+ (
+ key,
+ ",".join(self._primitive_value_to_str(item) for item in value if item is not None),
+ ),
+ ]
+ elif array_format == "repeat":
+ items = []
+ for item in value:
+ items.extend(self._stringify_item(key, item, opts))
+ return items
+ elif array_format == "indices":
+ raise NotImplementedError("The array indices format is not supported yet")
+ elif array_format == "brackets":
+ items = []
+ key = key + "[]"
+ for item in value:
+ items.extend(self._stringify_item(key, item, opts))
+ return items
+ else:
+ raise NotImplementedError(
+ f"Unknown array_format value: {array_format}, choose from {', '.join(get_args(ArrayFormat))}"
+ )
+
+ serialised = self._primitive_value_to_str(value)
+ if not serialised:
+ return []
+ return [(key, serialised)]
+
+ def _primitive_value_to_str(self, value: PrimitiveData) -> str:
+ # copied from httpx
+ if value is True:
+ return "true"
+ elif value is False:
+ return "false"
+ elif value is None:
+ return ""
+ return str(value)
+
+
+_qs = Querystring()
+parse = _qs.parse
+stringify = _qs.stringify
+stringify_items = _qs.stringify_items
+
+
+class Options:
+ array_format: ArrayFormat
+ nested_format: NestedFormat
+
+ def __init__(
+ self,
+ qs: Querystring = _qs,
+ *,
+ array_format: NotGivenOr[ArrayFormat] = NOT_GIVEN,
+ nested_format: NotGivenOr[NestedFormat] = NOT_GIVEN,
+ ) -> None:
+ self.array_format = qs.array_format if isinstance(array_format, NotGiven) else array_format
+ self.nested_format = qs.nested_format if isinstance(nested_format, NotGiven) else nested_format
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_resource.py b/.venv/lib/python3.12/site-packages/anthropic/_resource.py
new file mode 100644
index 00000000..f62cc2ba
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_resource.py
@@ -0,0 +1,41 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+import time
+
+import anyio
+
+from ._base_client import SyncAPIClient, AsyncAPIClient
+
+
+class SyncAPIResource:
+ _client: SyncAPIClient
+
+ def __init__(self, client: SyncAPIClient) -> None:
+ self._client = client
+ self._get = client.get
+ self._post = client.post
+ self._patch = client.patch
+ self._put = client.put
+ self._delete = client.delete
+ self._get_api_list = client.get_api_list
+
+ def _sleep(self, seconds: float) -> None:
+ time.sleep(seconds)
+
+
+class AsyncAPIResource:
+ _client: AsyncAPIClient
+
+ def __init__(self, client: AsyncAPIClient) -> None:
+ self._client = client
+ self._get = client.get
+ self._post = client.post
+ self._patch = client.patch
+ self._put = client.put
+ self._delete = client.delete
+ self._get_api_list = client.get_api_list
+
+ async def _sleep(self, seconds: float) -> None:
+ await anyio.sleep(seconds)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_response.py b/.venv/lib/python3.12/site-packages/anthropic/_response.py
new file mode 100644
index 00000000..64a3f158
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_response.py
@@ -0,0 +1,872 @@
+from __future__ import annotations
+
+import os
+import inspect
+import logging
+import datetime
+import functools
+from types import TracebackType
+from typing import (
+ TYPE_CHECKING,
+ Any,
+ Union,
+ Generic,
+ TypeVar,
+ Callable,
+ Iterator,
+ AsyncIterator,
+ cast,
+ overload,
+)
+from typing_extensions import Awaitable, ParamSpec, override, get_origin
+
+import anyio
+import httpx
+import pydantic
+
+from ._types import NoneType
+from ._utils import is_given, extract_type_arg, is_annotated_type, is_type_alias_type, extract_type_var_from_base
+from ._models import BaseModel, is_basemodel, add_request_id
+from ._constants import RAW_RESPONSE_HEADER, OVERRIDE_CAST_TO_HEADER
+from ._streaming import Stream, AsyncStream, is_stream_class_type, extract_stream_chunk_type
+from ._exceptions import AnthropicError, APIResponseValidationError
+from ._decoders.jsonl import JSONLDecoder, AsyncJSONLDecoder
+
+if TYPE_CHECKING:
+ from ._models import FinalRequestOptions
+ from ._base_client import BaseClient
+
+
+P = ParamSpec("P")
+R = TypeVar("R")
+_T = TypeVar("_T")
+_APIResponseT = TypeVar("_APIResponseT", bound="APIResponse[Any]")
+_AsyncAPIResponseT = TypeVar("_AsyncAPIResponseT", bound="AsyncAPIResponse[Any]")
+
+log: logging.Logger = logging.getLogger(__name__)
+
+
+class BaseAPIResponse(Generic[R]):
+ _cast_to: type[R]
+ _client: BaseClient[Any, Any]
+ _parsed_by_type: dict[type[Any], Any]
+ _is_sse_stream: bool
+ _stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None
+ _options: FinalRequestOptions
+
+ http_response: httpx.Response
+
+ retries_taken: int
+ """The number of retries made. If no retries happened this will be `0`"""
+
+ def __init__(
+ self,
+ *,
+ raw: httpx.Response,
+ cast_to: type[R],
+ client: BaseClient[Any, Any],
+ stream: bool,
+ stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None,
+ options: FinalRequestOptions,
+ retries_taken: int = 0,
+ ) -> None:
+ self._cast_to = cast_to
+ self._client = client
+ self._parsed_by_type = {}
+ self._is_sse_stream = stream
+ self._stream_cls = stream_cls
+ self._options = options
+ self.http_response = raw
+ self.retries_taken = retries_taken
+
+ @property
+ def headers(self) -> httpx.Headers:
+ return self.http_response.headers
+
+ @property
+ def http_request(self) -> httpx.Request:
+ """Returns the httpx Request instance associated with the current response."""
+ return self.http_response.request
+
+ @property
+ def status_code(self) -> int:
+ return self.http_response.status_code
+
+ @property
+ def url(self) -> httpx.URL:
+ """Returns the URL for which the request was made."""
+ return self.http_response.url
+
+ @property
+ def method(self) -> str:
+ return self.http_request.method
+
+ @property
+ def http_version(self) -> str:
+ return self.http_response.http_version
+
+ @property
+ def elapsed(self) -> datetime.timedelta:
+ """The time taken for the complete request/response cycle to complete."""
+ return self.http_response.elapsed
+
+ @property
+ def is_closed(self) -> bool:
+ """Whether or not the response body has been closed.
+
+ If this is False then there is response data that has not been read yet.
+ You must either fully consume the response body or call `.close()`
+ before discarding the response to prevent resource leaks.
+ """
+ return self.http_response.is_closed
+
+ @override
+ def __repr__(self) -> str:
+ return (
+ f"<{self.__class__.__name__} [{self.status_code} {self.http_response.reason_phrase}] type={self._cast_to}>"
+ )
+
+ def _parse(self, *, to: type[_T] | None = None) -> R | _T:
+ cast_to = to if to is not None else self._cast_to
+
+ # unwrap `TypeAlias('Name', T)` -> `T`
+ if is_type_alias_type(cast_to):
+ cast_to = cast_to.__value__ # type: ignore[unreachable]
+
+ # unwrap `Annotated[T, ...]` -> `T`
+ if cast_to and is_annotated_type(cast_to):
+ cast_to = extract_type_arg(cast_to, 0)
+
+ origin = get_origin(cast_to) or cast_to
+
+ if inspect.isclass(origin):
+ if issubclass(cast(Any, origin), JSONLDecoder):
+ return cast(
+ R,
+ cast("type[JSONLDecoder[Any]]", cast_to)(
+ raw_iterator=self.http_response.iter_bytes(chunk_size=64),
+ line_type=extract_type_arg(cast_to, 0),
+ http_response=self.http_response,
+ ),
+ )
+
+ if issubclass(cast(Any, origin), AsyncJSONLDecoder):
+ return cast(
+ R,
+ cast("type[AsyncJSONLDecoder[Any]]", cast_to)(
+ raw_iterator=self.http_response.aiter_bytes(chunk_size=64),
+ line_type=extract_type_arg(cast_to, 0),
+ http_response=self.http_response,
+ ),
+ )
+
+ if self._is_sse_stream:
+ if to:
+ if not is_stream_class_type(to):
+ raise TypeError(f"Expected custom parse type to be a subclass of {Stream} or {AsyncStream}")
+
+ return cast(
+ _T,
+ to(
+ cast_to=extract_stream_chunk_type(
+ to,
+ failure_message="Expected custom stream type to be passed with a type argument, e.g. Stream[ChunkType]",
+ ),
+ response=self.http_response,
+ client=cast(Any, self._client),
+ ),
+ )
+
+ if self._stream_cls:
+ return cast(
+ R,
+ self._stream_cls(
+ cast_to=extract_stream_chunk_type(self._stream_cls),
+ response=self.http_response,
+ client=cast(Any, self._client),
+ ),
+ )
+
+ stream_cls = cast("type[Stream[Any]] | type[AsyncStream[Any]] | None", self._client._default_stream_cls)
+ if stream_cls is None:
+ raise MissingStreamClassError()
+
+ return cast(
+ R,
+ stream_cls(
+ cast_to=cast_to,
+ response=self.http_response,
+ client=cast(Any, self._client),
+ ),
+ )
+
+ if cast_to is NoneType:
+ return cast(R, None)
+
+ response = self.http_response
+ if cast_to == str:
+ return cast(R, response.text)
+
+ if cast_to == bytes:
+ return cast(R, response.content)
+
+ if cast_to == int:
+ return cast(R, int(response.text))
+
+ if cast_to == float:
+ return cast(R, float(response.text))
+
+ if cast_to == bool:
+ return cast(R, response.text.lower() == "true")
+
+ # handle the legacy binary response case
+ if inspect.isclass(cast_to) and cast_to.__name__ == "HttpxBinaryResponseContent":
+ return cast(R, cast_to(response)) # type: ignore
+
+ if origin == APIResponse:
+ raise RuntimeError("Unexpected state - cast_to is `APIResponse`")
+
+ if inspect.isclass(
+ origin # pyright: ignore[reportUnknownArgumentType]
+ ) and issubclass(origin, httpx.Response):
+ # Because of the invariance of our ResponseT TypeVar, users can subclass httpx.Response
+ # and pass that class to our request functions. We cannot change the variance to be either
+ # covariant or contravariant as that makes our usage of ResponseT illegal. We could construct
+ # the response class ourselves but that is something that should be supported directly in httpx
+ # as it would be easy to incorrectly construct the Response object due to the multitude of arguments.
+ if cast_to != httpx.Response:
+ raise ValueError(f"Subclasses of httpx.Response cannot be passed to `cast_to`")
+ return cast(R, response)
+
+ if (
+ inspect.isclass(
+ origin # pyright: ignore[reportUnknownArgumentType]
+ )
+ and not issubclass(origin, BaseModel)
+ and issubclass(origin, pydantic.BaseModel)
+ ):
+ raise TypeError("Pydantic models must subclass our base model type, e.g. `from anthropic import BaseModel`")
+
+ if (
+ cast_to is not object
+ and not origin is list
+ and not origin is dict
+ and not origin is Union
+ and not issubclass(origin, BaseModel)
+ ):
+ raise RuntimeError(
+ f"Unsupported type, expected {cast_to} to be a subclass of {BaseModel}, {dict}, {list}, {Union}, {NoneType}, {str} or {httpx.Response}."
+ )
+
+ # split is required to handle cases where additional information is included
+ # in the response, e.g. application/json; charset=utf-8
+ content_type, *_ = response.headers.get("content-type", "*").split(";")
+ if content_type != "application/json":
+ if is_basemodel(cast_to):
+ try:
+ data = response.json()
+ except Exception as exc:
+ log.debug("Could not read JSON from response data due to %s - %s", type(exc), exc)
+ else:
+ return self._client._process_response_data(
+ data=data,
+ cast_to=cast_to, # type: ignore
+ response=response,
+ )
+
+ if self._client._strict_response_validation:
+ raise APIResponseValidationError(
+ response=response,
+ message=f"Expected Content-Type response header to be `application/json` but received `{content_type}` instead.",
+ body=response.text,
+ )
+
+ # If the API responds with content that isn't JSON then we just return
+ # the (decoded) text without performing any parsing so that you can still
+ # handle the response however you need to.
+ return response.text # type: ignore
+
+ data = response.json()
+
+ return self._client._process_response_data(
+ data=data,
+ cast_to=cast_to, # type: ignore
+ response=response,
+ )
+
+
+class APIResponse(BaseAPIResponse[R]):
+ @property
+ def request_id(self) -> str | None:
+ return self.http_response.headers.get("request-id") # type: ignore[no-any-return]
+
+ @overload
+ def parse(self, *, to: type[_T]) -> _T: ...
+
+ @overload
+ def parse(self) -> R: ...
+
+ def parse(self, *, to: type[_T] | None = None) -> R | _T:
+ """Returns the rich python representation of this response's data.
+
+ For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`.
+
+ You can customise the type that the response is parsed into through
+ the `to` argument, e.g.
+
+ ```py
+ from anthropic import BaseModel
+
+
+ class MyModel(BaseModel):
+ foo: str
+
+
+ obj = response.parse(to=MyModel)
+ print(obj.foo)
+ ```
+
+ We support parsing:
+ - `BaseModel`
+ - `dict`
+ - `list`
+ - `Union`
+ - `str`
+ - `int`
+ - `float`
+ - `httpx.Response`
+ """
+ cache_key = to if to is not None else self._cast_to
+ cached = self._parsed_by_type.get(cache_key)
+ if cached is not None:
+ return cached # type: ignore[no-any-return]
+
+ if not self._is_sse_stream:
+ self.read()
+
+ parsed = self._parse(to=to)
+ if is_given(self._options.post_parser):
+ parsed = self._options.post_parser(parsed)
+
+ if isinstance(parsed, BaseModel):
+ add_request_id(parsed, self.request_id)
+
+ self._parsed_by_type[cache_key] = parsed
+ return cast(R, parsed)
+
+ def read(self) -> bytes:
+ """Read and return the binary response content."""
+ try:
+ return self.http_response.read()
+ except httpx.StreamConsumed as exc:
+ # The default error raised by httpx isn't very
+ # helpful in our case so we re-raise it with
+ # a different error message.
+ raise StreamAlreadyConsumed() from exc
+
+ def text(self) -> str:
+ """Read and decode the response content into a string."""
+ self.read()
+ return self.http_response.text
+
+ def json(self) -> object:
+ """Read and decode the JSON response content."""
+ self.read()
+ return self.http_response.json()
+
+ def close(self) -> None:
+ """Close the response and release the connection.
+
+ Automatically called if the response body is read to completion.
+ """
+ self.http_response.close()
+
+ def iter_bytes(self, chunk_size: int | None = None) -> Iterator[bytes]:
+ """
+ A byte-iterator over the decoded response content.
+
+ This automatically handles gzip, deflate and brotli encoded responses.
+ """
+ for chunk in self.http_response.iter_bytes(chunk_size):
+ yield chunk
+
+ def iter_text(self, chunk_size: int | None = None) -> Iterator[str]:
+ """A str-iterator over the decoded response content
+ that handles both gzip, deflate, etc but also detects the content's
+ string encoding.
+ """
+ for chunk in self.http_response.iter_text(chunk_size):
+ yield chunk
+
+ def iter_lines(self) -> Iterator[str]:
+ """Like `iter_text()` but will only yield chunks for each line"""
+ for chunk in self.http_response.iter_lines():
+ yield chunk
+
+
+class AsyncAPIResponse(BaseAPIResponse[R]):
+ @property
+ def request_id(self) -> str | None:
+ return self.http_response.headers.get("request-id") # type: ignore[no-any-return]
+
+ @overload
+ async def parse(self, *, to: type[_T]) -> _T: ...
+
+ @overload
+ async def parse(self) -> R: ...
+
+ async def parse(self, *, to: type[_T] | None = None) -> R | _T:
+ """Returns the rich python representation of this response's data.
+
+ For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`.
+
+ You can customise the type that the response is parsed into through
+ the `to` argument, e.g.
+
+ ```py
+ from anthropic import BaseModel
+
+
+ class MyModel(BaseModel):
+ foo: str
+
+
+ obj = response.parse(to=MyModel)
+ print(obj.foo)
+ ```
+
+ We support parsing:
+ - `BaseModel`
+ - `dict`
+ - `list`
+ - `Union`
+ - `str`
+ - `httpx.Response`
+ """
+ cache_key = to if to is not None else self._cast_to
+ cached = self._parsed_by_type.get(cache_key)
+ if cached is not None:
+ return cached # type: ignore[no-any-return]
+
+ if not self._is_sse_stream:
+ await self.read()
+
+ parsed = self._parse(to=to)
+ if is_given(self._options.post_parser):
+ parsed = self._options.post_parser(parsed)
+
+ if isinstance(parsed, BaseModel):
+ add_request_id(parsed, self.request_id)
+
+ self._parsed_by_type[cache_key] = parsed
+ return cast(R, parsed)
+
+ async def read(self) -> bytes:
+ """Read and return the binary response content."""
+ try:
+ return await self.http_response.aread()
+ except httpx.StreamConsumed as exc:
+ # the default error raised by httpx isn't very
+ # helpful in our case so we re-raise it with
+ # a different error message
+ raise StreamAlreadyConsumed() from exc
+
+ async def text(self) -> str:
+ """Read and decode the response content into a string."""
+ await self.read()
+ return self.http_response.text
+
+ async def json(self) -> object:
+ """Read and decode the JSON response content."""
+ await self.read()
+ return self.http_response.json()
+
+ async def close(self) -> None:
+ """Close the response and release the connection.
+
+ Automatically called if the response body is read to completion.
+ """
+ await self.http_response.aclose()
+
+ async def iter_bytes(self, chunk_size: int | None = None) -> AsyncIterator[bytes]:
+ """
+ A byte-iterator over the decoded response content.
+
+ This automatically handles gzip, deflate and brotli encoded responses.
+ """
+ async for chunk in self.http_response.aiter_bytes(chunk_size):
+ yield chunk
+
+ async def iter_text(self, chunk_size: int | None = None) -> AsyncIterator[str]:
+ """A str-iterator over the decoded response content
+ that handles both gzip, deflate, etc but also detects the content's
+ string encoding.
+ """
+ async for chunk in self.http_response.aiter_text(chunk_size):
+ yield chunk
+
+ async def iter_lines(self) -> AsyncIterator[str]:
+ """Like `iter_text()` but will only yield chunks for each line"""
+ async for chunk in self.http_response.aiter_lines():
+ yield chunk
+
+
+class BinaryAPIResponse(APIResponse[bytes]):
+ """Subclass of APIResponse providing helpers for dealing with binary data.
+
+ Note: If you want to stream the response data instead of eagerly reading it
+ all at once then you should use `.with_streaming_response` when making
+ the API request, e.g. `.with_streaming_response.get_binary_response()`
+ """
+
+ def write_to_file(
+ self,
+ file: str | os.PathLike[str],
+ ) -> None:
+ """Write the output to the given file.
+
+ Accepts a filename or any path-like object, e.g. pathlib.Path
+
+ Note: if you want to stream the data to the file instead of writing
+ all at once then you should use `.with_streaming_response` when making
+ the API request, e.g. `.with_streaming_response.get_binary_response()`
+ """
+ with open(file, mode="wb") as f:
+ for data in self.iter_bytes():
+ f.write(data)
+
+
+class AsyncBinaryAPIResponse(AsyncAPIResponse[bytes]):
+ """Subclass of APIResponse providing helpers for dealing with binary data.
+
+ Note: If you want to stream the response data instead of eagerly reading it
+ all at once then you should use `.with_streaming_response` when making
+ the API request, e.g. `.with_streaming_response.get_binary_response()`
+ """
+
+ async def write_to_file(
+ self,
+ file: str | os.PathLike[str],
+ ) -> None:
+ """Write the output to the given file.
+
+ Accepts a filename or any path-like object, e.g. pathlib.Path
+
+ Note: if you want to stream the data to the file instead of writing
+ all at once then you should use `.with_streaming_response` when making
+ the API request, e.g. `.with_streaming_response.get_binary_response()`
+ """
+ path = anyio.Path(file)
+ async with await path.open(mode="wb") as f:
+ async for data in self.iter_bytes():
+ await f.write(data)
+
+
+class StreamedBinaryAPIResponse(APIResponse[bytes]):
+ def stream_to_file(
+ self,
+ file: str | os.PathLike[str],
+ *,
+ chunk_size: int | None = None,
+ ) -> None:
+ """Streams the output to the given file.
+
+ Accepts a filename or any path-like object, e.g. pathlib.Path
+ """
+ with open(file, mode="wb") as f:
+ for data in self.iter_bytes(chunk_size):
+ f.write(data)
+
+
+class AsyncStreamedBinaryAPIResponse(AsyncAPIResponse[bytes]):
+ async def stream_to_file(
+ self,
+ file: str | os.PathLike[str],
+ *,
+ chunk_size: int | None = None,
+ ) -> None:
+ """Streams the output to the given file.
+
+ Accepts a filename or any path-like object, e.g. pathlib.Path
+ """
+ path = anyio.Path(file)
+ async with await path.open(mode="wb") as f:
+ async for data in self.iter_bytes(chunk_size):
+ await f.write(data)
+
+
+class MissingStreamClassError(TypeError):
+ def __init__(self) -> None:
+ super().__init__(
+ "The `stream` argument was set to `True` but the `stream_cls` argument was not given. See `anthropic._streaming` for reference",
+ )
+
+
+class StreamAlreadyConsumed(AnthropicError):
+ """
+ Attempted to read or stream content, but the content has already
+ been streamed.
+
+ This can happen if you use a method like `.iter_lines()` and then attempt
+ to read th entire response body afterwards, e.g.
+
+ ```py
+ response = await client.post(...)
+ async for line in response.iter_lines():
+ ... # do something with `line`
+
+ content = await response.read()
+ # ^ error
+ ```
+
+ If you want this behaviour you'll need to either manually accumulate the response
+ content or call `await response.read()` before iterating over the stream.
+ """
+
+ def __init__(self) -> None:
+ message = (
+ "Attempted to read or stream some content, but the content has "
+ "already been streamed. "
+ "This could be due to attempting to stream the response "
+ "content more than once."
+ "\n\n"
+ "You can fix this by manually accumulating the response content while streaming "
+ "or by calling `.read()` before starting to stream."
+ )
+ super().__init__(message)
+
+
+class ResponseContextManager(Generic[_APIResponseT]):
+ """Context manager for ensuring that a request is not made
+ until it is entered and that the response will always be closed
+ when the context manager exits
+ """
+
+ def __init__(self, request_func: Callable[[], _APIResponseT]) -> None:
+ self._request_func = request_func
+ self.__response: _APIResponseT | None = None
+
+ def __enter__(self) -> _APIResponseT:
+ self.__response = self._request_func()
+ return self.__response
+
+ def __exit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ if self.__response is not None:
+ self.__response.close()
+
+
+class AsyncResponseContextManager(Generic[_AsyncAPIResponseT]):
+ """Context manager for ensuring that a request is not made
+ until it is entered and that the response will always be closed
+ when the context manager exits
+ """
+
+ def __init__(self, api_request: Awaitable[_AsyncAPIResponseT]) -> None:
+ self._api_request = api_request
+ self.__response: _AsyncAPIResponseT | None = None
+
+ async def __aenter__(self) -> _AsyncAPIResponseT:
+ self.__response = await self._api_request
+ return self.__response
+
+ async def __aexit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ if self.__response is not None:
+ await self.__response.close()
+
+
+def to_streamed_response_wrapper(func: Callable[P, R]) -> Callable[P, ResponseContextManager[APIResponse[R]]]:
+ """Higher order function that takes one of our bound API methods and wraps it
+ to support streaming and returning the raw `APIResponse` object directly.
+ """
+
+ @functools.wraps(func)
+ def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[APIResponse[R]]:
+ extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "stream"
+
+ kwargs["extra_headers"] = extra_headers
+
+ make_request = functools.partial(func, *args, **kwargs)
+
+ return ResponseContextManager(cast(Callable[[], APIResponse[R]], make_request))
+
+ return wrapped
+
+
+def async_to_streamed_response_wrapper(
+ func: Callable[P, Awaitable[R]],
+) -> Callable[P, AsyncResponseContextManager[AsyncAPIResponse[R]]]:
+ """Higher order function that takes one of our bound API methods and wraps it
+ to support streaming and returning the raw `APIResponse` object directly.
+ """
+
+ @functools.wraps(func)
+ def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[AsyncAPIResponse[R]]:
+ extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "stream"
+
+ kwargs["extra_headers"] = extra_headers
+
+ make_request = func(*args, **kwargs)
+
+ return AsyncResponseContextManager(cast(Awaitable[AsyncAPIResponse[R]], make_request))
+
+ return wrapped
+
+
+def to_custom_streamed_response_wrapper(
+ func: Callable[P, object],
+ response_cls: type[_APIResponseT],
+) -> Callable[P, ResponseContextManager[_APIResponseT]]:
+ """Higher order function that takes one of our bound API methods and an `APIResponse` class
+ and wraps the method to support streaming and returning the given response class directly.
+
+ Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])`
+ """
+
+ @functools.wraps(func)
+ def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[_APIResponseT]:
+ extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "stream"
+ extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls
+
+ kwargs["extra_headers"] = extra_headers
+
+ make_request = functools.partial(func, *args, **kwargs)
+
+ return ResponseContextManager(cast(Callable[[], _APIResponseT], make_request))
+
+ return wrapped
+
+
+def async_to_custom_streamed_response_wrapper(
+ func: Callable[P, Awaitable[object]],
+ response_cls: type[_AsyncAPIResponseT],
+) -> Callable[P, AsyncResponseContextManager[_AsyncAPIResponseT]]:
+ """Higher order function that takes one of our bound API methods and an `APIResponse` class
+ and wraps the method to support streaming and returning the given response class directly.
+
+ Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])`
+ """
+
+ @functools.wraps(func)
+ def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[_AsyncAPIResponseT]:
+ extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "stream"
+ extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls
+
+ kwargs["extra_headers"] = extra_headers
+
+ make_request = func(*args, **kwargs)
+
+ return AsyncResponseContextManager(cast(Awaitable[_AsyncAPIResponseT], make_request))
+
+ return wrapped
+
+
+def to_raw_response_wrapper(func: Callable[P, R]) -> Callable[P, APIResponse[R]]:
+ """Higher order function that takes one of our bound API methods and wraps it
+ to support returning the raw `APIResponse` object directly.
+ """
+
+ @functools.wraps(func)
+ def wrapped(*args: P.args, **kwargs: P.kwargs) -> APIResponse[R]:
+ extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "raw"
+
+ kwargs["extra_headers"] = extra_headers
+
+ return cast(APIResponse[R], func(*args, **kwargs))
+
+ return wrapped
+
+
+def async_to_raw_response_wrapper(func: Callable[P, Awaitable[R]]) -> Callable[P, Awaitable[AsyncAPIResponse[R]]]:
+ """Higher order function that takes one of our bound API methods and wraps it
+ to support returning the raw `APIResponse` object directly.
+ """
+
+ @functools.wraps(func)
+ async def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncAPIResponse[R]:
+ extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "raw"
+
+ kwargs["extra_headers"] = extra_headers
+
+ return cast(AsyncAPIResponse[R], await func(*args, **kwargs))
+
+ return wrapped
+
+
+def to_custom_raw_response_wrapper(
+ func: Callable[P, object],
+ response_cls: type[_APIResponseT],
+) -> Callable[P, _APIResponseT]:
+ """Higher order function that takes one of our bound API methods and an `APIResponse` class
+ and wraps the method to support returning the given response class directly.
+
+ Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])`
+ """
+
+ @functools.wraps(func)
+ def wrapped(*args: P.args, **kwargs: P.kwargs) -> _APIResponseT:
+ extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "raw"
+ extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls
+
+ kwargs["extra_headers"] = extra_headers
+
+ return cast(_APIResponseT, func(*args, **kwargs))
+
+ return wrapped
+
+
+def async_to_custom_raw_response_wrapper(
+ func: Callable[P, Awaitable[object]],
+ response_cls: type[_AsyncAPIResponseT],
+) -> Callable[P, Awaitable[_AsyncAPIResponseT]]:
+ """Higher order function that takes one of our bound API methods and an `APIResponse` class
+ and wraps the method to support returning the given response class directly.
+
+ Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])`
+ """
+
+ @functools.wraps(func)
+ def wrapped(*args: P.args, **kwargs: P.kwargs) -> Awaitable[_AsyncAPIResponseT]:
+ extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})}
+ extra_headers[RAW_RESPONSE_HEADER] = "raw"
+ extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls
+
+ kwargs["extra_headers"] = extra_headers
+
+ return cast(Awaitable[_AsyncAPIResponseT], func(*args, **kwargs))
+
+ return wrapped
+
+
+def extract_response_type(typ: type[BaseAPIResponse[Any]]) -> type:
+ """Given a type like `APIResponse[T]`, returns the generic type variable `T`.
+
+ This also handles the case where a concrete subclass is given, e.g.
+ ```py
+ class MyResponse(APIResponse[bytes]):
+ ...
+
+ extract_response_type(MyResponse) -> bytes
+ ```
+ """
+ return extract_type_var_from_base(
+ typ,
+ generic_bases=cast("tuple[type, ...]", (BaseAPIResponse, APIResponse, AsyncAPIResponse)),
+ index=0,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_streaming.py b/.venv/lib/python3.12/site-packages/anthropic/_streaming.py
new file mode 100644
index 00000000..d43e2e6a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_streaming.py
@@ -0,0 +1,443 @@
+# Note: initially copied from https://github.com/florimondmanca/httpx-sse/blob/master/src/httpx_sse/_decoders.py
+from __future__ import annotations
+
+import abc
+import json
+import inspect
+import warnings
+from types import TracebackType
+from typing import TYPE_CHECKING, Any, Generic, TypeVar, Iterator, AsyncIterator, cast
+from typing_extensions import Self, Protocol, TypeGuard, override, get_origin, runtime_checkable
+
+import httpx
+
+from ._utils import is_dict, extract_type_var_from_base
+
+if TYPE_CHECKING:
+ from ._client import Anthropic, AsyncAnthropic
+
+
+_T = TypeVar("_T")
+
+
+class _SyncStreamMeta(abc.ABCMeta):
+ @override
+ def __instancecheck__(self, instance: Any) -> bool:
+ # we override the `isinstance()` check for `Stream`
+ # as a previous version of the `MessageStream` class
+ # inherited from `Stream` & without this workaround,
+ # changing it to not inherit would be a breaking change.
+
+ from .lib.streaming import MessageStream
+
+ if isinstance(instance, MessageStream):
+ warnings.warn(
+ "Using `isinstance()` to check if a `MessageStream` object is an instance of `Stream` is deprecated & will be removed in the next major version",
+ DeprecationWarning,
+ stacklevel=2,
+ )
+ return True
+
+ return False
+
+
+class Stream(Generic[_T], metaclass=_SyncStreamMeta):
+ """Provides the core interface to iterate over a synchronous stream response."""
+
+ response: httpx.Response
+
+ _decoder: SSEBytesDecoder
+
+ def __init__(
+ self,
+ *,
+ cast_to: type[_T],
+ response: httpx.Response,
+ client: Anthropic,
+ ) -> None:
+ self.response = response
+ self._cast_to = cast_to
+ self._client = client
+ self._decoder = client._make_sse_decoder()
+ self._iterator = self.__stream__()
+
+ def __next__(self) -> _T:
+ return self._iterator.__next__()
+
+ def __iter__(self) -> Iterator[_T]:
+ for item in self._iterator:
+ yield item
+
+ def _iter_events(self) -> Iterator[ServerSentEvent]:
+ yield from self._decoder.iter_bytes(self.response.iter_bytes())
+
+ def __stream__(self) -> Iterator[_T]:
+ cast_to = cast(Any, self._cast_to)
+ response = self.response
+ process_data = self._client._process_response_data
+ iterator = self._iter_events()
+
+ for sse in iterator:
+ if sse.event == "completion":
+ yield process_data(data=sse.json(), cast_to=cast_to, response=response)
+
+ if (
+ sse.event == "message_start"
+ or sse.event == "message_delta"
+ or sse.event == "message_stop"
+ or sse.event == "content_block_start"
+ or sse.event == "content_block_delta"
+ or sse.event == "content_block_stop"
+ ):
+ data = sse.json()
+ if is_dict(data) and "type" not in data:
+ data["type"] = sse.event
+
+ yield process_data(data=data, cast_to=cast_to, response=response)
+
+ if sse.event == "ping":
+ continue
+
+ if sse.event == "error":
+ body = sse.data
+
+ try:
+ body = sse.json()
+ err_msg = f"{body}"
+ except Exception:
+ err_msg = sse.data or f"Error code: {response.status_code}"
+
+ raise self._client._make_status_error(
+ err_msg,
+ body=body,
+ response=self.response,
+ )
+
+ # Ensure the entire stream is consumed
+ for _sse in iterator:
+ ...
+
+ def __enter__(self) -> Self:
+ return self
+
+ def __exit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ self.close()
+
+ def close(self) -> None:
+ """
+ Close the response and release the connection.
+
+ Automatically called if the response body is read to completion.
+ """
+ self.response.close()
+
+
+class _AsyncStreamMeta(abc.ABCMeta):
+ @override
+ def __instancecheck__(self, instance: Any) -> bool:
+ # we override the `isinstance()` check for `AsyncStream`
+ # as a previous version of the `AsyncMessageStream` class
+ # inherited from `AsyncStream` & without this workaround,
+ # changing it to not inherit would be a breaking change.
+
+ from .lib.streaming import AsyncMessageStream
+
+ if isinstance(instance, AsyncMessageStream):
+ warnings.warn(
+ "Using `isinstance()` to check if a `AsyncMessageStream` object is an instance of `AsyncStream` is deprecated & will be removed in the next major version",
+ DeprecationWarning,
+ stacklevel=2,
+ )
+ return True
+
+ return False
+
+
+class AsyncStream(Generic[_T], metaclass=_AsyncStreamMeta):
+ """Provides the core interface to iterate over an asynchronous stream response."""
+
+ response: httpx.Response
+
+ _decoder: SSEDecoder | SSEBytesDecoder
+
+ def __init__(
+ self,
+ *,
+ cast_to: type[_T],
+ response: httpx.Response,
+ client: AsyncAnthropic,
+ ) -> None:
+ self.response = response
+ self._cast_to = cast_to
+ self._client = client
+ self._decoder = client._make_sse_decoder()
+ self._iterator = self.__stream__()
+
+ async def __anext__(self) -> _T:
+ return await self._iterator.__anext__()
+
+ async def __aiter__(self) -> AsyncIterator[_T]:
+ async for item in self._iterator:
+ yield item
+
+ async def _iter_events(self) -> AsyncIterator[ServerSentEvent]:
+ async for sse in self._decoder.aiter_bytes(self.response.aiter_bytes()):
+ yield sse
+
+ async def __stream__(self) -> AsyncIterator[_T]:
+ cast_to = cast(Any, self._cast_to)
+ response = self.response
+ process_data = self._client._process_response_data
+ iterator = self._iter_events()
+
+ async for sse in iterator:
+ if sse.event == "completion":
+ yield process_data(data=sse.json(), cast_to=cast_to, response=response)
+
+ if (
+ sse.event == "message_start"
+ or sse.event == "message_delta"
+ or sse.event == "message_stop"
+ or sse.event == "content_block_start"
+ or sse.event == "content_block_delta"
+ or sse.event == "content_block_stop"
+ ):
+ data = sse.json()
+ if is_dict(data) and "type" not in data:
+ data["type"] = sse.event
+
+ yield process_data(data=data, cast_to=cast_to, response=response)
+
+ if sse.event == "ping":
+ continue
+
+ if sse.event == "error":
+ body = sse.data
+
+ try:
+ body = sse.json()
+ err_msg = f"{body}"
+ except Exception:
+ err_msg = sse.data or f"Error code: {response.status_code}"
+
+ raise self._client._make_status_error(
+ err_msg,
+ body=body,
+ response=self.response,
+ )
+
+ # Ensure the entire stream is consumed
+ async for _sse in iterator:
+ ...
+
+ async def __aenter__(self) -> Self:
+ return self
+
+ async def __aexit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ await self.close()
+
+ async def close(self) -> None:
+ """
+ Close the response and release the connection.
+
+ Automatically called if the response body is read to completion.
+ """
+ await self.response.aclose()
+
+
+class ServerSentEvent:
+ def __init__(
+ self,
+ *,
+ event: str | None = None,
+ data: str | None = None,
+ id: str | None = None,
+ retry: int | None = None,
+ ) -> None:
+ if data is None:
+ data = ""
+
+ self._id = id
+ self._data = data
+ self._event = event or None
+ self._retry = retry
+
+ @property
+ def event(self) -> str | None:
+ return self._event
+
+ @property
+ def id(self) -> str | None:
+ return self._id
+
+ @property
+ def retry(self) -> int | None:
+ return self._retry
+
+ @property
+ def data(self) -> str:
+ return self._data
+
+ def json(self) -> Any:
+ return json.loads(self.data)
+
+ @override
+ def __repr__(self) -> str:
+ return f"ServerSentEvent(event={self.event}, data={self.data}, id={self.id}, retry={self.retry})"
+
+
+class SSEDecoder:
+ _data: list[str]
+ _event: str | None
+ _retry: int | None
+ _last_event_id: str | None
+
+ def __init__(self) -> None:
+ self._event = None
+ self._data = []
+ self._last_event_id = None
+ self._retry = None
+
+ def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]:
+ """Given an iterator that yields raw binary data, iterate over it & yield every event encountered"""
+ for chunk in self._iter_chunks(iterator):
+ # Split before decoding so splitlines() only uses \r and \n
+ for raw_line in chunk.splitlines():
+ line = raw_line.decode("utf-8")
+ sse = self.decode(line)
+ if sse:
+ yield sse
+
+ def _iter_chunks(self, iterator: Iterator[bytes]) -> Iterator[bytes]:
+ """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks"""
+ data = b""
+ for chunk in iterator:
+ for line in chunk.splitlines(keepends=True):
+ data += line
+ if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")):
+ yield data
+ data = b""
+ if data:
+ yield data
+
+ async def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]:
+ """Given an iterator that yields raw binary data, iterate over it & yield every event encountered"""
+ async for chunk in self._aiter_chunks(iterator):
+ # Split before decoding so splitlines() only uses \r and \n
+ for raw_line in chunk.splitlines():
+ line = raw_line.decode("utf-8")
+ sse = self.decode(line)
+ if sse:
+ yield sse
+
+ async def _aiter_chunks(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[bytes]:
+ """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks"""
+ data = b""
+ async for chunk in iterator:
+ for line in chunk.splitlines(keepends=True):
+ data += line
+ if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")):
+ yield data
+ data = b""
+ if data:
+ yield data
+
+ def decode(self, line: str) -> ServerSentEvent | None:
+ # See: https://html.spec.whatwg.org/multipage/server-sent-events.html#event-stream-interpretation # noqa: E501
+
+ if not line:
+ if not self._event and not self._data and not self._last_event_id and self._retry is None:
+ return None
+
+ sse = ServerSentEvent(
+ event=self._event,
+ data="\n".join(self._data),
+ id=self._last_event_id,
+ retry=self._retry,
+ )
+
+ # NOTE: as per the SSE spec, do not reset last_event_id.
+ self._event = None
+ self._data = []
+ self._retry = None
+
+ return sse
+
+ if line.startswith(":"):
+ return None
+
+ fieldname, _, value = line.partition(":")
+
+ if value.startswith(" "):
+ value = value[1:]
+
+ if fieldname == "event":
+ self._event = value
+ elif fieldname == "data":
+ self._data.append(value)
+ elif fieldname == "id":
+ if "\0" in value:
+ pass
+ else:
+ self._last_event_id = value
+ elif fieldname == "retry":
+ try:
+ self._retry = int(value)
+ except (TypeError, ValueError):
+ pass
+ else:
+ pass # Field is ignored.
+
+ return None
+
+
+@runtime_checkable
+class SSEBytesDecoder(Protocol):
+ def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]:
+ """Given an iterator that yields raw binary data, iterate over it & yield every event encountered"""
+ ...
+
+ def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]:
+ """Given an async iterator that yields raw binary data, iterate over it & yield every event encountered"""
+ ...
+
+
+def is_stream_class_type(typ: type) -> TypeGuard[type[Stream[object]] | type[AsyncStream[object]]]:
+ """TypeGuard for determining whether or not the given type is a subclass of `Stream` / `AsyncStream`"""
+ origin = get_origin(typ) or typ
+ return inspect.isclass(origin) and issubclass(origin, (Stream, AsyncStream))
+
+
+def extract_stream_chunk_type(
+ stream_cls: type,
+ *,
+ failure_message: str | None = None,
+) -> type:
+ """Given a type like `Stream[T]`, returns the generic type variable `T`.
+
+ This also handles the case where a concrete subclass is given, e.g.
+ ```py
+ class MyStream(Stream[bytes]):
+ ...
+
+ extract_stream_chunk_type(MyStream) -> bytes
+ ```
+ """
+ from ._base_client import Stream, AsyncStream
+
+ return extract_type_var_from_base(
+ stream_cls,
+ index=0,
+ generic_bases=cast("tuple[type, ...]", (Stream, AsyncStream)),
+ failure_message=failure_message,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_types.py b/.venv/lib/python3.12/site-packages/anthropic/_types.py
new file mode 100644
index 00000000..d80c2081
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_types.py
@@ -0,0 +1,219 @@
+from __future__ import annotations
+
+from os import PathLike
+from typing import (
+ IO,
+ TYPE_CHECKING,
+ Any,
+ Dict,
+ List,
+ Type,
+ Tuple,
+ Union,
+ Mapping,
+ TypeVar,
+ Callable,
+ Optional,
+ Sequence,
+)
+from typing_extensions import Set, Literal, Protocol, TypeAlias, TypedDict, override, runtime_checkable
+
+import httpx
+import pydantic
+from httpx import URL, Proxy, Timeout, Response, BaseTransport, AsyncBaseTransport
+
+if TYPE_CHECKING:
+ from ._models import BaseModel
+ from ._response import APIResponse, AsyncAPIResponse
+ from ._legacy_response import HttpxBinaryResponseContent
+
+Transport = BaseTransport
+AsyncTransport = AsyncBaseTransport
+Query = Mapping[str, object]
+Body = object
+AnyMapping = Mapping[str, object]
+ModelT = TypeVar("ModelT", bound=pydantic.BaseModel)
+_T = TypeVar("_T")
+
+
+# Approximates httpx internal ProxiesTypes and RequestFiles types
+# while adding support for `PathLike` instances
+ProxiesDict = Dict["str | URL", Union[None, str, URL, Proxy]]
+ProxiesTypes = Union[str, Proxy, ProxiesDict]
+if TYPE_CHECKING:
+ Base64FileInput = Union[IO[bytes], PathLike[str]]
+ FileContent = Union[IO[bytes], bytes, PathLike[str]]
+else:
+ Base64FileInput = Union[IO[bytes], PathLike]
+ FileContent = Union[IO[bytes], bytes, PathLike] # PathLike is not subscriptable in Python 3.8.
+FileTypes = Union[
+ # file (or bytes)
+ FileContent,
+ # (filename, file (or bytes))
+ Tuple[Optional[str], FileContent],
+ # (filename, file (or bytes), content_type)
+ Tuple[Optional[str], FileContent, Optional[str]],
+ # (filename, file (or bytes), content_type, headers)
+ Tuple[Optional[str], FileContent, Optional[str], Mapping[str, str]],
+]
+RequestFiles = Union[Mapping[str, FileTypes], Sequence[Tuple[str, FileTypes]]]
+
+# duplicate of the above but without our custom file support
+HttpxFileContent = Union[IO[bytes], bytes]
+HttpxFileTypes = Union[
+ # file (or bytes)
+ HttpxFileContent,
+ # (filename, file (or bytes))
+ Tuple[Optional[str], HttpxFileContent],
+ # (filename, file (or bytes), content_type)
+ Tuple[Optional[str], HttpxFileContent, Optional[str]],
+ # (filename, file (or bytes), content_type, headers)
+ Tuple[Optional[str], HttpxFileContent, Optional[str], Mapping[str, str]],
+]
+HttpxRequestFiles = Union[Mapping[str, HttpxFileTypes], Sequence[Tuple[str, HttpxFileTypes]]]
+
+# Workaround to support (cast_to: Type[ResponseT]) -> ResponseT
+# where ResponseT includes `None`. In order to support directly
+# passing `None`, overloads would have to be defined for every
+# method that uses `ResponseT` which would lead to an unacceptable
+# amount of code duplication and make it unreadable. See _base_client.py
+# for example usage.
+#
+# This unfortunately means that you will either have
+# to import this type and pass it explicitly:
+#
+# from anthropic import NoneType
+# client.get('/foo', cast_to=NoneType)
+#
+# or build it yourself:
+#
+# client.get('/foo', cast_to=type(None))
+if TYPE_CHECKING:
+ NoneType: Type[None]
+else:
+ NoneType = type(None)
+
+
+class RequestOptions(TypedDict, total=False):
+ headers: Headers
+ max_retries: int
+ timeout: float | Timeout | None
+ params: Query
+ extra_json: AnyMapping
+ idempotency_key: str
+
+
+# Sentinel class used until PEP 0661 is accepted
+class NotGiven:
+ """
+ A sentinel singleton class used to distinguish omitted keyword arguments
+ from those passed in with the value None (which may have different behavior).
+
+ For example:
+
+ ```py
+ def get(timeout: Union[int, NotGiven, None] = NotGiven()) -> Response: ...
+
+
+ get(timeout=1) # 1s timeout
+ get(timeout=None) # No timeout
+ get() # Default timeout behavior, which may not be statically known at the method definition.
+ ```
+ """
+
+ def __bool__(self) -> Literal[False]:
+ return False
+
+ @override
+ def __repr__(self) -> str:
+ return "NOT_GIVEN"
+
+
+NotGivenOr = Union[_T, NotGiven]
+NOT_GIVEN = NotGiven()
+
+
+class Omit:
+ """In certain situations you need to be able to represent a case where a default value has
+ to be explicitly removed and `None` is not an appropriate substitute, for example:
+
+ ```py
+ # as the default `Content-Type` header is `application/json` that will be sent
+ client.post("/upload/files", files={"file": b"my raw file content"})
+
+ # you can't explicitly override the header as it has to be dynamically generated
+ # to look something like: 'multipart/form-data; boundary=0d8382fcf5f8c3be01ca2e11002d2983'
+ client.post(..., headers={"Content-Type": "multipart/form-data"})
+
+ # instead you can remove the default `application/json` header by passing Omit
+ client.post(..., headers={"Content-Type": Omit()})
+ ```
+ """
+
+ def __bool__(self) -> Literal[False]:
+ return False
+
+
+@runtime_checkable
+class ModelBuilderProtocol(Protocol):
+ @classmethod
+ def build(
+ cls: type[_T],
+ *,
+ response: Response,
+ data: object,
+ ) -> _T: ...
+
+
+Headers = Mapping[str, Union[str, Omit]]
+
+
+class HeadersLikeProtocol(Protocol):
+ def get(self, __key: str) -> str | None: ...
+
+
+HeadersLike = Union[Headers, HeadersLikeProtocol]
+
+ResponseT = TypeVar(
+ "ResponseT",
+ bound=Union[
+ object,
+ str,
+ None,
+ "BaseModel",
+ List[Any],
+ Dict[str, Any],
+ Response,
+ ModelBuilderProtocol,
+ "APIResponse[Any]",
+ "AsyncAPIResponse[Any]",
+ "HttpxBinaryResponseContent",
+ ],
+)
+
+StrBytesIntFloat = Union[str, bytes, int, float]
+
+# Note: copied from Pydantic
+# https://github.com/pydantic/pydantic/blob/6f31f8f68ef011f84357330186f603ff295312fd/pydantic/main.py#L79
+IncEx: TypeAlias = Union[Set[int], Set[str], Mapping[int, Union["IncEx", bool]], Mapping[str, Union["IncEx", bool]]]
+
+PostParser = Callable[[Any], Any]
+
+
+@runtime_checkable
+class InheritsGeneric(Protocol):
+ """Represents a type that has inherited from `Generic`
+
+ The `__orig_bases__` property can be used to determine the resolved
+ type variable for a given base class.
+ """
+
+ __orig_bases__: tuple[_GenericAlias]
+
+
+class _GenericAlias(Protocol):
+ __origin__: type[object]
+
+
+class HttpxSendArgs(TypedDict, total=False):
+ auth: httpx.Auth
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/__init__.py
new file mode 100644
index 00000000..d4fda26f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/__init__.py
@@ -0,0 +1,57 @@
+from ._sync import asyncify as asyncify
+from ._proxy import LazyProxy as LazyProxy
+from ._utils import (
+ flatten as flatten,
+ is_dict as is_dict,
+ is_list as is_list,
+ is_given as is_given,
+ is_tuple as is_tuple,
+ json_safe as json_safe,
+ lru_cache as lru_cache,
+ is_mapping as is_mapping,
+ is_tuple_t as is_tuple_t,
+ parse_date as parse_date,
+ is_iterable as is_iterable,
+ is_sequence as is_sequence,
+ coerce_float as coerce_float,
+ is_mapping_t as is_mapping_t,
+ removeprefix as removeprefix,
+ removesuffix as removesuffix,
+ extract_files as extract_files,
+ is_sequence_t as is_sequence_t,
+ required_args as required_args,
+ coerce_boolean as coerce_boolean,
+ coerce_integer as coerce_integer,
+ file_from_path as file_from_path,
+ parse_datetime as parse_datetime,
+ strip_not_given as strip_not_given,
+ deepcopy_minimal as deepcopy_minimal,
+ get_async_library as get_async_library,
+ maybe_coerce_float as maybe_coerce_float,
+ get_required_header as get_required_header,
+ maybe_coerce_boolean as maybe_coerce_boolean,
+ maybe_coerce_integer as maybe_coerce_integer,
+)
+from ._typing import (
+ is_list_type as is_list_type,
+ is_union_type as is_union_type,
+ extract_type_arg as extract_type_arg,
+ is_iterable_type as is_iterable_type,
+ is_required_type as is_required_type,
+ is_annotated_type as is_annotated_type,
+ is_type_alias_type as is_type_alias_type,
+ strip_annotated_type as strip_annotated_type,
+ extract_type_var_from_base as extract_type_var_from_base,
+)
+from ._streams import consume_sync_iterator as consume_sync_iterator, consume_async_iterator as consume_async_iterator
+from ._transform import (
+ PropertyInfo as PropertyInfo,
+ transform as transform,
+ async_transform as async_transform,
+ maybe_transform as maybe_transform,
+ async_maybe_transform as async_maybe_transform,
+)
+from ._reflection import (
+ function_has_argument as function_has_argument,
+ assert_signatures_in_sync as assert_signatures_in_sync,
+)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/_logs.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/_logs.py
new file mode 100644
index 00000000..a409705b
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/_logs.py
@@ -0,0 +1,25 @@
+import os
+import logging
+
+logger: logging.Logger = logging.getLogger("anthropic")
+httpx_logger: logging.Logger = logging.getLogger("httpx")
+
+
+def _basic_config() -> None:
+ # e.g. [2023-10-05 14:12:26 - anthropic._base_client:818 - DEBUG] HTTP Request: POST http://127.0.0.1:4010/foo/bar "200 OK"
+ logging.basicConfig(
+ format="[%(asctime)s - %(name)s:%(lineno)d - %(levelname)s] %(message)s",
+ datefmt="%Y-%m-%d %H:%M:%S",
+ )
+
+
+def setup_logging() -> None:
+ env = os.environ.get("ANTHROPIC_LOG")
+ if env == "debug":
+ _basic_config()
+ logger.setLevel(logging.DEBUG)
+ httpx_logger.setLevel(logging.DEBUG)
+ elif env == "info":
+ _basic_config()
+ logger.setLevel(logging.INFO)
+ httpx_logger.setLevel(logging.INFO)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/_proxy.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/_proxy.py
new file mode 100644
index 00000000..ffd883e9
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/_proxy.py
@@ -0,0 +1,62 @@
+from __future__ import annotations
+
+from abc import ABC, abstractmethod
+from typing import Generic, TypeVar, Iterable, cast
+from typing_extensions import override
+
+T = TypeVar("T")
+
+
+class LazyProxy(Generic[T], ABC):
+ """Implements data methods to pretend that an instance is another instance.
+
+ This includes forwarding attribute access and other methods.
+ """
+
+ # Note: we have to special case proxies that themselves return proxies
+ # to support using a proxy as a catch-all for any random access, e.g. `proxy.foo.bar.baz`
+
+ def __getattr__(self, attr: str) -> object:
+ proxied = self.__get_proxied__()
+ if isinstance(proxied, LazyProxy):
+ return proxied # pyright: ignore
+ return getattr(proxied, attr)
+
+ @override
+ def __repr__(self) -> str:
+ proxied = self.__get_proxied__()
+ if isinstance(proxied, LazyProxy):
+ return proxied.__class__.__name__
+ return repr(self.__get_proxied__())
+
+ @override
+ def __str__(self) -> str:
+ proxied = self.__get_proxied__()
+ if isinstance(proxied, LazyProxy):
+ return proxied.__class__.__name__
+ return str(proxied)
+
+ @override
+ def __dir__(self) -> Iterable[str]:
+ proxied = self.__get_proxied__()
+ if isinstance(proxied, LazyProxy):
+ return []
+ return proxied.__dir__()
+
+ @property # type: ignore
+ @override
+ def __class__(self) -> type: # pyright: ignore
+ proxied = self.__get_proxied__()
+ if issubclass(type(proxied), LazyProxy):
+ return type(proxied)
+ return proxied.__class__
+
+ def __get_proxied__(self) -> T:
+ return self.__load__()
+
+ def __as_proxied__(self) -> T:
+ """Helper method that returns the current proxy, typed as the loaded object"""
+ return cast(T, self)
+
+ @abstractmethod
+ def __load__(self) -> T: ...
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/_reflection.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/_reflection.py
new file mode 100644
index 00000000..89aa712a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/_reflection.py
@@ -0,0 +1,42 @@
+from __future__ import annotations
+
+import inspect
+from typing import Any, Callable
+
+
+def function_has_argument(func: Callable[..., Any], arg_name: str) -> bool:
+ """Returns whether or not the given function has a specific parameter"""
+ sig = inspect.signature(func)
+ return arg_name in sig.parameters
+
+
+def assert_signatures_in_sync(
+ source_func: Callable[..., Any],
+ check_func: Callable[..., Any],
+ *,
+ exclude_params: set[str] = set(),
+) -> None:
+ """Ensure that the signature of the second function matches the first."""
+
+ check_sig = inspect.signature(check_func)
+ source_sig = inspect.signature(source_func)
+
+ errors: list[str] = []
+
+ for name, source_param in source_sig.parameters.items():
+ if name in exclude_params:
+ continue
+
+ custom_param = check_sig.parameters.get(name)
+ if not custom_param:
+ errors.append(f"the `{name}` param is missing")
+ continue
+
+ if custom_param.annotation != source_param.annotation:
+ errors.append(
+ f"types for the `{name}` param are do not match; source={repr(source_param.annotation)} checking={repr(custom_param.annotation)}"
+ )
+ continue
+
+ if errors:
+ raise AssertionError(f"{len(errors)} errors encountered when comparing signatures:\n\n" + "\n\n".join(errors))
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/_streams.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/_streams.py
new file mode 100644
index 00000000..f4a0208f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/_streams.py
@@ -0,0 +1,12 @@
+from typing import Any
+from typing_extensions import Iterator, AsyncIterator
+
+
+def consume_sync_iterator(iterator: Iterator[Any]) -> None:
+ for _ in iterator:
+ ...
+
+
+async def consume_async_iterator(iterator: AsyncIterator[Any]) -> None:
+ async for _ in iterator:
+ ...
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/_sync.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/_sync.py
new file mode 100644
index 00000000..ad7ec71b
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/_sync.py
@@ -0,0 +1,86 @@
+from __future__ import annotations
+
+import sys
+import asyncio
+import functools
+import contextvars
+from typing import Any, TypeVar, Callable, Awaitable
+from typing_extensions import ParamSpec
+
+import anyio
+import sniffio
+import anyio.to_thread
+
+T_Retval = TypeVar("T_Retval")
+T_ParamSpec = ParamSpec("T_ParamSpec")
+
+
+if sys.version_info >= (3, 9):
+ _asyncio_to_thread = asyncio.to_thread
+else:
+ # backport of https://docs.python.org/3/library/asyncio-task.html#asyncio.to_thread
+ # for Python 3.8 support
+ async def _asyncio_to_thread(
+ func: Callable[T_ParamSpec, T_Retval], /, *args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs
+ ) -> Any:
+ """Asynchronously run function *func* in a separate thread.
+
+ Any *args and **kwargs supplied for this function are directly passed
+ to *func*. Also, the current :class:`contextvars.Context` is propagated,
+ allowing context variables from the main thread to be accessed in the
+ separate thread.
+
+ Returns a coroutine that can be awaited to get the eventual result of *func*.
+ """
+ loop = asyncio.events.get_running_loop()
+ ctx = contextvars.copy_context()
+ func_call = functools.partial(ctx.run, func, *args, **kwargs)
+ return await loop.run_in_executor(None, func_call)
+
+
+async def to_thread(
+ func: Callable[T_ParamSpec, T_Retval], /, *args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs
+) -> T_Retval:
+ if sniffio.current_async_library() == "asyncio":
+ return await _asyncio_to_thread(func, *args, **kwargs)
+
+ return await anyio.to_thread.run_sync(
+ functools.partial(func, *args, **kwargs),
+ )
+
+
+# inspired by `asyncer`, https://github.com/tiangolo/asyncer
+def asyncify(function: Callable[T_ParamSpec, T_Retval]) -> Callable[T_ParamSpec, Awaitable[T_Retval]]:
+ """
+ Take a blocking function and create an async one that receives the same
+ positional and keyword arguments. For python version 3.9 and above, it uses
+ asyncio.to_thread to run the function in a separate thread. For python version
+ 3.8, it uses locally defined copy of the asyncio.to_thread function which was
+ introduced in python 3.9.
+
+ Usage:
+
+ ```python
+ def blocking_func(arg1, arg2, kwarg1=None):
+ # blocking code
+ return result
+
+
+ result = asyncify(blocking_function)(arg1, arg2, kwarg1=value1)
+ ```
+
+ ## Arguments
+
+ `function`: a blocking regular callable (e.g. a function)
+
+ ## Return
+
+ An async function that takes the same positional and keyword arguments as the
+ original one, that when called runs the same original function in a thread worker
+ and returns the result.
+ """
+
+ async def wrapper(*args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs) -> T_Retval:
+ return await to_thread(function, *args, **kwargs)
+
+ return wrapper
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/_transform.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/_transform.py
new file mode 100644
index 00000000..18afd9d8
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/_transform.py
@@ -0,0 +1,402 @@
+from __future__ import annotations
+
+import io
+import base64
+import pathlib
+from typing import Any, Mapping, TypeVar, cast
+from datetime import date, datetime
+from typing_extensions import Literal, get_args, override, get_type_hints
+
+import anyio
+import pydantic
+
+from ._utils import (
+ is_list,
+ is_mapping,
+ is_iterable,
+)
+from .._files import is_base64_file_input
+from ._typing import (
+ is_list_type,
+ is_union_type,
+ extract_type_arg,
+ is_iterable_type,
+ is_required_type,
+ is_annotated_type,
+ strip_annotated_type,
+)
+from .._compat import get_origin, model_dump, is_typeddict
+
+_T = TypeVar("_T")
+
+
+# TODO: support for drilling globals() and locals()
+# TODO: ensure works correctly with forward references in all cases
+
+
+PropertyFormat = Literal["iso8601", "base64", "custom"]
+
+
+class PropertyInfo:
+ """Metadata class to be used in Annotated types to provide information about a given type.
+
+ For example:
+
+ class MyParams(TypedDict):
+ account_holder_name: Annotated[str, PropertyInfo(alias='accountHolderName')]
+
+ This means that {'account_holder_name': 'Robert'} will be transformed to {'accountHolderName': 'Robert'} before being sent to the API.
+ """
+
+ alias: str | None
+ format: PropertyFormat | None
+ format_template: str | None
+ discriminator: str | None
+
+ def __init__(
+ self,
+ *,
+ alias: str | None = None,
+ format: PropertyFormat | None = None,
+ format_template: str | None = None,
+ discriminator: str | None = None,
+ ) -> None:
+ self.alias = alias
+ self.format = format
+ self.format_template = format_template
+ self.discriminator = discriminator
+
+ @override
+ def __repr__(self) -> str:
+ return f"{self.__class__.__name__}(alias='{self.alias}', format={self.format}, format_template='{self.format_template}', discriminator='{self.discriminator}')"
+
+
+def maybe_transform(
+ data: object,
+ expected_type: object,
+) -> Any | None:
+ """Wrapper over `transform()` that allows `None` to be passed.
+
+ See `transform()` for more details.
+ """
+ if data is None:
+ return None
+ return transform(data, expected_type)
+
+
+# Wrapper over _transform_recursive providing fake types
+def transform(
+ data: _T,
+ expected_type: object,
+) -> _T:
+ """Transform dictionaries based off of type information from the given type, for example:
+
+ ```py
+ class Params(TypedDict, total=False):
+ card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]]
+
+
+ transformed = transform({"card_id": "<my card ID>"}, Params)
+ # {'cardID': '<my card ID>'}
+ ```
+
+ Any keys / data that does not have type information given will be included as is.
+
+ It should be noted that the transformations that this function does are not represented in the type system.
+ """
+ transformed = _transform_recursive(data, annotation=cast(type, expected_type))
+ return cast(_T, transformed)
+
+
+def _get_annotated_type(type_: type) -> type | None:
+ """If the given type is an `Annotated` type then it is returned, if not `None` is returned.
+
+ This also unwraps the type when applicable, e.g. `Required[Annotated[T, ...]]`
+ """
+ if is_required_type(type_):
+ # Unwrap `Required[Annotated[T, ...]]` to `Annotated[T, ...]`
+ type_ = get_args(type_)[0]
+
+ if is_annotated_type(type_):
+ return type_
+
+ return None
+
+
+def _maybe_transform_key(key: str, type_: type) -> str:
+ """Transform the given `data` based on the annotations provided in `type_`.
+
+ Note: this function only looks at `Annotated` types that contain `PropertInfo` metadata.
+ """
+ annotated_type = _get_annotated_type(type_)
+ if annotated_type is None:
+ # no `Annotated` definition for this type, no transformation needed
+ return key
+
+ # ignore the first argument as it is the actual type
+ annotations = get_args(annotated_type)[1:]
+ for annotation in annotations:
+ if isinstance(annotation, PropertyInfo) and annotation.alias is not None:
+ return annotation.alias
+
+ return key
+
+
+def _transform_recursive(
+ data: object,
+ *,
+ annotation: type,
+ inner_type: type | None = None,
+) -> object:
+ """Transform the given data against the expected type.
+
+ Args:
+ annotation: The direct type annotation given to the particular piece of data.
+ This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc
+
+ inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type
+ is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in
+ the list can be transformed using the metadata from the container type.
+
+ Defaults to the same value as the `annotation` argument.
+ """
+ if inner_type is None:
+ inner_type = annotation
+
+ stripped_type = strip_annotated_type(inner_type)
+ origin = get_origin(stripped_type) or stripped_type
+ if is_typeddict(stripped_type) and is_mapping(data):
+ return _transform_typeddict(data, stripped_type)
+
+ if origin == dict and is_mapping(data):
+ items_type = get_args(stripped_type)[1]
+ return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()}
+
+ if (
+ # List[T]
+ (is_list_type(stripped_type) and is_list(data))
+ # Iterable[T]
+ or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str))
+ ):
+ # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually
+ # intended as an iterable, so we don't transform it.
+ if isinstance(data, dict):
+ return cast(object, data)
+
+ inner_type = extract_type_arg(stripped_type, 0)
+ return [_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data]
+
+ if is_union_type(stripped_type):
+ # For union types we run the transformation against all subtypes to ensure that everything is transformed.
+ #
+ # TODO: there may be edge cases where the same normalized field name will transform to two different names
+ # in different subtypes.
+ for subtype in get_args(stripped_type):
+ data = _transform_recursive(data, annotation=annotation, inner_type=subtype)
+ return data
+
+ if isinstance(data, pydantic.BaseModel):
+ return model_dump(data, exclude_unset=True, mode="json")
+
+ annotated_type = _get_annotated_type(annotation)
+ if annotated_type is None:
+ return data
+
+ # ignore the first argument as it is the actual type
+ annotations = get_args(annotated_type)[1:]
+ for annotation in annotations:
+ if isinstance(annotation, PropertyInfo) and annotation.format is not None:
+ return _format_data(data, annotation.format, annotation.format_template)
+
+ return data
+
+
+def _format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object:
+ if isinstance(data, (date, datetime)):
+ if format_ == "iso8601":
+ return data.isoformat()
+
+ if format_ == "custom" and format_template is not None:
+ return data.strftime(format_template)
+
+ if format_ == "base64" and is_base64_file_input(data):
+ binary: str | bytes | None = None
+
+ if isinstance(data, pathlib.Path):
+ binary = data.read_bytes()
+ elif isinstance(data, io.IOBase):
+ binary = data.read()
+
+ if isinstance(binary, str): # type: ignore[unreachable]
+ binary = binary.encode()
+
+ if not isinstance(binary, bytes):
+ raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}")
+
+ return base64.b64encode(binary).decode("ascii")
+
+ return data
+
+
+def _transform_typeddict(
+ data: Mapping[str, object],
+ expected_type: type,
+) -> Mapping[str, object]:
+ result: dict[str, object] = {}
+ annotations = get_type_hints(expected_type, include_extras=True)
+ for key, value in data.items():
+ type_ = annotations.get(key)
+ if type_ is None:
+ # we do not have a type annotation for this field, leave it as is
+ result[key] = value
+ else:
+ result[_maybe_transform_key(key, type_)] = _transform_recursive(value, annotation=type_)
+ return result
+
+
+async def async_maybe_transform(
+ data: object,
+ expected_type: object,
+) -> Any | None:
+ """Wrapper over `async_transform()` that allows `None` to be passed.
+
+ See `async_transform()` for more details.
+ """
+ if data is None:
+ return None
+ return await async_transform(data, expected_type)
+
+
+async def async_transform(
+ data: _T,
+ expected_type: object,
+) -> _T:
+ """Transform dictionaries based off of type information from the given type, for example:
+
+ ```py
+ class Params(TypedDict, total=False):
+ card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]]
+
+
+ transformed = transform({"card_id": "<my card ID>"}, Params)
+ # {'cardID': '<my card ID>'}
+ ```
+
+ Any keys / data that does not have type information given will be included as is.
+
+ It should be noted that the transformations that this function does are not represented in the type system.
+ """
+ transformed = await _async_transform_recursive(data, annotation=cast(type, expected_type))
+ return cast(_T, transformed)
+
+
+async def _async_transform_recursive(
+ data: object,
+ *,
+ annotation: type,
+ inner_type: type | None = None,
+) -> object:
+ """Transform the given data against the expected type.
+
+ Args:
+ annotation: The direct type annotation given to the particular piece of data.
+ This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc
+
+ inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type
+ is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in
+ the list can be transformed using the metadata from the container type.
+
+ Defaults to the same value as the `annotation` argument.
+ """
+ if inner_type is None:
+ inner_type = annotation
+
+ stripped_type = strip_annotated_type(inner_type)
+ origin = get_origin(stripped_type) or stripped_type
+ if is_typeddict(stripped_type) and is_mapping(data):
+ return await _async_transform_typeddict(data, stripped_type)
+
+ if origin == dict and is_mapping(data):
+ items_type = get_args(stripped_type)[1]
+ return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()}
+
+ if (
+ # List[T]
+ (is_list_type(stripped_type) and is_list(data))
+ # Iterable[T]
+ or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str))
+ ):
+ # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually
+ # intended as an iterable, so we don't transform it.
+ if isinstance(data, dict):
+ return cast(object, data)
+
+ inner_type = extract_type_arg(stripped_type, 0)
+ return [await _async_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data]
+
+ if is_union_type(stripped_type):
+ # For union types we run the transformation against all subtypes to ensure that everything is transformed.
+ #
+ # TODO: there may be edge cases where the same normalized field name will transform to two different names
+ # in different subtypes.
+ for subtype in get_args(stripped_type):
+ data = await _async_transform_recursive(data, annotation=annotation, inner_type=subtype)
+ return data
+
+ if isinstance(data, pydantic.BaseModel):
+ return model_dump(data, exclude_unset=True, mode="json")
+
+ annotated_type = _get_annotated_type(annotation)
+ if annotated_type is None:
+ return data
+
+ # ignore the first argument as it is the actual type
+ annotations = get_args(annotated_type)[1:]
+ for annotation in annotations:
+ if isinstance(annotation, PropertyInfo) and annotation.format is not None:
+ return await _async_format_data(data, annotation.format, annotation.format_template)
+
+ return data
+
+
+async def _async_format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object:
+ if isinstance(data, (date, datetime)):
+ if format_ == "iso8601":
+ return data.isoformat()
+
+ if format_ == "custom" and format_template is not None:
+ return data.strftime(format_template)
+
+ if format_ == "base64" and is_base64_file_input(data):
+ binary: str | bytes | None = None
+
+ if isinstance(data, pathlib.Path):
+ binary = await anyio.Path(data).read_bytes()
+ elif isinstance(data, io.IOBase):
+ binary = data.read()
+
+ if isinstance(binary, str): # type: ignore[unreachable]
+ binary = binary.encode()
+
+ if not isinstance(binary, bytes):
+ raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}")
+
+ return base64.b64encode(binary).decode("ascii")
+
+ return data
+
+
+async def _async_transform_typeddict(
+ data: Mapping[str, object],
+ expected_type: type,
+) -> Mapping[str, object]:
+ result: dict[str, object] = {}
+ annotations = get_type_hints(expected_type, include_extras=True)
+ for key, value in data.items():
+ type_ = annotations.get(key)
+ if type_ is None:
+ # we do not have a type annotation for this field, leave it as is
+ result[key] = value
+ else:
+ result[_maybe_transform_key(key, type_)] = await _async_transform_recursive(value, annotation=type_)
+ return result
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/_typing.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/_typing.py
new file mode 100644
index 00000000..278749b1
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/_typing.py
@@ -0,0 +1,149 @@
+from __future__ import annotations
+
+import sys
+import typing
+import typing_extensions
+from typing import Any, TypeVar, Iterable, cast
+from collections import abc as _c_abc
+from typing_extensions import (
+ TypeIs,
+ Required,
+ Annotated,
+ get_args,
+ get_origin,
+)
+
+from .._types import InheritsGeneric
+from .._compat import is_union as _is_union
+
+
+def is_annotated_type(typ: type) -> bool:
+ return get_origin(typ) == Annotated
+
+
+def is_list_type(typ: type) -> bool:
+ return (get_origin(typ) or typ) == list
+
+
+def is_iterable_type(typ: type) -> bool:
+ """If the given type is `typing.Iterable[T]`"""
+ origin = get_origin(typ) or typ
+ return origin == Iterable or origin == _c_abc.Iterable
+
+
+def is_union_type(typ: type) -> bool:
+ return _is_union(get_origin(typ))
+
+
+def is_required_type(typ: type) -> bool:
+ return get_origin(typ) == Required
+
+
+def is_typevar(typ: type) -> bool:
+ # type ignore is required because type checkers
+ # think this expression will always return False
+ return type(typ) == TypeVar # type: ignore
+
+
+_TYPE_ALIAS_TYPES: tuple[type[typing_extensions.TypeAliasType], ...] = (typing_extensions.TypeAliasType,)
+if sys.version_info >= (3, 12):
+ _TYPE_ALIAS_TYPES = (*_TYPE_ALIAS_TYPES, typing.TypeAliasType)
+
+
+def is_type_alias_type(tp: Any, /) -> TypeIs[typing_extensions.TypeAliasType]:
+ """Return whether the provided argument is an instance of `TypeAliasType`.
+
+ ```python
+ type Int = int
+ is_type_alias_type(Int)
+ # > True
+ Str = TypeAliasType("Str", str)
+ is_type_alias_type(Str)
+ # > True
+ ```
+ """
+ return isinstance(tp, _TYPE_ALIAS_TYPES)
+
+
+# Extracts T from Annotated[T, ...] or from Required[Annotated[T, ...]]
+def strip_annotated_type(typ: type) -> type:
+ if is_required_type(typ) or is_annotated_type(typ):
+ return strip_annotated_type(cast(type, get_args(typ)[0]))
+
+ return typ
+
+
+def extract_type_arg(typ: type, index: int) -> type:
+ args = get_args(typ)
+ try:
+ return cast(type, args[index])
+ except IndexError as err:
+ raise RuntimeError(f"Expected type {typ} to have a type argument at index {index} but it did not") from err
+
+
+def extract_type_var_from_base(
+ typ: type,
+ *,
+ generic_bases: tuple[type, ...],
+ index: int,
+ failure_message: str | None = None,
+) -> type:
+ """Given a type like `Foo[T]`, returns the generic type variable `T`.
+
+ This also handles the case where a concrete subclass is given, e.g.
+ ```py
+ class MyResponse(Foo[bytes]):
+ ...
+
+ extract_type_var(MyResponse, bases=(Foo,), index=0) -> bytes
+ ```
+
+ And where a generic subclass is given:
+ ```py
+ _T = TypeVar('_T')
+ class MyResponse(Foo[_T]):
+ ...
+
+ extract_type_var(MyResponse[bytes], bases=(Foo,), index=0) -> bytes
+ ```
+ """
+ cls = cast(object, get_origin(typ) or typ)
+ if cls in generic_bases:
+ # we're given the class directly
+ return extract_type_arg(typ, index)
+
+ # if a subclass is given
+ # ---
+ # this is needed as __orig_bases__ is not present in the typeshed stubs
+ # because it is intended to be for internal use only, however there does
+ # not seem to be a way to resolve generic TypeVars for inherited subclasses
+ # without using it.
+ if isinstance(cls, InheritsGeneric):
+ target_base_class: Any | None = None
+ for base in cls.__orig_bases__:
+ if base.__origin__ in generic_bases:
+ target_base_class = base
+ break
+
+ if target_base_class is None:
+ raise RuntimeError(
+ "Could not find the generic base class;\n"
+ "This should never happen;\n"
+ f"Does {cls} inherit from one of {generic_bases} ?"
+ )
+
+ extracted = extract_type_arg(target_base_class, index)
+ if is_typevar(extracted):
+ # If the extracted type argument is itself a type variable
+ # then that means the subclass itself is generic, so we have
+ # to resolve the type argument from the class itself, not
+ # the base class.
+ #
+ # Note: if there is more than 1 type argument, the subclass could
+ # change the ordering of the type arguments, this is not currently
+ # supported.
+ return extract_type_arg(typ, index)
+
+ return extracted
+
+ raise RuntimeError(failure_message or f"Could not resolve inner type variable at index {index} for {typ}")
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_utils/_utils.py b/.venv/lib/python3.12/site-packages/anthropic/_utils/_utils.py
new file mode 100644
index 00000000..e5811bba
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_utils/_utils.py
@@ -0,0 +1,414 @@
+from __future__ import annotations
+
+import os
+import re
+import inspect
+import functools
+from typing import (
+ Any,
+ Tuple,
+ Mapping,
+ TypeVar,
+ Callable,
+ Iterable,
+ Sequence,
+ cast,
+ overload,
+)
+from pathlib import Path
+from datetime import date, datetime
+from typing_extensions import TypeGuard
+
+import sniffio
+
+from .._types import NotGiven, FileTypes, NotGivenOr, HeadersLike
+from .._compat import parse_date as parse_date, parse_datetime as parse_datetime
+
+_T = TypeVar("_T")
+_TupleT = TypeVar("_TupleT", bound=Tuple[object, ...])
+_MappingT = TypeVar("_MappingT", bound=Mapping[str, object])
+_SequenceT = TypeVar("_SequenceT", bound=Sequence[object])
+CallableT = TypeVar("CallableT", bound=Callable[..., Any])
+
+
+def flatten(t: Iterable[Iterable[_T]]) -> list[_T]:
+ return [item for sublist in t for item in sublist]
+
+
+def extract_files(
+ # TODO: this needs to take Dict but variance issues.....
+ # create protocol type ?
+ query: Mapping[str, object],
+ *,
+ paths: Sequence[Sequence[str]],
+) -> list[tuple[str, FileTypes]]:
+ """Recursively extract files from the given dictionary based on specified paths.
+
+ A path may look like this ['foo', 'files', '<array>', 'data'].
+
+ Note: this mutates the given dictionary.
+ """
+ files: list[tuple[str, FileTypes]] = []
+ for path in paths:
+ files.extend(_extract_items(query, path, index=0, flattened_key=None))
+ return files
+
+
+def _extract_items(
+ obj: object,
+ path: Sequence[str],
+ *,
+ index: int,
+ flattened_key: str | None,
+) -> list[tuple[str, FileTypes]]:
+ try:
+ key = path[index]
+ except IndexError:
+ if isinstance(obj, NotGiven):
+ # no value was provided - we can safely ignore
+ return []
+
+ # cyclical import
+ from .._files import assert_is_file_content
+
+ # We have exhausted the path, return the entry we found.
+ assert_is_file_content(obj, key=flattened_key)
+ assert flattened_key is not None
+ return [(flattened_key, cast(FileTypes, obj))]
+
+ index += 1
+ if is_dict(obj):
+ try:
+ # We are at the last entry in the path so we must remove the field
+ if (len(path)) == index:
+ item = obj.pop(key)
+ else:
+ item = obj[key]
+ except KeyError:
+ # Key was not present in the dictionary, this is not indicative of an error
+ # as the given path may not point to a required field. We also do not want
+ # to enforce required fields as the API may differ from the spec in some cases.
+ return []
+ if flattened_key is None:
+ flattened_key = key
+ else:
+ flattened_key += f"[{key}]"
+ return _extract_items(
+ item,
+ path,
+ index=index,
+ flattened_key=flattened_key,
+ )
+ elif is_list(obj):
+ if key != "<array>":
+ return []
+
+ return flatten(
+ [
+ _extract_items(
+ item,
+ path,
+ index=index,
+ flattened_key=flattened_key + "[]" if flattened_key is not None else "[]",
+ )
+ for item in obj
+ ]
+ )
+
+ # Something unexpected was passed, just ignore it.
+ return []
+
+
+def is_given(obj: NotGivenOr[_T]) -> TypeGuard[_T]:
+ return not isinstance(obj, NotGiven)
+
+
+# Type safe methods for narrowing types with TypeVars.
+# The default narrowing for isinstance(obj, dict) is dict[unknown, unknown],
+# however this cause Pyright to rightfully report errors. As we know we don't
+# care about the contained types we can safely use `object` in it's place.
+#
+# There are two separate functions defined, `is_*` and `is_*_t` for different use cases.
+# `is_*` is for when you're dealing with an unknown input
+# `is_*_t` is for when you're narrowing a known union type to a specific subset
+
+
+def is_tuple(obj: object) -> TypeGuard[tuple[object, ...]]:
+ return isinstance(obj, tuple)
+
+
+def is_tuple_t(obj: _TupleT | object) -> TypeGuard[_TupleT]:
+ return isinstance(obj, tuple)
+
+
+def is_sequence(obj: object) -> TypeGuard[Sequence[object]]:
+ return isinstance(obj, Sequence)
+
+
+def is_sequence_t(obj: _SequenceT | object) -> TypeGuard[_SequenceT]:
+ return isinstance(obj, Sequence)
+
+
+def is_mapping(obj: object) -> TypeGuard[Mapping[str, object]]:
+ return isinstance(obj, Mapping)
+
+
+def is_mapping_t(obj: _MappingT | object) -> TypeGuard[_MappingT]:
+ return isinstance(obj, Mapping)
+
+
+def is_dict(obj: object) -> TypeGuard[dict[object, object]]:
+ return isinstance(obj, dict)
+
+
+def is_list(obj: object) -> TypeGuard[list[object]]:
+ return isinstance(obj, list)
+
+
+def is_iterable(obj: object) -> TypeGuard[Iterable[object]]:
+ return isinstance(obj, Iterable)
+
+
+def deepcopy_minimal(item: _T) -> _T:
+ """Minimal reimplementation of copy.deepcopy() that will only copy certain object types:
+
+ - mappings, e.g. `dict`
+ - list
+
+ This is done for performance reasons.
+ """
+ if is_mapping(item):
+ return cast(_T, {k: deepcopy_minimal(v) for k, v in item.items()})
+ if is_list(item):
+ return cast(_T, [deepcopy_minimal(entry) for entry in item])
+ return item
+
+
+# copied from https://github.com/Rapptz/RoboDanny
+def human_join(seq: Sequence[str], *, delim: str = ", ", final: str = "or") -> str:
+ size = len(seq)
+ if size == 0:
+ return ""
+
+ if size == 1:
+ return seq[0]
+
+ if size == 2:
+ return f"{seq[0]} {final} {seq[1]}"
+
+ return delim.join(seq[:-1]) + f" {final} {seq[-1]}"
+
+
+def quote(string: str) -> str:
+ """Add single quotation marks around the given string. Does *not* do any escaping."""
+ return f"'{string}'"
+
+
+def required_args(*variants: Sequence[str]) -> Callable[[CallableT], CallableT]:
+ """Decorator to enforce a given set of arguments or variants of arguments are passed to the decorated function.
+
+ Useful for enforcing runtime validation of overloaded functions.
+
+ Example usage:
+ ```py
+ @overload
+ def foo(*, a: str) -> str: ...
+
+
+ @overload
+ def foo(*, b: bool) -> str: ...
+
+
+ # This enforces the same constraints that a static type checker would
+ # i.e. that either a or b must be passed to the function
+ @required_args(["a"], ["b"])
+ def foo(*, a: str | None = None, b: bool | None = None) -> str: ...
+ ```
+ """
+
+ def inner(func: CallableT) -> CallableT:
+ params = inspect.signature(func).parameters
+ positional = [
+ name
+ for name, param in params.items()
+ if param.kind
+ in {
+ param.POSITIONAL_ONLY,
+ param.POSITIONAL_OR_KEYWORD,
+ }
+ ]
+
+ @functools.wraps(func)
+ def wrapper(*args: object, **kwargs: object) -> object:
+ given_params: set[str] = set()
+ for i, _ in enumerate(args):
+ try:
+ given_params.add(positional[i])
+ except IndexError:
+ raise TypeError(
+ f"{func.__name__}() takes {len(positional)} argument(s) but {len(args)} were given"
+ ) from None
+
+ for key in kwargs.keys():
+ given_params.add(key)
+
+ for variant in variants:
+ matches = all((param in given_params for param in variant))
+ if matches:
+ break
+ else: # no break
+ if len(variants) > 1:
+ variations = human_join(
+ ["(" + human_join([quote(arg) for arg in variant], final="and") + ")" for variant in variants]
+ )
+ msg = f"Missing required arguments; Expected either {variations} arguments to be given"
+ else:
+ assert len(variants) > 0
+
+ # TODO: this error message is not deterministic
+ missing = list(set(variants[0]) - given_params)
+ if len(missing) > 1:
+ msg = f"Missing required arguments: {human_join([quote(arg) for arg in missing])}"
+ else:
+ msg = f"Missing required argument: {quote(missing[0])}"
+ raise TypeError(msg)
+ return func(*args, **kwargs)
+
+ return wrapper # type: ignore
+
+ return inner
+
+
+_K = TypeVar("_K")
+_V = TypeVar("_V")
+
+
+@overload
+def strip_not_given(obj: None) -> None: ...
+
+
+@overload
+def strip_not_given(obj: Mapping[_K, _V | NotGiven]) -> dict[_K, _V]: ...
+
+
+@overload
+def strip_not_given(obj: object) -> object: ...
+
+
+def strip_not_given(obj: object | None) -> object:
+ """Remove all top-level keys where their values are instances of `NotGiven`"""
+ if obj is None:
+ return None
+
+ if not is_mapping(obj):
+ return obj
+
+ return {key: value for key, value in obj.items() if not isinstance(value, NotGiven)}
+
+
+def coerce_integer(val: str) -> int:
+ return int(val, base=10)
+
+
+def coerce_float(val: str) -> float:
+ return float(val)
+
+
+def coerce_boolean(val: str) -> bool:
+ return val == "true" or val == "1" or val == "on"
+
+
+def maybe_coerce_integer(val: str | None) -> int | None:
+ if val is None:
+ return None
+ return coerce_integer(val)
+
+
+def maybe_coerce_float(val: str | None) -> float | None:
+ if val is None:
+ return None
+ return coerce_float(val)
+
+
+def maybe_coerce_boolean(val: str | None) -> bool | None:
+ if val is None:
+ return None
+ return coerce_boolean(val)
+
+
+def removeprefix(string: str, prefix: str) -> str:
+ """Remove a prefix from a string.
+
+ Backport of `str.removeprefix` for Python < 3.9
+ """
+ if string.startswith(prefix):
+ return string[len(prefix) :]
+ return string
+
+
+def removesuffix(string: str, suffix: str) -> str:
+ """Remove a suffix from a string.
+
+ Backport of `str.removesuffix` for Python < 3.9
+ """
+ if string.endswith(suffix):
+ return string[: -len(suffix)]
+ return string
+
+
+def file_from_path(path: str) -> FileTypes:
+ contents = Path(path).read_bytes()
+ file_name = os.path.basename(path)
+ return (file_name, contents)
+
+
+def get_required_header(headers: HeadersLike, header: str) -> str:
+ lower_header = header.lower()
+ if is_mapping_t(headers):
+ # mypy doesn't understand the type narrowing here
+ for k, v in headers.items(): # type: ignore
+ if k.lower() == lower_header and isinstance(v, str):
+ return v
+
+ # to deal with the case where the header looks like Stainless-Event-Id
+ intercaps_header = re.sub(r"([^\w])(\w)", lambda pat: pat.group(1) + pat.group(2).upper(), header.capitalize())
+
+ for normalized_header in [header, lower_header, header.upper(), intercaps_header]:
+ value = headers.get(normalized_header)
+ if value:
+ return value
+
+ raise ValueError(f"Could not find {header} header")
+
+
+def get_async_library() -> str:
+ try:
+ return sniffio.current_async_library()
+ except Exception:
+ return "false"
+
+
+def lru_cache(*, maxsize: int | None = 128) -> Callable[[CallableT], CallableT]:
+ """A version of functools.lru_cache that retains the type signature
+ for the wrapped function arguments.
+ """
+ wrapper = functools.lru_cache( # noqa: TID251
+ maxsize=maxsize,
+ )
+ return cast(Any, wrapper) # type: ignore[no-any-return]
+
+
+def json_safe(data: object) -> object:
+ """Translates a mapping / sequence recursively in the same fashion
+ as `pydantic` v2's `model_dump(mode="json")`.
+ """
+ if is_mapping(data):
+ return {json_safe(key): json_safe(value) for key, value in data.items()}
+
+ if is_iterable(data) and not isinstance(data, (str, bytes, bytearray)):
+ return [json_safe(item) for item in data]
+
+ if isinstance(data, (datetime, date)):
+ return data.isoformat()
+
+ return data
diff --git a/.venv/lib/python3.12/site-packages/anthropic/_version.py b/.venv/lib/python3.12/site-packages/anthropic/_version.py
new file mode 100644
index 00000000..181038b4
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/_version.py
@@ -0,0 +1,4 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+__title__ = "anthropic"
+__version__ = "0.49.0" # x-release-please-version
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/.keep b/.venv/lib/python3.12/site-packages/anthropic/lib/.keep
new file mode 100644
index 00000000..5e2c99fd
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/.keep
@@ -0,0 +1,4 @@
+File generated from our OpenAPI spec by Stainless.
+
+This directory can be used to store custom files to expand the SDK.
+It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/lib/__init__.py
new file mode 100644
index 00000000..e69de29b
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/__init__.py
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/__init__.py
new file mode 100644
index 00000000..4e3037ee
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/__init__.py
@@ -0,0 +1 @@
+from ._google_auth import google_auth as google_auth
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/_common.py b/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/_common.py
new file mode 100644
index 00000000..5d2b7f6a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/_common.py
@@ -0,0 +1,13 @@
+from ..._exceptions import AnthropicError
+
+INSTRUCTIONS = """
+
+Anthropic error: missing required dependency `{library}`.
+
+ $ pip install anthropic[{extra}]
+"""
+
+
+class MissingDependencyError(AnthropicError):
+ def __init__(self, *, library: str, extra: str) -> None:
+ super().__init__(INSTRUCTIONS.format(library=library, extra=extra))
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/_google_auth.py b/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/_google_auth.py
new file mode 100644
index 00000000..16cc7909
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/_extras/_google_auth.py
@@ -0,0 +1,29 @@
+from __future__ import annotations
+
+from typing import TYPE_CHECKING, Any
+from typing_extensions import ClassVar, override
+
+from ._common import MissingDependencyError
+from ..._utils import LazyProxy
+
+if TYPE_CHECKING:
+ import google.auth # type: ignore
+
+ google_auth = google.auth
+
+
+class GoogleAuthProxy(LazyProxy[Any]):
+ should_cache: ClassVar[bool] = True
+
+ @override
+ def __load__(self) -> Any:
+ try:
+ import google.auth # type: ignore
+ except ImportError as err:
+ raise MissingDependencyError(extra="vertex", library="google-auth") from err
+
+ return google.auth
+
+
+if not TYPE_CHECKING:
+ google_auth = GoogleAuthProxy()
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/__init__.py
new file mode 100644
index 00000000..69440c76
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/__init__.py
@@ -0,0 +1 @@
+from ._client import AnthropicBedrock as AnthropicBedrock, AsyncAnthropicBedrock as AsyncAnthropicBedrock
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_auth.py b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_auth.py
new file mode 100644
index 00000000..0a8b2109
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_auth.py
@@ -0,0 +1,72 @@
+from __future__ import annotations
+
+from typing import TYPE_CHECKING
+
+import httpx
+
+from ..._utils import lru_cache
+
+if TYPE_CHECKING:
+ import boto3
+
+
+@lru_cache(maxsize=512)
+def _get_session(
+ *,
+ aws_access_key: str | None,
+ aws_secret_key: str | None,
+ aws_session_token: str | None,
+ region: str | None,
+ profile: str | None,
+) -> boto3.Session:
+ import boto3
+
+ return boto3.Session(
+ profile_name=profile,
+ region_name=region,
+ aws_access_key_id=aws_access_key,
+ aws_secret_access_key=aws_secret_key,
+ aws_session_token=aws_session_token,
+ )
+
+
+def get_auth_headers(
+ *,
+ method: str,
+ url: str,
+ headers: httpx.Headers,
+ aws_access_key: str | None,
+ aws_secret_key: str | None,
+ aws_session_token: str | None,
+ region: str | None,
+ profile: str | None,
+ data: str | None,
+) -> dict[str, str]:
+ from botocore.auth import SigV4Auth
+ from botocore.awsrequest import AWSRequest
+
+ session = _get_session(
+ profile=profile,
+ region=region,
+ aws_access_key=aws_access_key,
+ aws_secret_key=aws_secret_key,
+ aws_session_token=aws_session_token,
+ )
+
+ # The connection header may be stripped by a proxy somewhere, so the receiver
+ # of this message may not see this header, so we remove it from the set of headers
+ # that are signed.
+ headers = headers.copy()
+ del headers["connection"]
+
+ request = AWSRequest(method=method.upper(), url=url, headers=headers, data=data)
+ credentials = session.get_credentials()
+ if not credentials:
+ raise RuntimeError("could not resolve credentials from session")
+
+ signer = SigV4Auth(credentials, "bedrock", session.region_name)
+ signer.add_auth(request)
+
+ prepped = request.prepare()
+
+ return {key: value for key, value in dict(prepped.headers).items() if value is not None}
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_beta.py b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_beta.py
new file mode 100644
index 00000000..f2a91b42
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_beta.py
@@ -0,0 +1,102 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from ..._compat import cached_property
+from ..._resource import SyncAPIResource, AsyncAPIResource
+from ._beta_messages import (
+ Messages,
+ AsyncMessages,
+ MessagesWithRawResponse,
+ AsyncMessagesWithRawResponse,
+ MessagesWithStreamingResponse,
+ AsyncMessagesWithStreamingResponse,
+)
+
+__all__ = ["Beta", "AsyncBeta"]
+
+
+class Beta(SyncAPIResource):
+ @cached_property
+ def messages(self) -> Messages:
+ return Messages(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> BetaWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return the
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return BetaWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> BetaWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return BetaWithStreamingResponse(self)
+
+
+class AsyncBeta(AsyncAPIResource):
+ @cached_property
+ def messages(self) -> AsyncMessages:
+ return AsyncMessages(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> AsyncBetaWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return the
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncBetaWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncBetaWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncBetaWithStreamingResponse(self)
+
+
+class BetaWithRawResponse:
+ def __init__(self, beta: Beta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def messages(self) -> MessagesWithRawResponse:
+ return MessagesWithRawResponse(self._beta.messages)
+
+
+class AsyncBetaWithRawResponse:
+ def __init__(self, beta: AsyncBeta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def messages(self) -> AsyncMessagesWithRawResponse:
+ return AsyncMessagesWithRawResponse(self._beta.messages)
+
+
+class BetaWithStreamingResponse:
+ def __init__(self, beta: Beta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def messages(self) -> MessagesWithStreamingResponse:
+ return MessagesWithStreamingResponse(self._beta.messages)
+
+
+class AsyncBetaWithStreamingResponse:
+ def __init__(self, beta: AsyncBeta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def messages(self) -> AsyncMessagesWithStreamingResponse:
+ return AsyncMessagesWithStreamingResponse(self._beta.messages)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_beta_messages.py b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_beta_messages.py
new file mode 100644
index 00000000..332f6fba
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_beta_messages.py
@@ -0,0 +1,93 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from ... import _legacy_response
+from ..._compat import cached_property
+from ..._resource import SyncAPIResource, AsyncAPIResource
+from ..._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from ...resources.beta import Messages as FirstPartyMessagesAPI, AsyncMessages as FirstPartyAsyncMessagesAPI
+
+__all__ = ["Messages", "AsyncMessages"]
+
+
+class Messages(SyncAPIResource):
+ create = FirstPartyMessagesAPI.create
+
+ @cached_property
+ def with_raw_response(self) -> MessagesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return the
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return MessagesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> MessagesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return MessagesWithStreamingResponse(self)
+
+
+class AsyncMessages(AsyncAPIResource):
+ create = FirstPartyAsyncMessagesAPI.create
+
+ @cached_property
+ def with_raw_response(self) -> AsyncMessagesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return the
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncMessagesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncMessagesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncMessagesWithStreamingResponse(self)
+
+
+class MessagesWithRawResponse:
+ def __init__(self, messages: Messages) -> None:
+ self._messages = messages
+
+ self.create = _legacy_response.to_raw_response_wrapper(
+ messages.create,
+ )
+
+
+class AsyncMessagesWithRawResponse:
+ def __init__(self, messages: AsyncMessages) -> None:
+ self._messages = messages
+
+ self.create = _legacy_response.async_to_raw_response_wrapper(
+ messages.create,
+ )
+
+
+class MessagesWithStreamingResponse:
+ def __init__(self, messages: Messages) -> None:
+ self._messages = messages
+
+ self.create = to_streamed_response_wrapper(
+ messages.create,
+ )
+
+
+class AsyncMessagesWithStreamingResponse:
+ def __init__(self, messages: AsyncMessages) -> None:
+ self._messages = messages
+
+ self.create = async_to_streamed_response_wrapper(
+ messages.create,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_client.py b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_client.py
new file mode 100644
index 00000000..ca645489
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_client.py
@@ -0,0 +1,390 @@
+from __future__ import annotations
+
+import os
+import urllib.parse
+from typing import Any, Union, Mapping, TypeVar
+from typing_extensions import Self, override
+
+import httpx
+
+from ... import _exceptions
+from ._beta import Beta, AsyncBeta
+from ..._types import NOT_GIVEN, Timeout, NotGiven
+from ..._utils import is_dict, is_given
+from ..._compat import model_copy
+from ..._version import __version__
+from ..._streaming import Stream, AsyncStream
+from ..._exceptions import AnthropicError, APIStatusError
+from ..._base_client import (
+ DEFAULT_MAX_RETRIES,
+ BaseClient,
+ SyncAPIClient,
+ AsyncAPIClient,
+ FinalRequestOptions,
+)
+from ._stream_decoder import AWSEventStreamDecoder
+from ...resources.messages import Messages, AsyncMessages
+from ...resources.completions import Completions, AsyncCompletions
+
+DEFAULT_VERSION = "bedrock-2023-05-31"
+
+_HttpxClientT = TypeVar("_HttpxClientT", bound=Union[httpx.Client, httpx.AsyncClient])
+_DefaultStreamT = TypeVar("_DefaultStreamT", bound=Union[Stream[Any], AsyncStream[Any]])
+
+
+def _prepare_options(input_options: FinalRequestOptions) -> FinalRequestOptions:
+ options = model_copy(input_options, deep=True)
+
+ if is_dict(options.json_data):
+ options.json_data.setdefault("anthropic_version", DEFAULT_VERSION)
+
+ if is_given(options.headers):
+ betas = options.headers.get("anthropic-beta")
+ if betas:
+ options.json_data.setdefault("anthropic_beta", betas.split(","))
+
+ if options.url in {"/v1/complete", "/v1/messages", "/v1/messages?beta=true"} and options.method == "post":
+ if not is_dict(options.json_data):
+ raise RuntimeError("Expected dictionary json_data for post /completions endpoint")
+
+ model = options.json_data.pop("model", None)
+ model = urllib.parse.quote(str(model), safe=":")
+ stream = options.json_data.pop("stream", False)
+ if stream:
+ options.url = f"/model/{model}/invoke-with-response-stream"
+ else:
+ options.url = f"/model/{model}/invoke"
+
+ if options.url.startswith("/v1/messages/batches"):
+ raise AnthropicError("The Batch API is not supported in Bedrock yet")
+
+ if options.url == "/v1/messages/count_tokens":
+ raise AnthropicError("Token counting is not supported in Bedrock yet")
+
+ return options
+
+
+class BaseBedrockClient(BaseClient[_HttpxClientT, _DefaultStreamT]):
+ @override
+ def _make_status_error(
+ self,
+ err_msg: str,
+ *,
+ body: object,
+ response: httpx.Response,
+ ) -> APIStatusError:
+ if response.status_code == 400:
+ return _exceptions.BadRequestError(err_msg, response=response, body=body)
+
+ if response.status_code == 401:
+ return _exceptions.AuthenticationError(err_msg, response=response, body=body)
+
+ if response.status_code == 403:
+ return _exceptions.PermissionDeniedError(err_msg, response=response, body=body)
+
+ if response.status_code == 404:
+ return _exceptions.NotFoundError(err_msg, response=response, body=body)
+
+ if response.status_code == 409:
+ return _exceptions.ConflictError(err_msg, response=response, body=body)
+
+ if response.status_code == 422:
+ return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body)
+
+ if response.status_code == 429:
+ return _exceptions.RateLimitError(err_msg, response=response, body=body)
+
+ if response.status_code == 503:
+ return _exceptions.ServiceUnavailableError(err_msg, response=response, body=body)
+
+ if response.status_code >= 500:
+ return _exceptions.InternalServerError(err_msg, response=response, body=body)
+ return APIStatusError(err_msg, response=response, body=body)
+
+
+class AnthropicBedrock(BaseBedrockClient[httpx.Client, Stream[Any]], SyncAPIClient):
+ messages: Messages
+ completions: Completions
+ beta: Beta
+
+ def __init__(
+ self,
+ aws_secret_key: str | None = None,
+ aws_access_key: str | None = None,
+ aws_region: str | None = None,
+ aws_profile: str | None = None,
+ aws_session_token: str | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ # Configure a custom httpx client. See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details.
+ http_client: httpx.Client | None = None,
+ # Enable or disable schema validation for data returned by the API.
+ # When enabled an error APIResponseValidationError is raised
+ # if the API responds with invalid data for the expected schema.
+ #
+ # This parameter may be removed or changed in the future.
+ # If you rely on this feature, please open a GitHub issue
+ # outlining your use-case to help us decide if it should be
+ # part of our public interface in the future.
+ _strict_response_validation: bool = False,
+ ) -> None:
+ self.aws_secret_key = aws_secret_key
+
+ self.aws_access_key = aws_access_key
+
+ if aws_region is None:
+ aws_region = os.environ.get("AWS_REGION") or "us-east-1"
+ self.aws_region = aws_region
+ self.aws_profile = aws_profile
+
+ self.aws_session_token = aws_session_token
+
+ if base_url is None:
+ base_url = os.environ.get("ANTHROPIC_BEDROCK_BASE_URL")
+ if base_url is None:
+ base_url = f"https://bedrock-runtime.{self.aws_region}.amazonaws.com"
+
+ super().__init__(
+ version=__version__,
+ base_url=base_url,
+ timeout=timeout,
+ max_retries=max_retries,
+ custom_headers=default_headers,
+ custom_query=default_query,
+ http_client=http_client,
+ _strict_response_validation=_strict_response_validation,
+ )
+
+ self.beta = Beta(self)
+ self.messages = Messages(self)
+ self.completions = Completions(self)
+
+ @override
+ def _make_sse_decoder(self) -> AWSEventStreamDecoder:
+ return AWSEventStreamDecoder()
+
+ @override
+ def _prepare_options(self, options: FinalRequestOptions) -> FinalRequestOptions:
+ return _prepare_options(options)
+
+ @override
+ def _prepare_request(self, request: httpx.Request) -> None:
+ from ._auth import get_auth_headers
+
+ data = request.read().decode()
+
+ headers = get_auth_headers(
+ method=request.method,
+ url=str(request.url),
+ headers=request.headers,
+ aws_access_key=self.aws_access_key,
+ aws_secret_key=self.aws_secret_key,
+ aws_session_token=self.aws_session_token,
+ region=self.aws_region or "us-east-1",
+ profile=self.aws_profile,
+ data=data,
+ )
+ request.headers.update(headers)
+
+ def copy(
+ self,
+ *,
+ aws_secret_key: str | None = None,
+ aws_access_key: str | None = None,
+ aws_region: str | None = None,
+ aws_session_token: str | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | Timeout | None | NotGiven = NOT_GIVEN,
+ http_client: httpx.Client | None = None,
+ max_retries: int | NotGiven = NOT_GIVEN,
+ default_headers: Mapping[str, str] | None = None,
+ set_default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ set_default_query: Mapping[str, object] | None = None,
+ _extra_kwargs: Mapping[str, Any] = {},
+ ) -> Self:
+ """
+ Create a new client instance re-using the same options given to the current client with optional overriding.
+ """
+ if default_headers is not None and set_default_headers is not None:
+ raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive")
+
+ if default_query is not None and set_default_query is not None:
+ raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive")
+
+ headers = self._custom_headers
+ if default_headers is not None:
+ headers = {**headers, **default_headers}
+ elif set_default_headers is not None:
+ headers = set_default_headers
+
+ params = self._custom_query
+ if default_query is not None:
+ params = {**params, **default_query}
+ elif set_default_query is not None:
+ params = set_default_query
+
+ return self.__class__(
+ aws_secret_key=aws_secret_key or self.aws_secret_key,
+ aws_access_key=aws_access_key or self.aws_access_key,
+ aws_region=aws_region or self.aws_region,
+ aws_session_token=aws_session_token or self.aws_session_token,
+ base_url=base_url or self.base_url,
+ timeout=self.timeout if isinstance(timeout, NotGiven) else timeout,
+ http_client=http_client,
+ max_retries=max_retries if is_given(max_retries) else self.max_retries,
+ default_headers=headers,
+ default_query=params,
+ **_extra_kwargs,
+ )
+
+ # Alias for `copy` for nicer inline usage, e.g.
+ # client.with_options(timeout=10).foo.create(...)
+ with_options = copy
+
+
+class AsyncAnthropicBedrock(BaseBedrockClient[httpx.AsyncClient, AsyncStream[Any]], AsyncAPIClient):
+ messages: AsyncMessages
+ completions: AsyncCompletions
+ beta: AsyncBeta
+
+ def __init__(
+ self,
+ aws_secret_key: str | None = None,
+ aws_access_key: str | None = None,
+ aws_region: str | None = None,
+ aws_profile: str | None = None,
+ aws_session_token: str | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ # Configure a custom httpx client. See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details.
+ http_client: httpx.AsyncClient | None = None,
+ # Enable or disable schema validation for data returned by the API.
+ # When enabled an error APIResponseValidationError is raised
+ # if the API responds with invalid data for the expected schema.
+ #
+ # This parameter may be removed or changed in the future.
+ # If you rely on this feature, please open a GitHub issue
+ # outlining your use-case to help us decide if it should be
+ # part of our public interface in the future.
+ _strict_response_validation: bool = False,
+ ) -> None:
+ self.aws_secret_key = aws_secret_key
+
+ self.aws_access_key = aws_access_key
+
+ if aws_region is None:
+ aws_region = os.environ.get("AWS_REGION") or "us-east-1"
+ self.aws_region = aws_region
+ self.aws_profile = aws_profile
+
+ self.aws_session_token = aws_session_token
+
+ if base_url is None:
+ base_url = os.environ.get("ANTHROPIC_BEDROCK_BASE_URL")
+ if base_url is None:
+ base_url = f"https://bedrock-runtime.{self.aws_region}.amazonaws.com"
+
+ super().__init__(
+ version=__version__,
+ base_url=base_url,
+ timeout=timeout,
+ max_retries=max_retries,
+ custom_headers=default_headers,
+ custom_query=default_query,
+ http_client=http_client,
+ _strict_response_validation=_strict_response_validation,
+ )
+
+ self.messages = AsyncMessages(self)
+ self.completions = AsyncCompletions(self)
+ self.beta = AsyncBeta(self)
+
+ @override
+ def _make_sse_decoder(self) -> AWSEventStreamDecoder:
+ return AWSEventStreamDecoder()
+
+ @override
+ async def _prepare_options(self, options: FinalRequestOptions) -> FinalRequestOptions:
+ return _prepare_options(options)
+
+ @override
+ async def _prepare_request(self, request: httpx.Request) -> None:
+ from ._auth import get_auth_headers
+
+ data = request.read().decode()
+
+ headers = get_auth_headers(
+ method=request.method,
+ url=str(request.url),
+ headers=request.headers,
+ aws_access_key=self.aws_access_key,
+ aws_secret_key=self.aws_secret_key,
+ aws_session_token=self.aws_session_token,
+ region=self.aws_region or "us-east-1",
+ profile=self.aws_profile,
+ data=data,
+ )
+ request.headers.update(headers)
+
+ def copy(
+ self,
+ *,
+ aws_secret_key: str | None = None,
+ aws_access_key: str | None = None,
+ aws_region: str | None = None,
+ aws_session_token: str | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | Timeout | None | NotGiven = NOT_GIVEN,
+ http_client: httpx.AsyncClient | None = None,
+ max_retries: int | NotGiven = NOT_GIVEN,
+ default_headers: Mapping[str, str] | None = None,
+ set_default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ set_default_query: Mapping[str, object] | None = None,
+ _extra_kwargs: Mapping[str, Any] = {},
+ ) -> Self:
+ """
+ Create a new client instance re-using the same options given to the current client with optional overriding.
+ """
+ if default_headers is not None and set_default_headers is not None:
+ raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive")
+
+ if default_query is not None and set_default_query is not None:
+ raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive")
+
+ headers = self._custom_headers
+ if default_headers is not None:
+ headers = {**headers, **default_headers}
+ elif set_default_headers is not None:
+ headers = set_default_headers
+
+ params = self._custom_query
+ if default_query is not None:
+ params = {**params, **default_query}
+ elif set_default_query is not None:
+ params = set_default_query
+
+ return self.__class__(
+ aws_secret_key=aws_secret_key or self.aws_secret_key,
+ aws_access_key=aws_access_key or self.aws_access_key,
+ aws_region=aws_region or self.aws_region,
+ aws_session_token=aws_session_token or self.aws_session_token,
+ base_url=base_url or self.base_url,
+ timeout=self.timeout if isinstance(timeout, NotGiven) else timeout,
+ http_client=http_client,
+ max_retries=max_retries if is_given(max_retries) else self.max_retries,
+ default_headers=headers,
+ default_query=params,
+ **_extra_kwargs,
+ )
+
+ # Alias for `copy` for nicer inline usage, e.g.
+ # client.with_options(timeout=10).foo.create(...)
+ with_options = copy
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_stream.py b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_stream.py
new file mode 100644
index 00000000..6512c468
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_stream.py
@@ -0,0 +1,37 @@
+from __future__ import annotations
+
+from typing import TypeVar
+
+import httpx
+
+from ..._client import Anthropic, AsyncAnthropic
+from ..._streaming import Stream, AsyncStream
+from ._stream_decoder import AWSEventStreamDecoder
+
+_T = TypeVar("_T")
+
+
+class BedrockStream(Stream[_T]):
+ def __init__(
+ self,
+ *,
+ cast_to: type[_T],
+ response: httpx.Response,
+ client: Anthropic,
+ ) -> None:
+ super().__init__(cast_to=cast_to, response=response, client=client)
+
+ self._decoder = AWSEventStreamDecoder()
+
+
+class AsyncBedrockStream(AsyncStream[_T]):
+ def __init__(
+ self,
+ *,
+ cast_to: type[_T],
+ response: httpx.Response,
+ client: AsyncAnthropic,
+ ) -> None:
+ super().__init__(cast_to=cast_to, response=response, client=client)
+
+ self._decoder = AWSEventStreamDecoder()
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_stream_decoder.py b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_stream_decoder.py
new file mode 100644
index 00000000..02e81a3c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/bedrock/_stream_decoder.py
@@ -0,0 +1,64 @@
+from __future__ import annotations
+
+from typing import TYPE_CHECKING, Iterator, AsyncIterator
+
+from ..._utils import lru_cache
+from ..._streaming import ServerSentEvent
+
+if TYPE_CHECKING:
+ from botocore.model import Shape
+ from botocore.eventstream import EventStreamMessage
+
+
+@lru_cache(maxsize=None)
+def get_response_stream_shape() -> Shape:
+ from botocore.model import ServiceModel
+ from botocore.loaders import Loader
+
+ loader = Loader()
+ bedrock_service_dict = loader.load_service_model("bedrock-runtime", "service-2")
+ bedrock_service_model = ServiceModel(bedrock_service_dict)
+ return bedrock_service_model.shape_for("ResponseStream")
+
+
+class AWSEventStreamDecoder:
+ def __init__(self) -> None:
+ from botocore.parsers import EventStreamJSONParser
+
+ self.parser = EventStreamJSONParser()
+
+ def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]:
+ """Given an iterator that yields lines, iterate over it & yield every event encountered"""
+ from botocore.eventstream import EventStreamBuffer
+
+ event_stream_buffer = EventStreamBuffer()
+ for chunk in iterator:
+ event_stream_buffer.add_data(chunk)
+ for event in event_stream_buffer:
+ message = self._parse_message_from_event(event)
+ if message:
+ yield ServerSentEvent(data=message, event="completion")
+
+ async def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]:
+ """Given an async iterator that yields lines, iterate over it & yield every event encountered"""
+ from botocore.eventstream import EventStreamBuffer
+
+ event_stream_buffer = EventStreamBuffer()
+ async for chunk in iterator:
+ event_stream_buffer.add_data(chunk)
+ for event in event_stream_buffer:
+ message = self._parse_message_from_event(event)
+ if message:
+ yield ServerSentEvent(data=message, event="completion")
+
+ def _parse_message_from_event(self, event: EventStreamMessage) -> str | None:
+ response_dict = event.to_response_dict()
+ parsed_response = self.parser.parse(response_dict, get_response_stream_shape())
+ if response_dict["status_code"] != 200:
+ raise ValueError(f"Bad response code, expected 200: {response_dict}")
+
+ chunk = parsed_response.get("chunk")
+ if not chunk:
+ return None
+
+ return chunk.get("bytes").decode() # type: ignore[no-any-return]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/__init__.py
new file mode 100644
index 00000000..103fff58
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/__init__.py
@@ -0,0 +1,26 @@
+from ._types import (
+ TextEvent as TextEvent,
+ InputJsonEvent as InputJsonEvent,
+ MessageStopEvent as MessageStopEvent,
+ MessageStreamEvent as MessageStreamEvent,
+ ContentBlockStopEvent as ContentBlockStopEvent,
+)
+from ._messages import (
+ MessageStream as MessageStream,
+ AsyncMessageStream as AsyncMessageStream,
+ MessageStreamManager as MessageStreamManager,
+ AsyncMessageStreamManager as AsyncMessageStreamManager,
+)
+from ._beta_types import (
+ BetaTextEvent as BetaTextEvent,
+ BetaInputJsonEvent as BetaInputJsonEvent,
+ BetaMessageStopEvent as BetaMessageStopEvent,
+ BetaMessageStreamEvent as BetaMessageStreamEvent,
+ BetaContentBlockStopEvent as BetaContentBlockStopEvent,
+)
+from ._beta_messages import (
+ BetaMessageStream as BetaMessageStream,
+ BetaAsyncMessageStream as BetaAsyncMessageStream,
+ BetaMessageStreamManager as BetaMessageStreamManager,
+ BetaAsyncMessageStreamManager as BetaAsyncMessageStreamManager,
+)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_beta_messages.py b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_beta_messages.py
new file mode 100644
index 00000000..d979f83c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_beta_messages.py
@@ -0,0 +1,462 @@
+from __future__ import annotations
+
+from types import TracebackType
+from typing import TYPE_CHECKING, Any, Type, Callable, cast
+from typing_extensions import Self, Iterator, Awaitable, AsyncIterator, assert_never
+
+import httpx
+from pydantic import BaseModel
+
+from ..._utils import consume_sync_iterator, consume_async_iterator
+from ..._models import build, construct_type, construct_type_unchecked
+from ._beta_types import (
+ BetaTextEvent,
+ BetaCitationEvent,
+ BetaThinkingEvent,
+ BetaInputJsonEvent,
+ BetaSignatureEvent,
+ BetaMessageStopEvent,
+ BetaMessageStreamEvent,
+ BetaContentBlockStopEvent,
+)
+from ..._streaming import Stream, AsyncStream
+from ...types.beta import BetaMessage, BetaContentBlock, BetaRawMessageStreamEvent
+
+
+class BetaMessageStream:
+ text_stream: Iterator[str]
+ """Iterator over just the text deltas in the stream.
+
+ ```py
+ for text in stream.text_stream:
+ print(text, end="", flush=True)
+ print()
+ ```
+ """
+
+ def __init__(self, raw_stream: Stream[BetaRawMessageStreamEvent]) -> None:
+ self._raw_stream = raw_stream
+ self.text_stream = self.__stream_text__()
+ self._iterator = self.__stream__()
+ self.__final_message_snapshot: BetaMessage | None = None
+
+ @property
+ def response(self) -> httpx.Response:
+ return self._raw_stream.response
+
+ @property
+ def request_id(self) -> str | None:
+ return self.response.headers.get("request-id") # type: ignore[no-any-return]
+
+ def __next__(self) -> BetaMessageStreamEvent:
+ return self._iterator.__next__()
+
+ def __iter__(self) -> Iterator[BetaMessageStreamEvent]:
+ for item in self._iterator:
+ yield item
+
+ def __enter__(self) -> Self:
+ return self
+
+ def __exit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ self.close()
+
+ def close(self) -> None:
+ """
+ Close the response and release the connection.
+
+ Automatically called if the response body is read to completion.
+ """
+ self._raw_stream.close()
+
+ def get_final_message(self) -> BetaMessage:
+ """Waits until the stream has been read to completion and returns
+ the accumulated `Message` object.
+ """
+ self.until_done()
+ assert self.__final_message_snapshot is not None
+ return self.__final_message_snapshot
+
+ def get_final_text(self) -> str:
+ """Returns all `text` content blocks concatenated together.
+
+ > [!NOTE]
+ > Currently the API will only respond with a single content block.
+
+ Will raise an error if no `text` content blocks were returned.
+ """
+ message = self.get_final_message()
+ text_blocks: list[str] = []
+ for block in message.content:
+ if block.type == "text":
+ text_blocks.append(block.text)
+
+ if not text_blocks:
+ raise RuntimeError("Expected to have received at least 1 text block")
+
+ return "".join(text_blocks)
+
+ def until_done(self) -> None:
+ """Blocks until the stream has been consumed"""
+ consume_sync_iterator(self)
+
+ # properties
+ @property
+ def current_message_snapshot(self) -> BetaMessage:
+ assert self.__final_message_snapshot is not None
+ return self.__final_message_snapshot
+
+ def __stream__(self) -> Iterator[BetaMessageStreamEvent]:
+ for sse_event in self._raw_stream:
+ self.__final_message_snapshot = accumulate_event(
+ event=sse_event,
+ current_snapshot=self.__final_message_snapshot,
+ )
+
+ events_to_fire = build_events(event=sse_event, message_snapshot=self.current_message_snapshot)
+ for event in events_to_fire:
+ yield event
+
+ def __stream_text__(self) -> Iterator[str]:
+ for chunk in self:
+ if chunk.type == "content_block_delta" and chunk.delta.type == "text_delta":
+ yield chunk.delta.text
+
+
+class BetaMessageStreamManager:
+ """Wrapper over MessageStream that is returned by `.stream()`.
+
+ ```py
+ with client.beta.messages.stream(...) as stream:
+ for chunk in stream:
+ ...
+ ```
+ """
+
+ def __init__(
+ self,
+ api_request: Callable[[], Stream[BetaRawMessageStreamEvent]],
+ ) -> None:
+ self.__stream: BetaMessageStream | None = None
+ self.__api_request = api_request
+
+ def __enter__(self) -> BetaMessageStream:
+ raw_stream = self.__api_request()
+ self.__stream = BetaMessageStream(raw_stream)
+ return self.__stream
+
+ def __exit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ if self.__stream is not None:
+ self.__stream.close()
+
+
+class BetaAsyncMessageStream:
+ text_stream: AsyncIterator[str]
+ """Async iterator over just the text deltas in the stream.
+
+ ```py
+ async for text in stream.text_stream:
+ print(text, end="", flush=True)
+ print()
+ ```
+ """
+
+ def __init__(self, raw_stream: AsyncStream[BetaRawMessageStreamEvent]) -> None:
+ self._raw_stream = raw_stream
+ self.text_stream = self.__stream_text__()
+ self._iterator = self.__stream__()
+ self.__final_message_snapshot: BetaMessage | None = None
+
+ @property
+ def response(self) -> httpx.Response:
+ return self._raw_stream.response
+
+ @property
+ def request_id(self) -> str | None:
+ return self.response.headers.get("request-id") # type: ignore[no-any-return]
+
+ async def __anext__(self) -> BetaMessageStreamEvent:
+ return await self._iterator.__anext__()
+
+ async def __aiter__(self) -> AsyncIterator[BetaMessageStreamEvent]:
+ async for item in self._iterator:
+ yield item
+
+ async def __aenter__(self) -> Self:
+ return self
+
+ async def __aexit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ await self.close()
+
+ async def close(self) -> None:
+ """
+ Close the response and release the connection.
+
+ Automatically called if the response body is read to completion.
+ """
+ await self._raw_stream.close()
+
+ async def get_final_message(self) -> BetaMessage:
+ """Waits until the stream has been read to completion and returns
+ the accumulated `Message` object.
+ """
+ await self.until_done()
+ assert self.__final_message_snapshot is not None
+ return self.__final_message_snapshot
+
+ async def get_final_text(self) -> str:
+ """Returns all `text` content blocks concatenated together.
+
+ > [!NOTE]
+ > Currently the API will only respond with a single content block.
+
+ Will raise an error if no `text` content blocks were returned.
+ """
+ message = await self.get_final_message()
+ text_blocks: list[str] = []
+ for block in message.content:
+ if block.type == "text":
+ text_blocks.append(block.text)
+
+ if not text_blocks:
+ raise RuntimeError("Expected to have received at least 1 text block")
+
+ return "".join(text_blocks)
+
+ async def until_done(self) -> None:
+ """Waits until the stream has been consumed"""
+ await consume_async_iterator(self)
+
+ # properties
+ @property
+ def current_message_snapshot(self) -> BetaMessage:
+ assert self.__final_message_snapshot is not None
+ return self.__final_message_snapshot
+
+ async def __stream__(self) -> AsyncIterator[BetaMessageStreamEvent]:
+ async for sse_event in self._raw_stream:
+ self.__final_message_snapshot = accumulate_event(
+ event=sse_event,
+ current_snapshot=self.__final_message_snapshot,
+ )
+
+ events_to_fire = build_events(event=sse_event, message_snapshot=self.current_message_snapshot)
+ for event in events_to_fire:
+ yield event
+
+ async def __stream_text__(self) -> AsyncIterator[str]:
+ async for chunk in self:
+ if chunk.type == "content_block_delta" and chunk.delta.type == "text_delta":
+ yield chunk.delta.text
+
+
+class BetaAsyncMessageStreamManager:
+ """Wrapper over BetaAsyncMessageStream that is returned by `.stream()`
+ so that an async context manager can be used without `await`ing the
+ original client call.
+
+ ```py
+ async with client.beta.messages.stream(...) as stream:
+ async for chunk in stream:
+ ...
+ ```
+ """
+
+ def __init__(
+ self,
+ api_request: Awaitable[AsyncStream[BetaRawMessageStreamEvent]],
+ ) -> None:
+ self.__stream: BetaAsyncMessageStream | None = None
+ self.__api_request = api_request
+
+ async def __aenter__(self) -> BetaAsyncMessageStream:
+ raw_stream = await self.__api_request
+ self.__stream = BetaAsyncMessageStream(raw_stream)
+ return self.__stream
+
+ async def __aexit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ if self.__stream is not None:
+ await self.__stream.close()
+
+
+def build_events(
+ *,
+ event: BetaRawMessageStreamEvent,
+ message_snapshot: BetaMessage,
+) -> list[BetaMessageStreamEvent]:
+ events_to_fire: list[BetaMessageStreamEvent] = []
+
+ if event.type == "message_start":
+ events_to_fire.append(event)
+ elif event.type == "message_delta":
+ events_to_fire.append(event)
+ elif event.type == "message_stop":
+ events_to_fire.append(build(BetaMessageStopEvent, type="message_stop", message=message_snapshot))
+ elif event.type == "content_block_start":
+ events_to_fire.append(event)
+ elif event.type == "content_block_delta":
+ events_to_fire.append(event)
+
+ content_block = message_snapshot.content[event.index]
+ if event.delta.type == "text_delta":
+ if content_block.type == "text":
+ events_to_fire.append(
+ build(
+ BetaTextEvent,
+ type="text",
+ text=event.delta.text,
+ snapshot=content_block.text,
+ )
+ )
+ elif event.delta.type == "input_json_delta":
+ if content_block.type == "tool_use":
+ events_to_fire.append(
+ build(
+ BetaInputJsonEvent,
+ type="input_json",
+ partial_json=event.delta.partial_json,
+ snapshot=content_block.input,
+ )
+ )
+ elif event.delta.type == "citations_delta":
+ if content_block.type == "text":
+ events_to_fire.append(
+ build(
+ BetaCitationEvent,
+ type="citation",
+ citation=event.delta.citation,
+ snapshot=content_block.citations or [],
+ )
+ )
+ elif event.delta.type == "thinking_delta":
+ if content_block.type == "thinking":
+ events_to_fire.append(
+ build(
+ BetaThinkingEvent,
+ type="thinking",
+ thinking=event.delta.thinking,
+ snapshot=content_block.thinking,
+ )
+ )
+ elif event.delta.type == "signature_delta":
+ if content_block.type == "thinking":
+ events_to_fire.append(
+ build(
+ BetaSignatureEvent,
+ type="signature",
+ signature=content_block.signature,
+ )
+ )
+ pass
+ else:
+ # we only want exhaustive checking for linters, not at runtime
+ if TYPE_CHECKING: # type: ignore[unreachable]
+ assert_never(event.delta)
+ elif event.type == "content_block_stop":
+ content_block = message_snapshot.content[event.index]
+
+ events_to_fire.append(
+ build(BetaContentBlockStopEvent, type="content_block_stop", index=event.index, content_block=content_block),
+ )
+ else:
+ # we only want exhaustive checking for linters, not at runtime
+ if TYPE_CHECKING: # type: ignore[unreachable]
+ assert_never(event)
+
+ return events_to_fire
+
+
+JSON_BUF_PROPERTY = "__json_buf"
+
+
+def accumulate_event(
+ *,
+ event: BetaRawMessageStreamEvent,
+ current_snapshot: BetaMessage | None,
+) -> BetaMessage:
+ if not isinstance(cast(Any, event), BaseModel):
+ event = cast( # pyright: ignore[reportUnnecessaryCast]
+ BetaRawMessageStreamEvent,
+ construct_type_unchecked(
+ type_=cast(Type[BetaRawMessageStreamEvent], BetaRawMessageStreamEvent),
+ value=event,
+ ),
+ )
+ if not isinstance(cast(Any, event), BaseModel):
+ raise TypeError(f"Unexpected event runtime type, after deserialising twice - {event} - {type(event)}")
+
+ if current_snapshot is None:
+ if event.type == "message_start":
+ return BetaMessage.construct(**cast(Any, event.message.to_dict()))
+
+ raise RuntimeError(f'Unexpected event order, got {event.type} before "message_start"')
+
+ if event.type == "content_block_start":
+ # TODO: check index
+ current_snapshot.content.append(
+ cast(
+ BetaContentBlock,
+ construct_type(type_=BetaContentBlock, value=event.content_block.model_dump()),
+ ),
+ )
+ elif event.type == "content_block_delta":
+ content = current_snapshot.content[event.index]
+ if event.delta.type == "text_delta":
+ if content.type == "text":
+ content.text += event.delta.text
+ elif event.delta.type == "input_json_delta":
+ if content.type == "tool_use":
+ from jiter import from_json
+
+ # we need to keep track of the raw JSON string as well so that we can
+ # re-parse it for each delta, for now we just store it as an untyped
+ # property on the snapshot
+ json_buf = cast(bytes, getattr(content, JSON_BUF_PROPERTY, b""))
+ json_buf += bytes(event.delta.partial_json, "utf-8")
+
+ if json_buf:
+ content.input = from_json(json_buf, partial_mode=True)
+
+ setattr(content, JSON_BUF_PROPERTY, json_buf)
+ elif event.delta.type == "citations_delta":
+ if content.type == "text":
+ if not content.citations:
+ content.citations = [event.delta.citation]
+ else:
+ content.citations.append(event.delta.citation)
+ elif event.delta.type == "thinking_delta":
+ if content.type == "thinking":
+ content.thinking += event.delta.thinking
+ elif event.delta.type == "signature_delta":
+ if content.type == "thinking":
+ content.signature = event.delta.signature
+ else:
+ # we only want exhaustive checking for linters, not at runtime
+ if TYPE_CHECKING: # type: ignore[unreachable]
+ assert_never(event.delta)
+ elif event.type == "message_delta":
+ current_snapshot.stop_reason = event.delta.stop_reason
+ current_snapshot.stop_sequence = event.delta.stop_sequence
+ current_snapshot.usage.output_tokens = event.usage.output_tokens
+
+ return current_snapshot
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_beta_types.py b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_beta_types.py
new file mode 100644
index 00000000..24bb710c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_beta_types.py
@@ -0,0 +1,100 @@
+from typing import Union
+from typing_extensions import List, Literal, Annotated
+
+from ..._models import BaseModel
+from ...types.beta import (
+ BetaMessage,
+ BetaContentBlock,
+ BetaRawMessageStopEvent,
+ BetaRawMessageDeltaEvent,
+ BetaRawMessageStartEvent,
+ BetaRawContentBlockStopEvent,
+ BetaRawContentBlockDeltaEvent,
+ BetaRawContentBlockStartEvent,
+)
+from ..._utils._transform import PropertyInfo
+from ...types.beta.beta_citations_delta import Citation
+
+
+class BetaTextEvent(BaseModel):
+ type: Literal["text"]
+
+ text: str
+ """The text delta"""
+
+ snapshot: str
+ """The entire accumulated text"""
+
+
+class BetaCitationEvent(BaseModel):
+ type: Literal["citation"]
+
+ citation: Citation
+ """The new citation"""
+
+ snapshot: List[Citation]
+ """All of the accumulated citations"""
+
+
+class BetaThinkingEvent(BaseModel):
+ type: Literal["thinking"]
+
+ thinking: str
+ """The thinking delta"""
+
+ snapshot: str
+ """The accumulated thinking so far"""
+
+
+class BetaSignatureEvent(BaseModel):
+ type: Literal["signature"]
+
+ signature: str
+ """The signature of the thinking block"""
+
+
+class BetaInputJsonEvent(BaseModel):
+ type: Literal["input_json"]
+
+ partial_json: str
+ """A partial JSON string delta
+
+ e.g. `'"San Francisco,'`
+ """
+
+ snapshot: object
+ """The currently accumulated parsed object.
+
+
+ e.g. `{'location': 'San Francisco, CA'}`
+ """
+
+
+class BetaMessageStopEvent(BetaRawMessageStopEvent):
+ type: Literal["message_stop"]
+
+ message: BetaMessage
+
+
+class BetaContentBlockStopEvent(BetaRawContentBlockStopEvent):
+ type: Literal["content_block_stop"]
+
+ content_block: BetaContentBlock
+
+
+BetaMessageStreamEvent = Annotated[
+ Union[
+ BetaTextEvent,
+ BetaCitationEvent,
+ BetaThinkingEvent,
+ BetaSignatureEvent,
+ BetaInputJsonEvent,
+ BetaRawMessageStartEvent,
+ BetaRawMessageDeltaEvent,
+ BetaMessageStopEvent,
+ BetaRawContentBlockStartEvent,
+ BetaRawContentBlockDeltaEvent,
+ BetaContentBlockStopEvent,
+ ],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_messages.py b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_messages.py
new file mode 100644
index 00000000..09ed24f9
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_messages.py
@@ -0,0 +1,462 @@
+from __future__ import annotations
+
+from types import TracebackType
+from typing import TYPE_CHECKING, Any, Type, Callable, cast
+from typing_extensions import Self, Iterator, Awaitable, AsyncIterator, assert_never
+
+import httpx
+from pydantic import BaseModel
+
+from ._types import (
+ TextEvent,
+ CitationEvent,
+ ThinkingEvent,
+ InputJsonEvent,
+ SignatureEvent,
+ MessageStopEvent,
+ MessageStreamEvent,
+ ContentBlockStopEvent,
+)
+from ...types import Message, ContentBlock, RawMessageStreamEvent
+from ..._utils import consume_sync_iterator, consume_async_iterator
+from ..._models import build, construct_type, construct_type_unchecked
+from ..._streaming import Stream, AsyncStream
+
+
+class MessageStream:
+ text_stream: Iterator[str]
+ """Iterator over just the text deltas in the stream.
+
+ ```py
+ for text in stream.text_stream:
+ print(text, end="", flush=True)
+ print()
+ ```
+ """
+
+ def __init__(self, raw_stream: Stream[RawMessageStreamEvent]) -> None:
+ self._raw_stream = raw_stream
+ self.text_stream = self.__stream_text__()
+ self._iterator = self.__stream__()
+ self.__final_message_snapshot: Message | None = None
+
+ @property
+ def response(self) -> httpx.Response:
+ return self._raw_stream.response
+
+ @property
+ def request_id(self) -> str | None:
+ return self.response.headers.get("request-id") # type: ignore[no-any-return]
+
+ def __next__(self) -> MessageStreamEvent:
+ return self._iterator.__next__()
+
+ def __iter__(self) -> Iterator[MessageStreamEvent]:
+ for item in self._iterator:
+ yield item
+
+ def __enter__(self) -> Self:
+ return self
+
+ def __exit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ self.close()
+
+ def close(self) -> None:
+ """
+ Close the response and release the connection.
+
+ Automatically called if the response body is read to completion.
+ """
+ self._raw_stream.close()
+
+ def get_final_message(self) -> Message:
+ """Waits until the stream has been read to completion and returns
+ the accumulated `Message` object.
+ """
+ self.until_done()
+ assert self.__final_message_snapshot is not None
+ return self.__final_message_snapshot
+
+ def get_final_text(self) -> str:
+ """Returns all `text` content blocks concatenated together.
+
+ > [!NOTE]
+ > Currently the API will only respond with a single content block.
+
+ Will raise an error if no `text` content blocks were returned.
+ """
+ message = self.get_final_message()
+ text_blocks: list[str] = []
+ for block in message.content:
+ if block.type == "text":
+ text_blocks.append(block.text)
+
+ if not text_blocks:
+ raise RuntimeError("Expected to have received at least 1 text block")
+
+ return "".join(text_blocks)
+
+ def until_done(self) -> None:
+ """Blocks until the stream has been consumed"""
+ consume_sync_iterator(self)
+
+ # properties
+ @property
+ def current_message_snapshot(self) -> Message:
+ assert self.__final_message_snapshot is not None
+ return self.__final_message_snapshot
+
+ def __stream__(self) -> Iterator[MessageStreamEvent]:
+ for sse_event in self._raw_stream:
+ self.__final_message_snapshot = accumulate_event(
+ event=sse_event,
+ current_snapshot=self.__final_message_snapshot,
+ )
+
+ events_to_fire = build_events(event=sse_event, message_snapshot=self.current_message_snapshot)
+ for event in events_to_fire:
+ yield event
+
+ def __stream_text__(self) -> Iterator[str]:
+ for chunk in self:
+ if chunk.type == "content_block_delta" and chunk.delta.type == "text_delta":
+ yield chunk.delta.text
+
+
+class MessageStreamManager:
+ """Wrapper over MessageStream that is returned by `.stream()`.
+
+ ```py
+ with client.messages.stream(...) as stream:
+ for chunk in stream:
+ ...
+ ```
+ """
+
+ def __init__(
+ self,
+ api_request: Callable[[], Stream[RawMessageStreamEvent]],
+ ) -> None:
+ self.__stream: MessageStream | None = None
+ self.__api_request = api_request
+
+ def __enter__(self) -> MessageStream:
+ raw_stream = self.__api_request()
+ self.__stream = MessageStream(raw_stream)
+ return self.__stream
+
+ def __exit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ if self.__stream is not None:
+ self.__stream.close()
+
+
+class AsyncMessageStream:
+ text_stream: AsyncIterator[str]
+ """Async iterator over just the text deltas in the stream.
+
+ ```py
+ async for text in stream.text_stream:
+ print(text, end="", flush=True)
+ print()
+ ```
+ """
+
+ def __init__(self, raw_stream: AsyncStream[RawMessageStreamEvent]) -> None:
+ self._raw_stream = raw_stream
+ self.text_stream = self.__stream_text__()
+ self._iterator = self.__stream__()
+ self.__final_message_snapshot: Message | None = None
+
+ @property
+ def response(self) -> httpx.Response:
+ return self._raw_stream.response
+
+ @property
+ def request_id(self) -> str | None:
+ return self.response.headers.get("request-id") # type: ignore[no-any-return]
+
+ async def __anext__(self) -> MessageStreamEvent:
+ return await self._iterator.__anext__()
+
+ async def __aiter__(self) -> AsyncIterator[MessageStreamEvent]:
+ async for item in self._iterator:
+ yield item
+
+ async def __aenter__(self) -> Self:
+ return self
+
+ async def __aexit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ await self.close()
+
+ async def close(self) -> None:
+ """
+ Close the response and release the connection.
+
+ Automatically called if the response body is read to completion.
+ """
+ await self._raw_stream.close()
+
+ async def get_final_message(self) -> Message:
+ """Waits until the stream has been read to completion and returns
+ the accumulated `Message` object.
+ """
+ await self.until_done()
+ assert self.__final_message_snapshot is not None
+ return self.__final_message_snapshot
+
+ async def get_final_text(self) -> str:
+ """Returns all `text` content blocks concatenated together.
+
+ > [!NOTE]
+ > Currently the API will only respond with a single content block.
+
+ Will raise an error if no `text` content blocks were returned.
+ """
+ message = await self.get_final_message()
+ text_blocks: list[str] = []
+ for block in message.content:
+ if block.type == "text":
+ text_blocks.append(block.text)
+
+ if not text_blocks:
+ raise RuntimeError("Expected to have received at least 1 text block")
+
+ return "".join(text_blocks)
+
+ async def until_done(self) -> None:
+ """Waits until the stream has been consumed"""
+ await consume_async_iterator(self)
+
+ # properties
+ @property
+ def current_message_snapshot(self) -> Message:
+ assert self.__final_message_snapshot is not None
+ return self.__final_message_snapshot
+
+ async def __stream__(self) -> AsyncIterator[MessageStreamEvent]:
+ async for sse_event in self._raw_stream:
+ self.__final_message_snapshot = accumulate_event(
+ event=sse_event,
+ current_snapshot=self.__final_message_snapshot,
+ )
+
+ events_to_fire = build_events(event=sse_event, message_snapshot=self.current_message_snapshot)
+ for event in events_to_fire:
+ yield event
+
+ async def __stream_text__(self) -> AsyncIterator[str]:
+ async for chunk in self:
+ if chunk.type == "content_block_delta" and chunk.delta.type == "text_delta":
+ yield chunk.delta.text
+
+
+class AsyncMessageStreamManager:
+ """Wrapper over AsyncMessageStream that is returned by `.stream()`
+ so that an async context manager can be used without `await`ing the
+ original client call.
+
+ ```py
+ async with client.messages.stream(...) as stream:
+ async for chunk in stream:
+ ...
+ ```
+ """
+
+ def __init__(
+ self,
+ api_request: Awaitable[AsyncStream[RawMessageStreamEvent]],
+ ) -> None:
+ self.__stream: AsyncMessageStream | None = None
+ self.__api_request = api_request
+
+ async def __aenter__(self) -> AsyncMessageStream:
+ raw_stream = await self.__api_request
+ self.__stream = AsyncMessageStream(raw_stream)
+ return self.__stream
+
+ async def __aexit__(
+ self,
+ exc_type: type[BaseException] | None,
+ exc: BaseException | None,
+ exc_tb: TracebackType | None,
+ ) -> None:
+ if self.__stream is not None:
+ await self.__stream.close()
+
+
+def build_events(
+ *,
+ event: RawMessageStreamEvent,
+ message_snapshot: Message,
+) -> list[MessageStreamEvent]:
+ events_to_fire: list[MessageStreamEvent] = []
+
+ if event.type == "message_start":
+ events_to_fire.append(event)
+ elif event.type == "message_delta":
+ events_to_fire.append(event)
+ elif event.type == "message_stop":
+ events_to_fire.append(build(MessageStopEvent, type="message_stop", message=message_snapshot))
+ elif event.type == "content_block_start":
+ events_to_fire.append(event)
+ elif event.type == "content_block_delta":
+ events_to_fire.append(event)
+
+ content_block = message_snapshot.content[event.index]
+ if event.delta.type == "text_delta":
+ if content_block.type == "text":
+ events_to_fire.append(
+ build(
+ TextEvent,
+ type="text",
+ text=event.delta.text,
+ snapshot=content_block.text,
+ )
+ )
+ elif event.delta.type == "input_json_delta":
+ if content_block.type == "tool_use":
+ events_to_fire.append(
+ build(
+ InputJsonEvent,
+ type="input_json",
+ partial_json=event.delta.partial_json,
+ snapshot=content_block.input,
+ )
+ )
+ elif event.delta.type == "citations_delta":
+ if content_block.type == "text":
+ events_to_fire.append(
+ build(
+ CitationEvent,
+ type="citation",
+ citation=event.delta.citation,
+ snapshot=content_block.citations or [],
+ )
+ )
+ elif event.delta.type == "thinking_delta":
+ if content_block.type == "thinking":
+ events_to_fire.append(
+ build(
+ ThinkingEvent,
+ type="thinking",
+ thinking=event.delta.thinking,
+ snapshot=content_block.thinking,
+ )
+ )
+ elif event.delta.type == "signature_delta":
+ if content_block.type == "thinking":
+ events_to_fire.append(
+ build(
+ SignatureEvent,
+ type="signature",
+ signature=content_block.signature,
+ )
+ )
+ pass
+ else:
+ # we only want exhaustive checking for linters, not at runtime
+ if TYPE_CHECKING: # type: ignore[unreachable]
+ assert_never(event.delta)
+ elif event.type == "content_block_stop":
+ content_block = message_snapshot.content[event.index]
+
+ events_to_fire.append(
+ build(ContentBlockStopEvent, type="content_block_stop", index=event.index, content_block=content_block),
+ )
+ else:
+ # we only want exhaustive checking for linters, not at runtime
+ if TYPE_CHECKING: # type: ignore[unreachable]
+ assert_never(event)
+
+ return events_to_fire
+
+
+JSON_BUF_PROPERTY = "__json_buf"
+
+
+def accumulate_event(
+ *,
+ event: RawMessageStreamEvent,
+ current_snapshot: Message | None,
+) -> Message:
+ if not isinstance(cast(Any, event), BaseModel):
+ event = cast( # pyright: ignore[reportUnnecessaryCast]
+ RawMessageStreamEvent,
+ construct_type_unchecked(
+ type_=cast(Type[RawMessageStreamEvent], RawMessageStreamEvent),
+ value=event,
+ ),
+ )
+ if not isinstance(cast(Any, event), BaseModel):
+ raise TypeError(f"Unexpected event runtime type, after deserialising twice - {event} - {type(event)}")
+
+ if current_snapshot is None:
+ if event.type == "message_start":
+ return Message.construct(**cast(Any, event.message.to_dict()))
+
+ raise RuntimeError(f'Unexpected event order, got {event.type} before "message_start"')
+
+ if event.type == "content_block_start":
+ # TODO: check index
+ current_snapshot.content.append(
+ cast(
+ ContentBlock,
+ construct_type(type_=ContentBlock, value=event.content_block.model_dump()),
+ ),
+ )
+ elif event.type == "content_block_delta":
+ content = current_snapshot.content[event.index]
+ if event.delta.type == "text_delta":
+ if content.type == "text":
+ content.text += event.delta.text
+ elif event.delta.type == "input_json_delta":
+ if content.type == "tool_use":
+ from jiter import from_json
+
+ # we need to keep track of the raw JSON string as well so that we can
+ # re-parse it for each delta, for now we just store it as an untyped
+ # property on the snapshot
+ json_buf = cast(bytes, getattr(content, JSON_BUF_PROPERTY, b""))
+ json_buf += bytes(event.delta.partial_json, "utf-8")
+
+ if json_buf:
+ content.input = from_json(json_buf, partial_mode=True)
+
+ setattr(content, JSON_BUF_PROPERTY, json_buf)
+ elif event.delta.type == "citations_delta":
+ if content.type == "text":
+ if not content.citations:
+ content.citations = [event.delta.citation]
+ else:
+ content.citations.append(event.delta.citation)
+ elif event.delta.type == "thinking_delta":
+ if content.type == "thinking":
+ content.thinking += event.delta.thinking
+ elif event.delta.type == "signature_delta":
+ if content.type == "thinking":
+ content.signature = event.delta.signature
+ else:
+ # we only want exhaustive checking for linters, not at runtime
+ if TYPE_CHECKING: # type: ignore[unreachable]
+ assert_never(event.delta)
+ elif event.type == "message_delta":
+ current_snapshot.stop_reason = event.delta.stop_reason
+ current_snapshot.stop_sequence = event.delta.stop_sequence
+ current_snapshot.usage.output_tokens = event.usage.output_tokens
+
+ return current_snapshot
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_types.py b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_types.py
new file mode 100644
index 00000000..0918427a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/streaming/_types.py
@@ -0,0 +1,100 @@
+from typing import Union
+from typing_extensions import List, Literal, Annotated
+
+from ...types import (
+ Message,
+ ContentBlock,
+ MessageDeltaEvent as RawMessageDeltaEvent,
+ MessageStartEvent as RawMessageStartEvent,
+ RawMessageStopEvent,
+ ContentBlockDeltaEvent as RawContentBlockDeltaEvent,
+ ContentBlockStartEvent as RawContentBlockStartEvent,
+ RawContentBlockStopEvent,
+)
+from ..._models import BaseModel
+from ..._utils._transform import PropertyInfo
+from ...types.citations_delta import Citation
+
+
+class TextEvent(BaseModel):
+ type: Literal["text"]
+
+ text: str
+ """The text delta"""
+
+ snapshot: str
+ """The entire accumulated text"""
+
+
+class CitationEvent(BaseModel):
+ type: Literal["citation"]
+
+ citation: Citation
+ """The new citation"""
+
+ snapshot: List[Citation]
+ """All of the accumulated citations"""
+
+
+class ThinkingEvent(BaseModel):
+ type: Literal["thinking"]
+
+ thinking: str
+ """The thinking delta"""
+
+ snapshot: str
+ """The accumulated thinking so far"""
+
+
+class SignatureEvent(BaseModel):
+ type: Literal["signature"]
+
+ signature: str
+ """The signature of the thinking block"""
+
+
+class InputJsonEvent(BaseModel):
+ type: Literal["input_json"]
+
+ partial_json: str
+ """A partial JSON string delta
+
+ e.g. `'"San Francisco,'`
+ """
+
+ snapshot: object
+ """The currently accumulated parsed object.
+
+
+ e.g. `{'location': 'San Francisco, CA'}`
+ """
+
+
+class MessageStopEvent(RawMessageStopEvent):
+ type: Literal["message_stop"]
+
+ message: Message
+
+
+class ContentBlockStopEvent(RawContentBlockStopEvent):
+ type: Literal["content_block_stop"]
+
+ content_block: ContentBlock
+
+
+MessageStreamEvent = Annotated[
+ Union[
+ TextEvent,
+ CitationEvent,
+ ThinkingEvent,
+ SignatureEvent,
+ InputJsonEvent,
+ RawMessageStartEvent,
+ RawMessageDeltaEvent,
+ MessageStopEvent,
+ RawContentBlockStartEvent,
+ RawContentBlockDeltaEvent,
+ ContentBlockStopEvent,
+ ],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/__init__.py
new file mode 100644
index 00000000..45b6301e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/__init__.py
@@ -0,0 +1 @@
+from ._client import AnthropicVertex as AnthropicVertex, AsyncAnthropicVertex as AsyncAnthropicVertex
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_auth.py b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_auth.py
new file mode 100644
index 00000000..3063016a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_auth.py
@@ -0,0 +1,42 @@
+from __future__ import annotations
+
+from typing import TYPE_CHECKING, Any, cast
+
+from .._extras import google_auth
+
+if TYPE_CHECKING:
+ from google.auth.credentials import Credentials # type: ignore[import-untyped]
+
+# pyright: reportMissingTypeStubs=false, reportUnknownVariableType=false, reportUnknownMemberType=false, reportUnknownArgumentType=false
+# google libraries don't provide types :/
+
+# Note: these functions are blocking as they make HTTP requests, the async
+# client runs these functions in a separate thread to ensure they do not
+# cause synchronous blocking issues.
+
+
+def load_auth(*, project_id: str | None) -> tuple[Credentials, str]:
+ from google.auth.transport.requests import Request # type: ignore[import-untyped]
+
+ credentials, loaded_project_id = google_auth.default(
+ scopes=["https://www.googleapis.com/auth/cloud-platform"],
+ )
+ credentials = cast(Any, credentials)
+ credentials.refresh(Request())
+
+ if not project_id:
+ project_id = loaded_project_id
+
+ if not project_id:
+ raise ValueError("Could not resolve project_id")
+
+ if not isinstance(project_id, str):
+ raise TypeError(f"Expected project_id to be a str but got {type(project_id)}")
+
+ return credentials, project_id
+
+
+def refresh_auth(credentials: Credentials) -> None:
+ from google.auth.transport.requests import Request # type: ignore[import-untyped]
+
+ credentials.refresh(Request())
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_beta.py b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_beta.py
new file mode 100644
index 00000000..f2a91b42
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_beta.py
@@ -0,0 +1,102 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from ..._compat import cached_property
+from ..._resource import SyncAPIResource, AsyncAPIResource
+from ._beta_messages import (
+ Messages,
+ AsyncMessages,
+ MessagesWithRawResponse,
+ AsyncMessagesWithRawResponse,
+ MessagesWithStreamingResponse,
+ AsyncMessagesWithStreamingResponse,
+)
+
+__all__ = ["Beta", "AsyncBeta"]
+
+
+class Beta(SyncAPIResource):
+ @cached_property
+ def messages(self) -> Messages:
+ return Messages(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> BetaWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return the
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return BetaWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> BetaWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return BetaWithStreamingResponse(self)
+
+
+class AsyncBeta(AsyncAPIResource):
+ @cached_property
+ def messages(self) -> AsyncMessages:
+ return AsyncMessages(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> AsyncBetaWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return the
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncBetaWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncBetaWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncBetaWithStreamingResponse(self)
+
+
+class BetaWithRawResponse:
+ def __init__(self, beta: Beta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def messages(self) -> MessagesWithRawResponse:
+ return MessagesWithRawResponse(self._beta.messages)
+
+
+class AsyncBetaWithRawResponse:
+ def __init__(self, beta: AsyncBeta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def messages(self) -> AsyncMessagesWithRawResponse:
+ return AsyncMessagesWithRawResponse(self._beta.messages)
+
+
+class BetaWithStreamingResponse:
+ def __init__(self, beta: Beta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def messages(self) -> MessagesWithStreamingResponse:
+ return MessagesWithStreamingResponse(self._beta.messages)
+
+
+class AsyncBetaWithStreamingResponse:
+ def __init__(self, beta: AsyncBeta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def messages(self) -> AsyncMessagesWithStreamingResponse:
+ return AsyncMessagesWithStreamingResponse(self._beta.messages)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_beta_messages.py b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_beta_messages.py
new file mode 100644
index 00000000..332f6fba
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_beta_messages.py
@@ -0,0 +1,93 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from ... import _legacy_response
+from ..._compat import cached_property
+from ..._resource import SyncAPIResource, AsyncAPIResource
+from ..._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from ...resources.beta import Messages as FirstPartyMessagesAPI, AsyncMessages as FirstPartyAsyncMessagesAPI
+
+__all__ = ["Messages", "AsyncMessages"]
+
+
+class Messages(SyncAPIResource):
+ create = FirstPartyMessagesAPI.create
+
+ @cached_property
+ def with_raw_response(self) -> MessagesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return the
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return MessagesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> MessagesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return MessagesWithStreamingResponse(self)
+
+
+class AsyncMessages(AsyncAPIResource):
+ create = FirstPartyAsyncMessagesAPI.create
+
+ @cached_property
+ def with_raw_response(self) -> AsyncMessagesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return the
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncMessagesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncMessagesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncMessagesWithStreamingResponse(self)
+
+
+class MessagesWithRawResponse:
+ def __init__(self, messages: Messages) -> None:
+ self._messages = messages
+
+ self.create = _legacy_response.to_raw_response_wrapper(
+ messages.create,
+ )
+
+
+class AsyncMessagesWithRawResponse:
+ def __init__(self, messages: AsyncMessages) -> None:
+ self._messages = messages
+
+ self.create = _legacy_response.async_to_raw_response_wrapper(
+ messages.create,
+ )
+
+
+class MessagesWithStreamingResponse:
+ def __init__(self, messages: Messages) -> None:
+ self._messages = messages
+
+ self.create = to_streamed_response_wrapper(
+ messages.create,
+ )
+
+
+class AsyncMessagesWithStreamingResponse:
+ def __init__(self, messages: AsyncMessages) -> None:
+ self._messages = messages
+
+ self.create = async_to_streamed_response_wrapper(
+ messages.create,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_client.py b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_client.py
new file mode 100644
index 00000000..c5ee9909
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/lib/vertex/_client.py
@@ -0,0 +1,406 @@
+from __future__ import annotations
+
+import os
+from typing import TYPE_CHECKING, Any, Union, Mapping, TypeVar
+from typing_extensions import Self, override
+
+import httpx
+
+from ... import _exceptions
+from ._auth import load_auth, refresh_auth
+from ._beta import Beta, AsyncBeta
+from ..._types import NOT_GIVEN, NotGiven
+from ..._utils import is_dict, asyncify, is_given
+from ..._compat import model_copy, typed_cached_property
+from ..._models import FinalRequestOptions
+from ..._version import __version__
+from ..._streaming import Stream, AsyncStream
+from ..._exceptions import AnthropicError, APIStatusError
+from ..._base_client import (
+ DEFAULT_MAX_RETRIES,
+ BaseClient,
+ SyncAPIClient,
+ AsyncAPIClient,
+)
+from ...resources.messages import Messages, AsyncMessages
+
+if TYPE_CHECKING:
+ from google.auth.credentials import Credentials as GoogleCredentials # type: ignore
+
+
+DEFAULT_VERSION = "vertex-2023-10-16"
+
+_HttpxClientT = TypeVar("_HttpxClientT", bound=Union[httpx.Client, httpx.AsyncClient])
+_DefaultStreamT = TypeVar("_DefaultStreamT", bound=Union[Stream[Any], AsyncStream[Any]])
+
+
+class BaseVertexClient(BaseClient[_HttpxClientT, _DefaultStreamT]):
+ @typed_cached_property
+ def region(self) -> str:
+ raise RuntimeError("region not set")
+
+ @typed_cached_property
+ def project_id(self) -> str | None:
+ project_id = os.environ.get("ANTHROPIC_VERTEX_PROJECT_ID")
+ if project_id:
+ return project_id
+
+ return None
+
+ @override
+ def _make_status_error(
+ self,
+ err_msg: str,
+ *,
+ body: object,
+ response: httpx.Response,
+ ) -> APIStatusError:
+ if response.status_code == 400:
+ return _exceptions.BadRequestError(err_msg, response=response, body=body)
+
+ if response.status_code == 401:
+ return _exceptions.AuthenticationError(err_msg, response=response, body=body)
+
+ if response.status_code == 403:
+ return _exceptions.PermissionDeniedError(err_msg, response=response, body=body)
+
+ if response.status_code == 404:
+ return _exceptions.NotFoundError(err_msg, response=response, body=body)
+
+ if response.status_code == 409:
+ return _exceptions.ConflictError(err_msg, response=response, body=body)
+
+ if response.status_code == 422:
+ return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body)
+
+ if response.status_code == 429:
+ return _exceptions.RateLimitError(err_msg, response=response, body=body)
+
+ if response.status_code == 503:
+ return _exceptions.ServiceUnavailableError(err_msg, response=response, body=body)
+
+ if response.status_code == 504:
+ return _exceptions.DeadlineExceededError(err_msg, response=response, body=body)
+
+ if response.status_code >= 500:
+ return _exceptions.InternalServerError(err_msg, response=response, body=body)
+ return APIStatusError(err_msg, response=response, body=body)
+
+
+class AnthropicVertex(BaseVertexClient[httpx.Client, Stream[Any]], SyncAPIClient):
+ messages: Messages
+ beta: Beta
+
+ def __init__(
+ self,
+ *,
+ region: str | NotGiven = NOT_GIVEN,
+ project_id: str | NotGiven = NOT_GIVEN,
+ access_token: str | None = None,
+ credentials: GoogleCredentials | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ # Configure a custom httpx client. See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details.
+ http_client: httpx.Client | None = None,
+ _strict_response_validation: bool = False,
+ ) -> None:
+ if not is_given(region):
+ region = os.environ.get("CLOUD_ML_REGION", NOT_GIVEN)
+ if not is_given(region):
+ raise ValueError(
+ "No region was given. The client should be instantiated with the `region` argument or the `CLOUD_ML_REGION` environment variable should be set."
+ )
+
+ if base_url is None:
+ base_url = os.environ.get("ANTHROPIC_VERTEX_BASE_URL")
+ if base_url is None:
+ base_url = f"https://{region}-aiplatform.googleapis.com/v1"
+
+ super().__init__(
+ version=__version__,
+ base_url=base_url,
+ timeout=timeout,
+ max_retries=max_retries,
+ custom_headers=default_headers,
+ custom_query=default_query,
+ http_client=http_client,
+ _strict_response_validation=_strict_response_validation,
+ )
+
+ if is_given(project_id):
+ self.project_id = project_id
+
+ self.region = region
+ self.access_token = access_token
+ self.credentials = credentials
+
+ self.messages = Messages(self)
+ self.beta = Beta(self)
+
+ @override
+ def _prepare_options(self, options: FinalRequestOptions) -> FinalRequestOptions:
+ return _prepare_options(options, project_id=self.project_id, region=self.region)
+
+ @override
+ def _prepare_request(self, request: httpx.Request) -> None:
+ if request.headers.get("Authorization"):
+ # already authenticated, nothing for us to do
+ return
+
+ request.headers["Authorization"] = f"Bearer {self._ensure_access_token()}"
+
+ def _ensure_access_token(self) -> str:
+ if self.access_token is not None:
+ return self.access_token
+
+ if not self.credentials:
+ self.credentials, project_id = load_auth(project_id=self.project_id)
+ if not self.project_id:
+ self.project_id = project_id
+
+ if self.credentials.expired or not self.credentials.token:
+ refresh_auth(self.credentials)
+
+ if not self.credentials.token:
+ raise RuntimeError("Could not resolve API token from the environment")
+
+ assert isinstance(self.credentials.token, str)
+ return self.credentials.token
+
+ def copy(
+ self,
+ *,
+ region: str | NotGiven = NOT_GIVEN,
+ project_id: str | NotGiven = NOT_GIVEN,
+ access_token: str | None = None,
+ credentials: GoogleCredentials | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ http_client: httpx.Client | None = None,
+ max_retries: int | NotGiven = NOT_GIVEN,
+ default_headers: Mapping[str, str] | None = None,
+ set_default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ set_default_query: Mapping[str, object] | None = None,
+ _extra_kwargs: Mapping[str, Any] = {},
+ ) -> Self:
+ """
+ Create a new client instance re-using the same options given to the current client with optional overriding.
+ """
+ if default_headers is not None and set_default_headers is not None:
+ raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive")
+
+ if default_query is not None and set_default_query is not None:
+ raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive")
+
+ headers = self._custom_headers
+ if default_headers is not None:
+ headers = {**headers, **default_headers}
+ elif set_default_headers is not None:
+ headers = set_default_headers
+
+ params = self._custom_query
+ if default_query is not None:
+ params = {**params, **default_query}
+ elif set_default_query is not None:
+ params = set_default_query
+
+ http_client = http_client or self._client
+
+ return self.__class__(
+ region=region if is_given(region) else self.region,
+ project_id=project_id if is_given(project_id) else self.project_id or NOT_GIVEN,
+ access_token=access_token or self.access_token,
+ credentials=credentials or self.credentials,
+ base_url=base_url or self.base_url,
+ timeout=self.timeout if isinstance(timeout, NotGiven) else timeout,
+ http_client=http_client,
+ max_retries=max_retries if is_given(max_retries) else self.max_retries,
+ default_headers=headers,
+ default_query=params,
+ **_extra_kwargs,
+ )
+
+ # Alias for `copy` for nicer inline usage, e.g.
+ # client.with_options(timeout=10).foo.create(...)
+ with_options = copy
+
+
+class AsyncAnthropicVertex(BaseVertexClient[httpx.AsyncClient, AsyncStream[Any]], AsyncAPIClient):
+ messages: AsyncMessages
+ beta: AsyncBeta
+
+ def __init__(
+ self,
+ *,
+ region: str | NotGiven = NOT_GIVEN,
+ project_id: str | NotGiven = NOT_GIVEN,
+ access_token: str | None = None,
+ credentials: GoogleCredentials | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ max_retries: int = DEFAULT_MAX_RETRIES,
+ default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ # Configure a custom httpx client. See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details.
+ http_client: httpx.AsyncClient | None = None,
+ _strict_response_validation: bool = False,
+ ) -> None:
+ if not is_given(region):
+ region = os.environ.get("CLOUD_ML_REGION", NOT_GIVEN)
+ if not is_given(region):
+ raise ValueError(
+ "No region was given. The client should be instantiated with the `region` argument or the `CLOUD_ML_REGION` environment variable should be set."
+ )
+
+ if base_url is None:
+ base_url = os.environ.get("ANTHROPIC_VERTEX_BASE_URL")
+ if base_url is None:
+ base_url = f"https://{region}-aiplatform.googleapis.com/v1"
+
+ super().__init__(
+ version=__version__,
+ base_url=base_url,
+ timeout=timeout,
+ max_retries=max_retries,
+ custom_headers=default_headers,
+ custom_query=default_query,
+ http_client=http_client,
+ _strict_response_validation=_strict_response_validation,
+ )
+
+ if is_given(project_id):
+ self.project_id = project_id
+
+ self.region = region
+ self.access_token = access_token
+ self.credentials = credentials
+
+ self.messages = AsyncMessages(self)
+ self.beta = AsyncBeta(self)
+
+ @override
+ async def _prepare_options(self, options: FinalRequestOptions) -> FinalRequestOptions:
+ return _prepare_options(options, project_id=self.project_id, region=self.region)
+
+ @override
+ async def _prepare_request(self, request: httpx.Request) -> None:
+ if request.headers.get("Authorization"):
+ # already authenticated, nothing for us to do
+ return
+
+ request.headers["Authorization"] = f"Bearer {await self._ensure_access_token()}"
+
+ async def _ensure_access_token(self) -> str:
+ if self.access_token is not None:
+ return self.access_token
+
+ if not self.credentials:
+ self.credentials, project_id = await asyncify(load_auth)(project_id=self.project_id)
+ if not self.project_id:
+ self.project_id = project_id
+
+ if self.credentials.expired or not self.credentials.token:
+ await asyncify(refresh_auth)(self.credentials)
+
+ if not self.credentials.token:
+ raise RuntimeError("Could not resolve API token from the environment")
+
+ assert isinstance(self.credentials.token, str)
+ return self.credentials.token
+
+ def copy(
+ self,
+ *,
+ region: str | NotGiven = NOT_GIVEN,
+ project_id: str | NotGiven = NOT_GIVEN,
+ access_token: str | None = None,
+ credentials: GoogleCredentials | None = None,
+ base_url: str | httpx.URL | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ http_client: httpx.AsyncClient | None = None,
+ max_retries: int | NotGiven = NOT_GIVEN,
+ default_headers: Mapping[str, str] | None = None,
+ set_default_headers: Mapping[str, str] | None = None,
+ default_query: Mapping[str, object] | None = None,
+ set_default_query: Mapping[str, object] | None = None,
+ _extra_kwargs: Mapping[str, Any] = {},
+ ) -> Self:
+ """
+ Create a new client instance re-using the same options given to the current client with optional overriding.
+ """
+ if default_headers is not None and set_default_headers is not None:
+ raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive")
+
+ if default_query is not None and set_default_query is not None:
+ raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive")
+
+ headers = self._custom_headers
+ if default_headers is not None:
+ headers = {**headers, **default_headers}
+ elif set_default_headers is not None:
+ headers = set_default_headers
+
+ params = self._custom_query
+ if default_query is not None:
+ params = {**params, **default_query}
+ elif set_default_query is not None:
+ params = set_default_query
+
+ http_client = http_client or self._client
+
+ return self.__class__(
+ region=region if is_given(region) else self.region,
+ project_id=project_id if is_given(project_id) else self.project_id or NOT_GIVEN,
+ access_token=access_token or self.access_token,
+ credentials=credentials or self.credentials,
+ base_url=base_url or self.base_url,
+ timeout=self.timeout if isinstance(timeout, NotGiven) else timeout,
+ http_client=http_client,
+ max_retries=max_retries if is_given(max_retries) else self.max_retries,
+ default_headers=headers,
+ default_query=params,
+ **_extra_kwargs,
+ )
+
+ # Alias for `copy` for nicer inline usage, e.g.
+ # client.with_options(timeout=10).foo.create(...)
+ with_options = copy
+
+
+def _prepare_options(input_options: FinalRequestOptions, *, project_id: str | None, region: str) -> FinalRequestOptions:
+ options = model_copy(input_options, deep=True)
+
+ if is_dict(options.json_data):
+ options.json_data.setdefault("anthropic_version", DEFAULT_VERSION)
+
+ if options.url in {"/v1/messages", "/v1/messages?beta=true"} and options.method == "post":
+ if project_id is None:
+ raise RuntimeError(
+ "No project_id was given and it could not be resolved from credentials. The client should be instantiated with the `project_id` argument or the `ANTHROPIC_VERTEX_PROJECT_ID` environment variable should be set."
+ )
+
+ if not is_dict(options.json_data):
+ raise RuntimeError("Expected json data to be a dictionary for post /v1/messages")
+
+ model = options.json_data.pop("model")
+ stream = options.json_data.get("stream", False)
+ specifier = "streamRawPredict" if stream else "rawPredict"
+
+ options.url = f"/projects/{project_id}/locations/{region}/publishers/anthropic/models/{model}:{specifier}"
+
+ if options.url in {"/v1/messages/count_tokens", "/v1/messages/count_tokens?beta=true"} and options.method == "post":
+ if project_id is None:
+ raise RuntimeError(
+ "No project_id was given and it could not be resolved from credentials. The client should be instantiated with the `project_id` argument or the `ANTHROPIC_VERTEX_PROJECT_ID` environment variable should be set."
+ )
+
+ options.url = f"/projects/{project_id}/locations/{region}/publishers/anthropic/models/count-tokens:rawPredict"
+
+ if options.url.startswith("/v1/messages/batches"):
+ raise AnthropicError("The Batch API is not supported in the Vertex client yet")
+
+ return options
diff --git a/.venv/lib/python3.12/site-packages/anthropic/pagination.py b/.venv/lib/python3.12/site-packages/anthropic/pagination.py
new file mode 100644
index 00000000..c4553fba
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/pagination.py
@@ -0,0 +1,84 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import List, Generic, TypeVar, Optional
+from typing_extensions import override
+
+from ._base_client import BasePage, PageInfo, BaseSyncPage, BaseAsyncPage
+
+__all__ = ["SyncPage", "AsyncPage"]
+
+_T = TypeVar("_T")
+
+
+class SyncPage(BaseSyncPage[_T], BasePage[_T], Generic[_T]):
+ data: List[_T]
+ has_more: Optional[bool] = None
+ first_id: Optional[str] = None
+ last_id: Optional[str] = None
+
+ @override
+ def _get_page_items(self) -> List[_T]:
+ data = self.data
+ if not data:
+ return []
+ return data
+
+ @override
+ def has_next_page(self) -> bool:
+ has_more = self.has_more
+ if has_more is not None and has_more is False:
+ return False
+
+ return super().has_next_page()
+
+ @override
+ def next_page_info(self) -> Optional[PageInfo]:
+ if self._options.params.get("before_id"):
+ first_id = self.first_id
+ if not first_id:
+ return None
+
+ return PageInfo(params={"before_id": first_id})
+
+ last_id = self.last_id
+ if not last_id:
+ return None
+
+ return PageInfo(params={"after_id": last_id})
+
+
+class AsyncPage(BaseAsyncPage[_T], BasePage[_T], Generic[_T]):
+ data: List[_T]
+ has_more: Optional[bool] = None
+ first_id: Optional[str] = None
+ last_id: Optional[str] = None
+
+ @override
+ def _get_page_items(self) -> List[_T]:
+ data = self.data
+ if not data:
+ return []
+ return data
+
+ @override
+ def has_next_page(self) -> bool:
+ has_more = self.has_more
+ if has_more is not None and has_more is False:
+ return False
+
+ return super().has_next_page()
+
+ @override
+ def next_page_info(self) -> Optional[PageInfo]:
+ if self._options.params.get("before_id"):
+ first_id = self.first_id
+ if not first_id:
+ return None
+
+ return PageInfo(params={"before_id": first_id})
+
+ last_id = self.last_id
+ if not last_id:
+ return None
+
+ return PageInfo(params={"after_id": last_id})
diff --git a/.venv/lib/python3.12/site-packages/anthropic/py.typed b/.venv/lib/python3.12/site-packages/anthropic/py.typed
new file mode 100644
index 00000000..e69de29b
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/py.typed
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/resources/__init__.py
new file mode 100644
index 00000000..ffff8855
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/__init__.py
@@ -0,0 +1,61 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from .beta import (
+ Beta,
+ AsyncBeta,
+ BetaWithRawResponse,
+ AsyncBetaWithRawResponse,
+ BetaWithStreamingResponse,
+ AsyncBetaWithStreamingResponse,
+)
+from .models import (
+ Models,
+ AsyncModels,
+ ModelsWithRawResponse,
+ AsyncModelsWithRawResponse,
+ ModelsWithStreamingResponse,
+ AsyncModelsWithStreamingResponse,
+)
+from .messages import (
+ Messages,
+ AsyncMessages,
+ MessagesWithRawResponse,
+ AsyncMessagesWithRawResponse,
+ MessagesWithStreamingResponse,
+ AsyncMessagesWithStreamingResponse,
+)
+from .completions import (
+ Completions,
+ AsyncCompletions,
+ CompletionsWithRawResponse,
+ AsyncCompletionsWithRawResponse,
+ CompletionsWithStreamingResponse,
+ AsyncCompletionsWithStreamingResponse,
+)
+
+__all__ = [
+ "Completions",
+ "AsyncCompletions",
+ "CompletionsWithRawResponse",
+ "AsyncCompletionsWithRawResponse",
+ "CompletionsWithStreamingResponse",
+ "AsyncCompletionsWithStreamingResponse",
+ "Messages",
+ "AsyncMessages",
+ "MessagesWithRawResponse",
+ "AsyncMessagesWithRawResponse",
+ "MessagesWithStreamingResponse",
+ "AsyncMessagesWithStreamingResponse",
+ "Models",
+ "AsyncModels",
+ "ModelsWithRawResponse",
+ "AsyncModelsWithRawResponse",
+ "ModelsWithStreamingResponse",
+ "AsyncModelsWithStreamingResponse",
+ "Beta",
+ "AsyncBeta",
+ "BetaWithRawResponse",
+ "AsyncBetaWithRawResponse",
+ "BetaWithStreamingResponse",
+ "AsyncBetaWithStreamingResponse",
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/beta/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/__init__.py
new file mode 100644
index 00000000..82b343fa
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/__init__.py
@@ -0,0 +1,47 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from .beta import (
+ Beta,
+ AsyncBeta,
+ BetaWithRawResponse,
+ AsyncBetaWithRawResponse,
+ BetaWithStreamingResponse,
+ AsyncBetaWithStreamingResponse,
+)
+from .models import (
+ Models,
+ AsyncModels,
+ ModelsWithRawResponse,
+ AsyncModelsWithRawResponse,
+ ModelsWithStreamingResponse,
+ AsyncModelsWithStreamingResponse,
+)
+from .messages import (
+ Messages,
+ AsyncMessages,
+ MessagesWithRawResponse,
+ AsyncMessagesWithRawResponse,
+ MessagesWithStreamingResponse,
+ AsyncMessagesWithStreamingResponse,
+)
+
+__all__ = [
+ "Models",
+ "AsyncModels",
+ "ModelsWithRawResponse",
+ "AsyncModelsWithRawResponse",
+ "ModelsWithStreamingResponse",
+ "AsyncModelsWithStreamingResponse",
+ "Messages",
+ "AsyncMessages",
+ "MessagesWithRawResponse",
+ "AsyncMessagesWithRawResponse",
+ "MessagesWithStreamingResponse",
+ "AsyncMessagesWithStreamingResponse",
+ "Beta",
+ "AsyncBeta",
+ "BetaWithRawResponse",
+ "AsyncBetaWithRawResponse",
+ "BetaWithStreamingResponse",
+ "AsyncBetaWithStreamingResponse",
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/beta/beta.py b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/beta.py
new file mode 100644
index 00000000..ae5c7d98
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/beta.py
@@ -0,0 +1,134 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from .models import (
+ Models,
+ AsyncModels,
+ ModelsWithRawResponse,
+ AsyncModelsWithRawResponse,
+ ModelsWithStreamingResponse,
+ AsyncModelsWithStreamingResponse,
+)
+from ..._compat import cached_property
+from ..._resource import SyncAPIResource, AsyncAPIResource
+from .messages.messages import (
+ Messages,
+ AsyncMessages,
+ MessagesWithRawResponse,
+ AsyncMessagesWithRawResponse,
+ MessagesWithStreamingResponse,
+ AsyncMessagesWithStreamingResponse,
+)
+
+__all__ = ["Beta", "AsyncBeta"]
+
+
+class Beta(SyncAPIResource):
+ @cached_property
+ def models(self) -> Models:
+ return Models(self._client)
+
+ @cached_property
+ def messages(self) -> Messages:
+ return Messages(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> BetaWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return BetaWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> BetaWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return BetaWithStreamingResponse(self)
+
+
+class AsyncBeta(AsyncAPIResource):
+ @cached_property
+ def models(self) -> AsyncModels:
+ return AsyncModels(self._client)
+
+ @cached_property
+ def messages(self) -> AsyncMessages:
+ return AsyncMessages(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> AsyncBetaWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncBetaWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncBetaWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncBetaWithStreamingResponse(self)
+
+
+class BetaWithRawResponse:
+ def __init__(self, beta: Beta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def models(self) -> ModelsWithRawResponse:
+ return ModelsWithRawResponse(self._beta.models)
+
+ @cached_property
+ def messages(self) -> MessagesWithRawResponse:
+ return MessagesWithRawResponse(self._beta.messages)
+
+
+class AsyncBetaWithRawResponse:
+ def __init__(self, beta: AsyncBeta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def models(self) -> AsyncModelsWithRawResponse:
+ return AsyncModelsWithRawResponse(self._beta.models)
+
+ @cached_property
+ def messages(self) -> AsyncMessagesWithRawResponse:
+ return AsyncMessagesWithRawResponse(self._beta.messages)
+
+
+class BetaWithStreamingResponse:
+ def __init__(self, beta: Beta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def models(self) -> ModelsWithStreamingResponse:
+ return ModelsWithStreamingResponse(self._beta.models)
+
+ @cached_property
+ def messages(self) -> MessagesWithStreamingResponse:
+ return MessagesWithStreamingResponse(self._beta.messages)
+
+
+class AsyncBetaWithStreamingResponse:
+ def __init__(self, beta: AsyncBeta) -> None:
+ self._beta = beta
+
+ @cached_property
+ def models(self) -> AsyncModelsWithStreamingResponse:
+ return AsyncModelsWithStreamingResponse(self._beta.models)
+
+ @cached_property
+ def messages(self) -> AsyncMessagesWithStreamingResponse:
+ return AsyncMessagesWithStreamingResponse(self._beta.messages)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/__init__.py
new file mode 100644
index 00000000..34b0a923
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/__init__.py
@@ -0,0 +1,33 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from .batches import (
+ Batches,
+ AsyncBatches,
+ BatchesWithRawResponse,
+ AsyncBatchesWithRawResponse,
+ BatchesWithStreamingResponse,
+ AsyncBatchesWithStreamingResponse,
+)
+from .messages import (
+ Messages,
+ AsyncMessages,
+ MessagesWithRawResponse,
+ AsyncMessagesWithRawResponse,
+ MessagesWithStreamingResponse,
+ AsyncMessagesWithStreamingResponse,
+)
+
+__all__ = [
+ "Batches",
+ "AsyncBatches",
+ "BatchesWithRawResponse",
+ "AsyncBatchesWithRawResponse",
+ "BatchesWithStreamingResponse",
+ "AsyncBatchesWithStreamingResponse",
+ "Messages",
+ "AsyncMessages",
+ "MessagesWithRawResponse",
+ "AsyncMessagesWithRawResponse",
+ "MessagesWithStreamingResponse",
+ "AsyncMessagesWithStreamingResponse",
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/batches.py b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/batches.py
new file mode 100644
index 00000000..f5483ca6
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/batches.py
@@ -0,0 +1,889 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import List, Iterable
+from itertools import chain
+
+import httpx
+
+from .... import _legacy_response
+from ...._types import NOT_GIVEN, Body, Query, Headers, NotGiven
+from ...._utils import (
+ is_given,
+ maybe_transform,
+ strip_not_given,
+ async_maybe_transform,
+)
+from ...._compat import cached_property
+from ...._resource import SyncAPIResource, AsyncAPIResource
+from ...._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from ....pagination import SyncPage, AsyncPage
+from ...._exceptions import AnthropicError
+from ...._base_client import AsyncPaginator, make_request_options
+from ...._decoders.jsonl import JSONLDecoder, AsyncJSONLDecoder
+from ....types.beta.messages import batch_list_params, batch_create_params
+from ....types.anthropic_beta_param import AnthropicBetaParam
+from ....types.beta.messages.beta_message_batch import BetaMessageBatch
+from ....types.beta.messages.beta_deleted_message_batch import BetaDeletedMessageBatch
+from ....types.beta.messages.beta_message_batch_individual_response import BetaMessageBatchIndividualResponse
+
+__all__ = ["Batches", "AsyncBatches"]
+
+
+class Batches(SyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> BatchesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return BatchesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> BatchesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return BatchesWithStreamingResponse(self)
+
+ def create(
+ self,
+ *,
+ requests: Iterable[batch_create_params.Request],
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageBatch:
+ """
+ Send a batch of Message creation requests.
+
+ The Message Batches API can be used to process multiple Messages API requests at
+ once. Once a Message Batch is created, it begins processing immediately. Batches
+ can take up to 24 hours to complete.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ requests: List of requests for prompt completion. Each is an individual request to create
+ a Message.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return self._post(
+ "/v1/messages/batches?beta=true",
+ body=maybe_transform({"requests": requests}, batch_create_params.BatchCreateParams),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessageBatch,
+ )
+
+ def retrieve(
+ self,
+ message_batch_id: str,
+ *,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageBatch:
+ """This endpoint is idempotent and can be used to poll for Message Batch
+ completion.
+
+ To access the results of a Message Batch, make a request to the
+ `results_url` field in the response.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return self._get(
+ f"/v1/messages/batches/{message_batch_id}?beta=true",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessageBatch,
+ )
+
+ def list(
+ self,
+ *,
+ after_id: str | NotGiven = NOT_GIVEN,
+ before_id: str | NotGiven = NOT_GIVEN,
+ limit: int | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> SyncPage[BetaMessageBatch]:
+ """List all Message Batches within a Workspace.
+
+ Most recently created batches are
+ returned first.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ after_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately after this object.
+
+ before_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately before this object.
+
+ limit: Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return self._get_api_list(
+ "/v1/messages/batches?beta=true",
+ page=SyncPage[BetaMessageBatch],
+ options=make_request_options(
+ extra_headers=extra_headers,
+ extra_query=extra_query,
+ extra_body=extra_body,
+ timeout=timeout,
+ query=maybe_transform(
+ {
+ "after_id": after_id,
+ "before_id": before_id,
+ "limit": limit,
+ },
+ batch_list_params.BatchListParams,
+ ),
+ ),
+ model=BetaMessageBatch,
+ )
+
+ def delete(
+ self,
+ message_batch_id: str,
+ *,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaDeletedMessageBatch:
+ """
+ Delete a Message Batch.
+
+ Message Batches can only be deleted once they've finished processing. If you'd
+ like to delete an in-progress batch, you must first cancel it.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return self._delete(
+ f"/v1/messages/batches/{message_batch_id}?beta=true",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaDeletedMessageBatch,
+ )
+
+ def cancel(
+ self,
+ message_batch_id: str,
+ *,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageBatch:
+ """Batches may be canceled any time before processing ends.
+
+ Once cancellation is
+ initiated, the batch enters a `canceling` state, at which time the system may
+ complete any in-progress, non-interruptible requests before finalizing
+ cancellation.
+
+ The number of canceled requests is specified in `request_counts`. To determine
+ which requests were canceled, check the individual results within the batch.
+ Note that cancellation may not result in any canceled requests if they were
+ non-interruptible.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return self._post(
+ f"/v1/messages/batches/{message_batch_id}/cancel?beta=true",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessageBatch,
+ )
+
+ def results(
+ self,
+ message_batch_id: str,
+ *,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> JSONLDecoder[BetaMessageBatchIndividualResponse]:
+ """
+ Streams the results of a Message Batch as a `.jsonl` file.
+
+ Each line in the file is a JSON object containing the result of a single request
+ in the Message Batch. Results are not guaranteed to be in the same order as
+ requests. Use the `custom_id` field to match results to requests.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+
+ batch = self.retrieve(message_batch_id=message_batch_id)
+ if not batch.results_url:
+ raise AnthropicError(
+ f"No `results_url` for the given batch; Has it finished processing? {batch.processing_status}"
+ )
+
+ extra_headers = {"Accept": "application/binary", **(extra_headers or {})}
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return self._get(
+ batch.results_url,
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=JSONLDecoder[BetaMessageBatchIndividualResponse],
+ stream=True,
+ )
+
+
+class AsyncBatches(AsyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> AsyncBatchesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncBatchesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncBatchesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncBatchesWithStreamingResponse(self)
+
+ async def create(
+ self,
+ *,
+ requests: Iterable[batch_create_params.Request],
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageBatch:
+ """
+ Send a batch of Message creation requests.
+
+ The Message Batches API can be used to process multiple Messages API requests at
+ once. Once a Message Batch is created, it begins processing immediately. Batches
+ can take up to 24 hours to complete.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ requests: List of requests for prompt completion. Each is an individual request to create
+ a Message.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return await self._post(
+ "/v1/messages/batches?beta=true",
+ body=await async_maybe_transform({"requests": requests}, batch_create_params.BatchCreateParams),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessageBatch,
+ )
+
+ async def retrieve(
+ self,
+ message_batch_id: str,
+ *,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageBatch:
+ """This endpoint is idempotent and can be used to poll for Message Batch
+ completion.
+
+ To access the results of a Message Batch, make a request to the
+ `results_url` field in the response.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return await self._get(
+ f"/v1/messages/batches/{message_batch_id}?beta=true",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessageBatch,
+ )
+
+ def list(
+ self,
+ *,
+ after_id: str | NotGiven = NOT_GIVEN,
+ before_id: str | NotGiven = NOT_GIVEN,
+ limit: int | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncPaginator[BetaMessageBatch, AsyncPage[BetaMessageBatch]]:
+ """List all Message Batches within a Workspace.
+
+ Most recently created batches are
+ returned first.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ after_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately after this object.
+
+ before_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately before this object.
+
+ limit: Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return self._get_api_list(
+ "/v1/messages/batches?beta=true",
+ page=AsyncPage[BetaMessageBatch],
+ options=make_request_options(
+ extra_headers=extra_headers,
+ extra_query=extra_query,
+ extra_body=extra_body,
+ timeout=timeout,
+ query=maybe_transform(
+ {
+ "after_id": after_id,
+ "before_id": before_id,
+ "limit": limit,
+ },
+ batch_list_params.BatchListParams,
+ ),
+ ),
+ model=BetaMessageBatch,
+ )
+
+ async def delete(
+ self,
+ message_batch_id: str,
+ *,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaDeletedMessageBatch:
+ """
+ Delete a Message Batch.
+
+ Message Batches can only be deleted once they've finished processing. If you'd
+ like to delete an in-progress batch, you must first cancel it.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return await self._delete(
+ f"/v1/messages/batches/{message_batch_id}?beta=true",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaDeletedMessageBatch,
+ )
+
+ async def cancel(
+ self,
+ message_batch_id: str,
+ *,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageBatch:
+ """Batches may be canceled any time before processing ends.
+
+ Once cancellation is
+ initiated, the batch enters a `canceling` state, at which time the system may
+ complete any in-progress, non-interruptible requests before finalizing
+ cancellation.
+
+ The number of canceled requests is specified in `request_counts`. To determine
+ which requests were canceled, check the individual results within the batch.
+ Note that cancellation may not result in any canceled requests if they were
+ non-interruptible.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return await self._post(
+ f"/v1/messages/batches/{message_batch_id}/cancel?beta=true",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessageBatch,
+ )
+
+ async def results(
+ self,
+ message_batch_id: str,
+ *,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncJSONLDecoder[BetaMessageBatchIndividualResponse]:
+ """
+ Streams the results of a Message Batch as a `.jsonl` file.
+
+ Each line in the file is a JSON object containing the result of a single request
+ in the Message Batch. Results are not guaranteed to be in the same order as
+ requests. Use the `custom_id` field to match results to requests.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+
+ batch = await self.retrieve(message_batch_id=message_batch_id)
+ if not batch.results_url:
+ raise AnthropicError(
+ f"No `results_url` for the given batch; Has it finished processing? {batch.processing_status}"
+ )
+
+ extra_headers = {"Accept": "application/binary", **(extra_headers or {})}
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["message-batches-2024-09-24"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "message-batches-2024-09-24", **(extra_headers or {})}
+ return await self._get(
+ batch.results_url,
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=AsyncJSONLDecoder[BetaMessageBatchIndividualResponse],
+ stream=True,
+ )
+
+
+class BatchesWithRawResponse:
+ def __init__(self, batches: Batches) -> None:
+ self._batches = batches
+
+ self.create = _legacy_response.to_raw_response_wrapper(
+ batches.create,
+ )
+ self.retrieve = _legacy_response.to_raw_response_wrapper(
+ batches.retrieve,
+ )
+ self.list = _legacy_response.to_raw_response_wrapper(
+ batches.list,
+ )
+ self.delete = _legacy_response.to_raw_response_wrapper(
+ batches.delete,
+ )
+ self.cancel = _legacy_response.to_raw_response_wrapper(
+ batches.cancel,
+ )
+
+
+class AsyncBatchesWithRawResponse:
+ def __init__(self, batches: AsyncBatches) -> None:
+ self._batches = batches
+
+ self.create = _legacy_response.async_to_raw_response_wrapper(
+ batches.create,
+ )
+ self.retrieve = _legacy_response.async_to_raw_response_wrapper(
+ batches.retrieve,
+ )
+ self.list = _legacy_response.async_to_raw_response_wrapper(
+ batches.list,
+ )
+ self.delete = _legacy_response.async_to_raw_response_wrapper(
+ batches.delete,
+ )
+ self.cancel = _legacy_response.async_to_raw_response_wrapper(
+ batches.cancel,
+ )
+
+
+class BatchesWithStreamingResponse:
+ def __init__(self, batches: Batches) -> None:
+ self._batches = batches
+
+ self.create = to_streamed_response_wrapper(
+ batches.create,
+ )
+ self.retrieve = to_streamed_response_wrapper(
+ batches.retrieve,
+ )
+ self.list = to_streamed_response_wrapper(
+ batches.list,
+ )
+ self.delete = to_streamed_response_wrapper(
+ batches.delete,
+ )
+ self.cancel = to_streamed_response_wrapper(
+ batches.cancel,
+ )
+
+
+class AsyncBatchesWithStreamingResponse:
+ def __init__(self, batches: AsyncBatches) -> None:
+ self._batches = batches
+
+ self.create = async_to_streamed_response_wrapper(
+ batches.create,
+ )
+ self.retrieve = async_to_streamed_response_wrapper(
+ batches.retrieve,
+ )
+ self.list = async_to_streamed_response_wrapper(
+ batches.list,
+ )
+ self.delete = async_to_streamed_response_wrapper(
+ batches.delete,
+ )
+ self.cancel = async_to_streamed_response_wrapper(
+ batches.cancel,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/messages.py b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/messages.py
new file mode 100644
index 00000000..c1c2ef06
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/messages/messages.py
@@ -0,0 +1,2587 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+import warnings
+from typing import List, Union, Iterable
+from functools import partial
+from itertools import chain
+from typing_extensions import Literal, overload
+
+import httpx
+
+from .... import _legacy_response
+from .batches import (
+ Batches,
+ AsyncBatches,
+ BatchesWithRawResponse,
+ AsyncBatchesWithRawResponse,
+ BatchesWithStreamingResponse,
+ AsyncBatchesWithStreamingResponse,
+)
+from ...._types import NOT_GIVEN, Body, Query, Headers, NotGiven
+from ...._utils import (
+ is_given,
+ required_args,
+ maybe_transform,
+ strip_not_given,
+ async_maybe_transform,
+)
+from ...._compat import cached_property
+from ...._resource import SyncAPIResource, AsyncAPIResource
+from ...._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from ...._constants import DEFAULT_TIMEOUT
+from ...._streaming import Stream, AsyncStream
+from ....types.beta import (
+ BetaThinkingConfigParam,
+ message_create_params,
+ message_count_tokens_params,
+)
+from ...._base_client import make_request_options
+from ....lib.streaming import BetaMessageStreamManager, BetaAsyncMessageStreamManager
+from ...messages.messages import DEPRECATED_MODELS
+from ....types.model_param import ModelParam
+from ....types.beta.beta_message import BetaMessage
+from ....types.anthropic_beta_param import AnthropicBetaParam
+from ....types.beta.beta_message_param import BetaMessageParam
+from ....types.beta.beta_metadata_param import BetaMetadataParam
+from ....types.beta.beta_text_block_param import BetaTextBlockParam
+from ....types.beta.beta_tool_union_param import BetaToolUnionParam
+from ....types.beta.beta_tool_choice_param import BetaToolChoiceParam
+from ....types.beta.beta_message_tokens_count import BetaMessageTokensCount
+from ....types.beta.beta_thinking_config_param import BetaThinkingConfigParam
+from ....types.beta.beta_raw_message_stream_event import BetaRawMessageStreamEvent
+
+__all__ = ["Messages", "AsyncMessages"]
+
+
+class Messages(SyncAPIResource):
+ @cached_property
+ def batches(self) -> Batches:
+ return Batches(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> MessagesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return MessagesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> MessagesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return MessagesWithStreamingResponse(self)
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessage:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ stream: Literal[True],
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Stream[BetaRawMessageStreamEvent]:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ stream: bool,
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessage | Stream[BetaRawMessageStreamEvent]:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @required_args(["max_tokens", "messages", "model"], ["max_tokens", "messages", "model", "stream"])
+ def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | Literal[True] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessage | Stream[BetaRawMessageStreamEvent]:
+ if not stream and not is_given(timeout) and self._client.timeout == DEFAULT_TIMEOUT:
+ timeout = self._client._calculate_nonstreaming_timeout(max_tokens)
+
+ if model in DEPRECATED_MODELS:
+ warnings.warn(
+ f"The model '{model}' is deprecated and will reach end-of-life on {DEPRECATED_MODELS[model]}.\nPlease migrate to a newer model. Visit https://docs.anthropic.com/en/docs/resources/model-deprecations for more information.",
+ DeprecationWarning,
+ stacklevel=3,
+ )
+
+ extra_headers = {
+ **strip_not_given({"anthropic-beta": ",".join(str(e) for e in betas) if is_given(betas) else NOT_GIVEN}),
+ **(extra_headers or {}),
+ }
+ return self._post(
+ "/v1/messages?beta=true",
+ body=maybe_transform(
+ {
+ "max_tokens": max_tokens,
+ "messages": messages,
+ "model": model,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "stream": stream,
+ "system": system,
+ "temperature": temperature,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "tools": tools,
+ "top_k": top_k,
+ "top_p": top_p,
+ },
+ message_create_params.MessageCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessage,
+ stream=stream or False,
+ stream_cls=Stream[BetaRawMessageStreamEvent],
+ )
+
+ def stream(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageStreamManager:
+ """Create a Message stream"""
+ extra_headers = {
+ "X-Stainless-Stream-Helper": "beta.messages",
+ **strip_not_given({"anthropic-beta": ",".join(str(e) for e in betas) if is_given(betas) else NOT_GIVEN}),
+ **(extra_headers or {}),
+ }
+ make_request = partial(
+ self._post,
+ "/v1/messages?beta=true",
+ body=maybe_transform(
+ {
+ "max_tokens": max_tokens,
+ "messages": messages,
+ "model": model,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "system": system,
+ "temperature": temperature,
+ "thinking": thinking,
+ "top_k": top_k,
+ "top_p": top_p,
+ "tools": tools,
+ "tool_choice": tool_choice,
+ "stream": True,
+ },
+ message_create_params.MessageCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessage,
+ stream=True,
+ stream_cls=Stream[BetaRawMessageStreamEvent],
+ )
+ return BetaMessageStreamManager(make_request)
+
+ def count_tokens(
+ self,
+ *,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[message_count_tokens_params.Tool] | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageTokensCount:
+ """
+ Count the number of tokens in a Message.
+
+ The Token Count API can be used to count the number of tokens in a Message,
+ including tools, images, and documents, without creating it.
+
+ Learn more about token counting in our
+ [user guide](/en/docs/build-with-claude/token-counting)
+
+ Args:
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["token-counting-2024-11-01"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "token-counting-2024-11-01", **(extra_headers or {})}
+ return self._post(
+ "/v1/messages/count_tokens?beta=true",
+ body=maybe_transform(
+ {
+ "messages": messages,
+ "model": model,
+ "system": system,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "tools": tools,
+ },
+ message_count_tokens_params.MessageCountTokensParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessageTokensCount,
+ )
+
+
+class AsyncMessages(AsyncAPIResource):
+ @cached_property
+ def batches(self) -> AsyncBatches:
+ return AsyncBatches(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> AsyncMessagesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncMessagesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncMessagesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncMessagesWithStreamingResponse(self)
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessage:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ stream: Literal[True],
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncStream[BetaRawMessageStreamEvent]:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ stream: bool,
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessage | AsyncStream[BetaRawMessageStreamEvent]:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @required_args(["max_tokens", "messages", "model"], ["max_tokens", "messages", "model", "stream"])
+ async def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | Literal[True] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessage | AsyncStream[BetaRawMessageStreamEvent]:
+ if not stream and not is_given(timeout) and self._client.timeout == DEFAULT_TIMEOUT:
+ timeout = self._client._calculate_nonstreaming_timeout(max_tokens)
+
+ if model in DEPRECATED_MODELS:
+ warnings.warn(
+ f"The model '{model}' is deprecated and will reach end-of-life on {DEPRECATED_MODELS[model]}.\nPlease migrate to a newer model. Visit https://docs.anthropic.com/en/docs/resources/model-deprecations for more information.",
+ DeprecationWarning,
+ stacklevel=3,
+ )
+
+ extra_headers = {
+ **strip_not_given({"anthropic-beta": ",".join(str(e) for e in betas) if is_given(betas) else NOT_GIVEN}),
+ **(extra_headers or {}),
+ }
+ return await self._post(
+ "/v1/messages?beta=true",
+ body=await async_maybe_transform(
+ {
+ "max_tokens": max_tokens,
+ "messages": messages,
+ "model": model,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "stream": stream,
+ "system": system,
+ "temperature": temperature,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "tools": tools,
+ "top_k": top_k,
+ "top_p": top_p,
+ },
+ message_create_params.MessageCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessage,
+ stream=stream or False,
+ stream_cls=AsyncStream[BetaRawMessageStreamEvent],
+ )
+
+ def stream(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ metadata: BetaMetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[BetaToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaAsyncMessageStreamManager:
+ extra_headers = {
+ "X-Stainless-Stream-Helper": "beta.messages",
+ **strip_not_given({"anthropic-beta": ",".join(str(e) for e in betas) if is_given(betas) else NOT_GIVEN}),
+ **(extra_headers or {}),
+ }
+ request = self._post(
+ "/v1/messages",
+ body=maybe_transform(
+ {
+ "max_tokens": max_tokens,
+ "messages": messages,
+ "model": model,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "system": system,
+ "temperature": temperature,
+ "thinking": thinking,
+ "top_k": top_k,
+ "top_p": top_p,
+ "tools": tools,
+ "tool_choice": tool_choice,
+ "stream": True,
+ },
+ message_create_params.MessageCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessage,
+ stream=True,
+ stream_cls=AsyncStream[BetaRawMessageStreamEvent],
+ )
+ return BetaAsyncMessageStreamManager(request)
+
+ async def count_tokens(
+ self,
+ *,
+ messages: Iterable[BetaMessageParam],
+ model: ModelParam,
+ system: Union[str, Iterable[BetaTextBlockParam]] | NotGiven = NOT_GIVEN,
+ thinking: BetaThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: BetaToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[message_count_tokens_params.Tool] | NotGiven = NOT_GIVEN,
+ betas: List[AnthropicBetaParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaMessageTokensCount:
+ """
+ Count the number of tokens in a Message.
+
+ The Token Count API can be used to count the number of tokens in a Message,
+ including tools, images, and documents, without creating it.
+
+ Learn more about token counting in our
+ [user guide](/en/docs/build-with-claude/token-counting)
+
+ Args:
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ betas: Optional header to specify the beta version(s) you want to use.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ extra_headers = {
+ **strip_not_given(
+ {
+ "anthropic-beta": ",".join(chain((str(e) for e in betas), ["token-counting-2024-11-01"]))
+ if is_given(betas)
+ else NOT_GIVEN
+ }
+ ),
+ **(extra_headers or {}),
+ }
+ extra_headers = {"anthropic-beta": "token-counting-2024-11-01", **(extra_headers or {})}
+ return await self._post(
+ "/v1/messages/count_tokens?beta=true",
+ body=await async_maybe_transform(
+ {
+ "messages": messages,
+ "model": model,
+ "system": system,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "tools": tools,
+ },
+ message_count_tokens_params.MessageCountTokensParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaMessageTokensCount,
+ )
+
+
+class MessagesWithRawResponse:
+ def __init__(self, messages: Messages) -> None:
+ self._messages = messages
+
+ self.create = _legacy_response.to_raw_response_wrapper(
+ messages.create,
+ )
+ self.count_tokens = _legacy_response.to_raw_response_wrapper(
+ messages.count_tokens,
+ )
+
+ @cached_property
+ def batches(self) -> BatchesWithRawResponse:
+ return BatchesWithRawResponse(self._messages.batches)
+
+
+class AsyncMessagesWithRawResponse:
+ def __init__(self, messages: AsyncMessages) -> None:
+ self._messages = messages
+
+ self.create = _legacy_response.async_to_raw_response_wrapper(
+ messages.create,
+ )
+ self.count_tokens = _legacy_response.async_to_raw_response_wrapper(
+ messages.count_tokens,
+ )
+
+ @cached_property
+ def batches(self) -> AsyncBatchesWithRawResponse:
+ return AsyncBatchesWithRawResponse(self._messages.batches)
+
+
+class MessagesWithStreamingResponse:
+ def __init__(self, messages: Messages) -> None:
+ self._messages = messages
+
+ self.create = to_streamed_response_wrapper(
+ messages.create,
+ )
+ self.count_tokens = to_streamed_response_wrapper(
+ messages.count_tokens,
+ )
+
+ @cached_property
+ def batches(self) -> BatchesWithStreamingResponse:
+ return BatchesWithStreamingResponse(self._messages.batches)
+
+
+class AsyncMessagesWithStreamingResponse:
+ def __init__(self, messages: AsyncMessages) -> None:
+ self._messages = messages
+
+ self.create = async_to_streamed_response_wrapper(
+ messages.create,
+ )
+ self.count_tokens = async_to_streamed_response_wrapper(
+ messages.count_tokens,
+ )
+
+ @cached_property
+ def batches(self) -> AsyncBatchesWithStreamingResponse:
+ return AsyncBatchesWithStreamingResponse(self._messages.batches)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/beta/models.py b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/models.py
new file mode 100644
index 00000000..04d620c5
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/beta/models.py
@@ -0,0 +1,300 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+import httpx
+
+from ... import _legacy_response
+from ..._types import NOT_GIVEN, Body, Query, Headers, NotGiven
+from ..._utils import maybe_transform
+from ..._compat import cached_property
+from ..._resource import SyncAPIResource, AsyncAPIResource
+from ..._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from ...pagination import SyncPage, AsyncPage
+from ...types.beta import model_list_params
+from ..._base_client import AsyncPaginator, make_request_options
+from ...types.beta.beta_model_info import BetaModelInfo
+
+__all__ = ["Models", "AsyncModels"]
+
+
+class Models(SyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> ModelsWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return ModelsWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> ModelsWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return ModelsWithStreamingResponse(self)
+
+ def retrieve(
+ self,
+ model_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaModelInfo:
+ """
+ Get a specific model.
+
+ The Models API response can be used to determine information about a specific
+ model or resolve a model alias to a model ID.
+
+ Args:
+ model_id: Model identifier or alias.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not model_id:
+ raise ValueError(f"Expected a non-empty value for `model_id` but received {model_id!r}")
+ return self._get(
+ f"/v1/models/{model_id}?beta=true",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaModelInfo,
+ )
+
+ def list(
+ self,
+ *,
+ after_id: str | NotGiven = NOT_GIVEN,
+ before_id: str | NotGiven = NOT_GIVEN,
+ limit: int | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> SyncPage[BetaModelInfo]:
+ """
+ List available models.
+
+ The Models API response can be used to determine which models are available for
+ use in the API. More recently released models are listed first.
+
+ Args:
+ after_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately after this object.
+
+ before_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately before this object.
+
+ limit: Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return self._get_api_list(
+ "/v1/models?beta=true",
+ page=SyncPage[BetaModelInfo],
+ options=make_request_options(
+ extra_headers=extra_headers,
+ extra_query=extra_query,
+ extra_body=extra_body,
+ timeout=timeout,
+ query=maybe_transform(
+ {
+ "after_id": after_id,
+ "before_id": before_id,
+ "limit": limit,
+ },
+ model_list_params.ModelListParams,
+ ),
+ ),
+ model=BetaModelInfo,
+ )
+
+
+class AsyncModels(AsyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> AsyncModelsWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncModelsWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncModelsWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncModelsWithStreamingResponse(self)
+
+ async def retrieve(
+ self,
+ model_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> BetaModelInfo:
+ """
+ Get a specific model.
+
+ The Models API response can be used to determine information about a specific
+ model or resolve a model alias to a model ID.
+
+ Args:
+ model_id: Model identifier or alias.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not model_id:
+ raise ValueError(f"Expected a non-empty value for `model_id` but received {model_id!r}")
+ return await self._get(
+ f"/v1/models/{model_id}?beta=true",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=BetaModelInfo,
+ )
+
+ def list(
+ self,
+ *,
+ after_id: str | NotGiven = NOT_GIVEN,
+ before_id: str | NotGiven = NOT_GIVEN,
+ limit: int | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncPaginator[BetaModelInfo, AsyncPage[BetaModelInfo]]:
+ """
+ List available models.
+
+ The Models API response can be used to determine which models are available for
+ use in the API. More recently released models are listed first.
+
+ Args:
+ after_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately after this object.
+
+ before_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately before this object.
+
+ limit: Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return self._get_api_list(
+ "/v1/models?beta=true",
+ page=AsyncPage[BetaModelInfo],
+ options=make_request_options(
+ extra_headers=extra_headers,
+ extra_query=extra_query,
+ extra_body=extra_body,
+ timeout=timeout,
+ query=maybe_transform(
+ {
+ "after_id": after_id,
+ "before_id": before_id,
+ "limit": limit,
+ },
+ model_list_params.ModelListParams,
+ ),
+ ),
+ model=BetaModelInfo,
+ )
+
+
+class ModelsWithRawResponse:
+ def __init__(self, models: Models) -> None:
+ self._models = models
+
+ self.retrieve = _legacy_response.to_raw_response_wrapper(
+ models.retrieve,
+ )
+ self.list = _legacy_response.to_raw_response_wrapper(
+ models.list,
+ )
+
+
+class AsyncModelsWithRawResponse:
+ def __init__(self, models: AsyncModels) -> None:
+ self._models = models
+
+ self.retrieve = _legacy_response.async_to_raw_response_wrapper(
+ models.retrieve,
+ )
+ self.list = _legacy_response.async_to_raw_response_wrapper(
+ models.list,
+ )
+
+
+class ModelsWithStreamingResponse:
+ def __init__(self, models: Models) -> None:
+ self._models = models
+
+ self.retrieve = to_streamed_response_wrapper(
+ models.retrieve,
+ )
+ self.list = to_streamed_response_wrapper(
+ models.list,
+ )
+
+
+class AsyncModelsWithStreamingResponse:
+ def __init__(self, models: AsyncModels) -> None:
+ self._models = models
+
+ self.retrieve = async_to_streamed_response_wrapper(
+ models.retrieve,
+ )
+ self.list = async_to_streamed_response_wrapper(
+ models.list,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/completions.py b/.venv/lib/python3.12/site-packages/anthropic/resources/completions.py
new file mode 100644
index 00000000..67e3977e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/completions.py
@@ -0,0 +1,823 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import List
+from typing_extensions import Literal, overload
+
+import httpx
+
+from .. import _legacy_response
+from ..types import completion_create_params
+from .._types import NOT_GIVEN, Body, Query, Headers, NotGiven
+from .._utils import (
+ is_given,
+ required_args,
+ maybe_transform,
+ async_maybe_transform,
+)
+from .._compat import cached_property
+from .._resource import SyncAPIResource, AsyncAPIResource
+from .._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from .._constants import DEFAULT_TIMEOUT
+from .._streaming import Stream, AsyncStream
+from .._base_client import make_request_options
+from ..types.completion import Completion
+from ..types.model_param import ModelParam
+from ..types.metadata_param import MetadataParam
+
+__all__ = ["Completions", "AsyncCompletions"]
+
+
+class Completions(SyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> CompletionsWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return CompletionsWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> CompletionsWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return CompletionsWithStreamingResponse(self)
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens_to_sample: int,
+ model: ModelParam,
+ prompt: str,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Completion:
+ """[Legacy] Create a Text Completion.
+
+ The Text Completions API is a legacy API.
+
+ We recommend using the
+ [Messages API](https://docs.anthropic.com/en/api/messages) going forward.
+
+ Future models and features will not be compatible with Text Completions. See our
+ [migration guide](https://docs.anthropic.com/en/api/migrating-from-text-completions-to-messages)
+ for guidance in migrating from Text Completions to Messages.
+
+ Args:
+ max_tokens_to_sample: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ prompt: The prompt that you want Claude to complete.
+
+ For proper response generation you will need to format your prompt using
+ alternating `\n\nHuman:` and `\n\nAssistant:` conversational turns. For example:
+
+ ```
+ "\n\nHuman: {userQuestion}\n\nAssistant:"
+ ```
+
+ See [prompt validation](https://docs.anthropic.com/en/api/prompt-validation) and
+ our guide to
+ [prompt design](https://docs.anthropic.com/en/docs/intro-to-prompting) for more
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Sequences that will cause the model to stop generating.
+
+ Our models stop on `"\n\nHuman:"`, and may include additional built-in stop
+ sequences in the future. By providing the stop_sequences parameter, you may
+ include additional strings that will cause the model to stop generating.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/streaming) for details.
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens_to_sample: int,
+ model: ModelParam,
+ prompt: str,
+ stream: Literal[True],
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Stream[Completion]:
+ """[Legacy] Create a Text Completion.
+
+ The Text Completions API is a legacy API.
+
+ We recommend using the
+ [Messages API](https://docs.anthropic.com/en/api/messages) going forward.
+
+ Future models and features will not be compatible with Text Completions. See our
+ [migration guide](https://docs.anthropic.com/en/api/migrating-from-text-completions-to-messages)
+ for guidance in migrating from Text Completions to Messages.
+
+ Args:
+ max_tokens_to_sample: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ prompt: The prompt that you want Claude to complete.
+
+ For proper response generation you will need to format your prompt using
+ alternating `\n\nHuman:` and `\n\nAssistant:` conversational turns. For example:
+
+ ```
+ "\n\nHuman: {userQuestion}\n\nAssistant:"
+ ```
+
+ See [prompt validation](https://docs.anthropic.com/en/api/prompt-validation) and
+ our guide to
+ [prompt design](https://docs.anthropic.com/en/docs/intro-to-prompting) for more
+ details.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/streaming) for details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Sequences that will cause the model to stop generating.
+
+ Our models stop on `"\n\nHuman:"`, and may include additional built-in stop
+ sequences in the future. By providing the stop_sequences parameter, you may
+ include additional strings that will cause the model to stop generating.
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens_to_sample: int,
+ model: ModelParam,
+ prompt: str,
+ stream: bool,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Completion | Stream[Completion]:
+ """[Legacy] Create a Text Completion.
+
+ The Text Completions API is a legacy API.
+
+ We recommend using the
+ [Messages API](https://docs.anthropic.com/en/api/messages) going forward.
+
+ Future models and features will not be compatible with Text Completions. See our
+ [migration guide](https://docs.anthropic.com/en/api/migrating-from-text-completions-to-messages)
+ for guidance in migrating from Text Completions to Messages.
+
+ Args:
+ max_tokens_to_sample: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ prompt: The prompt that you want Claude to complete.
+
+ For proper response generation you will need to format your prompt using
+ alternating `\n\nHuman:` and `\n\nAssistant:` conversational turns. For example:
+
+ ```
+ "\n\nHuman: {userQuestion}\n\nAssistant:"
+ ```
+
+ See [prompt validation](https://docs.anthropic.com/en/api/prompt-validation) and
+ our guide to
+ [prompt design](https://docs.anthropic.com/en/docs/intro-to-prompting) for more
+ details.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/streaming) for details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Sequences that will cause the model to stop generating.
+
+ Our models stop on `"\n\nHuman:"`, and may include additional built-in stop
+ sequences in the future. By providing the stop_sequences parameter, you may
+ include additional strings that will cause the model to stop generating.
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @required_args(["max_tokens_to_sample", "model", "prompt"], ["max_tokens_to_sample", "model", "prompt", "stream"])
+ def create(
+ self,
+ *,
+ max_tokens_to_sample: int,
+ model: ModelParam,
+ prompt: str,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | Literal[True] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Completion | Stream[Completion]:
+ if not is_given(timeout) and self._client.timeout == DEFAULT_TIMEOUT:
+ timeout = 600
+ return self._post(
+ "/v1/complete",
+ body=maybe_transform(
+ {
+ "max_tokens_to_sample": max_tokens_to_sample,
+ "model": model,
+ "prompt": prompt,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "stream": stream,
+ "temperature": temperature,
+ "top_k": top_k,
+ "top_p": top_p,
+ },
+ completion_create_params.CompletionCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=Completion,
+ stream=stream or False,
+ stream_cls=Stream[Completion],
+ )
+
+
+class AsyncCompletions(AsyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> AsyncCompletionsWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncCompletionsWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncCompletionsWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncCompletionsWithStreamingResponse(self)
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens_to_sample: int,
+ model: ModelParam,
+ prompt: str,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Completion:
+ """[Legacy] Create a Text Completion.
+
+ The Text Completions API is a legacy API.
+
+ We recommend using the
+ [Messages API](https://docs.anthropic.com/en/api/messages) going forward.
+
+ Future models and features will not be compatible with Text Completions. See our
+ [migration guide](https://docs.anthropic.com/en/api/migrating-from-text-completions-to-messages)
+ for guidance in migrating from Text Completions to Messages.
+
+ Args:
+ max_tokens_to_sample: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ prompt: The prompt that you want Claude to complete.
+
+ For proper response generation you will need to format your prompt using
+ alternating `\n\nHuman:` and `\n\nAssistant:` conversational turns. For example:
+
+ ```
+ "\n\nHuman: {userQuestion}\n\nAssistant:"
+ ```
+
+ See [prompt validation](https://docs.anthropic.com/en/api/prompt-validation) and
+ our guide to
+ [prompt design](https://docs.anthropic.com/en/docs/intro-to-prompting) for more
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Sequences that will cause the model to stop generating.
+
+ Our models stop on `"\n\nHuman:"`, and may include additional built-in stop
+ sequences in the future. By providing the stop_sequences parameter, you may
+ include additional strings that will cause the model to stop generating.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/streaming) for details.
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens_to_sample: int,
+ model: ModelParam,
+ prompt: str,
+ stream: Literal[True],
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncStream[Completion]:
+ """[Legacy] Create a Text Completion.
+
+ The Text Completions API is a legacy API.
+
+ We recommend using the
+ [Messages API](https://docs.anthropic.com/en/api/messages) going forward.
+
+ Future models and features will not be compatible with Text Completions. See our
+ [migration guide](https://docs.anthropic.com/en/api/migrating-from-text-completions-to-messages)
+ for guidance in migrating from Text Completions to Messages.
+
+ Args:
+ max_tokens_to_sample: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ prompt: The prompt that you want Claude to complete.
+
+ For proper response generation you will need to format your prompt using
+ alternating `\n\nHuman:` and `\n\nAssistant:` conversational turns. For example:
+
+ ```
+ "\n\nHuman: {userQuestion}\n\nAssistant:"
+ ```
+
+ See [prompt validation](https://docs.anthropic.com/en/api/prompt-validation) and
+ our guide to
+ [prompt design](https://docs.anthropic.com/en/docs/intro-to-prompting) for more
+ details.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/streaming) for details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Sequences that will cause the model to stop generating.
+
+ Our models stop on `"\n\nHuman:"`, and may include additional built-in stop
+ sequences in the future. By providing the stop_sequences parameter, you may
+ include additional strings that will cause the model to stop generating.
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens_to_sample: int,
+ model: ModelParam,
+ prompt: str,
+ stream: bool,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Completion | AsyncStream[Completion]:
+ """[Legacy] Create a Text Completion.
+
+ The Text Completions API is a legacy API.
+
+ We recommend using the
+ [Messages API](https://docs.anthropic.com/en/api/messages) going forward.
+
+ Future models and features will not be compatible with Text Completions. See our
+ [migration guide](https://docs.anthropic.com/en/api/migrating-from-text-completions-to-messages)
+ for guidance in migrating from Text Completions to Messages.
+
+ Args:
+ max_tokens_to_sample: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ prompt: The prompt that you want Claude to complete.
+
+ For proper response generation you will need to format your prompt using
+ alternating `\n\nHuman:` and `\n\nAssistant:` conversational turns. For example:
+
+ ```
+ "\n\nHuman: {userQuestion}\n\nAssistant:"
+ ```
+
+ See [prompt validation](https://docs.anthropic.com/en/api/prompt-validation) and
+ our guide to
+ [prompt design](https://docs.anthropic.com/en/docs/intro-to-prompting) for more
+ details.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/streaming) for details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Sequences that will cause the model to stop generating.
+
+ Our models stop on `"\n\nHuman:"`, and may include additional built-in stop
+ sequences in the future. By providing the stop_sequences parameter, you may
+ include additional strings that will cause the model to stop generating.
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @required_args(["max_tokens_to_sample", "model", "prompt"], ["max_tokens_to_sample", "model", "prompt", "stream"])
+ async def create(
+ self,
+ *,
+ max_tokens_to_sample: int,
+ model: ModelParam,
+ prompt: str,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | Literal[True] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Completion | AsyncStream[Completion]:
+ if not is_given(timeout) and self._client.timeout == DEFAULT_TIMEOUT:
+ timeout = 600
+ return await self._post(
+ "/v1/complete",
+ body=await async_maybe_transform(
+ {
+ "max_tokens_to_sample": max_tokens_to_sample,
+ "model": model,
+ "prompt": prompt,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "stream": stream,
+ "temperature": temperature,
+ "top_k": top_k,
+ "top_p": top_p,
+ },
+ completion_create_params.CompletionCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=Completion,
+ stream=stream or False,
+ stream_cls=AsyncStream[Completion],
+ )
+
+
+class CompletionsWithRawResponse:
+ def __init__(self, completions: Completions) -> None:
+ self._completions = completions
+
+ self.create = _legacy_response.to_raw_response_wrapper(
+ completions.create,
+ )
+
+
+class AsyncCompletionsWithRawResponse:
+ def __init__(self, completions: AsyncCompletions) -> None:
+ self._completions = completions
+
+ self.create = _legacy_response.async_to_raw_response_wrapper(
+ completions.create,
+ )
+
+
+class CompletionsWithStreamingResponse:
+ def __init__(self, completions: Completions) -> None:
+ self._completions = completions
+
+ self.create = to_streamed_response_wrapper(
+ completions.create,
+ )
+
+
+class AsyncCompletionsWithStreamingResponse:
+ def __init__(self, completions: AsyncCompletions) -> None:
+ self._completions = completions
+
+ self.create = async_to_streamed_response_wrapper(
+ completions.create,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/messages/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/resources/messages/__init__.py
new file mode 100644
index 00000000..6e7cf9d9
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/messages/__init__.py
@@ -0,0 +1,35 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from .batches import (
+ Batches,
+ AsyncBatches,
+ BatchesWithRawResponse,
+ AsyncBatchesWithRawResponse,
+ BatchesWithStreamingResponse,
+ AsyncBatchesWithStreamingResponse,
+)
+from .messages import (
+ DEPRECATED_MODELS,
+ Messages,
+ AsyncMessages,
+ MessagesWithRawResponse,
+ AsyncMessagesWithRawResponse,
+ MessagesWithStreamingResponse,
+ AsyncMessagesWithStreamingResponse,
+)
+
+__all__ = [
+ "Batches",
+ "AsyncBatches",
+ "BatchesWithRawResponse",
+ "AsyncBatchesWithRawResponse",
+ "BatchesWithStreamingResponse",
+ "AsyncBatchesWithStreamingResponse",
+ "Messages",
+ "AsyncMessages",
+ "MessagesWithRawResponse",
+ "AsyncMessagesWithRawResponse",
+ "MessagesWithStreamingResponse",
+ "AsyncMessagesWithStreamingResponse",
+ "DEPRECATED_MODELS",
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/messages/batches.py b/.venv/lib/python3.12/site-packages/anthropic/resources/messages/batches.py
new file mode 100644
index 00000000..4ebd8fd4
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/messages/batches.py
@@ -0,0 +1,717 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Iterable
+
+import httpx
+
+from ... import _legacy_response
+from ..._types import NOT_GIVEN, Body, Query, Headers, NotGiven
+from ..._utils import (
+ maybe_transform,
+ async_maybe_transform,
+)
+from ..._compat import cached_property
+from ..._resource import SyncAPIResource, AsyncAPIResource
+from ..._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from ...pagination import SyncPage, AsyncPage
+from ..._exceptions import AnthropicError
+from ..._base_client import AsyncPaginator, make_request_options
+from ...types.messages import batch_list_params, batch_create_params
+from ..._decoders.jsonl import JSONLDecoder, AsyncJSONLDecoder
+from ...types.messages.message_batch import MessageBatch
+from ...types.messages.deleted_message_batch import DeletedMessageBatch
+from ...types.messages.message_batch_individual_response import MessageBatchIndividualResponse
+
+__all__ = ["Batches", "AsyncBatches"]
+
+
+class Batches(SyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> BatchesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return BatchesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> BatchesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return BatchesWithStreamingResponse(self)
+
+ def create(
+ self,
+ *,
+ requests: Iterable[batch_create_params.Request],
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageBatch:
+ """
+ Send a batch of Message creation requests.
+
+ The Message Batches API can be used to process multiple Messages API requests at
+ once. Once a Message Batch is created, it begins processing immediately. Batches
+ can take up to 24 hours to complete.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ requests: List of requests for prompt completion. Each is an individual request to create
+ a Message.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return self._post(
+ "/v1/messages/batches",
+ body=maybe_transform({"requests": requests}, batch_create_params.BatchCreateParams),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=MessageBatch,
+ )
+
+ def retrieve(
+ self,
+ message_batch_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageBatch:
+ """This endpoint is idempotent and can be used to poll for Message Batch
+ completion.
+
+ To access the results of a Message Batch, make a request to the
+ `results_url` field in the response.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ return self._get(
+ f"/v1/messages/batches/{message_batch_id}",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=MessageBatch,
+ )
+
+ def list(
+ self,
+ *,
+ after_id: str | NotGiven = NOT_GIVEN,
+ before_id: str | NotGiven = NOT_GIVEN,
+ limit: int | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> SyncPage[MessageBatch]:
+ """List all Message Batches within a Workspace.
+
+ Most recently created batches are
+ returned first.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ after_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately after this object.
+
+ before_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately before this object.
+
+ limit: Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return self._get_api_list(
+ "/v1/messages/batches",
+ page=SyncPage[MessageBatch],
+ options=make_request_options(
+ extra_headers=extra_headers,
+ extra_query=extra_query,
+ extra_body=extra_body,
+ timeout=timeout,
+ query=maybe_transform(
+ {
+ "after_id": after_id,
+ "before_id": before_id,
+ "limit": limit,
+ },
+ batch_list_params.BatchListParams,
+ ),
+ ),
+ model=MessageBatch,
+ )
+
+ def delete(
+ self,
+ message_batch_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> DeletedMessageBatch:
+ """
+ Delete a Message Batch.
+
+ Message Batches can only be deleted once they've finished processing. If you'd
+ like to delete an in-progress batch, you must first cancel it.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ return self._delete(
+ f"/v1/messages/batches/{message_batch_id}",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=DeletedMessageBatch,
+ )
+
+ def cancel(
+ self,
+ message_batch_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageBatch:
+ """Batches may be canceled any time before processing ends.
+
+ Once cancellation is
+ initiated, the batch enters a `canceling` state, at which time the system may
+ complete any in-progress, non-interruptible requests before finalizing
+ cancellation.
+
+ The number of canceled requests is specified in `request_counts`. To determine
+ which requests were canceled, check the individual results within the batch.
+ Note that cancellation may not result in any canceled requests if they were
+ non-interruptible.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ return self._post(
+ f"/v1/messages/batches/{message_batch_id}/cancel",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=MessageBatch,
+ )
+
+ def results(
+ self,
+ message_batch_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> JSONLDecoder[MessageBatchIndividualResponse]:
+ """
+ Streams the results of a Message Batch as a `.jsonl` file.
+
+ Each line in the file is a JSON object containing the result of a single request
+ in the Message Batch. Results are not guaranteed to be in the same order as
+ requests. Use the `custom_id` field to match results to requests.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+
+ batch = self.retrieve(message_batch_id=message_batch_id)
+ if not batch.results_url:
+ raise AnthropicError(
+ f"No `results_url` for the given batch; Has it finished processing? {batch.processing_status}"
+ )
+
+ extra_headers = {"Accept": "application/binary", **(extra_headers or {})}
+ return self._get(
+ batch.results_url,
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=JSONLDecoder[MessageBatchIndividualResponse],
+ stream=True,
+ )
+
+
+class AsyncBatches(AsyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> AsyncBatchesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncBatchesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncBatchesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncBatchesWithStreamingResponse(self)
+
+ async def create(
+ self,
+ *,
+ requests: Iterable[batch_create_params.Request],
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageBatch:
+ """
+ Send a batch of Message creation requests.
+
+ The Message Batches API can be used to process multiple Messages API requests at
+ once. Once a Message Batch is created, it begins processing immediately. Batches
+ can take up to 24 hours to complete.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ requests: List of requests for prompt completion. Each is an individual request to create
+ a Message.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return await self._post(
+ "/v1/messages/batches",
+ body=await async_maybe_transform({"requests": requests}, batch_create_params.BatchCreateParams),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=MessageBatch,
+ )
+
+ async def retrieve(
+ self,
+ message_batch_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageBatch:
+ """This endpoint is idempotent and can be used to poll for Message Batch
+ completion.
+
+ To access the results of a Message Batch, make a request to the
+ `results_url` field in the response.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ return await self._get(
+ f"/v1/messages/batches/{message_batch_id}",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=MessageBatch,
+ )
+
+ def list(
+ self,
+ *,
+ after_id: str | NotGiven = NOT_GIVEN,
+ before_id: str | NotGiven = NOT_GIVEN,
+ limit: int | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncPaginator[MessageBatch, AsyncPage[MessageBatch]]:
+ """List all Message Batches within a Workspace.
+
+ Most recently created batches are
+ returned first.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ after_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately after this object.
+
+ before_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately before this object.
+
+ limit: Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return self._get_api_list(
+ "/v1/messages/batches",
+ page=AsyncPage[MessageBatch],
+ options=make_request_options(
+ extra_headers=extra_headers,
+ extra_query=extra_query,
+ extra_body=extra_body,
+ timeout=timeout,
+ query=maybe_transform(
+ {
+ "after_id": after_id,
+ "before_id": before_id,
+ "limit": limit,
+ },
+ batch_list_params.BatchListParams,
+ ),
+ ),
+ model=MessageBatch,
+ )
+
+ async def delete(
+ self,
+ message_batch_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> DeletedMessageBatch:
+ """
+ Delete a Message Batch.
+
+ Message Batches can only be deleted once they've finished processing. If you'd
+ like to delete an in-progress batch, you must first cancel it.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ return await self._delete(
+ f"/v1/messages/batches/{message_batch_id}",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=DeletedMessageBatch,
+ )
+
+ async def cancel(
+ self,
+ message_batch_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageBatch:
+ """Batches may be canceled any time before processing ends.
+
+ Once cancellation is
+ initiated, the batch enters a `canceling` state, at which time the system may
+ complete any in-progress, non-interruptible requests before finalizing
+ cancellation.
+
+ The number of canceled requests is specified in `request_counts`. To determine
+ which requests were canceled, check the individual results within the batch.
+ Note that cancellation may not result in any canceled requests if they were
+ non-interruptible.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+ return await self._post(
+ f"/v1/messages/batches/{message_batch_id}/cancel",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=MessageBatch,
+ )
+
+ async def results(
+ self,
+ message_batch_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncJSONLDecoder[MessageBatchIndividualResponse]:
+ """
+ Streams the results of a Message Batch as a `.jsonl` file.
+
+ Each line in the file is a JSON object containing the result of a single request
+ in the Message Batch. Results are not guaranteed to be in the same order as
+ requests. Use the `custom_id` field to match results to requests.
+
+ Learn more about the Message Batches API in our
+ [user guide](/en/docs/build-with-claude/batch-processing)
+
+ Args:
+ message_batch_id: ID of the Message Batch.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not message_batch_id:
+ raise ValueError(f"Expected a non-empty value for `message_batch_id` but received {message_batch_id!r}")
+
+ batch = await self.retrieve(message_batch_id=message_batch_id)
+ if not batch.results_url:
+ raise AnthropicError(
+ f"No `results_url` for the given batch; Has it finished processing? {batch.processing_status}"
+ )
+
+ extra_headers = {"Accept": "application/binary", **(extra_headers or {})}
+ return await self._get(
+ batch.results_url,
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=AsyncJSONLDecoder[MessageBatchIndividualResponse],
+ stream=True,
+ )
+
+
+class BatchesWithRawResponse:
+ def __init__(self, batches: Batches) -> None:
+ self._batches = batches
+
+ self.create = _legacy_response.to_raw_response_wrapper(
+ batches.create,
+ )
+ self.retrieve = _legacy_response.to_raw_response_wrapper(
+ batches.retrieve,
+ )
+ self.list = _legacy_response.to_raw_response_wrapper(
+ batches.list,
+ )
+ self.delete = _legacy_response.to_raw_response_wrapper(
+ batches.delete,
+ )
+ self.cancel = _legacy_response.to_raw_response_wrapper(
+ batches.cancel,
+ )
+
+
+class AsyncBatchesWithRawResponse:
+ def __init__(self, batches: AsyncBatches) -> None:
+ self._batches = batches
+
+ self.create = _legacy_response.async_to_raw_response_wrapper(
+ batches.create,
+ )
+ self.retrieve = _legacy_response.async_to_raw_response_wrapper(
+ batches.retrieve,
+ )
+ self.list = _legacy_response.async_to_raw_response_wrapper(
+ batches.list,
+ )
+ self.delete = _legacy_response.async_to_raw_response_wrapper(
+ batches.delete,
+ )
+ self.cancel = _legacy_response.async_to_raw_response_wrapper(
+ batches.cancel,
+ )
+
+
+class BatchesWithStreamingResponse:
+ def __init__(self, batches: Batches) -> None:
+ self._batches = batches
+
+ self.create = to_streamed_response_wrapper(
+ batches.create,
+ )
+ self.retrieve = to_streamed_response_wrapper(
+ batches.retrieve,
+ )
+ self.list = to_streamed_response_wrapper(
+ batches.list,
+ )
+ self.delete = to_streamed_response_wrapper(
+ batches.delete,
+ )
+ self.cancel = to_streamed_response_wrapper(
+ batches.cancel,
+ )
+
+
+class AsyncBatchesWithStreamingResponse:
+ def __init__(self, batches: AsyncBatches) -> None:
+ self._batches = batches
+
+ self.create = async_to_streamed_response_wrapper(
+ batches.create,
+ )
+ self.retrieve = async_to_streamed_response_wrapper(
+ batches.retrieve,
+ )
+ self.list = async_to_streamed_response_wrapper(
+ batches.list,
+ )
+ self.delete = async_to_streamed_response_wrapper(
+ batches.delete,
+ )
+ self.cancel = async_to_streamed_response_wrapper(
+ batches.cancel,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/messages/messages.py b/.venv/lib/python3.12/site-packages/anthropic/resources/messages/messages.py
new file mode 100644
index 00000000..70bceb7f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/messages/messages.py
@@ -0,0 +1,2551 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+import warnings
+from typing import List, Union, Iterable
+from functools import partial
+from typing_extensions import Literal, overload
+
+import httpx
+
+from ... import _legacy_response
+from ...types import (
+ ThinkingConfigParam,
+ message_create_params,
+ message_count_tokens_params,
+)
+from .batches import (
+ Batches,
+ AsyncBatches,
+ BatchesWithRawResponse,
+ AsyncBatchesWithRawResponse,
+ BatchesWithStreamingResponse,
+ AsyncBatchesWithStreamingResponse,
+)
+from ..._types import NOT_GIVEN, Body, Query, Headers, NotGiven
+from ..._utils import (
+ is_given,
+ required_args,
+ maybe_transform,
+ async_maybe_transform,
+)
+from ..._compat import cached_property
+from ..._resource import SyncAPIResource, AsyncAPIResource
+from ..._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from ..._constants import DEFAULT_TIMEOUT
+from ..._streaming import Stream, AsyncStream
+from ..._base_client import make_request_options
+from ...lib.streaming import MessageStreamManager, AsyncMessageStreamManager
+from ...types.message import Message
+from ...types.model_param import ModelParam
+from ...types.message_param import MessageParam
+from ...types.metadata_param import MetadataParam
+from ...types.text_block_param import TextBlockParam
+from ...types.tool_union_param import ToolUnionParam
+from ...types.tool_choice_param import ToolChoiceParam
+from ...types.message_tokens_count import MessageTokensCount
+from ...types.thinking_config_param import ThinkingConfigParam
+from ...types.raw_message_stream_event import RawMessageStreamEvent
+from ...types.message_count_tokens_tool_param import MessageCountTokensToolParam
+
+__all__ = ["Messages", "AsyncMessages"]
+
+
+DEPRECATED_MODELS = {
+ "claude-1.3": "November 6th, 2024",
+ "claude-1.3-100k": "November 6th, 2024",
+ "claude-instant-1.1": "November 6th, 2024",
+ "claude-instant-1.1-100k": "November 6th, 2024",
+ "claude-instant-1.2": "November 6th, 2024",
+ "claude-3-sonnet-20240229": "July 21st, 2025",
+ "claude-2.1": "July 21st, 2025",
+ "claude-2.0": "July 21st, 2025",
+}
+
+
+class Messages(SyncAPIResource):
+ @cached_property
+ def batches(self) -> Batches:
+ return Batches(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> MessagesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return MessagesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> MessagesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return MessagesWithStreamingResponse(self)
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Message:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ stream: Literal[True],
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Stream[RawMessageStreamEvent]:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ stream: bool,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Message | Stream[RawMessageStreamEvent]:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @required_args(["max_tokens", "messages", "model"], ["max_tokens", "messages", "model", "stream"])
+ def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | Literal[True] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Message | Stream[RawMessageStreamEvent]:
+ if not stream and not is_given(timeout) and self._client.timeout == DEFAULT_TIMEOUT:
+ timeout = self._client._calculate_nonstreaming_timeout(max_tokens)
+
+ if model in DEPRECATED_MODELS:
+ warnings.warn(
+ f"The model '{model}' is deprecated and will reach end-of-life on {DEPRECATED_MODELS[model]}.\nPlease migrate to a newer model. Visit https://docs.anthropic.com/en/docs/resources/model-deprecations for more information.",
+ DeprecationWarning,
+ stacklevel=3,
+ )
+
+ return self._post(
+ "/v1/messages",
+ body=maybe_transform(
+ {
+ "max_tokens": max_tokens,
+ "messages": messages,
+ "model": model,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "stream": stream,
+ "system": system,
+ "temperature": temperature,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "tools": tools,
+ "top_k": top_k,
+ "top_p": top_p,
+ },
+ message_create_params.MessageCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=Message,
+ stream=stream or False,
+ stream_cls=Stream[RawMessageStreamEvent],
+ )
+
+ def stream(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageStreamManager:
+ """Create a Message stream"""
+ if model in DEPRECATED_MODELS:
+ warnings.warn(
+ f"The model '{model}' is deprecated and will reach end-of-life on {DEPRECATED_MODELS[model]}.\nPlease migrate to a newer model. Visit https://docs.anthropic.com/en/docs/resources/model-deprecations for more information.",
+ DeprecationWarning,
+ stacklevel=3,
+ )
+
+ extra_headers = {
+ "X-Stainless-Stream-Helper": "messages",
+ **(extra_headers or {}),
+ }
+ make_request = partial(
+ self._post,
+ "/v1/messages",
+ body=maybe_transform(
+ {
+ "max_tokens": max_tokens,
+ "messages": messages,
+ "model": model,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "system": system,
+ "temperature": temperature,
+ "top_k": top_k,
+ "top_p": top_p,
+ "tools": tools,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "stream": True,
+ },
+ message_create_params.MessageCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=Message,
+ stream=True,
+ stream_cls=Stream[RawMessageStreamEvent],
+ )
+ return MessageStreamManager(make_request)
+
+ def count_tokens(
+ self,
+ *,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[MessageCountTokensToolParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageTokensCount:
+ """
+ Count the number of tokens in a Message.
+
+ The Token Count API can be used to count the number of tokens in a Message,
+ including tools, images, and documents, without creating it.
+
+ Learn more about token counting in our
+ [user guide](/en/docs/build-with-claude/token-counting)
+
+ Args:
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return self._post(
+ "/v1/messages/count_tokens",
+ body=maybe_transform(
+ {
+ "messages": messages,
+ "model": model,
+ "system": system,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "tools": tools,
+ },
+ message_count_tokens_params.MessageCountTokensParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=MessageTokensCount,
+ )
+
+
+class AsyncMessages(AsyncAPIResource):
+ @cached_property
+ def batches(self) -> AsyncBatches:
+ return AsyncBatches(self._client)
+
+ @cached_property
+ def with_raw_response(self) -> AsyncMessagesWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncMessagesWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncMessagesWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncMessagesWithStreamingResponse(self)
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Message:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ stream: Literal[True],
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncStream[RawMessageStreamEvent]:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @overload
+ async def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ stream: bool,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Message | AsyncStream[RawMessageStreamEvent]:
+ """
+ Send a structured list of input messages with text and/or image content, and the
+ model will generate the next message in the conversation.
+
+ The Messages API can be used for either single queries or stateless multi-turn
+ conversations.
+
+ Learn more about the Messages API in our [user guide](/en/docs/initial-setup)
+
+ Args:
+ max_tokens: The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ stream: Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+
+ metadata: An object describing metadata about the request.
+
+ stop_sequences: Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ temperature: Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ top_k: Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ top_p: Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ ...
+
+ @required_args(["max_tokens", "messages", "model"], ["max_tokens", "messages", "model", "stream"])
+ async def create(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ stream: Literal[False] | Literal[True] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> Message | AsyncStream[RawMessageStreamEvent]:
+ if not stream and not is_given(timeout) and self._client.timeout == DEFAULT_TIMEOUT:
+ timeout = self._client._calculate_nonstreaming_timeout(max_tokens)
+
+ if model in DEPRECATED_MODELS:
+ warnings.warn(
+ f"The model '{model}' is deprecated and will reach end-of-life on {DEPRECATED_MODELS[model]}.\nPlease migrate to a newer model. Visit https://docs.anthropic.com/en/docs/resources/model-deprecations for more information.",
+ DeprecationWarning,
+ stacklevel=3,
+ )
+
+ return await self._post(
+ "/v1/messages",
+ body=await async_maybe_transform(
+ {
+ "max_tokens": max_tokens,
+ "messages": messages,
+ "model": model,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "stream": stream,
+ "system": system,
+ "temperature": temperature,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "tools": tools,
+ "top_k": top_k,
+ "top_p": top_p,
+ },
+ message_create_params.MessageCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=Message,
+ stream=stream or False,
+ stream_cls=AsyncStream[RawMessageStreamEvent],
+ )
+
+ def stream(
+ self,
+ *,
+ max_tokens: int,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ metadata: MetadataParam | NotGiven = NOT_GIVEN,
+ stop_sequences: List[str] | NotGiven = NOT_GIVEN,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ temperature: float | NotGiven = NOT_GIVEN,
+ top_k: int | NotGiven = NOT_GIVEN,
+ top_p: float | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[ToolUnionParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncMessageStreamManager:
+ """Create a Message stream"""
+ if model in DEPRECATED_MODELS:
+ warnings.warn(
+ f"The model '{model}' is deprecated and will reach end-of-life on {DEPRECATED_MODELS[model]}.\nPlease migrate to a newer model. Visit https://docs.anthropic.com/en/docs/resources/model-deprecations for more information.",
+ DeprecationWarning,
+ stacklevel=3,
+ )
+
+ extra_headers = {
+ "X-Stainless-Stream-Helper": "messages",
+ **(extra_headers or {}),
+ }
+ request = self._post(
+ "/v1/messages",
+ body=maybe_transform(
+ {
+ "max_tokens": max_tokens,
+ "messages": messages,
+ "model": model,
+ "metadata": metadata,
+ "stop_sequences": stop_sequences,
+ "system": system,
+ "temperature": temperature,
+ "top_k": top_k,
+ "top_p": top_p,
+ "tools": tools,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "stream": True,
+ },
+ message_create_params.MessageCreateParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=Message,
+ stream=True,
+ stream_cls=AsyncStream[RawMessageStreamEvent],
+ )
+ return AsyncMessageStreamManager(request)
+
+ async def count_tokens(
+ self,
+ *,
+ messages: Iterable[MessageParam],
+ model: ModelParam,
+ system: Union[str, Iterable[TextBlockParam]] | NotGiven = NOT_GIVEN,
+ thinking: ThinkingConfigParam | NotGiven = NOT_GIVEN,
+ tool_choice: ToolChoiceParam | NotGiven = NOT_GIVEN,
+ tools: Iterable[MessageCountTokensToolParam] | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> MessageTokensCount:
+ """
+ Count the number of tokens in a Message.
+
+ The Token Count API can be used to count the number of tokens in a Message,
+ including tools, images, and documents, without creating it.
+
+ Learn more about token counting in our
+ [user guide](/en/docs/build-with-claude/token-counting)
+
+ Args:
+ messages: Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+
+ model: The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+
+ system: System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+
+ thinking: Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+
+ tool_choice: How the model should use the provided tools. The model can use a specific tool,
+ any available tool, decide by itself, or not use tools at all.
+
+ tools: Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return await self._post(
+ "/v1/messages/count_tokens",
+ body=await async_maybe_transform(
+ {
+ "messages": messages,
+ "model": model,
+ "system": system,
+ "thinking": thinking,
+ "tool_choice": tool_choice,
+ "tools": tools,
+ },
+ message_count_tokens_params.MessageCountTokensParams,
+ ),
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=MessageTokensCount,
+ )
+
+
+class MessagesWithRawResponse:
+ def __init__(self, messages: Messages) -> None:
+ self._messages = messages
+
+ self.create = _legacy_response.to_raw_response_wrapper(
+ messages.create,
+ )
+ self.count_tokens = _legacy_response.to_raw_response_wrapper(
+ messages.count_tokens,
+ )
+
+ @cached_property
+ def batches(self) -> BatchesWithRawResponse:
+ return BatchesWithRawResponse(self._messages.batches)
+
+
+class AsyncMessagesWithRawResponse:
+ def __init__(self, messages: AsyncMessages) -> None:
+ self._messages = messages
+
+ self.create = _legacy_response.async_to_raw_response_wrapper(
+ messages.create,
+ )
+ self.count_tokens = _legacy_response.async_to_raw_response_wrapper(
+ messages.count_tokens,
+ )
+
+ @cached_property
+ def batches(self) -> AsyncBatchesWithRawResponse:
+ return AsyncBatchesWithRawResponse(self._messages.batches)
+
+
+class MessagesWithStreamingResponse:
+ def __init__(self, messages: Messages) -> None:
+ self._messages = messages
+
+ self.create = to_streamed_response_wrapper(
+ messages.create,
+ )
+ self.count_tokens = to_streamed_response_wrapper(
+ messages.count_tokens,
+ )
+
+ @cached_property
+ def batches(self) -> BatchesWithStreamingResponse:
+ return BatchesWithStreamingResponse(self._messages.batches)
+
+
+class AsyncMessagesWithStreamingResponse:
+ def __init__(self, messages: AsyncMessages) -> None:
+ self._messages = messages
+
+ self.create = async_to_streamed_response_wrapper(
+ messages.create,
+ )
+ self.count_tokens = async_to_streamed_response_wrapper(
+ messages.count_tokens,
+ )
+
+ @cached_property
+ def batches(self) -> AsyncBatchesWithStreamingResponse:
+ return AsyncBatchesWithStreamingResponse(self._messages.batches)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/resources/models.py b/.venv/lib/python3.12/site-packages/anthropic/resources/models.py
new file mode 100644
index 00000000..3469ccf9
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/resources/models.py
@@ -0,0 +1,300 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+import httpx
+
+from .. import _legacy_response
+from ..types import model_list_params
+from .._types import NOT_GIVEN, Body, Query, Headers, NotGiven
+from .._utils import maybe_transform
+from .._compat import cached_property
+from .._resource import SyncAPIResource, AsyncAPIResource
+from .._response import to_streamed_response_wrapper, async_to_streamed_response_wrapper
+from ..pagination import SyncPage, AsyncPage
+from .._base_client import AsyncPaginator, make_request_options
+from ..types.model_info import ModelInfo
+
+__all__ = ["Models", "AsyncModels"]
+
+
+class Models(SyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> ModelsWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return ModelsWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> ModelsWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return ModelsWithStreamingResponse(self)
+
+ def retrieve(
+ self,
+ model_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> ModelInfo:
+ """
+ Get a specific model.
+
+ The Models API response can be used to determine information about a specific
+ model or resolve a model alias to a model ID.
+
+ Args:
+ model_id: Model identifier or alias.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not model_id:
+ raise ValueError(f"Expected a non-empty value for `model_id` but received {model_id!r}")
+ return self._get(
+ f"/v1/models/{model_id}",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=ModelInfo,
+ )
+
+ def list(
+ self,
+ *,
+ after_id: str | NotGiven = NOT_GIVEN,
+ before_id: str | NotGiven = NOT_GIVEN,
+ limit: int | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> SyncPage[ModelInfo]:
+ """
+ List available models.
+
+ The Models API response can be used to determine which models are available for
+ use in the API. More recently released models are listed first.
+
+ Args:
+ after_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately after this object.
+
+ before_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately before this object.
+
+ limit: Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return self._get_api_list(
+ "/v1/models",
+ page=SyncPage[ModelInfo],
+ options=make_request_options(
+ extra_headers=extra_headers,
+ extra_query=extra_query,
+ extra_body=extra_body,
+ timeout=timeout,
+ query=maybe_transform(
+ {
+ "after_id": after_id,
+ "before_id": before_id,
+ "limit": limit,
+ },
+ model_list_params.ModelListParams,
+ ),
+ ),
+ model=ModelInfo,
+ )
+
+
+class AsyncModels(AsyncAPIResource):
+ @cached_property
+ def with_raw_response(self) -> AsyncModelsWithRawResponse:
+ """
+ This property can be used as a prefix for any HTTP method call to return
+ the raw response object instead of the parsed content.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#accessing-raw-response-data-eg-headers
+ """
+ return AsyncModelsWithRawResponse(self)
+
+ @cached_property
+ def with_streaming_response(self) -> AsyncModelsWithStreamingResponse:
+ """
+ An alternative to `.with_raw_response` that doesn't eagerly read the response body.
+
+ For more information, see https://www.github.com/anthropics/anthropic-sdk-python#with_streaming_response
+ """
+ return AsyncModelsWithStreamingResponse(self)
+
+ async def retrieve(
+ self,
+ model_id: str,
+ *,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> ModelInfo:
+ """
+ Get a specific model.
+
+ The Models API response can be used to determine information about a specific
+ model or resolve a model alias to a model ID.
+
+ Args:
+ model_id: Model identifier or alias.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ if not model_id:
+ raise ValueError(f"Expected a non-empty value for `model_id` but received {model_id!r}")
+ return await self._get(
+ f"/v1/models/{model_id}",
+ options=make_request_options(
+ extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout
+ ),
+ cast_to=ModelInfo,
+ )
+
+ def list(
+ self,
+ *,
+ after_id: str | NotGiven = NOT_GIVEN,
+ before_id: str | NotGiven = NOT_GIVEN,
+ limit: int | NotGiven = NOT_GIVEN,
+ # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs.
+ # The extra values given here take precedence over values defined on the client or passed to this method.
+ extra_headers: Headers | None = None,
+ extra_query: Query | None = None,
+ extra_body: Body | None = None,
+ timeout: float | httpx.Timeout | None | NotGiven = NOT_GIVEN,
+ ) -> AsyncPaginator[ModelInfo, AsyncPage[ModelInfo]]:
+ """
+ List available models.
+
+ The Models API response can be used to determine which models are available for
+ use in the API. More recently released models are listed first.
+
+ Args:
+ after_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately after this object.
+
+ before_id: ID of the object to use as a cursor for pagination. When provided, returns the
+ page of results immediately before this object.
+
+ limit: Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+
+ extra_headers: Send extra headers
+
+ extra_query: Add additional query parameters to the request
+
+ extra_body: Add additional JSON properties to the request
+
+ timeout: Override the client-level default timeout for this request, in seconds
+ """
+ return self._get_api_list(
+ "/v1/models",
+ page=AsyncPage[ModelInfo],
+ options=make_request_options(
+ extra_headers=extra_headers,
+ extra_query=extra_query,
+ extra_body=extra_body,
+ timeout=timeout,
+ query=maybe_transform(
+ {
+ "after_id": after_id,
+ "before_id": before_id,
+ "limit": limit,
+ },
+ model_list_params.ModelListParams,
+ ),
+ ),
+ model=ModelInfo,
+ )
+
+
+class ModelsWithRawResponse:
+ def __init__(self, models: Models) -> None:
+ self._models = models
+
+ self.retrieve = _legacy_response.to_raw_response_wrapper(
+ models.retrieve,
+ )
+ self.list = _legacy_response.to_raw_response_wrapper(
+ models.list,
+ )
+
+
+class AsyncModelsWithRawResponse:
+ def __init__(self, models: AsyncModels) -> None:
+ self._models = models
+
+ self.retrieve = _legacy_response.async_to_raw_response_wrapper(
+ models.retrieve,
+ )
+ self.list = _legacy_response.async_to_raw_response_wrapper(
+ models.list,
+ )
+
+
+class ModelsWithStreamingResponse:
+ def __init__(self, models: Models) -> None:
+ self._models = models
+
+ self.retrieve = to_streamed_response_wrapper(
+ models.retrieve,
+ )
+ self.list = to_streamed_response_wrapper(
+ models.list,
+ )
+
+
+class AsyncModelsWithStreamingResponse:
+ def __init__(self, models: AsyncModels) -> None:
+ self._models = models
+
+ self.retrieve = async_to_streamed_response_wrapper(
+ models.retrieve,
+ )
+ self.list = async_to_streamed_response_wrapper(
+ models.list,
+ )
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/types/__init__.py
new file mode 100644
index 00000000..94196102
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/__init__.py
@@ -0,0 +1,107 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from .model import Model as Model
+from .usage import Usage as Usage
+from .shared import (
+ ErrorObject as ErrorObject,
+ BillingError as BillingError,
+ ErrorResponse as ErrorResponse,
+ NotFoundError as NotFoundError,
+ APIErrorObject as APIErrorObject,
+ RateLimitError as RateLimitError,
+ OverloadedError as OverloadedError,
+ PermissionError as PermissionError,
+ AuthenticationError as AuthenticationError,
+ GatewayTimeoutError as GatewayTimeoutError,
+ InvalidRequestError as InvalidRequestError,
+)
+from .message import Message as Message
+from .beta_error import BetaError as BetaError
+from .completion import Completion as Completion
+from .model_info import ModelInfo as ModelInfo
+from .text_block import TextBlock as TextBlock
+from .text_delta import TextDelta as TextDelta
+from .tool_param import ToolParam as ToolParam
+from .model_param import ModelParam as ModelParam
+from .content_block import ContentBlock as ContentBlock
+from .message_param import MessageParam as MessageParam
+from .text_citation import TextCitation as TextCitation
+from .beta_api_error import BetaAPIError as BetaAPIError
+from .metadata_param import MetadataParam as MetadataParam
+from .thinking_block import ThinkingBlock as ThinkingBlock
+from .thinking_delta import ThinkingDelta as ThinkingDelta
+from .tool_use_block import ToolUseBlock as ToolUseBlock
+from .citations_delta import CitationsDelta as CitationsDelta
+from .signature_delta import SignatureDelta as SignatureDelta
+from .input_json_delta import InputJSONDelta as InputJSONDelta
+from .text_block_param import TextBlockParam as TextBlockParam
+from .tool_union_param import ToolUnionParam as ToolUnionParam
+from .image_block_param import ImageBlockParam as ImageBlockParam
+from .model_list_params import ModelListParams as ModelListParams
+from .tool_choice_param import ToolChoiceParam as ToolChoiceParam
+from .beta_billing_error import BetaBillingError as BetaBillingError
+from .message_stop_event import MessageStopEvent as MessageStopEvent
+from .beta_error_response import BetaErrorResponse as BetaErrorResponse
+from .content_block_param import ContentBlockParam as ContentBlockParam
+from .message_delta_event import MessageDeltaEvent as MessageDeltaEvent
+from .message_delta_usage import MessageDeltaUsage as MessageDeltaUsage
+from .message_start_event import MessageStartEvent as MessageStartEvent
+from .text_citation_param import TextCitationParam as TextCitationParam
+from .anthropic_beta_param import AnthropicBetaParam as AnthropicBetaParam
+from .beta_not_found_error import BetaNotFoundError as BetaNotFoundError
+from .document_block_param import DocumentBlockParam as DocumentBlockParam
+from .message_stream_event import MessageStreamEvent as MessageStreamEvent
+from .message_tokens_count import MessageTokensCount as MessageTokensCount
+from .thinking_block_param import ThinkingBlockParam as ThinkingBlockParam
+from .tool_use_block_param import ToolUseBlockParam as ToolUseBlockParam
+from .url_pdf_source_param import URLPDFSourceParam as URLPDFSourceParam
+from .beta_overloaded_error import BetaOverloadedError as BetaOverloadedError
+from .beta_permission_error import BetaPermissionError as BetaPermissionError
+from .beta_rate_limit_error import BetaRateLimitError as BetaRateLimitError
+from .message_create_params import MessageCreateParams as MessageCreateParams
+from .thinking_config_param import ThinkingConfigParam as ThinkingConfigParam
+from .tool_choice_any_param import ToolChoiceAnyParam as ToolChoiceAnyParam
+from .citation_char_location import CitationCharLocation as CitationCharLocation
+from .citation_page_location import CitationPageLocation as CitationPageLocation
+from .citations_config_param import CitationsConfigParam as CitationsConfigParam
+from .raw_message_stop_event import RawMessageStopEvent as RawMessageStopEvent
+from .tool_choice_auto_param import ToolChoiceAutoParam as ToolChoiceAutoParam
+from .tool_choice_none_param import ToolChoiceNoneParam as ToolChoiceNoneParam
+from .tool_choice_tool_param import ToolChoiceToolParam as ToolChoiceToolParam
+from .url_image_source_param import URLImageSourceParam as URLImageSourceParam
+from .base64_pdf_source_param import Base64PDFSourceParam as Base64PDFSourceParam
+from .plain_text_source_param import PlainTextSourceParam as PlainTextSourceParam
+from .raw_message_delta_event import RawMessageDeltaEvent as RawMessageDeltaEvent
+from .raw_message_start_event import RawMessageStartEvent as RawMessageStartEvent
+from .redacted_thinking_block import RedactedThinkingBlock as RedactedThinkingBlock
+from .tool_result_block_param import ToolResultBlockParam as ToolResultBlockParam
+from .completion_create_params import CompletionCreateParams as CompletionCreateParams
+from .content_block_stop_event import ContentBlockStopEvent as ContentBlockStopEvent
+from .raw_message_stream_event import RawMessageStreamEvent as RawMessageStreamEvent
+from .tool_bash_20250124_param import ToolBash20250124Param as ToolBash20250124Param
+from .base64_image_source_param import Base64ImageSourceParam as Base64ImageSourceParam
+from .beta_authentication_error import BetaAuthenticationError as BetaAuthenticationError
+from .content_block_delta_event import ContentBlockDeltaEvent as ContentBlockDeltaEvent
+from .content_block_start_event import ContentBlockStartEvent as ContentBlockStartEvent
+from .beta_gateway_timeout_error import BetaGatewayTimeoutError as BetaGatewayTimeoutError
+from .beta_invalid_request_error import BetaInvalidRequestError as BetaInvalidRequestError
+from .content_block_source_param import ContentBlockSourceParam as ContentBlockSourceParam
+from .message_count_tokens_params import MessageCountTokensParams as MessageCountTokensParams
+from .citation_char_location_param import CitationCharLocationParam as CitationCharLocationParam
+from .citation_page_location_param import CitationPageLocationParam as CitationPageLocationParam
+from .raw_content_block_stop_event import RawContentBlockStopEvent as RawContentBlockStopEvent
+from .cache_control_ephemeral_param import CacheControlEphemeralParam as CacheControlEphemeralParam
+from .raw_content_block_delta_event import RawContentBlockDeltaEvent as RawContentBlockDeltaEvent
+from .raw_content_block_start_event import RawContentBlockStartEvent as RawContentBlockStartEvent
+from .redacted_thinking_block_param import RedactedThinkingBlockParam as RedactedThinkingBlockParam
+from .thinking_config_enabled_param import ThinkingConfigEnabledParam as ThinkingConfigEnabledParam
+from .thinking_config_disabled_param import ThinkingConfigDisabledParam as ThinkingConfigDisabledParam
+from .citation_content_block_location import CitationContentBlockLocation as CitationContentBlockLocation
+from .message_count_tokens_tool_param import MessageCountTokensToolParam as MessageCountTokensToolParam
+from .tool_text_editor_20250124_param import ToolTextEditor20250124Param as ToolTextEditor20250124Param
+from .content_block_source_content_param import ContentBlockSourceContentParam as ContentBlockSourceContentParam
+from .citation_content_block_location_param import (
+ CitationContentBlockLocationParam as CitationContentBlockLocationParam,
+)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/anthropic_beta_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/anthropic_beta_param.py
new file mode 100644
index 00000000..ff5fdffd
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/anthropic_beta_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import Literal, TypeAlias
+
+__all__ = ["AnthropicBetaParam"]
+
+AnthropicBetaParam: TypeAlias = Union[
+ str,
+ Literal[
+ "message-batches-2024-09-24",
+ "prompt-caching-2024-07-31",
+ "computer-use-2024-10-22",
+ "computer-use-2025-01-24",
+ "pdfs-2024-09-25",
+ "token-counting-2024-11-01",
+ "token-efficient-tools-2025-02-19",
+ "output-128k-2025-02-19",
+ ],
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/base64_image_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/base64_image_source_param.py
new file mode 100644
index 00000000..93fdb9d1
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/base64_image_source_param.py
@@ -0,0 +1,23 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import Literal, Required, Annotated, TypedDict
+
+from .._types import Base64FileInput
+from .._utils import PropertyInfo
+from .._models import set_pydantic_config
+
+__all__ = ["Base64ImageSourceParam"]
+
+
+class Base64ImageSourceParam(TypedDict, total=False):
+ data: Required[Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")]]
+
+ media_type: Required[Literal["image/jpeg", "image/png", "image/gif", "image/webp"]]
+
+ type: Required[Literal["base64"]]
+
+
+set_pydantic_config(Base64ImageSourceParam, {"arbitrary_types_allowed": True})
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/base64_pdf_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/base64_pdf_source_param.py
new file mode 100644
index 00000000..ac247a19
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/base64_pdf_source_param.py
@@ -0,0 +1,23 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import Literal, Required, Annotated, TypedDict
+
+from .._types import Base64FileInput
+from .._utils import PropertyInfo
+from .._models import set_pydantic_config
+
+__all__ = ["Base64PDFSourceParam"]
+
+
+class Base64PDFSourceParam(TypedDict, total=False):
+ data: Required[Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")]]
+
+ media_type: Required[Literal["application/pdf"]]
+
+ type: Required[Literal["base64"]]
+
+
+set_pydantic_config(Base64PDFSourceParam, {"arbitrary_types_allowed": True})
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/__init__.py
new file mode 100644
index 00000000..916b0ab6
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/__init__.py
@@ -0,0 +1,76 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from .beta_usage import BetaUsage as BetaUsage
+from .beta_message import BetaMessage as BetaMessage
+from .beta_model_info import BetaModelInfo as BetaModelInfo
+from .beta_text_block import BetaTextBlock as BetaTextBlock
+from .beta_text_delta import BetaTextDelta as BetaTextDelta
+from .beta_tool_param import BetaToolParam as BetaToolParam
+from .model_list_params import ModelListParams as ModelListParams
+from .beta_content_block import BetaContentBlock as BetaContentBlock
+from .beta_message_param import BetaMessageParam as BetaMessageParam
+from .beta_text_citation import BetaTextCitation as BetaTextCitation
+from .beta_metadata_param import BetaMetadataParam as BetaMetadataParam
+from .beta_thinking_block import BetaThinkingBlock as BetaThinkingBlock
+from .beta_thinking_delta import BetaThinkingDelta as BetaThinkingDelta
+from .beta_tool_use_block import BetaToolUseBlock as BetaToolUseBlock
+from .beta_citations_delta import BetaCitationsDelta as BetaCitationsDelta
+from .beta_signature_delta import BetaSignatureDelta as BetaSignatureDelta
+from .beta_input_json_delta import BetaInputJSONDelta as BetaInputJSONDelta
+from .beta_text_block_param import BetaTextBlockParam as BetaTextBlockParam
+from .beta_tool_union_param import BetaToolUnionParam as BetaToolUnionParam
+from .message_create_params import MessageCreateParams as MessageCreateParams
+from .beta_image_block_param import BetaImageBlockParam as BetaImageBlockParam
+from .beta_tool_choice_param import BetaToolChoiceParam as BetaToolChoiceParam
+from .beta_content_block_param import BetaContentBlockParam as BetaContentBlockParam
+from .beta_message_delta_usage import BetaMessageDeltaUsage as BetaMessageDeltaUsage
+from .beta_text_citation_param import BetaTextCitationParam as BetaTextCitationParam
+from .beta_message_tokens_count import BetaMessageTokensCount as BetaMessageTokensCount
+from .beta_thinking_block_param import BetaThinkingBlockParam as BetaThinkingBlockParam
+from .beta_tool_use_block_param import BetaToolUseBlockParam as BetaToolUseBlockParam
+from .beta_url_pdf_source_param import BetaURLPDFSourceParam as BetaURLPDFSourceParam
+from .beta_thinking_config_param import BetaThinkingConfigParam as BetaThinkingConfigParam
+from .beta_tool_choice_any_param import BetaToolChoiceAnyParam as BetaToolChoiceAnyParam
+from .beta_base64_pdf_block_param import BetaBase64PDFBlockParam as BetaBase64PDFBlockParam
+from .beta_citation_char_location import BetaCitationCharLocation as BetaCitationCharLocation
+from .beta_citation_page_location import BetaCitationPageLocation as BetaCitationPageLocation
+from .beta_citations_config_param import BetaCitationsConfigParam as BetaCitationsConfigParam
+from .beta_raw_message_stop_event import BetaRawMessageStopEvent as BetaRawMessageStopEvent
+from .beta_tool_choice_auto_param import BetaToolChoiceAutoParam as BetaToolChoiceAutoParam
+from .beta_tool_choice_none_param import BetaToolChoiceNoneParam as BetaToolChoiceNoneParam
+from .beta_tool_choice_tool_param import BetaToolChoiceToolParam as BetaToolChoiceToolParam
+from .beta_url_image_source_param import BetaURLImageSourceParam as BetaURLImageSourceParam
+from .message_count_tokens_params import MessageCountTokensParams as MessageCountTokensParams
+from .beta_base64_pdf_source_param import BetaBase64PDFSourceParam as BetaBase64PDFSourceParam
+from .beta_plain_text_source_param import BetaPlainTextSourceParam as BetaPlainTextSourceParam
+from .beta_raw_message_delta_event import BetaRawMessageDeltaEvent as BetaRawMessageDeltaEvent
+from .beta_raw_message_start_event import BetaRawMessageStartEvent as BetaRawMessageStartEvent
+from .beta_redacted_thinking_block import BetaRedactedThinkingBlock as BetaRedactedThinkingBlock
+from .beta_tool_result_block_param import BetaToolResultBlockParam as BetaToolResultBlockParam
+from .beta_raw_message_stream_event import BetaRawMessageStreamEvent as BetaRawMessageStreamEvent
+from .beta_tool_bash_20241022_param import BetaToolBash20241022Param as BetaToolBash20241022Param
+from .beta_tool_bash_20250124_param import BetaToolBash20250124Param as BetaToolBash20250124Param
+from .beta_base64_image_source_param import BetaBase64ImageSourceParam as BetaBase64ImageSourceParam
+from .beta_content_block_source_param import BetaContentBlockSourceParam as BetaContentBlockSourceParam
+from .beta_citation_char_location_param import BetaCitationCharLocationParam as BetaCitationCharLocationParam
+from .beta_citation_page_location_param import BetaCitationPageLocationParam as BetaCitationPageLocationParam
+from .beta_raw_content_block_stop_event import BetaRawContentBlockStopEvent as BetaRawContentBlockStopEvent
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam as BetaCacheControlEphemeralParam
+from .beta_raw_content_block_delta_event import BetaRawContentBlockDeltaEvent as BetaRawContentBlockDeltaEvent
+from .beta_raw_content_block_start_event import BetaRawContentBlockStartEvent as BetaRawContentBlockStartEvent
+from .beta_redacted_thinking_block_param import BetaRedactedThinkingBlockParam as BetaRedactedThinkingBlockParam
+from .beta_thinking_config_enabled_param import BetaThinkingConfigEnabledParam as BetaThinkingConfigEnabledParam
+from .beta_thinking_config_disabled_param import BetaThinkingConfigDisabledParam as BetaThinkingConfigDisabledParam
+from .beta_citation_content_block_location import BetaCitationContentBlockLocation as BetaCitationContentBlockLocation
+from .beta_tool_text_editor_20241022_param import BetaToolTextEditor20241022Param as BetaToolTextEditor20241022Param
+from .beta_tool_text_editor_20250124_param import BetaToolTextEditor20250124Param as BetaToolTextEditor20250124Param
+from .beta_tool_computer_use_20241022_param import BetaToolComputerUse20241022Param as BetaToolComputerUse20241022Param
+from .beta_tool_computer_use_20250124_param import BetaToolComputerUse20250124Param as BetaToolComputerUse20250124Param
+from .beta_content_block_source_content_param import (
+ BetaContentBlockSourceContentParam as BetaContentBlockSourceContentParam,
+)
+from .beta_citation_content_block_location_param import (
+ BetaCitationContentBlockLocationParam as BetaCitationContentBlockLocationParam,
+)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_image_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_image_source_param.py
new file mode 100644
index 00000000..8f13ce38
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_image_source_param.py
@@ -0,0 +1,23 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import Literal, Required, Annotated, TypedDict
+
+from ..._types import Base64FileInput
+from ..._utils import PropertyInfo
+from ..._models import set_pydantic_config
+
+__all__ = ["BetaBase64ImageSourceParam"]
+
+
+class BetaBase64ImageSourceParam(TypedDict, total=False):
+ data: Required[Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")]]
+
+ media_type: Required[Literal["image/jpeg", "image/png", "image/gif", "image/webp"]]
+
+ type: Required[Literal["base64"]]
+
+
+set_pydantic_config(BetaBase64ImageSourceParam, {"arbitrary_types_allowed": True})
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_pdf_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_pdf_block_param.py
new file mode 100644
index 00000000..16f51a9d
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_pdf_block_param.py
@@ -0,0 +1,33 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Optional
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .beta_url_pdf_source_param import BetaURLPDFSourceParam
+from .beta_citations_config_param import BetaCitationsConfigParam
+from .beta_base64_pdf_source_param import BetaBase64PDFSourceParam
+from .beta_plain_text_source_param import BetaPlainTextSourceParam
+from .beta_content_block_source_param import BetaContentBlockSourceParam
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaBase64PDFBlockParam", "Source"]
+
+Source: TypeAlias = Union[
+ BetaBase64PDFSourceParam, BetaPlainTextSourceParam, BetaContentBlockSourceParam, BetaURLPDFSourceParam
+]
+
+
+class BetaBase64PDFBlockParam(TypedDict, total=False):
+ source: Required[Source]
+
+ type: Required[Literal["document"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
+
+ citations: BetaCitationsConfigParam
+
+ context: Optional[str]
+
+ title: Optional[str]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_pdf_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_pdf_source_param.py
new file mode 100644
index 00000000..1137c957
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_base64_pdf_source_param.py
@@ -0,0 +1,23 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import Literal, Required, Annotated, TypedDict
+
+from ..._types import Base64FileInput
+from ..._utils import PropertyInfo
+from ..._models import set_pydantic_config
+
+__all__ = ["BetaBase64PDFSourceParam"]
+
+
+class BetaBase64PDFSourceParam(TypedDict, total=False):
+ data: Required[Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")]]
+
+ media_type: Required[Literal["application/pdf"]]
+
+ type: Required[Literal["base64"]]
+
+
+set_pydantic_config(BetaBase64PDFSourceParam, {"arbitrary_types_allowed": True})
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_cache_control_ephemeral_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_cache_control_ephemeral_param.py
new file mode 100644
index 00000000..540d769d
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_cache_control_ephemeral_param.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaCacheControlEphemeralParam"]
+
+
+class BetaCacheControlEphemeralParam(TypedDict, total=False):
+ type: Required[Literal["ephemeral"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_char_location.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_char_location.py
new file mode 100644
index 00000000..2109949a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_char_location.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaCitationCharLocation"]
+
+
+class BetaCitationCharLocation(BaseModel):
+ cited_text: str
+
+ document_index: int
+
+ document_title: Optional[str] = None
+
+ end_char_index: int
+
+ start_char_index: int
+
+ type: Literal["char_location"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_char_location_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_char_location_param.py
new file mode 100644
index 00000000..8c09f5a7
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_char_location_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaCitationCharLocationParam"]
+
+
+class BetaCitationCharLocationParam(TypedDict, total=False):
+ cited_text: Required[str]
+
+ document_index: Required[int]
+
+ document_title: Required[Optional[str]]
+
+ end_char_index: Required[int]
+
+ start_char_index: Required[int]
+
+ type: Required[Literal["char_location"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_content_block_location.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_content_block_location.py
new file mode 100644
index 00000000..8fde76f9
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_content_block_location.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaCitationContentBlockLocation"]
+
+
+class BetaCitationContentBlockLocation(BaseModel):
+ cited_text: str
+
+ document_index: int
+
+ document_title: Optional[str] = None
+
+ end_block_index: int
+
+ start_block_index: int
+
+ type: Literal["content_block_location"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_content_block_location_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_content_block_location_param.py
new file mode 100644
index 00000000..9e378a78
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_content_block_location_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaCitationContentBlockLocationParam"]
+
+
+class BetaCitationContentBlockLocationParam(TypedDict, total=False):
+ cited_text: Required[str]
+
+ document_index: Required[int]
+
+ document_title: Required[Optional[str]]
+
+ end_block_index: Required[int]
+
+ start_block_index: Required[int]
+
+ type: Required[Literal["content_block_location"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_page_location.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_page_location.py
new file mode 100644
index 00000000..9e6f60dd
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_page_location.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaCitationPageLocation"]
+
+
+class BetaCitationPageLocation(BaseModel):
+ cited_text: str
+
+ document_index: int
+
+ document_title: Optional[str] = None
+
+ end_page_number: int
+
+ start_page_number: int
+
+ type: Literal["page_location"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_page_location_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_page_location_param.py
new file mode 100644
index 00000000..60e5b1c2
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citation_page_location_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaCitationPageLocationParam"]
+
+
+class BetaCitationPageLocationParam(TypedDict, total=False):
+ cited_text: Required[str]
+
+ document_index: Required[int]
+
+ document_title: Required[Optional[str]]
+
+ end_page_number: Required[int]
+
+ start_page_number: Required[int]
+
+ type: Required[Literal["page_location"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citations_config_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citations_config_param.py
new file mode 100644
index 00000000..409cfde7
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citations_config_param.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import TypedDict
+
+__all__ = ["BetaCitationsConfigParam"]
+
+
+class BetaCitationsConfigParam(TypedDict, total=False):
+ enabled: bool
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citations_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citations_delta.py
new file mode 100644
index 00000000..2c6c02b2
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_citations_delta.py
@@ -0,0 +1,23 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Literal, Annotated, TypeAlias
+
+from ..._utils import PropertyInfo
+from ..._models import BaseModel
+from .beta_citation_char_location import BetaCitationCharLocation
+from .beta_citation_page_location import BetaCitationPageLocation
+from .beta_citation_content_block_location import BetaCitationContentBlockLocation
+
+__all__ = ["BetaCitationsDelta", "Citation"]
+
+Citation: TypeAlias = Annotated[
+ Union[BetaCitationCharLocation, BetaCitationPageLocation, BetaCitationContentBlockLocation],
+ PropertyInfo(discriminator="type"),
+]
+
+
+class BetaCitationsDelta(BaseModel):
+ citation: Citation
+
+ type: Literal["citations_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block.py
new file mode 100644
index 00000000..7cf9736e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block.py
@@ -0,0 +1,17 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from ..._utils import PropertyInfo
+from .beta_text_block import BetaTextBlock
+from .beta_thinking_block import BetaThinkingBlock
+from .beta_tool_use_block import BetaToolUseBlock
+from .beta_redacted_thinking_block import BetaRedactedThinkingBlock
+
+__all__ = ["BetaContentBlock"]
+
+BetaContentBlock: TypeAlias = Annotated[
+ Union[BetaTextBlock, BetaToolUseBlock, BetaThinkingBlock, BetaRedactedThinkingBlock],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_param.py
new file mode 100644
index 00000000..1768f321
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_param.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .beta_text_block_param import BetaTextBlockParam
+from .beta_image_block_param import BetaImageBlockParam
+from .beta_thinking_block_param import BetaThinkingBlockParam
+from .beta_tool_use_block_param import BetaToolUseBlockParam
+from .beta_base64_pdf_block_param import BetaBase64PDFBlockParam
+from .beta_tool_result_block_param import BetaToolResultBlockParam
+from .beta_redacted_thinking_block_param import BetaRedactedThinkingBlockParam
+
+__all__ = ["BetaContentBlockParam"]
+
+BetaContentBlockParam: TypeAlias = Union[
+ BetaTextBlockParam,
+ BetaImageBlockParam,
+ BetaToolUseBlockParam,
+ BetaToolResultBlockParam,
+ BetaBase64PDFBlockParam,
+ BetaThinkingBlockParam,
+ BetaRedactedThinkingBlockParam,
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_source_content_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_source_content_param.py
new file mode 100644
index 00000000..bc13b146
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_source_content_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .beta_text_block_param import BetaTextBlockParam
+from .beta_image_block_param import BetaImageBlockParam
+
+__all__ = ["BetaContentBlockSourceContentParam"]
+
+BetaContentBlockSourceContentParam: TypeAlias = Union[BetaTextBlockParam, BetaImageBlockParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_source_param.py
new file mode 100644
index 00000000..512cf0db
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_content_block_source_param.py
@@ -0,0 +1,16 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Iterable
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_content_block_source_content_param import BetaContentBlockSourceContentParam
+
+__all__ = ["BetaContentBlockSourceParam"]
+
+
+class BetaContentBlockSourceParam(TypedDict, total=False):
+ content: Required[Union[str, Iterable[BetaContentBlockSourceContentParam]]]
+
+ type: Required[Literal["content"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_image_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_image_block_param.py
new file mode 100644
index 00000000..ddb9d4c0
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_image_block_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Optional
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .beta_url_image_source_param import BetaURLImageSourceParam
+from .beta_base64_image_source_param import BetaBase64ImageSourceParam
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaImageBlockParam", "Source"]
+
+Source: TypeAlias = Union[BetaBase64ImageSourceParam, BetaURLImageSourceParam]
+
+
+class BetaImageBlockParam(TypedDict, total=False):
+ source: Required[Source]
+
+ type: Required[Literal["image"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_input_json_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_input_json_delta.py
new file mode 100644
index 00000000..a5f9cbea
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_input_json_delta.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaInputJSONDelta"]
+
+
+class BetaInputJSONDelta(BaseModel):
+ partial_json: str
+
+ type: Literal["input_json_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message.py
new file mode 100644
index 00000000..a4d6cdec
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message.py
@@ -0,0 +1,112 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import List, Optional
+from typing_extensions import Literal
+
+from ..model import Model
+from ..._models import BaseModel
+from .beta_usage import BetaUsage
+from .beta_content_block import BetaContentBlock, BetaContentBlock as BetaContentBlock
+
+__all__ = ["BetaMessage"]
+
+
+class BetaMessage(BaseModel):
+ id: str
+ """Unique object identifier.
+
+ The format and length of IDs may change over time.
+ """
+
+ content: List[BetaContentBlock]
+ """Content generated by the model.
+
+ This is an array of content blocks, each of which has a `type` that determines
+ its shape.
+
+ Example:
+
+ ```json
+ [{ "type": "text", "text": "Hi, I'm Claude." }]
+ ```
+
+ If the request input `messages` ended with an `assistant` turn, then the
+ response `content` will continue directly from that last turn. You can use this
+ to constrain the model's output.
+
+ For example, if the input `messages` were:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Then the response `content` might be:
+
+ ```json
+ [{ "type": "text", "text": "B)" }]
+ ```
+ """
+
+ model: Model
+ """
+ The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+ """
+
+ role: Literal["assistant"]
+ """Conversational role of the generated message.
+
+ This will always be `"assistant"`.
+ """
+
+ stop_reason: Optional[Literal["end_turn", "max_tokens", "stop_sequence", "tool_use"]] = None
+ """The reason that we stopped.
+
+ This may be one the following values:
+
+ - `"end_turn"`: the model reached a natural stopping point
+ - `"max_tokens"`: we exceeded the requested `max_tokens` or the model's maximum
+ - `"stop_sequence"`: one of your provided custom `stop_sequences` was generated
+ - `"tool_use"`: the model invoked one or more tools
+
+ In non-streaming mode this value is always non-null. In streaming mode, it is
+ null in the `message_start` event and non-null otherwise.
+ """
+
+ stop_sequence: Optional[str] = None
+ """Which custom stop sequence was generated, if any.
+
+ This value will be a non-null string if one of your custom stop sequences was
+ generated.
+ """
+
+ type: Literal["message"]
+ """Object type.
+
+ For Messages, this is always `"message"`.
+ """
+
+ usage: BetaUsage
+ """Billing and rate-limit usage.
+
+ Anthropic's API bills and rate-limits by token counts, as tokens represent the
+ underlying cost to our systems.
+
+ Under the hood, the API transforms requests into a format suitable for the
+ model. The model's output then goes through a parsing stage before becoming an
+ API response. As a result, the token counts in `usage` will not match one-to-one
+ with the exact visible content of an API request or response.
+
+ For example, `output_tokens` will be non-zero, even for an empty string response
+ from Claude.
+
+ Total input tokens in a request is the summation of `input_tokens`,
+ `cache_creation_input_tokens`, and `cache_read_input_tokens`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_delta_usage.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_delta_usage.py
new file mode 100644
index 00000000..cc681911
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_delta_usage.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from ..._models import BaseModel
+
+__all__ = ["BetaMessageDeltaUsage"]
+
+
+class BetaMessageDeltaUsage(BaseModel):
+ output_tokens: int
+ """The cumulative number of output tokens which were used."""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_param.py
new file mode 100644
index 00000000..b41e56d3
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_param.py
@@ -0,0 +1,16 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Iterable
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_content_block_param import BetaContentBlockParam
+
+__all__ = ["BetaMessageParam"]
+
+
+class BetaMessageParam(TypedDict, total=False):
+ content: Required[Union[str, Iterable[BetaContentBlockParam]]]
+
+ role: Required[Literal["user", "assistant"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_tokens_count.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_tokens_count.py
new file mode 100644
index 00000000..e11daee7
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_message_tokens_count.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from ..._models import BaseModel
+
+__all__ = ["BetaMessageTokensCount"]
+
+
+class BetaMessageTokensCount(BaseModel):
+ input_tokens: int
+ """
+ The total number of tokens across the provided list of messages, system prompt,
+ and tools.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_metadata_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_metadata_param.py
new file mode 100644
index 00000000..8ccda216
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_metadata_param.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import TypedDict
+
+__all__ = ["BetaMetadataParam"]
+
+
+class BetaMetadataParam(TypedDict, total=False):
+ user_id: Optional[str]
+ """An external identifier for the user who is associated with the request.
+
+ This should be a uuid, hash value, or other opaque identifier. Anthropic may use
+ this id to help detect abuse. Do not include any identifying information such as
+ name, email address, or phone number.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_model_info.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_model_info.py
new file mode 100644
index 00000000..6ea50d9f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_model_info.py
@@ -0,0 +1,28 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from datetime import datetime
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaModelInfo"]
+
+
+class BetaModelInfo(BaseModel):
+ id: str
+ """Unique model identifier."""
+
+ created_at: datetime
+ """RFC 3339 datetime string representing the time at which the model was released.
+
+ May be set to an epoch value if the release date is unknown.
+ """
+
+ display_name: str
+ """A human-readable name for the model."""
+
+ type: Literal["model"]
+ """Object type.
+
+ For Models, this is always `"model"`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_plain_text_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_plain_text_source_param.py
new file mode 100644
index 00000000..187a2386
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_plain_text_source_param.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaPlainTextSourceParam"]
+
+
+class BetaPlainTextSourceParam(TypedDict, total=False):
+ data: Required[str]
+
+ media_type: Required[Literal["text/plain"]]
+
+ type: Required[Literal["text"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_delta_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_delta_event.py
new file mode 100644
index 00000000..cd50f289
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_delta_event.py
@@ -0,0 +1,27 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Literal, Annotated, TypeAlias
+
+from ..._utils import PropertyInfo
+from ..._models import BaseModel
+from .beta_text_delta import BetaTextDelta
+from .beta_thinking_delta import BetaThinkingDelta
+from .beta_citations_delta import BetaCitationsDelta
+from .beta_signature_delta import BetaSignatureDelta
+from .beta_input_json_delta import BetaInputJSONDelta
+
+__all__ = ["BetaRawContentBlockDeltaEvent", "Delta"]
+
+Delta: TypeAlias = Annotated[
+ Union[BetaTextDelta, BetaInputJSONDelta, BetaCitationsDelta, BetaThinkingDelta, BetaSignatureDelta],
+ PropertyInfo(discriminator="type"),
+]
+
+
+class BetaRawContentBlockDeltaEvent(BaseModel):
+ delta: Delta
+
+ index: int
+
+ type: Literal["content_block_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_start_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_start_event.py
new file mode 100644
index 00000000..086c216c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_start_event.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Literal, Annotated, TypeAlias
+
+from ..._utils import PropertyInfo
+from ..._models import BaseModel
+from .beta_text_block import BetaTextBlock
+from .beta_thinking_block import BetaThinkingBlock
+from .beta_tool_use_block import BetaToolUseBlock
+from .beta_redacted_thinking_block import BetaRedactedThinkingBlock
+
+__all__ = ["BetaRawContentBlockStartEvent", "ContentBlock"]
+
+ContentBlock: TypeAlias = Annotated[
+ Union[BetaTextBlock, BetaToolUseBlock, BetaThinkingBlock, BetaRedactedThinkingBlock],
+ PropertyInfo(discriminator="type"),
+]
+
+
+class BetaRawContentBlockStartEvent(BaseModel):
+ content_block: ContentBlock
+
+ index: int
+
+ type: Literal["content_block_start"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_stop_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_stop_event.py
new file mode 100644
index 00000000..d8551860
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_content_block_stop_event.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaRawContentBlockStopEvent"]
+
+
+class BetaRawContentBlockStopEvent(BaseModel):
+ index: int
+
+ type: Literal["content_block_stop"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_delta_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_delta_event.py
new file mode 100644
index 00000000..525fd10c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_delta_event.py
@@ -0,0 +1,39 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+from .beta_message_delta_usage import BetaMessageDeltaUsage
+
+__all__ = ["BetaRawMessageDeltaEvent", "Delta"]
+
+
+class Delta(BaseModel):
+ stop_reason: Optional[Literal["end_turn", "max_tokens", "stop_sequence", "tool_use"]] = None
+
+ stop_sequence: Optional[str] = None
+
+
+class BetaRawMessageDeltaEvent(BaseModel):
+ delta: Delta
+
+ type: Literal["message_delta"]
+
+ usage: BetaMessageDeltaUsage
+ """Billing and rate-limit usage.
+
+ Anthropic's API bills and rate-limits by token counts, as tokens represent the
+ underlying cost to our systems.
+
+ Under the hood, the API transforms requests into a format suitable for the
+ model. The model's output then goes through a parsing stage before becoming an
+ API response. As a result, the token counts in `usage` will not match one-to-one
+ with the exact visible content of an API request or response.
+
+ For example, `output_tokens` will be non-zero, even for an empty string response
+ from Claude.
+
+ Total input tokens in a request is the summation of `input_tokens`,
+ `cache_creation_input_tokens`, and `cache_read_input_tokens`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_start_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_start_event.py
new file mode 100644
index 00000000..9bb16f94
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_start_event.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+from .beta_message import BetaMessage
+
+__all__ = ["BetaRawMessageStartEvent"]
+
+
+class BetaRawMessageStartEvent(BaseModel):
+ message: BetaMessage
+
+ type: Literal["message_start"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_stop_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_stop_event.py
new file mode 100644
index 00000000..dff33cde
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_stop_event.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaRawMessageStopEvent"]
+
+
+class BetaRawMessageStopEvent(BaseModel):
+ type: Literal["message_stop"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_stream_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_stream_event.py
new file mode 100644
index 00000000..00ffd7c1
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_raw_message_stream_event.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from ..._utils import PropertyInfo
+from .beta_raw_message_stop_event import BetaRawMessageStopEvent
+from .beta_raw_message_delta_event import BetaRawMessageDeltaEvent
+from .beta_raw_message_start_event import BetaRawMessageStartEvent
+from .beta_raw_content_block_stop_event import BetaRawContentBlockStopEvent
+from .beta_raw_content_block_delta_event import BetaRawContentBlockDeltaEvent
+from .beta_raw_content_block_start_event import BetaRawContentBlockStartEvent
+
+__all__ = ["BetaRawMessageStreamEvent"]
+
+BetaRawMessageStreamEvent: TypeAlias = Annotated[
+ Union[
+ BetaRawMessageStartEvent,
+ BetaRawMessageDeltaEvent,
+ BetaRawMessageStopEvent,
+ BetaRawContentBlockStartEvent,
+ BetaRawContentBlockDeltaEvent,
+ BetaRawContentBlockStopEvent,
+ ],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_redacted_thinking_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_redacted_thinking_block.py
new file mode 100644
index 00000000..b27bd933
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_redacted_thinking_block.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaRedactedThinkingBlock"]
+
+
+class BetaRedactedThinkingBlock(BaseModel):
+ data: str
+
+ type: Literal["redacted_thinking"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_redacted_thinking_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_redacted_thinking_block_param.py
new file mode 100644
index 00000000..cc7d870f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_redacted_thinking_block_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaRedactedThinkingBlockParam"]
+
+
+class BetaRedactedThinkingBlockParam(TypedDict, total=False):
+ data: Required[str]
+
+ type: Required[Literal["redacted_thinking"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_signature_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_signature_delta.py
new file mode 100644
index 00000000..a3586826
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_signature_delta.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaSignatureDelta"]
+
+
+class BetaSignatureDelta(BaseModel):
+ signature: str
+
+ type: Literal["signature_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_block.py
new file mode 100644
index 00000000..f6374b41
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_block.py
@@ -0,0 +1,23 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import List, Optional
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+from .beta_text_citation import BetaTextCitation
+
+__all__ = ["BetaTextBlock"]
+
+
+class BetaTextBlock(BaseModel):
+ citations: Optional[List[BetaTextCitation]] = None
+ """Citations supporting the text block.
+
+ The type of citation returned will depend on the type of document being cited.
+ Citing a PDF results in `page_location`, plain text results in `char_location`,
+ and content document results in `content_block_location`.
+ """
+
+ text: str
+
+ type: Literal["text"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_block_param.py
new file mode 100644
index 00000000..e40b03a5
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_block_param.py
@@ -0,0 +1,21 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Iterable, Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_text_citation_param import BetaTextCitationParam
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaTextBlockParam"]
+
+
+class BetaTextBlockParam(TypedDict, total=False):
+ text: Required[str]
+
+ type: Required[Literal["text"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
+
+ citations: Optional[Iterable[BetaTextCitationParam]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_citation.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_citation.py
new file mode 100644
index 00000000..538878b6
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_citation.py
@@ -0,0 +1,16 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from ..._utils import PropertyInfo
+from .beta_citation_char_location import BetaCitationCharLocation
+from .beta_citation_page_location import BetaCitationPageLocation
+from .beta_citation_content_block_location import BetaCitationContentBlockLocation
+
+__all__ = ["BetaTextCitation"]
+
+BetaTextCitation: TypeAlias = Annotated[
+ Union[BetaCitationCharLocation, BetaCitationPageLocation, BetaCitationContentBlockLocation],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_citation_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_citation_param.py
new file mode 100644
index 00000000..b04c3305
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_citation_param.py
@@ -0,0 +1,16 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .beta_citation_char_location_param import BetaCitationCharLocationParam
+from .beta_citation_page_location_param import BetaCitationPageLocationParam
+from .beta_citation_content_block_location_param import BetaCitationContentBlockLocationParam
+
+__all__ = ["BetaTextCitationParam"]
+
+BetaTextCitationParam: TypeAlias = Union[
+ BetaCitationCharLocationParam, BetaCitationPageLocationParam, BetaCitationContentBlockLocationParam
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_delta.py
new file mode 100644
index 00000000..b94ba5ea
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_text_delta.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaTextDelta"]
+
+
+class BetaTextDelta(BaseModel):
+ text: str
+
+ type: Literal["text_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_block.py
new file mode 100644
index 00000000..9a9c1df8
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_block.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaThinkingBlock"]
+
+
+class BetaThinkingBlock(BaseModel):
+ signature: str
+
+ thinking: str
+
+ type: Literal["thinking"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_block_param.py
new file mode 100644
index 00000000..5bd43180
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_block_param.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaThinkingBlockParam"]
+
+
+class BetaThinkingBlockParam(TypedDict, total=False):
+ signature: Required[str]
+
+ thinking: Required[str]
+
+ type: Required[Literal["thinking"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_disabled_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_disabled_param.py
new file mode 100644
index 00000000..e7c4a2a0
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_disabled_param.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaThinkingConfigDisabledParam"]
+
+
+class BetaThinkingConfigDisabledParam(TypedDict, total=False):
+ type: Required[Literal["disabled"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_enabled_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_enabled_param.py
new file mode 100644
index 00000000..f9490c4c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_enabled_param.py
@@ -0,0 +1,24 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaThinkingConfigEnabledParam"]
+
+
+class BetaThinkingConfigEnabledParam(TypedDict, total=False):
+ budget_tokens: Required[int]
+ """Determines how many tokens Claude can use for its internal reasoning process.
+
+ Larger budgets can enable more thorough analysis for complex problems, improving
+ response quality.
+
+ Must be ≥1024 and less than `max_tokens`.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+ """
+
+ type: Required[Literal["enabled"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_param.py
new file mode 100644
index 00000000..47494239
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_config_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .beta_thinking_config_enabled_param import BetaThinkingConfigEnabledParam
+from .beta_thinking_config_disabled_param import BetaThinkingConfigDisabledParam
+
+__all__ = ["BetaThinkingConfigParam"]
+
+BetaThinkingConfigParam: TypeAlias = Union[BetaThinkingConfigEnabledParam, BetaThinkingConfigDisabledParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_delta.py
new file mode 100644
index 00000000..790a304e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_thinking_delta.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaThinkingDelta"]
+
+
+class BetaThinkingDelta(BaseModel):
+ thinking: str
+
+ type: Literal["thinking_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_bash_20241022_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_bash_20241022_param.py
new file mode 100644
index 00000000..82ed02b3
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_bash_20241022_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolBash20241022Param"]
+
+
+class BetaToolBash20241022Param(TypedDict, total=False):
+ name: Required[Literal["bash"]]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ type: Required[Literal["bash_20241022"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_bash_20250124_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_bash_20250124_param.py
new file mode 100644
index 00000000..3fcab440
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_bash_20250124_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolBash20250124Param"]
+
+
+class BetaToolBash20250124Param(TypedDict, total=False):
+ name: Required[Literal["bash"]]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ type: Required[Literal["bash_20250124"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_any_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_any_param.py
new file mode 100644
index 00000000..6cdac00a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_any_param.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaToolChoiceAnyParam"]
+
+
+class BetaToolChoiceAnyParam(TypedDict, total=False):
+ type: Required[Literal["any"]]
+
+ disable_parallel_tool_use: bool
+ """Whether to disable parallel tool use.
+
+ Defaults to `false`. If set to `true`, the model will output exactly one tool
+ use.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_auto_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_auto_param.py
new file mode 100644
index 00000000..e2f20572
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_auto_param.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaToolChoiceAutoParam"]
+
+
+class BetaToolChoiceAutoParam(TypedDict, total=False):
+ type: Required[Literal["auto"]]
+
+ disable_parallel_tool_use: bool
+ """Whether to disable parallel tool use.
+
+ Defaults to `false`. If set to `true`, the model will output at most one tool
+ use.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_none_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_none_param.py
new file mode 100644
index 00000000..3a0951a4
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_none_param.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaToolChoiceNoneParam"]
+
+
+class BetaToolChoiceNoneParam(TypedDict, total=False):
+ type: Required[Literal["none"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_param.py
new file mode 100644
index 00000000..ff6a51aa
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_param.py
@@ -0,0 +1,17 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .beta_tool_choice_any_param import BetaToolChoiceAnyParam
+from .beta_tool_choice_auto_param import BetaToolChoiceAutoParam
+from .beta_tool_choice_none_param import BetaToolChoiceNoneParam
+from .beta_tool_choice_tool_param import BetaToolChoiceToolParam
+
+__all__ = ["BetaToolChoiceParam"]
+
+BetaToolChoiceParam: TypeAlias = Union[
+ BetaToolChoiceAutoParam, BetaToolChoiceAnyParam, BetaToolChoiceToolParam, BetaToolChoiceNoneParam
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_tool_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_tool_param.py
new file mode 100644
index 00000000..e826237a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_choice_tool_param.py
@@ -0,0 +1,21 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaToolChoiceToolParam"]
+
+
+class BetaToolChoiceToolParam(TypedDict, total=False):
+ name: Required[str]
+ """The name of the tool to use."""
+
+ type: Required[Literal["tool"]]
+
+ disable_parallel_tool_use: bool
+ """Whether to disable parallel tool use.
+
+ Defaults to `false`. If set to `true`, the model will output exactly one tool
+ use.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_computer_use_20241022_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_computer_use_20241022_param.py
new file mode 100644
index 00000000..b95472be
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_computer_use_20241022_param.py
@@ -0,0 +1,31 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolComputerUse20241022Param"]
+
+
+class BetaToolComputerUse20241022Param(TypedDict, total=False):
+ display_height_px: Required[int]
+ """The height of the display in pixels."""
+
+ display_width_px: Required[int]
+ """The width of the display in pixels."""
+
+ name: Required[Literal["computer"]]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ type: Required[Literal["computer_20241022"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
+
+ display_number: Optional[int]
+ """The X11 display number (e.g. 0, 1) for the display."""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_computer_use_20250124_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_computer_use_20250124_param.py
new file mode 100644
index 00000000..089d67aa
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_computer_use_20250124_param.py
@@ -0,0 +1,31 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolComputerUse20250124Param"]
+
+
+class BetaToolComputerUse20250124Param(TypedDict, total=False):
+ display_height_px: Required[int]
+ """The height of the display in pixels."""
+
+ display_width_px: Required[int]
+ """The width of the display in pixels."""
+
+ name: Required[Literal["computer"]]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ type: Required[Literal["computer_20250124"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
+
+ display_number: Optional[int]
+ """The X11 display number (e.g. 0, 1) for the display."""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_param.py
new file mode 100644
index 00000000..da9d43bc
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_param.py
@@ -0,0 +1,47 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Dict, Union, Optional
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolParam", "InputSchema"]
+
+
+class InputSchemaTyped(TypedDict, total=False):
+ type: Required[Literal["object"]]
+
+ properties: Optional[object]
+
+
+InputSchema: TypeAlias = Union[InputSchemaTyped, Dict[str, object]]
+
+
+class BetaToolParam(TypedDict, total=False):
+ input_schema: Required[InputSchema]
+ """[JSON schema](https://json-schema.org/draft/2020-12) for this tool's input.
+
+ This defines the shape of the `input` that your tool accepts and that the model
+ will produce.
+ """
+
+ name: Required[str]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
+
+ description: str
+ """Description of what this tool does.
+
+ Tool descriptions should be as detailed as possible. The more information that
+ the model has about what the tool is and how to use it, the better it will
+ perform. You can use natural language descriptions to reinforce important
+ aspects of the tool input JSON schema.
+ """
+
+ type: Optional[Literal["custom"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_result_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_result_block_param.py
new file mode 100644
index 00000000..9418b650
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_result_block_param.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Iterable, Optional
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .beta_text_block_param import BetaTextBlockParam
+from .beta_image_block_param import BetaImageBlockParam
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolResultBlockParam", "Content"]
+
+Content: TypeAlias = Union[BetaTextBlockParam, BetaImageBlockParam]
+
+
+class BetaToolResultBlockParam(TypedDict, total=False):
+ tool_use_id: Required[str]
+
+ type: Required[Literal["tool_result"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
+
+ content: Union[str, Iterable[Content]]
+
+ is_error: bool
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_text_editor_20241022_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_text_editor_20241022_param.py
new file mode 100644
index 00000000..86c93278
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_text_editor_20241022_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolTextEditor20241022Param"]
+
+
+class BetaToolTextEditor20241022Param(TypedDict, total=False):
+ name: Required[Literal["str_replace_editor"]]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ type: Required[Literal["text_editor_20241022"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_text_editor_20250124_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_text_editor_20250124_param.py
new file mode 100644
index 00000000..07b86bd5
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_text_editor_20250124_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolTextEditor20250124Param"]
+
+
+class BetaToolTextEditor20250124Param(TypedDict, total=False):
+ name: Required[Literal["str_replace_editor"]]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ type: Required[Literal["text_editor_20250124"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_union_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_union_param.py
new file mode 100644
index 00000000..d37480da
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_union_param.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .beta_tool_param import BetaToolParam
+from .beta_tool_bash_20241022_param import BetaToolBash20241022Param
+from .beta_tool_bash_20250124_param import BetaToolBash20250124Param
+from .beta_tool_text_editor_20241022_param import BetaToolTextEditor20241022Param
+from .beta_tool_text_editor_20250124_param import BetaToolTextEditor20250124Param
+from .beta_tool_computer_use_20241022_param import BetaToolComputerUse20241022Param
+from .beta_tool_computer_use_20250124_param import BetaToolComputerUse20250124Param
+
+__all__ = ["BetaToolUnionParam"]
+
+BetaToolUnionParam: TypeAlias = Union[
+ BetaToolParam,
+ BetaToolComputerUse20241022Param,
+ BetaToolBash20241022Param,
+ BetaToolTextEditor20241022Param,
+ BetaToolComputerUse20250124Param,
+ BetaToolBash20250124Param,
+ BetaToolTextEditor20250124Param,
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_use_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_use_block.py
new file mode 100644
index 00000000..7cfc0c33
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_use_block.py
@@ -0,0 +1,17 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BetaToolUseBlock"]
+
+
+class BetaToolUseBlock(BaseModel):
+ id: str
+
+ input: object
+
+ name: str
+
+ type: Literal["tool_use"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_use_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_use_block_param.py
new file mode 100644
index 00000000..603dc85f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_tool_use_block_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .beta_cache_control_ephemeral_param import BetaCacheControlEphemeralParam
+
+__all__ = ["BetaToolUseBlockParam"]
+
+
+class BetaToolUseBlockParam(TypedDict, total=False):
+ id: Required[str]
+
+ input: Required[object]
+
+ name: Required[str]
+
+ type: Required[Literal["tool_use"]]
+
+ cache_control: Optional[BetaCacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_url_image_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_url_image_source_param.py
new file mode 100644
index 00000000..a094a433
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_url_image_source_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaURLImageSourceParam"]
+
+
+class BetaURLImageSourceParam(TypedDict, total=False):
+ type: Required[Literal["url"]]
+
+ url: Required[str]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_url_pdf_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_url_pdf_source_param.py
new file mode 100644
index 00000000..acc1eabf
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_url_pdf_source_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["BetaURLPDFSourceParam"]
+
+
+class BetaURLPDFSourceParam(TypedDict, total=False):
+ type: Required[Literal["url"]]
+
+ url: Required[str]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_usage.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_usage.py
new file mode 100644
index 00000000..0d956c70
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/beta_usage.py
@@ -0,0 +1,21 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+
+from ..._models import BaseModel
+
+__all__ = ["BetaUsage"]
+
+
+class BetaUsage(BaseModel):
+ cache_creation_input_tokens: Optional[int] = None
+ """The number of input tokens used to create the cache entry."""
+
+ cache_read_input_tokens: Optional[int] = None
+ """The number of input tokens read from the cache."""
+
+ input_tokens: int
+ """The number of input tokens which were used."""
+
+ output_tokens: int
+ """The number of output tokens which were used."""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/message_count_tokens_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/message_count_tokens_params.py
new file mode 100644
index 00000000..056c4289
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/message_count_tokens_params.py
@@ -0,0 +1,234 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import List, Union, Iterable
+from typing_extensions import Required, Annotated, TypeAlias, TypedDict
+
+from ..._utils import PropertyInfo
+from ..model_param import ModelParam
+from .beta_tool_param import BetaToolParam
+from .beta_message_param import BetaMessageParam
+from ..anthropic_beta_param import AnthropicBetaParam
+from .beta_text_block_param import BetaTextBlockParam
+from .beta_tool_choice_param import BetaToolChoiceParam
+from .beta_thinking_config_param import BetaThinkingConfigParam
+from .beta_tool_bash_20241022_param import BetaToolBash20241022Param
+from .beta_tool_bash_20250124_param import BetaToolBash20250124Param
+from .beta_tool_text_editor_20241022_param import BetaToolTextEditor20241022Param
+from .beta_tool_text_editor_20250124_param import BetaToolTextEditor20250124Param
+from .beta_tool_computer_use_20241022_param import BetaToolComputerUse20241022Param
+from .beta_tool_computer_use_20250124_param import BetaToolComputerUse20250124Param
+
+__all__ = ["MessageCountTokensParams", "Tool"]
+
+
+class MessageCountTokensParams(TypedDict, total=False):
+ messages: Required[Iterable[BetaMessageParam]]
+ """Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+ """
+
+ model: Required[ModelParam]
+ """
+ The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+ """
+
+ system: Union[str, Iterable[BetaTextBlockParam]]
+ """System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+ """
+
+ thinking: BetaThinkingConfigParam
+ """Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+ """
+
+ tool_choice: BetaToolChoiceParam
+ """How the model should use the provided tools.
+
+ The model can use a specific tool, any available tool, decide by itself, or not
+ use tools at all.
+ """
+
+ tools: Iterable[Tool]
+ """Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+ """
+
+ betas: Annotated[List[AnthropicBetaParam], PropertyInfo(alias="anthropic-beta")]
+ """Optional header to specify the beta version(s) you want to use."""
+
+
+Tool: TypeAlias = Union[
+ BetaToolParam,
+ BetaToolComputerUse20241022Param,
+ BetaToolBash20241022Param,
+ BetaToolTextEditor20241022Param,
+ BetaToolComputerUse20250124Param,
+ BetaToolBash20250124Param,
+ BetaToolTextEditor20250124Param,
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/message_create_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/message_create_params.py
new file mode 100644
index 00000000..e05f92da
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/message_create_params.py
@@ -0,0 +1,297 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import List, Union, Iterable
+from typing_extensions import Literal, Required, Annotated, TypedDict
+
+from ..._utils import PropertyInfo
+from ..model_param import ModelParam
+from .beta_message_param import BetaMessageParam
+from .beta_metadata_param import BetaMetadataParam
+from ..anthropic_beta_param import AnthropicBetaParam
+from .beta_text_block_param import BetaTextBlockParam
+from .beta_tool_union_param import BetaToolUnionParam
+from .beta_tool_choice_param import BetaToolChoiceParam
+from .beta_thinking_config_param import BetaThinkingConfigParam
+
+__all__ = ["MessageCreateParamsBase", "MessageCreateParamsNonStreaming", "MessageCreateParamsStreaming"]
+
+
+class MessageCreateParamsBase(TypedDict, total=False):
+ max_tokens: Required[int]
+ """The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+ """
+
+ messages: Required[Iterable[BetaMessageParam]]
+ """Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+ """
+
+ model: Required[ModelParam]
+ """
+ The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+ """
+
+ metadata: BetaMetadataParam
+ """An object describing metadata about the request."""
+
+ stop_sequences: List[str]
+ """Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+ """
+
+ system: Union[str, Iterable[BetaTextBlockParam]]
+ """System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+ """
+
+ temperature: float
+ """Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+ """
+
+ thinking: BetaThinkingConfigParam
+ """Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+ """
+
+ tool_choice: BetaToolChoiceParam
+ """How the model should use the provided tools.
+
+ The model can use a specific tool, any available tool, decide by itself, or not
+ use tools at all.
+ """
+
+ tools: Iterable[BetaToolUnionParam]
+ """Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+ """
+
+ top_k: int
+ """Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+ """
+
+ top_p: float
+ """Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+ """
+
+ betas: Annotated[List[AnthropicBetaParam], PropertyInfo(alias="anthropic-beta")]
+ """Optional header to specify the beta version(s) you want to use."""
+
+
+class MessageCreateParamsNonStreaming(MessageCreateParamsBase, total=False):
+ stream: Literal[False]
+ """Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+ """
+
+
+class MessageCreateParamsStreaming(MessageCreateParamsBase):
+ stream: Required[Literal[True]]
+ """Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+ """
+
+
+MessageCreateParams = Union[MessageCreateParamsNonStreaming, MessageCreateParamsStreaming]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/__init__.py
new file mode 100644
index 00000000..fef14dd1
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/__init__.py
@@ -0,0 +1,17 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from .batch_list_params import BatchListParams as BatchListParams
+from .beta_message_batch import BetaMessageBatch as BetaMessageBatch
+from .batch_create_params import BatchCreateParams as BatchCreateParams
+from .beta_message_batch_result import BetaMessageBatchResult as BetaMessageBatchResult
+from .beta_deleted_message_batch import BetaDeletedMessageBatch as BetaDeletedMessageBatch
+from .beta_message_batch_errored_result import BetaMessageBatchErroredResult as BetaMessageBatchErroredResult
+from .beta_message_batch_expired_result import BetaMessageBatchExpiredResult as BetaMessageBatchExpiredResult
+from .beta_message_batch_request_counts import BetaMessageBatchRequestCounts as BetaMessageBatchRequestCounts
+from .beta_message_batch_canceled_result import BetaMessageBatchCanceledResult as BetaMessageBatchCanceledResult
+from .beta_message_batch_succeeded_result import BetaMessageBatchSucceededResult as BetaMessageBatchSucceededResult
+from .beta_message_batch_individual_response import (
+ BetaMessageBatchIndividualResponse as BetaMessageBatchIndividualResponse,
+)
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/batch_create_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/batch_create_params.py
new file mode 100644
index 00000000..8eb9c4af
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/batch_create_params.py
@@ -0,0 +1,41 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import List, Iterable
+from typing_extensions import Required, Annotated, TypedDict
+
+from ...._utils import PropertyInfo
+from ...anthropic_beta_param import AnthropicBetaParam
+from ..message_create_params import MessageCreateParamsNonStreaming
+
+__all__ = ["BatchCreateParams", "Request"]
+
+
+class BatchCreateParams(TypedDict, total=False):
+ requests: Required[Iterable[Request]]
+ """List of requests for prompt completion.
+
+ Each is an individual request to create a Message.
+ """
+
+ betas: Annotated[List[AnthropicBetaParam], PropertyInfo(alias="anthropic-beta")]
+ """Optional header to specify the beta version(s) you want to use."""
+
+
+class Request(TypedDict, total=False):
+ custom_id: Required[str]
+ """Developer-provided ID created for each request in a Message Batch.
+
+ Useful for matching results to requests, as results may be given out of request
+ order.
+
+ Must be unique for each request within the Message Batch.
+ """
+
+ params: Required[MessageCreateParamsNonStreaming]
+ """Messages API creation parameters for the individual request.
+
+ See the [Messages API reference](/en/api/messages) for full documentation on
+ available parameters.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/batch_list_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/batch_list_params.py
new file mode 100644
index 00000000..3f406251
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/batch_list_params.py
@@ -0,0 +1,34 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import List
+from typing_extensions import Annotated, TypedDict
+
+from ...._utils import PropertyInfo
+from ...anthropic_beta_param import AnthropicBetaParam
+
+__all__ = ["BatchListParams"]
+
+
+class BatchListParams(TypedDict, total=False):
+ after_id: str
+ """ID of the object to use as a cursor for pagination.
+
+ When provided, returns the page of results immediately after this object.
+ """
+
+ before_id: str
+ """ID of the object to use as a cursor for pagination.
+
+ When provided, returns the page of results immediately before this object.
+ """
+
+ limit: int
+ """Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+ """
+
+ betas: Annotated[List[AnthropicBetaParam], PropertyInfo(alias="anthropic-beta")]
+ """Optional header to specify the beta version(s) you want to use."""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_deleted_message_batch.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_deleted_message_batch.py
new file mode 100644
index 00000000..f7dd1d52
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_deleted_message_batch.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ...._models import BaseModel
+
+__all__ = ["BetaDeletedMessageBatch"]
+
+
+class BetaDeletedMessageBatch(BaseModel):
+ id: str
+ """ID of the Message Batch."""
+
+ type: Literal["message_batch_deleted"]
+ """Deleted object type.
+
+ For Message Batches, this is always `"message_batch_deleted"`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch.py
new file mode 100644
index 00000000..1ea92c3a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch.py
@@ -0,0 +1,77 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from datetime import datetime
+from typing_extensions import Literal
+
+from ...._models import BaseModel
+from .beta_message_batch_request_counts import BetaMessageBatchRequestCounts
+
+__all__ = ["BetaMessageBatch"]
+
+
+class BetaMessageBatch(BaseModel):
+ id: str
+ """Unique object identifier.
+
+ The format and length of IDs may change over time.
+ """
+
+ archived_at: Optional[datetime] = None
+ """
+ RFC 3339 datetime string representing the time at which the Message Batch was
+ archived and its results became unavailable.
+ """
+
+ cancel_initiated_at: Optional[datetime] = None
+ """
+ RFC 3339 datetime string representing the time at which cancellation was
+ initiated for the Message Batch. Specified only if cancellation was initiated.
+ """
+
+ created_at: datetime
+ """
+ RFC 3339 datetime string representing the time at which the Message Batch was
+ created.
+ """
+
+ ended_at: Optional[datetime] = None
+ """
+ RFC 3339 datetime string representing the time at which processing for the
+ Message Batch ended. Specified only once processing ends.
+
+ Processing ends when every request in a Message Batch has either succeeded,
+ errored, canceled, or expired.
+ """
+
+ expires_at: datetime
+ """
+ RFC 3339 datetime string representing the time at which the Message Batch will
+ expire and end processing, which is 24 hours after creation.
+ """
+
+ processing_status: Literal["in_progress", "canceling", "ended"]
+ """Processing status of the Message Batch."""
+
+ request_counts: BetaMessageBatchRequestCounts
+ """Tallies requests within the Message Batch, categorized by their status.
+
+ Requests start as `processing` and move to one of the other statuses only once
+ processing of the entire batch ends. The sum of all values always matches the
+ total number of requests in the batch.
+ """
+
+ results_url: Optional[str] = None
+ """URL to a `.jsonl` file containing the results of the Message Batch requests.
+
+ Specified only once processing ends.
+
+ Results in the file are not guaranteed to be in the same order as requests. Use
+ the `custom_id` field to match results to requests.
+ """
+
+ type: Literal["message_batch"]
+ """Object type.
+
+ For Message Batches, this is always `"message_batch"`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_canceled_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_canceled_result.py
new file mode 100644
index 00000000..e5dae348
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_canceled_result.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ...._models import BaseModel
+
+__all__ = ["BetaMessageBatchCanceledResult"]
+
+
+class BetaMessageBatchCanceledResult(BaseModel):
+ type: Literal["canceled"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_errored_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_errored_result.py
new file mode 100644
index 00000000..44ea9027
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_errored_result.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ...._models import BaseModel
+from ...beta_error_response import BetaErrorResponse
+
+__all__ = ["BetaMessageBatchErroredResult"]
+
+
+class BetaMessageBatchErroredResult(BaseModel):
+ error: BetaErrorResponse
+
+ type: Literal["errored"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_expired_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_expired_result.py
new file mode 100644
index 00000000..0dbfde41
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_expired_result.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ...._models import BaseModel
+
+__all__ = ["BetaMessageBatchExpiredResult"]
+
+
+class BetaMessageBatchExpiredResult(BaseModel):
+ type: Literal["expired"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_individual_response.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_individual_response.py
new file mode 100644
index 00000000..8c493934
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_individual_response.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from ...._models import BaseModel
+from .beta_message_batch_result import BetaMessageBatchResult
+
+__all__ = ["BetaMessageBatchIndividualResponse"]
+
+
+class BetaMessageBatchIndividualResponse(BaseModel):
+ custom_id: str
+ """Developer-provided ID created for each request in a Message Batch.
+
+ Useful for matching results to requests, as results may be given out of request
+ order.
+
+ Must be unique for each request within the Message Batch.
+ """
+
+ result: BetaMessageBatchResult
+ """Processing result for this request.
+
+ Contains a Message output if processing was successful, an error response if
+ processing failed, or the reason why processing was not attempted, such as
+ cancellation or expiration.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_request_counts.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_request_counts.py
new file mode 100644
index 00000000..48e6952f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_request_counts.py
@@ -0,0 +1,35 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from ...._models import BaseModel
+
+__all__ = ["BetaMessageBatchRequestCounts"]
+
+
+class BetaMessageBatchRequestCounts(BaseModel):
+ canceled: int
+ """Number of requests in the Message Batch that have been canceled.
+
+ This is zero until processing of the entire Message Batch has ended.
+ """
+
+ errored: int
+ """Number of requests in the Message Batch that encountered an error.
+
+ This is zero until processing of the entire Message Batch has ended.
+ """
+
+ expired: int
+ """Number of requests in the Message Batch that have expired.
+
+ This is zero until processing of the entire Message Batch has ended.
+ """
+
+ processing: int
+ """Number of requests in the Message Batch that are processing."""
+
+ succeeded: int
+ """Number of requests in the Message Batch that have completed successfully.
+
+ This is zero until processing of the entire Message Batch has ended.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_result.py
new file mode 100644
index 00000000..78ca7317
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_result.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from ...._utils import PropertyInfo
+from .beta_message_batch_errored_result import BetaMessageBatchErroredResult
+from .beta_message_batch_expired_result import BetaMessageBatchExpiredResult
+from .beta_message_batch_canceled_result import BetaMessageBatchCanceledResult
+from .beta_message_batch_succeeded_result import BetaMessageBatchSucceededResult
+
+__all__ = ["BetaMessageBatchResult"]
+
+BetaMessageBatchResult: TypeAlias = Annotated[
+ Union[
+ BetaMessageBatchSucceededResult,
+ BetaMessageBatchErroredResult,
+ BetaMessageBatchCanceledResult,
+ BetaMessageBatchExpiredResult,
+ ],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_succeeded_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_succeeded_result.py
new file mode 100644
index 00000000..94389d60
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/messages/beta_message_batch_succeeded_result.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ...._models import BaseModel
+from ..beta_message import BetaMessage
+
+__all__ = ["BetaMessageBatchSucceededResult"]
+
+
+class BetaMessageBatchSucceededResult(BaseModel):
+ message: BetaMessage
+
+ type: Literal["succeeded"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta/model_list_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta/model_list_params.py
new file mode 100644
index 00000000..b16d22a3
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta/model_list_params.py
@@ -0,0 +1,27 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import TypedDict
+
+__all__ = ["ModelListParams"]
+
+
+class ModelListParams(TypedDict, total=False):
+ after_id: str
+ """ID of the object to use as a cursor for pagination.
+
+ When provided, returns the page of results immediately after this object.
+ """
+
+ before_id: str
+ """ID of the object to use as a cursor for pagination.
+
+ When provided, returns the page of results immediately before this object.
+ """
+
+ limit: int
+ """Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_api_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_api_error.py
new file mode 100644
index 00000000..16aa604e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_api_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaAPIError"]
+
+
+class BetaAPIError(BaseModel):
+ message: str
+
+ type: Literal["api_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_authentication_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_authentication_error.py
new file mode 100644
index 00000000..8a555570
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_authentication_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaAuthenticationError"]
+
+
+class BetaAuthenticationError(BaseModel):
+ message: str
+
+ type: Literal["authentication_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_billing_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_billing_error.py
new file mode 100644
index 00000000..1ab37614
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_billing_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaBillingError"]
+
+
+class BetaBillingError(BaseModel):
+ message: str
+
+ type: Literal["billing_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_error.py
new file mode 100644
index 00000000..029d80dc
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_error.py
@@ -0,0 +1,32 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from .._utils import PropertyInfo
+from .beta_api_error import BetaAPIError
+from .beta_billing_error import BetaBillingError
+from .beta_not_found_error import BetaNotFoundError
+from .beta_overloaded_error import BetaOverloadedError
+from .beta_permission_error import BetaPermissionError
+from .beta_rate_limit_error import BetaRateLimitError
+from .beta_authentication_error import BetaAuthenticationError
+from .beta_gateway_timeout_error import BetaGatewayTimeoutError
+from .beta_invalid_request_error import BetaInvalidRequestError
+
+__all__ = ["BetaError"]
+
+BetaError: TypeAlias = Annotated[
+ Union[
+ BetaInvalidRequestError,
+ BetaAuthenticationError,
+ BetaBillingError,
+ BetaPermissionError,
+ BetaNotFoundError,
+ BetaRateLimitError,
+ BetaGatewayTimeoutError,
+ BetaAPIError,
+ BetaOverloadedError,
+ ],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_error_response.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_error_response.py
new file mode 100644
index 00000000..1751183e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_error_response.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+from .beta_error import BetaError
+
+__all__ = ["BetaErrorResponse"]
+
+
+class BetaErrorResponse(BaseModel):
+ error: BetaError
+
+ type: Literal["error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_gateway_timeout_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_gateway_timeout_error.py
new file mode 100644
index 00000000..9a29705b
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_gateway_timeout_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaGatewayTimeoutError"]
+
+
+class BetaGatewayTimeoutError(BaseModel):
+ message: str
+
+ type: Literal["timeout_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_invalid_request_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_invalid_request_error.py
new file mode 100644
index 00000000..a84d53cc
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_invalid_request_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaInvalidRequestError"]
+
+
+class BetaInvalidRequestError(BaseModel):
+ message: str
+
+ type: Literal["invalid_request_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_not_found_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_not_found_error.py
new file mode 100644
index 00000000..3d57cb5a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_not_found_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaNotFoundError"]
+
+
+class BetaNotFoundError(BaseModel):
+ message: str
+
+ type: Literal["not_found_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_overloaded_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_overloaded_error.py
new file mode 100644
index 00000000..ff5dbe81
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_overloaded_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaOverloadedError"]
+
+
+class BetaOverloadedError(BaseModel):
+ message: str
+
+ type: Literal["overloaded_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_permission_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_permission_error.py
new file mode 100644
index 00000000..986cf894
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_permission_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaPermissionError"]
+
+
+class BetaPermissionError(BaseModel):
+ message: str
+
+ type: Literal["permission_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/beta_rate_limit_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/beta_rate_limit_error.py
new file mode 100644
index 00000000..ae3cb1ae
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/beta_rate_limit_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["BetaRateLimitError"]
+
+
+class BetaRateLimitError(BaseModel):
+ message: str
+
+ type: Literal["rate_limit_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/cache_control_ephemeral_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/cache_control_ephemeral_param.py
new file mode 100644
index 00000000..8900071e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/cache_control_ephemeral_param.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["CacheControlEphemeralParam"]
+
+
+class CacheControlEphemeralParam(TypedDict, total=False):
+ type: Required[Literal["ephemeral"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/citation_char_location.py b/.venv/lib/python3.12/site-packages/anthropic/types/citation_char_location.py
new file mode 100644
index 00000000..011b1066
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/citation_char_location.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["CitationCharLocation"]
+
+
+class CitationCharLocation(BaseModel):
+ cited_text: str
+
+ document_index: int
+
+ document_title: Optional[str] = None
+
+ end_char_index: int
+
+ start_char_index: int
+
+ type: Literal["char_location"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/citation_char_location_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/citation_char_location_param.py
new file mode 100644
index 00000000..1cc1dfb1
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/citation_char_location_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["CitationCharLocationParam"]
+
+
+class CitationCharLocationParam(TypedDict, total=False):
+ cited_text: Required[str]
+
+ document_index: Required[int]
+
+ document_title: Required[Optional[str]]
+
+ end_char_index: Required[int]
+
+ start_char_index: Required[int]
+
+ type: Required[Literal["char_location"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/citation_content_block_location.py b/.venv/lib/python3.12/site-packages/anthropic/types/citation_content_block_location.py
new file mode 100644
index 00000000..0df0ce57
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/citation_content_block_location.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["CitationContentBlockLocation"]
+
+
+class CitationContentBlockLocation(BaseModel):
+ cited_text: str
+
+ document_index: int
+
+ document_title: Optional[str] = None
+
+ end_block_index: int
+
+ start_block_index: int
+
+ type: Literal["content_block_location"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/citation_content_block_location_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/citation_content_block_location_param.py
new file mode 100644
index 00000000..ee0a6a23
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/citation_content_block_location_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["CitationContentBlockLocationParam"]
+
+
+class CitationContentBlockLocationParam(TypedDict, total=False):
+ cited_text: Required[str]
+
+ document_index: Required[int]
+
+ document_title: Required[Optional[str]]
+
+ end_block_index: Required[int]
+
+ start_block_index: Required[int]
+
+ type: Required[Literal["content_block_location"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/citation_page_location.py b/.venv/lib/python3.12/site-packages/anthropic/types/citation_page_location.py
new file mode 100644
index 00000000..94c4d509
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/citation_page_location.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["CitationPageLocation"]
+
+
+class CitationPageLocation(BaseModel):
+ cited_text: str
+
+ document_index: int
+
+ document_title: Optional[str] = None
+
+ end_page_number: int
+
+ start_page_number: int
+
+ type: Literal["page_location"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/citation_page_location_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/citation_page_location_param.py
new file mode 100644
index 00000000..483837b5
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/citation_page_location_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["CitationPageLocationParam"]
+
+
+class CitationPageLocationParam(TypedDict, total=False):
+ cited_text: Required[str]
+
+ document_index: Required[int]
+
+ document_title: Required[Optional[str]]
+
+ end_page_number: Required[int]
+
+ start_page_number: Required[int]
+
+ type: Required[Literal["page_location"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/citations_config_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/citations_config_param.py
new file mode 100644
index 00000000..817397f8
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/citations_config_param.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import TypedDict
+
+__all__ = ["CitationsConfigParam"]
+
+
+class CitationsConfigParam(TypedDict, total=False):
+ enabled: bool
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/citations_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/citations_delta.py
new file mode 100644
index 00000000..3eab03d1
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/citations_delta.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Literal, Annotated, TypeAlias
+
+from .._utils import PropertyInfo
+from .._models import BaseModel
+from .citation_char_location import CitationCharLocation
+from .citation_page_location import CitationPageLocation
+from .citation_content_block_location import CitationContentBlockLocation
+
+__all__ = ["CitationsDelta", "Citation"]
+
+Citation: TypeAlias = Annotated[
+ Union[CitationCharLocation, CitationPageLocation, CitationContentBlockLocation], PropertyInfo(discriminator="type")
+]
+
+
+class CitationsDelta(BaseModel):
+ citation: Citation
+
+ type: Literal["citations_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/completion.py b/.venv/lib/python3.12/site-packages/anthropic/types/completion.py
new file mode 100644
index 00000000..e6293210
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/completion.py
@@ -0,0 +1,43 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from .model import Model
+from .._models import BaseModel
+
+__all__ = ["Completion"]
+
+
+class Completion(BaseModel):
+ id: str
+ """Unique object identifier.
+
+ The format and length of IDs may change over time.
+ """
+
+ completion: str
+ """The resulting completion up to and excluding the stop sequences."""
+
+ model: Model
+ """
+ The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+ """
+
+ stop_reason: Optional[str] = None
+ """The reason that we stopped.
+
+ This may be one the following values:
+
+ - `"stop_sequence"`: we reached a stop sequence — either provided by you via the
+ `stop_sequences` parameter, or a stop sequence built into the model
+ - `"max_tokens"`: we exceeded `max_tokens_to_sample` or the model's maximum
+ """
+
+ type: Literal["completion"]
+ """Object type.
+
+ For Text Completions, this is always `"completion"`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/completion_create_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/completion_create_params.py
new file mode 100644
index 00000000..0eb25725
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/completion_create_params.py
@@ -0,0 +1,131 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import List, Union
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .model_param import ModelParam
+from .metadata_param import MetadataParam
+
+__all__ = [
+ "CompletionRequestStreamingMetadata",
+ "CompletionRequestNonStreamingMetadata",
+ "CompletionRequestNonStreaming",
+ "CompletionRequestStreaming",
+ "CompletionCreateParamsBase",
+ "Metadata",
+ "CompletionCreateParamsNonStreaming",
+ "CompletionCreateParamsStreaming",
+]
+
+
+class CompletionCreateParamsBase(TypedDict, total=False):
+ max_tokens_to_sample: Required[int]
+ """The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+ """
+
+ model: Required[ModelParam]
+ """
+ The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+ """
+
+ prompt: Required[str]
+ """The prompt that you want Claude to complete.
+
+ For proper response generation you will need to format your prompt using
+ alternating `\n\nHuman:` and `\n\nAssistant:` conversational turns. For example:
+
+ ```
+ "\n\nHuman: {userQuestion}\n\nAssistant:"
+ ```
+
+ See [prompt validation](https://docs.anthropic.com/en/api/prompt-validation) and
+ our guide to
+ [prompt design](https://docs.anthropic.com/en/docs/intro-to-prompting) for more
+ details.
+ """
+
+ metadata: MetadataParam
+ """An object describing metadata about the request."""
+
+ stop_sequences: List[str]
+ """Sequences that will cause the model to stop generating.
+
+ Our models stop on `"\n\nHuman:"`, and may include additional built-in stop
+ sequences in the future. By providing the stop_sequences parameter, you may
+ include additional strings that will cause the model to stop generating.
+ """
+
+ temperature: float
+ """Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+ """
+
+ top_k: int
+ """Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+ """
+
+ top_p: float
+ """Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+ """
+
+
+Metadata: TypeAlias = MetadataParam
+"""This is deprecated, `MetadataParam` should be used instead"""
+
+
+class CompletionCreateParamsNonStreaming(CompletionCreateParamsBase, total=False):
+ stream: Literal[False]
+ """Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/streaming) for details.
+ """
+
+
+class CompletionCreateParamsStreaming(CompletionCreateParamsBase):
+ stream: Required[Literal[True]]
+ """Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/streaming) for details.
+ """
+
+
+CompletionRequestStreamingMetadata = MetadataParam
+"""This is deprecated, `MetadataParam` should be used instead"""
+
+CompletionRequestNonStreamingMetadata = MetadataParam
+"""This is deprecated, `MetadataParam` should be used instead"""
+
+CompletionRequestNonStreaming = CompletionCreateParamsNonStreaming
+"""This is deprecated, `CompletionCreateParamsNonStreaming` should be used instead"""
+
+CompletionRequestStreaming = CompletionCreateParamsStreaming
+"""This is deprecated, `CompletionCreateParamsStreaming` should be used instead"""
+
+CompletionCreateParams = Union[CompletionCreateParamsNonStreaming, CompletionCreateParamsStreaming]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/content_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/content_block.py
new file mode 100644
index 00000000..1bc77596
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/content_block.py
@@ -0,0 +1,16 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from .._utils import PropertyInfo
+from .text_block import TextBlock
+from .thinking_block import ThinkingBlock
+from .tool_use_block import ToolUseBlock
+from .redacted_thinking_block import RedactedThinkingBlock
+
+__all__ = ["ContentBlock"]
+
+ContentBlock: TypeAlias = Annotated[
+ Union[TextBlock, ToolUseBlock, ThinkingBlock, RedactedThinkingBlock], PropertyInfo(discriminator="type")
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/content_block_delta_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_delta_event.py
new file mode 100644
index 00000000..a32602b4
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_delta_event.py
@@ -0,0 +1,9 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .raw_content_block_delta_event import RawContentBlockDeltaEvent
+
+__all__ = ["ContentBlockDeltaEvent"]
+
+ContentBlockDeltaEvent = RawContentBlockDeltaEvent
+"""The RawContentBlockDeltaEvent type should be used instead"""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/content_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_param.py
new file mode 100644
index 00000000..97f132e7
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_param.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .text_block_param import TextBlockParam
+from .image_block_param import ImageBlockParam
+from .document_block_param import DocumentBlockParam
+from .thinking_block_param import ThinkingBlockParam
+from .tool_use_block_param import ToolUseBlockParam
+from .tool_result_block_param import ToolResultBlockParam
+from .redacted_thinking_block_param import RedactedThinkingBlockParam
+
+__all__ = ["ContentBlockParam"]
+
+ContentBlockParam: TypeAlias = Union[
+ TextBlockParam,
+ ImageBlockParam,
+ ToolUseBlockParam,
+ ToolResultBlockParam,
+ DocumentBlockParam,
+ ThinkingBlockParam,
+ RedactedThinkingBlockParam,
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/content_block_source_content_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_source_content_param.py
new file mode 100644
index 00000000..0e70cd25
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_source_content_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .text_block_param import TextBlockParam
+from .image_block_param import ImageBlockParam
+
+__all__ = ["ContentBlockSourceContentParam"]
+
+ContentBlockSourceContentParam: TypeAlias = Union[TextBlockParam, ImageBlockParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/content_block_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_source_param.py
new file mode 100644
index 00000000..8050f3e6
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_source_param.py
@@ -0,0 +1,16 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Iterable
+from typing_extensions import Literal, Required, TypedDict
+
+from .content_block_source_content_param import ContentBlockSourceContentParam
+
+__all__ = ["ContentBlockSourceParam"]
+
+
+class ContentBlockSourceParam(TypedDict, total=False):
+ content: Required[Union[str, Iterable[ContentBlockSourceContentParam]]]
+
+ type: Required[Literal["content"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/content_block_start_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_start_event.py
new file mode 100644
index 00000000..873cba3b
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_start_event.py
@@ -0,0 +1,9 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .raw_content_block_start_event import RawContentBlockStartEvent
+
+__all__ = ["ContentBlockStartEvent"]
+
+ContentBlockStartEvent = RawContentBlockStartEvent
+"""The RawContentBlockStartEvent type should be used instead"""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/content_block_stop_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_stop_event.py
new file mode 100644
index 00000000..36c62c89
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/content_block_stop_event.py
@@ -0,0 +1,9 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .raw_content_block_stop_event import RawContentBlockStopEvent
+
+__all__ = ["ContentBlockStopEvent"]
+
+ContentBlockStopEvent = RawContentBlockStopEvent
+"""The RawContentBlockStopEvent type should be used instead"""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/document_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/document_block_param.py
new file mode 100644
index 00000000..e3285266
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/document_block_param.py
@@ -0,0 +1,31 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Optional
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .url_pdf_source_param import URLPDFSourceParam
+from .citations_config_param import CitationsConfigParam
+from .base64_pdf_source_param import Base64PDFSourceParam
+from .plain_text_source_param import PlainTextSourceParam
+from .content_block_source_param import ContentBlockSourceParam
+from .cache_control_ephemeral_param import CacheControlEphemeralParam
+
+__all__ = ["DocumentBlockParam", "Source"]
+
+Source: TypeAlias = Union[Base64PDFSourceParam, PlainTextSourceParam, ContentBlockSourceParam, URLPDFSourceParam]
+
+
+class DocumentBlockParam(TypedDict, total=False):
+ source: Required[Source]
+
+ type: Required[Literal["document"]]
+
+ cache_control: Optional[CacheControlEphemeralParam]
+
+ citations: CitationsConfigParam
+
+ context: Optional[str]
+
+ title: Optional[str]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/image_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/image_block_param.py
new file mode 100644
index 00000000..914ed6bb
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/image_block_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Optional
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .url_image_source_param import URLImageSourceParam
+from .base64_image_source_param import Base64ImageSourceParam
+from .cache_control_ephemeral_param import CacheControlEphemeralParam
+
+__all__ = ["ImageBlockParam", "Source"]
+
+Source: TypeAlias = Union[Base64ImageSourceParam, URLImageSourceParam]
+
+
+class ImageBlockParam(TypedDict, total=False):
+ source: Required[Source]
+
+ type: Required[Literal["image"]]
+
+ cache_control: Optional[CacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/input_json_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/input_json_delta.py
new file mode 100644
index 00000000..5d735d72
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/input_json_delta.py
@@ -0,0 +1,16 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["InputJSONDelta", "InputJsonDelta"]
+
+
+class InputJSONDelta(BaseModel):
+ partial_json: str
+
+ type: Literal["input_json_delta"]
+
+
+InputJsonDelta = InputJSONDelta
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message.py b/.venv/lib/python3.12/site-packages/anthropic/types/message.py
new file mode 100644
index 00000000..6179ee12
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message.py
@@ -0,0 +1,112 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import List, Optional
+from typing_extensions import Literal
+
+from .model import Model
+from .usage import Usage
+from .._models import BaseModel
+from .content_block import ContentBlock, ContentBlock as ContentBlock
+
+__all__ = ["Message"]
+
+
+class Message(BaseModel):
+ id: str
+ """Unique object identifier.
+
+ The format and length of IDs may change over time.
+ """
+
+ content: List[ContentBlock]
+ """Content generated by the model.
+
+ This is an array of content blocks, each of which has a `type` that determines
+ its shape.
+
+ Example:
+
+ ```json
+ [{ "type": "text", "text": "Hi, I'm Claude." }]
+ ```
+
+ If the request input `messages` ended with an `assistant` turn, then the
+ response `content` will continue directly from that last turn. You can use this
+ to constrain the model's output.
+
+ For example, if the input `messages` were:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Then the response `content` might be:
+
+ ```json
+ [{ "type": "text", "text": "B)" }]
+ ```
+ """
+
+ model: Model
+ """
+ The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+ """
+
+ role: Literal["assistant"]
+ """Conversational role of the generated message.
+
+ This will always be `"assistant"`.
+ """
+
+ stop_reason: Optional[Literal["end_turn", "max_tokens", "stop_sequence", "tool_use"]] = None
+ """The reason that we stopped.
+
+ This may be one the following values:
+
+ - `"end_turn"`: the model reached a natural stopping point
+ - `"max_tokens"`: we exceeded the requested `max_tokens` or the model's maximum
+ - `"stop_sequence"`: one of your provided custom `stop_sequences` was generated
+ - `"tool_use"`: the model invoked one or more tools
+
+ In non-streaming mode this value is always non-null. In streaming mode, it is
+ null in the `message_start` event and non-null otherwise.
+ """
+
+ stop_sequence: Optional[str] = None
+ """Which custom stop sequence was generated, if any.
+
+ This value will be a non-null string if one of your custom stop sequences was
+ generated.
+ """
+
+ type: Literal["message"]
+ """Object type.
+
+ For Messages, this is always `"message"`.
+ """
+
+ usage: Usage
+ """Billing and rate-limit usage.
+
+ Anthropic's API bills and rate-limits by token counts, as tokens represent the
+ underlying cost to our systems.
+
+ Under the hood, the API transforms requests into a format suitable for the
+ model. The model's output then goes through a parsing stage before becoming an
+ API response. As a result, the token counts in `usage` will not match one-to-one
+ with the exact visible content of an API request or response.
+
+ For example, `output_tokens` will be non-zero, even for an empty string response
+ from Claude.
+
+ Total input tokens in a request is the summation of `input_tokens`,
+ `cache_creation_input_tokens`, and `cache_read_input_tokens`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_count_tokens_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_count_tokens_params.py
new file mode 100644
index 00000000..ea88dd5d
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_count_tokens_params.py
@@ -0,0 +1,212 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Iterable
+from typing_extensions import Required, TypedDict
+
+from .model_param import ModelParam
+from .message_param import MessageParam
+from .text_block_param import TextBlockParam
+from .tool_choice_param import ToolChoiceParam
+from .thinking_config_param import ThinkingConfigParam
+from .message_count_tokens_tool_param import MessageCountTokensToolParam
+
+__all__ = ["MessageCountTokensParams"]
+
+
+class MessageCountTokensParams(TypedDict, total=False):
+ messages: Required[Iterable[MessageParam]]
+ """Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+ """
+
+ model: Required[ModelParam]
+ """
+ The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+ """
+
+ system: Union[str, Iterable[TextBlockParam]]
+ """System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+ """
+
+ thinking: ThinkingConfigParam
+ """Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+ """
+
+ tool_choice: ToolChoiceParam
+ """How the model should use the provided tools.
+
+ The model can use a specific tool, any available tool, decide by itself, or not
+ use tools at all.
+ """
+
+ tools: Iterable[MessageCountTokensToolParam]
+ """Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_count_tokens_tool_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_count_tokens_tool_param.py
new file mode 100644
index 00000000..e28c0ccf
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_count_tokens_tool_param.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .tool_param import ToolParam
+from .tool_bash_20250124_param import ToolBash20250124Param
+from .tool_text_editor_20250124_param import ToolTextEditor20250124Param
+
+__all__ = ["MessageCountTokensToolParam"]
+
+MessageCountTokensToolParam: TypeAlias = Union[ToolParam, ToolBash20250124Param, ToolTextEditor20250124Param]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_create_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_create_params.py
new file mode 100644
index 00000000..c079bafd
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_create_params.py
@@ -0,0 +1,320 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import List, Union, Iterable
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .model_param import ModelParam
+from .message_param import MessageParam
+from .metadata_param import MetadataParam
+from .text_block_param import TextBlockParam
+from .tool_union_param import ToolUnionParam
+from .tool_choice_param import ToolChoiceParam
+from .thinking_config_param import ThinkingConfigParam
+from .tool_choice_any_param import ToolChoiceAnyParam
+from .tool_choice_auto_param import ToolChoiceAutoParam
+from .tool_choice_tool_param import ToolChoiceToolParam
+
+__all__ = [
+ "MessageCreateParamsBase",
+ "Metadata",
+ "ToolChoice",
+ "ToolChoiceToolChoiceAuto",
+ "ToolChoiceToolChoiceAny",
+ "ToolChoiceToolChoiceTool",
+ "MessageCreateParamsNonStreaming",
+ "MessageCreateParamsStreaming",
+]
+
+
+class MessageCreateParamsBase(TypedDict, total=False):
+ max_tokens: Required[int]
+ """The maximum number of tokens to generate before stopping.
+
+ Note that our models may stop _before_ reaching this maximum. This parameter
+ only specifies the absolute maximum number of tokens to generate.
+
+ Different models have different maximum values for this parameter. See
+ [models](https://docs.anthropic.com/en/docs/models-overview) for details.
+ """
+
+ messages: Required[Iterable[MessageParam]]
+ """Input messages.
+
+ Our models are trained to operate on alternating `user` and `assistant`
+ conversational turns. When creating a new `Message`, you specify the prior
+ conversational turns with the `messages` parameter, and the model then generates
+ the next `Message` in the conversation. Consecutive `user` or `assistant` turns
+ in your request will be combined into a single turn.
+
+ Each input message must be an object with a `role` and `content`. You can
+ specify a single `user`-role message, or you can include multiple `user` and
+ `assistant` messages.
+
+ If the final message uses the `assistant` role, the response content will
+ continue immediately from the content in that message. This can be used to
+ constrain part of the model's response.
+
+ Example with a single `user` message:
+
+ ```json
+ [{ "role": "user", "content": "Hello, Claude" }]
+ ```
+
+ Example with multiple conversational turns:
+
+ ```json
+ [
+ { "role": "user", "content": "Hello there." },
+ { "role": "assistant", "content": "Hi, I'm Claude. How can I help you?" },
+ { "role": "user", "content": "Can you explain LLMs in plain English?" }
+ ]
+ ```
+
+ Example with a partially-filled response from Claude:
+
+ ```json
+ [
+ {
+ "role": "user",
+ "content": "What's the Greek name for Sun? (A) Sol (B) Helios (C) Sun"
+ },
+ { "role": "assistant", "content": "The best answer is (" }
+ ]
+ ```
+
+ Each input message `content` may be either a single `string` or an array of
+ content blocks, where each block has a specific `type`. Using a `string` for
+ `content` is shorthand for an array of one content block of type `"text"`. The
+ following input messages are equivalent:
+
+ ```json
+ { "role": "user", "content": "Hello, Claude" }
+ ```
+
+ ```json
+ { "role": "user", "content": [{ "type": "text", "text": "Hello, Claude" }] }
+ ```
+
+ Starting with Claude 3 models, you can also send image content blocks:
+
+ ```json
+ {
+ "role": "user",
+ "content": [
+ {
+ "type": "image",
+ "source": {
+ "type": "base64",
+ "media_type": "image/jpeg",
+ "data": "/9j/4AAQSkZJRg..."
+ }
+ },
+ { "type": "text", "text": "What is in this image?" }
+ ]
+ }
+ ```
+
+ We currently support the `base64` source type for images, and the `image/jpeg`,
+ `image/png`, `image/gif`, and `image/webp` media types.
+
+ See [examples](https://docs.anthropic.com/en/api/messages-examples#vision) for
+ more input examples.
+
+ Note that if you want to include a
+ [system prompt](https://docs.anthropic.com/en/docs/system-prompts), you can use
+ the top-level `system` parameter — there is no `"system"` role for input
+ messages in the Messages API.
+ """
+
+ model: Required[ModelParam]
+ """
+ The model that will complete your prompt.\n\nSee
+ [models](https://docs.anthropic.com/en/docs/models-overview) for additional
+ details and options.
+ """
+
+ metadata: MetadataParam
+ """An object describing metadata about the request."""
+
+ stop_sequences: List[str]
+ """Custom text sequences that will cause the model to stop generating.
+
+ Our models will normally stop when they have naturally completed their turn,
+ which will result in a response `stop_reason` of `"end_turn"`.
+
+ If you want the model to stop generating when it encounters custom strings of
+ text, you can use the `stop_sequences` parameter. If the model encounters one of
+ the custom sequences, the response `stop_reason` value will be `"stop_sequence"`
+ and the response `stop_sequence` value will contain the matched stop sequence.
+ """
+
+ system: Union[str, Iterable[TextBlockParam]]
+ """System prompt.
+
+ A system prompt is a way of providing context and instructions to Claude, such
+ as specifying a particular goal or role. See our
+ [guide to system prompts](https://docs.anthropic.com/en/docs/system-prompts).
+ """
+
+ temperature: float
+ """Amount of randomness injected into the response.
+
+ Defaults to `1.0`. Ranges from `0.0` to `1.0`. Use `temperature` closer to `0.0`
+ for analytical / multiple choice, and closer to `1.0` for creative and
+ generative tasks.
+
+ Note that even with `temperature` of `0.0`, the results will not be fully
+ deterministic.
+ """
+
+ thinking: ThinkingConfigParam
+ """Configuration for enabling Claude's extended thinking.
+
+ When enabled, responses include `thinking` content blocks showing Claude's
+ thinking process before the final answer. Requires a minimum budget of 1,024
+ tokens and counts towards your `max_tokens` limit.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+ """
+
+ tool_choice: ToolChoiceParam
+ """How the model should use the provided tools.
+
+ The model can use a specific tool, any available tool, decide by itself, or not
+ use tools at all.
+ """
+
+ tools: Iterable[ToolUnionParam]
+ """Definitions of tools that the model may use.
+
+ If you include `tools` in your API request, the model may return `tool_use`
+ content blocks that represent the model's use of those tools. You can then run
+ those tools using the tool input generated by the model and then optionally
+ return results back to the model using `tool_result` content blocks.
+
+ Each tool definition includes:
+
+ - `name`: Name of the tool.
+ - `description`: Optional, but strongly-recommended description of the tool.
+ - `input_schema`: [JSON schema](https://json-schema.org/draft/2020-12) for the
+ tool `input` shape that the model will produce in `tool_use` output content
+ blocks.
+
+ For example, if you defined `tools` as:
+
+ ```json
+ [
+ {
+ "name": "get_stock_price",
+ "description": "Get the current stock price for a given ticker symbol.",
+ "input_schema": {
+ "type": "object",
+ "properties": {
+ "ticker": {
+ "type": "string",
+ "description": "The stock ticker symbol, e.g. AAPL for Apple Inc."
+ }
+ },
+ "required": ["ticker"]
+ }
+ }
+ ]
+ ```
+
+ And then asked the model "What's the S&P 500 at today?", the model might produce
+ `tool_use` content blocks in the response like this:
+
+ ```json
+ [
+ {
+ "type": "tool_use",
+ "id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "name": "get_stock_price",
+ "input": { "ticker": "^GSPC" }
+ }
+ ]
+ ```
+
+ You might then run your `get_stock_price` tool with `{"ticker": "^GSPC"}` as an
+ input, and return the following back to the model in a subsequent `user`
+ message:
+
+ ```json
+ [
+ {
+ "type": "tool_result",
+ "tool_use_id": "toolu_01D7FLrfh4GYq7yT1ULFeyMV",
+ "content": "259.75 USD"
+ }
+ ]
+ ```
+
+ Tools can be used for workflows that include running client-side tools and
+ functions, or more generally whenever you want the model to produce a particular
+ JSON structure of output.
+
+ See our [guide](https://docs.anthropic.com/en/docs/tool-use) for more details.
+ """
+
+ top_k: int
+ """Only sample from the top K options for each subsequent token.
+
+ Used to remove "long tail" low probability responses.
+ [Learn more technical details here](https://towardsdatascience.com/how-to-sample-from-language-models-682bceb97277).
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+ """
+
+ top_p: float
+ """Use nucleus sampling.
+
+ In nucleus sampling, we compute the cumulative distribution over all the options
+ for each subsequent token in decreasing probability order and cut it off once it
+ reaches a particular probability specified by `top_p`. You should either alter
+ `temperature` or `top_p`, but not both.
+
+ Recommended for advanced use cases only. You usually only need to use
+ `temperature`.
+ """
+
+
+Metadata: TypeAlias = MetadataParam
+"""This is deprecated, `MetadataParam` should be used instead"""
+
+ToolChoice: TypeAlias = ToolChoiceParam
+"""This is deprecated, `ToolChoiceParam` should be used instead"""
+
+ToolChoiceToolChoiceAuto: TypeAlias = ToolChoiceAutoParam
+"""This is deprecated, `ToolChoiceAutoParam` should be used instead"""
+
+ToolChoiceToolChoiceAny: TypeAlias = ToolChoiceAnyParam
+"""This is deprecated, `ToolChoiceAnyParam` should be used instead"""
+
+ToolChoiceToolChoiceTool: TypeAlias = ToolChoiceToolParam
+"""This is deprecated, `ToolChoiceToolParam` should be used instead"""
+
+
+class MessageCreateParamsNonStreaming(MessageCreateParamsBase, total=False):
+ stream: Literal[False]
+ """Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+ """
+
+
+class MessageCreateParamsStreaming(MessageCreateParamsBase):
+ stream: Required[Literal[True]]
+ """Whether to incrementally stream the response using server-sent events.
+
+ See [streaming](https://docs.anthropic.com/en/api/messages-streaming) for
+ details.
+ """
+
+
+MessageCreateParams = Union[MessageCreateParamsNonStreaming, MessageCreateParamsStreaming]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_delta_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_delta_event.py
new file mode 100644
index 00000000..3803629a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_delta_event.py
@@ -0,0 +1,9 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .raw_message_delta_event import RawMessageDeltaEvent
+
+__all__ = ["MessageDeltaEvent"]
+
+MessageDeltaEvent = RawMessageDeltaEvent
+"""The RawMessageDeltaEvent type should be used instead"""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_delta_usage.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_delta_usage.py
new file mode 100644
index 00000000..e4321be4
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_delta_usage.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .._models import BaseModel
+
+__all__ = ["MessageDeltaUsage"]
+
+
+class MessageDeltaUsage(BaseModel):
+ output_tokens: int
+ """The cumulative number of output tokens which were used."""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_param.py
new file mode 100644
index 00000000..3c054395
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_param.py
@@ -0,0 +1,39 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Iterable
+from typing_extensions import Literal, Required, TypedDict
+
+from .content_block import ContentBlock
+from .text_block_param import TextBlockParam
+from .image_block_param import ImageBlockParam
+from .document_block_param import DocumentBlockParam
+from .thinking_block_param import ThinkingBlockParam
+from .tool_use_block_param import ToolUseBlockParam
+from .tool_result_block_param import ToolResultBlockParam
+from .redacted_thinking_block_param import RedactedThinkingBlockParam
+
+__all__ = ["MessageParam"]
+
+
+class MessageParam(TypedDict, total=False):
+ content: Required[
+ Union[
+ str,
+ Iterable[
+ Union[
+ TextBlockParam,
+ ImageBlockParam,
+ ToolUseBlockParam,
+ ToolResultBlockParam,
+ DocumentBlockParam,
+ ThinkingBlockParam,
+ RedactedThinkingBlockParam,
+ ContentBlock,
+ ]
+ ],
+ ]
+ ]
+
+ role: Required[Literal["user", "assistant"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_start_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_start_event.py
new file mode 100644
index 00000000..c210d3ad
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_start_event.py
@@ -0,0 +1,9 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .raw_message_start_event import RawMessageStartEvent
+
+__all__ = ["MessageStartEvent"]
+
+MessageStartEvent = RawMessageStartEvent
+"""The RawMessageStartEvent type should be used instead"""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_stop_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_stop_event.py
new file mode 100644
index 00000000..1076a62c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_stop_event.py
@@ -0,0 +1,9 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .raw_message_stop_event import RawMessageStopEvent
+
+__all__ = ["MessageStopEvent"]
+
+MessageStopEvent = RawMessageStopEvent
+"""The RawMessageStopEvent type should be used instead"""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_stream_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_stream_event.py
new file mode 100644
index 00000000..ec5a0125
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_stream_event.py
@@ -0,0 +1,9 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .raw_message_stream_event import RawMessageStreamEvent
+
+__all__ = ["MessageStreamEvent"]
+
+MessageStreamEvent = RawMessageStreamEvent
+"""The RawMessageStreamEvent type should be used instead"""
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/message_tokens_count.py b/.venv/lib/python3.12/site-packages/anthropic/types/message_tokens_count.py
new file mode 100644
index 00000000..d570019f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/message_tokens_count.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from .._models import BaseModel
+
+__all__ = ["MessageTokensCount"]
+
+
+class MessageTokensCount(BaseModel):
+ input_tokens: int
+ """
+ The total number of tokens across the provided list of messages, system prompt,
+ and tools.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/__init__.py
new file mode 100644
index 00000000..25d311da
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/__init__.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from .message_batch import MessageBatch as MessageBatch
+from .batch_list_params import BatchListParams as BatchListParams
+from .batch_create_params import BatchCreateParams as BatchCreateParams
+from .message_batch_result import MessageBatchResult as MessageBatchResult
+from .deleted_message_batch import DeletedMessageBatch as DeletedMessageBatch
+from .message_batch_errored_result import MessageBatchErroredResult as MessageBatchErroredResult
+from .message_batch_expired_result import MessageBatchExpiredResult as MessageBatchExpiredResult
+from .message_batch_request_counts import MessageBatchRequestCounts as MessageBatchRequestCounts
+from .message_batch_canceled_result import MessageBatchCanceledResult as MessageBatchCanceledResult
+from .message_batch_succeeded_result import MessageBatchSucceededResult as MessageBatchSucceededResult
+from .message_batch_individual_response import MessageBatchIndividualResponse as MessageBatchIndividualResponse
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/batch_create_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/batch_create_params.py
new file mode 100644
index 00000000..a82a5ff0
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/batch_create_params.py
@@ -0,0 +1,36 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Iterable
+from typing_extensions import Required, TypedDict
+
+from ..message_create_params import MessageCreateParamsNonStreaming
+
+__all__ = ["BatchCreateParams", "Request"]
+
+
+class BatchCreateParams(TypedDict, total=False):
+ requests: Required[Iterable[Request]]
+ """List of requests for prompt completion.
+
+ Each is an individual request to create a Message.
+ """
+
+
+class Request(TypedDict, total=False):
+ custom_id: Required[str]
+ """Developer-provided ID created for each request in a Message Batch.
+
+ Useful for matching results to requests, as results may be given out of request
+ order.
+
+ Must be unique for each request within the Message Batch.
+ """
+
+ params: Required[MessageCreateParamsNonStreaming]
+ """Messages API creation parameters for the individual request.
+
+ See the [Messages API reference](/en/api/messages) for full documentation on
+ available parameters.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/batch_list_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/batch_list_params.py
new file mode 100644
index 00000000..7b290a77
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/batch_list_params.py
@@ -0,0 +1,27 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import TypedDict
+
+__all__ = ["BatchListParams"]
+
+
+class BatchListParams(TypedDict, total=False):
+ after_id: str
+ """ID of the object to use as a cursor for pagination.
+
+ When provided, returns the page of results immediately after this object.
+ """
+
+ before_id: str
+ """ID of the object to use as a cursor for pagination.
+
+ When provided, returns the page of results immediately before this object.
+ """
+
+ limit: int
+ """Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/deleted_message_batch.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/deleted_message_batch.py
new file mode 100644
index 00000000..7a6c321e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/deleted_message_batch.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["DeletedMessageBatch"]
+
+
+class DeletedMessageBatch(BaseModel):
+ id: str
+ """ID of the Message Batch."""
+
+ type: Literal["message_batch_deleted"]
+ """Deleted object type.
+
+ For Message Batches, this is always `"message_batch_deleted"`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch.py
new file mode 100644
index 00000000..a03e73e1
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch.py
@@ -0,0 +1,77 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from datetime import datetime
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+from .message_batch_request_counts import MessageBatchRequestCounts
+
+__all__ = ["MessageBatch"]
+
+
+class MessageBatch(BaseModel):
+ id: str
+ """Unique object identifier.
+
+ The format and length of IDs may change over time.
+ """
+
+ archived_at: Optional[datetime] = None
+ """
+ RFC 3339 datetime string representing the time at which the Message Batch was
+ archived and its results became unavailable.
+ """
+
+ cancel_initiated_at: Optional[datetime] = None
+ """
+ RFC 3339 datetime string representing the time at which cancellation was
+ initiated for the Message Batch. Specified only if cancellation was initiated.
+ """
+
+ created_at: datetime
+ """
+ RFC 3339 datetime string representing the time at which the Message Batch was
+ created.
+ """
+
+ ended_at: Optional[datetime] = None
+ """
+ RFC 3339 datetime string representing the time at which processing for the
+ Message Batch ended. Specified only once processing ends.
+
+ Processing ends when every request in a Message Batch has either succeeded,
+ errored, canceled, or expired.
+ """
+
+ expires_at: datetime
+ """
+ RFC 3339 datetime string representing the time at which the Message Batch will
+ expire and end processing, which is 24 hours after creation.
+ """
+
+ processing_status: Literal["in_progress", "canceling", "ended"]
+ """Processing status of the Message Batch."""
+
+ request_counts: MessageBatchRequestCounts
+ """Tallies requests within the Message Batch, categorized by their status.
+
+ Requests start as `processing` and move to one of the other statuses only once
+ processing of the entire batch ends. The sum of all values always matches the
+ total number of requests in the batch.
+ """
+
+ results_url: Optional[str] = None
+ """URL to a `.jsonl` file containing the results of the Message Batch requests.
+
+ Specified only once processing ends.
+
+ Results in the file are not guaranteed to be in the same order as requests. Use
+ the `custom_id` field to match results to requests.
+ """
+
+ type: Literal["message_batch"]
+ """Object type.
+
+ For Message Batches, this is always `"message_batch"`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_canceled_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_canceled_result.py
new file mode 100644
index 00000000..9826aa91
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_canceled_result.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["MessageBatchCanceledResult"]
+
+
+class MessageBatchCanceledResult(BaseModel):
+ type: Literal["canceled"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_errored_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_errored_result.py
new file mode 100644
index 00000000..5f890bfd
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_errored_result.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+from ..shared.error_response import ErrorResponse
+
+__all__ = ["MessageBatchErroredResult"]
+
+
+class MessageBatchErroredResult(BaseModel):
+ error: ErrorResponse
+
+ type: Literal["errored"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_expired_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_expired_result.py
new file mode 100644
index 00000000..ab9964e7
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_expired_result.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["MessageBatchExpiredResult"]
+
+
+class MessageBatchExpiredResult(BaseModel):
+ type: Literal["expired"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_individual_response.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_individual_response.py
new file mode 100644
index 00000000..19d4f090
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_individual_response.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from ..._models import BaseModel
+from .message_batch_result import MessageBatchResult
+
+__all__ = ["MessageBatchIndividualResponse"]
+
+
+class MessageBatchIndividualResponse(BaseModel):
+ custom_id: str
+ """Developer-provided ID created for each request in a Message Batch.
+
+ Useful for matching results to requests, as results may be given out of request
+ order.
+
+ Must be unique for each request within the Message Batch.
+ """
+
+ result: MessageBatchResult
+ """Processing result for this request.
+
+ Contains a Message output if processing was successful, an error response if
+ processing failed, or the reason why processing was not attempted, such as
+ cancellation or expiration.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_request_counts.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_request_counts.py
new file mode 100644
index 00000000..04edc3c3
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_request_counts.py
@@ -0,0 +1,35 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+
+from ..._models import BaseModel
+
+__all__ = ["MessageBatchRequestCounts"]
+
+
+class MessageBatchRequestCounts(BaseModel):
+ canceled: int
+ """Number of requests in the Message Batch that have been canceled.
+
+ This is zero until processing of the entire Message Batch has ended.
+ """
+
+ errored: int
+ """Number of requests in the Message Batch that encountered an error.
+
+ This is zero until processing of the entire Message Batch has ended.
+ """
+
+ expired: int
+ """Number of requests in the Message Batch that have expired.
+
+ This is zero until processing of the entire Message Batch has ended.
+ """
+
+ processing: int
+ """Number of requests in the Message Batch that are processing."""
+
+ succeeded: int
+ """Number of requests in the Message Batch that have completed successfully.
+
+ This is zero until processing of the entire Message Batch has ended.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_result.py
new file mode 100644
index 00000000..3186f2aa
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_result.py
@@ -0,0 +1,19 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from ..._utils import PropertyInfo
+from .message_batch_errored_result import MessageBatchErroredResult
+from .message_batch_expired_result import MessageBatchExpiredResult
+from .message_batch_canceled_result import MessageBatchCanceledResult
+from .message_batch_succeeded_result import MessageBatchSucceededResult
+
+__all__ = ["MessageBatchResult"]
+
+MessageBatchResult: TypeAlias = Annotated[
+ Union[
+ MessageBatchSucceededResult, MessageBatchErroredResult, MessageBatchCanceledResult, MessageBatchExpiredResult
+ ],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_succeeded_result.py b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_succeeded_result.py
new file mode 100644
index 00000000..1cc454a4
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/messages/message_batch_succeeded_result.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..message import Message
+from ..._models import BaseModel
+
+__all__ = ["MessageBatchSucceededResult"]
+
+
+class MessageBatchSucceededResult(BaseModel):
+ message: Message
+
+ type: Literal["succeeded"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/metadata_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/metadata_param.py
new file mode 100644
index 00000000..b7bc1ea3
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/metadata_param.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import TypedDict
+
+__all__ = ["MetadataParam"]
+
+
+class MetadataParam(TypedDict, total=False):
+ user_id: Optional[str]
+ """An external identifier for the user who is associated with the request.
+
+ This should be a uuid, hash value, or other opaque identifier. Anthropic may use
+ this id to help detect abuse. Do not include any identifying information such as
+ name, email address, or phone number.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/model.py b/.venv/lib/python3.12/site-packages/anthropic/types/model.py
new file mode 100644
index 00000000..02d40800
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/model.py
@@ -0,0 +1,25 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Literal, TypeAlias
+
+__all__ = ["Model"]
+
+Model: TypeAlias = Union[
+ Literal[
+ "claude-3-7-sonnet-latest",
+ "claude-3-7-sonnet-20250219",
+ "claude-3-5-haiku-latest",
+ "claude-3-5-haiku-20241022",
+ "claude-3-5-sonnet-latest",
+ "claude-3-5-sonnet-20241022",
+ "claude-3-5-sonnet-20240620",
+ "claude-3-opus-latest",
+ "claude-3-opus-20240229",
+ "claude-3-sonnet-20240229",
+ "claude-3-haiku-20240307",
+ "claude-2.1",
+ "claude-2.0",
+ ],
+ str,
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/model_info.py b/.venv/lib/python3.12/site-packages/anthropic/types/model_info.py
new file mode 100644
index 00000000..0e3945fe
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/model_info.py
@@ -0,0 +1,28 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from datetime import datetime
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["ModelInfo"]
+
+
+class ModelInfo(BaseModel):
+ id: str
+ """Unique model identifier."""
+
+ created_at: datetime
+ """RFC 3339 datetime string representing the time at which the model was released.
+
+ May be set to an epoch value if the release date is unknown.
+ """
+
+ display_name: str
+ """A human-readable name for the model."""
+
+ type: Literal["model"]
+ """Object type.
+
+ For Models, this is always `"model"`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/model_list_params.py b/.venv/lib/python3.12/site-packages/anthropic/types/model_list_params.py
new file mode 100644
index 00000000..b16d22a3
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/model_list_params.py
@@ -0,0 +1,27 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import TypedDict
+
+__all__ = ["ModelListParams"]
+
+
+class ModelListParams(TypedDict, total=False):
+ after_id: str
+ """ID of the object to use as a cursor for pagination.
+
+ When provided, returns the page of results immediately after this object.
+ """
+
+ before_id: str
+ """ID of the object to use as a cursor for pagination.
+
+ When provided, returns the page of results immediately before this object.
+ """
+
+ limit: int
+ """Number of items to return per page.
+
+ Defaults to `20`. Ranges from `1` to `1000`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/model_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/model_param.py
new file mode 100644
index 00000000..bce6f522
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/model_param.py
@@ -0,0 +1,27 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import Literal, TypeAlias
+
+__all__ = ["ModelParam"]
+
+ModelParam: TypeAlias = Union[
+ Literal[
+ "claude-3-7-sonnet-latest",
+ "claude-3-7-sonnet-20250219",
+ "claude-3-5-haiku-latest",
+ "claude-3-5-haiku-20241022",
+ "claude-3-5-sonnet-latest",
+ "claude-3-5-sonnet-20241022",
+ "claude-3-5-sonnet-20240620",
+ "claude-3-opus-latest",
+ "claude-3-opus-20240229",
+ "claude-3-sonnet-20240229",
+ "claude-3-haiku-20240307",
+ "claude-2.1",
+ "claude-2.0",
+ ],
+ str,
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/plain_text_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/plain_text_source_param.py
new file mode 100644
index 00000000..a2a3b8de
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/plain_text_source_param.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["PlainTextSourceParam"]
+
+
+class PlainTextSourceParam(TypedDict, total=False):
+ data: Required[str]
+
+ media_type: Required[Literal["text/plain"]]
+
+ type: Required[Literal["text"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_delta_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_delta_event.py
new file mode 100644
index 00000000..5bdbf09a
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_delta_event.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Literal, Annotated, TypeAlias
+
+from .._utils import PropertyInfo
+from .._models import BaseModel
+from .text_delta import TextDelta
+from .thinking_delta import ThinkingDelta
+from .citations_delta import CitationsDelta
+from .signature_delta import SignatureDelta
+from .input_json_delta import InputJSONDelta
+
+__all__ = ["RawContentBlockDeltaEvent", "Delta"]
+
+Delta: TypeAlias = Annotated[
+ Union[TextDelta, InputJSONDelta, CitationsDelta, ThinkingDelta, SignatureDelta], PropertyInfo(discriminator="type")
+]
+
+
+class RawContentBlockDeltaEvent(BaseModel):
+ delta: Delta
+
+ index: int
+
+ type: Literal["content_block_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_start_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_start_event.py
new file mode 100644
index 00000000..bfbaa63d
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_start_event.py
@@ -0,0 +1,25 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Literal, Annotated, TypeAlias
+
+from .._utils import PropertyInfo
+from .._models import BaseModel
+from .text_block import TextBlock
+from .thinking_block import ThinkingBlock
+from .tool_use_block import ToolUseBlock
+from .redacted_thinking_block import RedactedThinkingBlock
+
+__all__ = ["RawContentBlockStartEvent", "ContentBlock"]
+
+ContentBlock: TypeAlias = Annotated[
+ Union[TextBlock, ToolUseBlock, ThinkingBlock, RedactedThinkingBlock], PropertyInfo(discriminator="type")
+]
+
+
+class RawContentBlockStartEvent(BaseModel):
+ content_block: ContentBlock
+
+ index: int
+
+ type: Literal["content_block_start"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_stop_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_stop_event.py
new file mode 100644
index 00000000..6241a8b2
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/raw_content_block_stop_event.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["RawContentBlockStopEvent"]
+
+
+class RawContentBlockStopEvent(BaseModel):
+ index: int
+
+ type: Literal["content_block_stop"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_delta_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_delta_event.py
new file mode 100644
index 00000000..3dae1e0d
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_delta_event.py
@@ -0,0 +1,39 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+from typing_extensions import Literal
+
+from .._models import BaseModel
+from .message_delta_usage import MessageDeltaUsage
+
+__all__ = ["RawMessageDeltaEvent", "Delta"]
+
+
+class Delta(BaseModel):
+ stop_reason: Optional[Literal["end_turn", "max_tokens", "stop_sequence", "tool_use"]] = None
+
+ stop_sequence: Optional[str] = None
+
+
+class RawMessageDeltaEvent(BaseModel):
+ delta: Delta
+
+ type: Literal["message_delta"]
+
+ usage: MessageDeltaUsage
+ """Billing and rate-limit usage.
+
+ Anthropic's API bills and rate-limits by token counts, as tokens represent the
+ underlying cost to our systems.
+
+ Under the hood, the API transforms requests into a format suitable for the
+ model. The model's output then goes through a parsing stage before becoming an
+ API response. As a result, the token counts in `usage` will not match one-to-one
+ with the exact visible content of an API request or response.
+
+ For example, `output_tokens` will be non-zero, even for an empty string response
+ from Claude.
+
+ Total input tokens in a request is the summation of `input_tokens`,
+ `cache_creation_input_tokens`, and `cache_read_input_tokens`.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_start_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_start_event.py
new file mode 100644
index 00000000..1b9e8904
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_start_event.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .message import Message
+from .._models import BaseModel
+
+__all__ = ["RawMessageStartEvent"]
+
+
+class RawMessageStartEvent(BaseModel):
+ message: Message
+
+ type: Literal["message_start"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_stop_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_stop_event.py
new file mode 100644
index 00000000..d40ccfe2
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_stop_event.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["RawMessageStopEvent"]
+
+
+class RawMessageStopEvent(BaseModel):
+ type: Literal["message_stop"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_stream_event.py b/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_stream_event.py
new file mode 100644
index 00000000..728fbe88
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/raw_message_stream_event.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from .._utils import PropertyInfo
+from .raw_message_stop_event import RawMessageStopEvent
+from .raw_message_delta_event import RawMessageDeltaEvent
+from .raw_message_start_event import RawMessageStartEvent
+from .raw_content_block_stop_event import RawContentBlockStopEvent
+from .raw_content_block_delta_event import RawContentBlockDeltaEvent
+from .raw_content_block_start_event import RawContentBlockStartEvent
+
+__all__ = ["RawMessageStreamEvent"]
+
+RawMessageStreamEvent: TypeAlias = Annotated[
+ Union[
+ RawMessageStartEvent,
+ RawMessageDeltaEvent,
+ RawMessageStopEvent,
+ RawContentBlockStartEvent,
+ RawContentBlockDeltaEvent,
+ RawContentBlockStopEvent,
+ ],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/redacted_thinking_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/redacted_thinking_block.py
new file mode 100644
index 00000000..4850b335
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/redacted_thinking_block.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["RedactedThinkingBlock"]
+
+
+class RedactedThinkingBlock(BaseModel):
+ data: str
+
+ type: Literal["redacted_thinking"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/redacted_thinking_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/redacted_thinking_block_param.py
new file mode 100644
index 00000000..0933188c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/redacted_thinking_block_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["RedactedThinkingBlockParam"]
+
+
+class RedactedThinkingBlockParam(TypedDict, total=False):
+ data: Required[str]
+
+ type: Required[Literal["redacted_thinking"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/__init__.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/__init__.py
new file mode 100644
index 00000000..178643b6
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/__init__.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from .error_object import ErrorObject as ErrorObject
+from .billing_error import BillingError as BillingError
+from .error_response import ErrorResponse as ErrorResponse
+from .not_found_error import NotFoundError as NotFoundError
+from .api_error_object import APIErrorObject as APIErrorObject
+from .overloaded_error import OverloadedError as OverloadedError
+from .permission_error import PermissionError as PermissionError
+from .rate_limit_error import RateLimitError as RateLimitError
+from .authentication_error import AuthenticationError as AuthenticationError
+from .gateway_timeout_error import GatewayTimeoutError as GatewayTimeoutError
+from .invalid_request_error import InvalidRequestError as InvalidRequestError
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/api_error_object.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/api_error_object.py
new file mode 100644
index 00000000..dd92bead
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/api_error_object.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["APIErrorObject"]
+
+
+class APIErrorObject(BaseModel):
+ message: str
+
+ type: Literal["api_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/authentication_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/authentication_error.py
new file mode 100644
index 00000000..f777f5c8
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/authentication_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["AuthenticationError"]
+
+
+class AuthenticationError(BaseModel):
+ message: str
+
+ type: Literal["authentication_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/billing_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/billing_error.py
new file mode 100644
index 00000000..26be12bb
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/billing_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["BillingError"]
+
+
+class BillingError(BaseModel):
+ message: str
+
+ type: Literal["billing_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/error_object.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/error_object.py
new file mode 100644
index 00000000..086db503
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/error_object.py
@@ -0,0 +1,32 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from ..._utils import PropertyInfo
+from .billing_error import BillingError
+from .not_found_error import NotFoundError
+from .api_error_object import APIErrorObject
+from .overloaded_error import OverloadedError
+from .permission_error import PermissionError
+from .rate_limit_error import RateLimitError
+from .authentication_error import AuthenticationError
+from .gateway_timeout_error import GatewayTimeoutError
+from .invalid_request_error import InvalidRequestError
+
+__all__ = ["ErrorObject"]
+
+ErrorObject: TypeAlias = Annotated[
+ Union[
+ InvalidRequestError,
+ AuthenticationError,
+ BillingError,
+ PermissionError,
+ NotFoundError,
+ RateLimitError,
+ GatewayTimeoutError,
+ APIErrorObject,
+ OverloadedError,
+ ],
+ PropertyInfo(discriminator="type"),
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/error_response.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/error_response.py
new file mode 100644
index 00000000..97034923
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/error_response.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+from .error_object import ErrorObject
+
+__all__ = ["ErrorResponse"]
+
+
+class ErrorResponse(BaseModel):
+ error: ErrorObject
+
+ type: Literal["error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/gateway_timeout_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/gateway_timeout_error.py
new file mode 100644
index 00000000..908aa12f
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/gateway_timeout_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["GatewayTimeoutError"]
+
+
+class GatewayTimeoutError(BaseModel):
+ message: str
+
+ type: Literal["timeout_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/invalid_request_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/invalid_request_error.py
new file mode 100644
index 00000000..ee5befc0
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/invalid_request_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["InvalidRequestError"]
+
+
+class InvalidRequestError(BaseModel):
+ message: str
+
+ type: Literal["invalid_request_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/not_found_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/not_found_error.py
new file mode 100644
index 00000000..43e826fb
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/not_found_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["NotFoundError"]
+
+
+class NotFoundError(BaseModel):
+ message: str
+
+ type: Literal["not_found_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/overloaded_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/overloaded_error.py
new file mode 100644
index 00000000..74ee8373
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/overloaded_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["OverloadedError"]
+
+
+class OverloadedError(BaseModel):
+ message: str
+
+ type: Literal["overloaded_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/permission_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/permission_error.py
new file mode 100644
index 00000000..48eb3546
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/permission_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["PermissionError"]
+
+
+class PermissionError(BaseModel):
+ message: str
+
+ type: Literal["permission_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/shared/rate_limit_error.py b/.venv/lib/python3.12/site-packages/anthropic/types/shared/rate_limit_error.py
new file mode 100644
index 00000000..3fa065ac
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/shared/rate_limit_error.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from ..._models import BaseModel
+
+__all__ = ["RateLimitError"]
+
+
+class RateLimitError(BaseModel):
+ message: str
+
+ type: Literal["rate_limit_error"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/signature_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/signature_delta.py
new file mode 100644
index 00000000..55d15189
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/signature_delta.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["SignatureDelta"]
+
+
+class SignatureDelta(BaseModel):
+ signature: str
+
+ type: Literal["signature_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/text_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/text_block.py
new file mode 100644
index 00000000..ecdddb69
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/text_block.py
@@ -0,0 +1,23 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import List, Optional
+from typing_extensions import Literal
+
+from .._models import BaseModel
+from .text_citation import TextCitation
+
+__all__ = ["TextBlock"]
+
+
+class TextBlock(BaseModel):
+ citations: Optional[List[TextCitation]] = None
+ """Citations supporting the text block.
+
+ The type of citation returned will depend on the type of document being cited.
+ Citing a PDF results in `page_location`, plain text results in `char_location`,
+ and content document results in `content_block_location`.
+ """
+
+ text: str
+
+ type: Literal["text"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/text_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/text_block_param.py
new file mode 100644
index 00000000..92151733
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/text_block_param.py
@@ -0,0 +1,21 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Iterable, Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .text_citation_param import TextCitationParam
+from .cache_control_ephemeral_param import CacheControlEphemeralParam
+
+__all__ = ["TextBlockParam"]
+
+
+class TextBlockParam(TypedDict, total=False):
+ text: Required[str]
+
+ type: Required[Literal["text"]]
+
+ cache_control: Optional[CacheControlEphemeralParam]
+
+ citations: Optional[Iterable[TextCitationParam]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/text_citation.py b/.venv/lib/python3.12/site-packages/anthropic/types/text_citation.py
new file mode 100644
index 00000000..159771ae
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/text_citation.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Union
+from typing_extensions import Annotated, TypeAlias
+
+from .._utils import PropertyInfo
+from .citation_char_location import CitationCharLocation
+from .citation_page_location import CitationPageLocation
+from .citation_content_block_location import CitationContentBlockLocation
+
+__all__ = ["TextCitation"]
+
+TextCitation: TypeAlias = Annotated[
+ Union[CitationCharLocation, CitationPageLocation, CitationContentBlockLocation], PropertyInfo(discriminator="type")
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/text_citation_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/text_citation_param.py
new file mode 100644
index 00000000..8e988141
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/text_citation_param.py
@@ -0,0 +1,16 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .citation_char_location_param import CitationCharLocationParam
+from .citation_page_location_param import CitationPageLocationParam
+from .citation_content_block_location_param import CitationContentBlockLocationParam
+
+__all__ = ["TextCitationParam"]
+
+TextCitationParam: TypeAlias = Union[
+ CitationCharLocationParam, CitationPageLocationParam, CitationContentBlockLocationParam
+]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/text_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/text_delta.py
new file mode 100644
index 00000000..7ce96491
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/text_delta.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["TextDelta"]
+
+
+class TextDelta(BaseModel):
+ text: str
+
+ type: Literal["text_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/thinking_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_block.py
new file mode 100644
index 00000000..7f98b500
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_block.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["ThinkingBlock"]
+
+
+class ThinkingBlock(BaseModel):
+ signature: str
+
+ thinking: str
+
+ type: Literal["thinking"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/thinking_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_block_param.py
new file mode 100644
index 00000000..d310c7f6
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_block_param.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["ThinkingBlockParam"]
+
+
+class ThinkingBlockParam(TypedDict, total=False):
+ signature: Required[str]
+
+ thinking: Required[str]
+
+ type: Required[Literal["thinking"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_disabled_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_disabled_param.py
new file mode 100644
index 00000000..23b5fbad
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_disabled_param.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["ThinkingConfigDisabledParam"]
+
+
+class ThinkingConfigDisabledParam(TypedDict, total=False):
+ type: Required[Literal["disabled"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_enabled_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_enabled_param.py
new file mode 100644
index 00000000..46b54892
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_enabled_param.py
@@ -0,0 +1,24 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["ThinkingConfigEnabledParam"]
+
+
+class ThinkingConfigEnabledParam(TypedDict, total=False):
+ budget_tokens: Required[int]
+ """Determines how many tokens Claude can use for its internal reasoning process.
+
+ Larger budgets can enable more thorough analysis for complex problems, improving
+ response quality.
+
+ Must be ≥1024 and less than `max_tokens`.
+
+ See
+ [extended thinking](https://docs.anthropic.com/en/docs/build-with-claude/extended-thinking)
+ for details.
+ """
+
+ type: Required[Literal["enabled"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_param.py
new file mode 100644
index 00000000..0c1f9173
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_config_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .thinking_config_enabled_param import ThinkingConfigEnabledParam
+from .thinking_config_disabled_param import ThinkingConfigDisabledParam
+
+__all__ = ["ThinkingConfigParam"]
+
+ThinkingConfigParam: TypeAlias = Union[ThinkingConfigEnabledParam, ThinkingConfigDisabledParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/thinking_delta.py b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_delta.py
new file mode 100644
index 00000000..fb79933c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/thinking_delta.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["ThinkingDelta"]
+
+
+class ThinkingDelta(BaseModel):
+ thinking: str
+
+ type: Literal["thinking_delta"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_bash_20250124_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_bash_20250124_param.py
new file mode 100644
index 00000000..6c8ff0fc
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_bash_20250124_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .cache_control_ephemeral_param import CacheControlEphemeralParam
+
+__all__ = ["ToolBash20250124Param"]
+
+
+class ToolBash20250124Param(TypedDict, total=False):
+ name: Required[Literal["bash"]]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ type: Required[Literal["bash_20250124"]]
+
+ cache_control: Optional[CacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_any_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_any_param.py
new file mode 100644
index 00000000..a0a566ea
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_any_param.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["ToolChoiceAnyParam"]
+
+
+class ToolChoiceAnyParam(TypedDict, total=False):
+ type: Required[Literal["any"]]
+
+ disable_parallel_tool_use: bool
+ """Whether to disable parallel tool use.
+
+ Defaults to `false`. If set to `true`, the model will output exactly one tool
+ use.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_auto_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_auto_param.py
new file mode 100644
index 00000000..456f675c
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_auto_param.py
@@ -0,0 +1,18 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["ToolChoiceAutoParam"]
+
+
+class ToolChoiceAutoParam(TypedDict, total=False):
+ type: Required[Literal["auto"]]
+
+ disable_parallel_tool_use: bool
+ """Whether to disable parallel tool use.
+
+ Defaults to `false`. If set to `true`, the model will output at most one tool
+ use.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_none_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_none_param.py
new file mode 100644
index 00000000..1e2e68a7
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_none_param.py
@@ -0,0 +1,11 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["ToolChoiceNoneParam"]
+
+
+class ToolChoiceNoneParam(TypedDict, total=False):
+ type: Required[Literal["none"]]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_param.py
new file mode 100644
index 00000000..868277d4
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_param.py
@@ -0,0 +1,15 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .tool_choice_any_param import ToolChoiceAnyParam
+from .tool_choice_auto_param import ToolChoiceAutoParam
+from .tool_choice_none_param import ToolChoiceNoneParam
+from .tool_choice_tool_param import ToolChoiceToolParam
+
+__all__ = ["ToolChoiceParam"]
+
+ToolChoiceParam: TypeAlias = Union[ToolChoiceAutoParam, ToolChoiceAnyParam, ToolChoiceToolParam, ToolChoiceNoneParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_tool_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_tool_param.py
new file mode 100644
index 00000000..aeec9966
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_choice_tool_param.py
@@ -0,0 +1,21 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["ToolChoiceToolParam"]
+
+
+class ToolChoiceToolParam(TypedDict, total=False):
+ name: Required[str]
+ """The name of the tool to use."""
+
+ type: Required[Literal["tool"]]
+
+ disable_parallel_tool_use: bool
+ """Whether to disable parallel tool use.
+
+ Defaults to `false`. If set to `true`, the model will output exactly one tool
+ use.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_param.py
new file mode 100644
index 00000000..a01a014e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_param.py
@@ -0,0 +1,48 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Dict, Union, Optional
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .._models import set_pydantic_config
+from .cache_control_ephemeral_param import CacheControlEphemeralParam
+
+__all__ = ["ToolParam", "InputSchema"]
+
+
+class InputSchemaTyped(TypedDict, total=False):
+ type: Required[Literal["object"]]
+
+ properties: Optional[object]
+
+
+set_pydantic_config(InputSchemaTyped, {"extra": "allow"})
+
+InputSchema: TypeAlias = Union[InputSchemaTyped, Dict[str, object]]
+
+
+class ToolParam(TypedDict, total=False):
+ input_schema: Required[InputSchema]
+ """[JSON schema](https://json-schema.org/draft/2020-12) for this tool's input.
+
+ This defines the shape of the `input` that your tool accepts and that the model
+ will produce.
+ """
+
+ name: Required[str]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ cache_control: Optional[CacheControlEphemeralParam]
+
+ description: str
+ """Description of what this tool does.
+
+ Tool descriptions should be as detailed as possible. The more information that
+ the model has about what the tool is and how to use it, the better it will
+ perform. You can use natural language descriptions to reinforce important
+ aspects of the tool input JSON schema.
+ """
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_result_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_result_block_param.py
new file mode 100644
index 00000000..b6ca8aa9
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_result_block_param.py
@@ -0,0 +1,26 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union, Iterable, Optional
+from typing_extensions import Literal, Required, TypeAlias, TypedDict
+
+from .text_block_param import TextBlockParam
+from .image_block_param import ImageBlockParam
+from .cache_control_ephemeral_param import CacheControlEphemeralParam
+
+__all__ = ["ToolResultBlockParam", "Content"]
+
+Content: TypeAlias = Union[TextBlockParam, ImageBlockParam]
+
+
+class ToolResultBlockParam(TypedDict, total=False):
+ tool_use_id: Required[str]
+
+ type: Required[Literal["tool_result"]]
+
+ cache_control: Optional[CacheControlEphemeralParam]
+
+ content: Union[str, Iterable[Content]]
+
+ is_error: bool
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_text_editor_20250124_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_text_editor_20250124_param.py
new file mode 100644
index 00000000..94f63102
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_text_editor_20250124_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .cache_control_ephemeral_param import CacheControlEphemeralParam
+
+__all__ = ["ToolTextEditor20250124Param"]
+
+
+class ToolTextEditor20250124Param(TypedDict, total=False):
+ name: Required[Literal["str_replace_editor"]]
+ """Name of the tool.
+
+ This is how the tool will be called by the model and in tool_use blocks.
+ """
+
+ type: Required[Literal["text_editor_20250124"]]
+
+ cache_control: Optional[CacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_union_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_union_param.py
new file mode 100644
index 00000000..6c02090e
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_union_param.py
@@ -0,0 +1,14 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Union
+from typing_extensions import TypeAlias
+
+from .tool_param import ToolParam
+from .tool_bash_20250124_param import ToolBash20250124Param
+from .tool_text_editor_20250124_param import ToolTextEditor20250124Param
+
+__all__ = ["ToolUnionParam"]
+
+ToolUnionParam: TypeAlias = Union[ToolParam, ToolBash20250124Param, ToolTextEditor20250124Param]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_use_block.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_use_block.py
new file mode 100644
index 00000000..05514471
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_use_block.py
@@ -0,0 +1,17 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing_extensions import Literal
+
+from .._models import BaseModel
+
+__all__ = ["ToolUseBlock"]
+
+
+class ToolUseBlock(BaseModel):
+ id: str
+
+ input: object
+
+ name: str
+
+ type: Literal["tool_use"]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/tool_use_block_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/tool_use_block_param.py
new file mode 100644
index 00000000..cc285079
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/tool_use_block_param.py
@@ -0,0 +1,22 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing import Optional
+from typing_extensions import Literal, Required, TypedDict
+
+from .cache_control_ephemeral_param import CacheControlEphemeralParam
+
+__all__ = ["ToolUseBlockParam"]
+
+
+class ToolUseBlockParam(TypedDict, total=False):
+ id: Required[str]
+
+ input: Required[object]
+
+ name: Required[str]
+
+ type: Required[Literal["tool_use"]]
+
+ cache_control: Optional[CacheControlEphemeralParam]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/url_image_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/url_image_source_param.py
new file mode 100644
index 00000000..852b8eee
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/url_image_source_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["URLImageSourceParam"]
+
+
+class URLImageSourceParam(TypedDict, total=False):
+ type: Required[Literal["url"]]
+
+ url: Required[str]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/url_pdf_source_param.py b/.venv/lib/python3.12/site-packages/anthropic/types/url_pdf_source_param.py
new file mode 100644
index 00000000..b5321d56
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/url_pdf_source_param.py
@@ -0,0 +1,13 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from __future__ import annotations
+
+from typing_extensions import Literal, Required, TypedDict
+
+__all__ = ["URLPDFSourceParam"]
+
+
+class URLPDFSourceParam(TypedDict, total=False):
+ type: Required[Literal["url"]]
+
+ url: Required[str]
diff --git a/.venv/lib/python3.12/site-packages/anthropic/types/usage.py b/.venv/lib/python3.12/site-packages/anthropic/types/usage.py
new file mode 100644
index 00000000..b4f817bd
--- /dev/null
+++ b/.venv/lib/python3.12/site-packages/anthropic/types/usage.py
@@ -0,0 +1,21 @@
+# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details.
+
+from typing import Optional
+
+from .._models import BaseModel
+
+__all__ = ["Usage"]
+
+
+class Usage(BaseModel):
+ cache_creation_input_tokens: Optional[int] = None
+ """The number of input tokens used to create the cache entry."""
+
+ cache_read_input_tokens: Optional[int] = None
+ """The number of input tokens read from the cache."""
+
+ input_tokens: int
+ """The number of input tokens which were used."""
+
+ output_tokens: int
+ """The number of output tokens which were used."""